浏览代码

synchronized static templates with dropbox verion

larsz 14 年之前
父节点
当前提交
bd91554c89
共有 82 个文件被更改,包括 16086 次插入3337 次删除
  1. 403 0
      web/static-templates/backups.html
  2. 466 0
      web/static-templates/cron.html
  3. 68 0
      web/static-templates/css/popup.css
  4. 205 0
      web/static-templates/css/vesta-login-form.css
  5. 209 0
      web/static-templates/css/vesta-login-form_new.css
  6. 3177 1752
      web/static-templates/css/vesta.css
  7. 700 0
      web/static-templates/db.html
  8. 504 450
      web/static-templates/dns.html
  9. 二进制
      web/static-templates/i/_asterisk.gif
  10. 二进制
      web/static-templates/i/asterisk1.png
  11. 二进制
      web/static-templates/i/asterisk2.png
  12. 二进制
      web/static-templates/i/auth/auth-bg.png
  13. 二进制
      web/static-templates/i/auth/checkboxes.png
  14. 二进制
      web/static-templates/i/auth/form-bg.png
  15. 二进制
      web/static-templates/i/auth/logo.png
  16. 二进制
      web/static-templates/i/auth/planet-1.png
  17. 二进制
      web/static-templates/i/auth/planet-2.png
  18. 二进制
      web/static-templates/i/autocomplete-field-arrows-sprite.png
  19. 二进制
      web/static-templates/i/backup-checkbox-checked.png
  20. 二进制
      web/static-templates/i/backup-checkbox-unchecked.png
  21. 二进制
      web/static-templates/i/backup-checkbox.png
  22. 二进制
      web/static-templates/i/backup-checkboxes.png
  23. 二进制
      web/static-templates/i/backup-collapsed-ico.png
  24. 二进制
      web/static-templates/i/backup-expand-ico.png
  25. 二进制
      web/static-templates/i/backup-ico.png
  26. 二进制
      web/static-templates/i/backup-restore-ico.png
  27. 二进制
      web/static-templates/i/bar-value-mark.png
  28. 二进制
      web/static-templates/i/check-row-sprite-2011-12-18.png
  29. 二进制
      web/static-templates/i/check-row-sprite_.png
  30. 二进制
      web/static-templates/i/checkbox-1.png
  31. 二进制
      web/static-templates/i/checkboxes-2011-12-18.png
  32. 二进制
      web/static-templates/i/chekbox-selector.png
  33. 二进制
      web/static-templates/i/chosen-sprite.png
  34. 二进制
      web/static-templates/i/cust-option-bullets.png
  35. 二进制
      web/static-templates/i/custom-arrow.png
  36. 二进制
      web/static-templates/i/delete-ico-active.png
  37. 二进制
      web/static-templates/i/fav.ico
  38. 二进制
      web/static-templates/i/form-checkboxes.png
  39. 二进制
      web/static-templates/i/form-group-collapsed.png
  40. 二进制
      web/static-templates/i/form-group-collapsed_.png
  41. 二进制
      web/static-templates/i/green-bracket-l-highlighted.png
  42. 二进制
      web/static-templates/i/green-bracket-l.png
  43. 二进制
      web/static-templates/i/green-bracket-r-highlighted.png
  44. 二进制
      web/static-templates/i/green-bracket-r.png
  45. 二进制
      web/static-templates/i/group-value-bullet.png
  46. 二进制
      web/static-templates/i/group-values-collapsed.png
  47. 二进制
      web/static-templates/i/info-popup-bg-1.png
  48. 二进制
      web/static-templates/i/info-popup-bg-2.png
  49. 二进制
      web/static-templates/i/info-popup-bg.png
  50. 二进制
      web/static-templates/i/info-popup-sprite-2011-12-14.png
  51. 二进制
      web/static-templates/i/info-popup-sprite.png
  52. 二进制
      web/static-templates/i/old-add-entry-plus.gif
  53. 二进制
      web/static-templates/i/overrun-border.png
  54. 二进制
      web/static-templates/i/plus-sprite.png
  55. 二进制
      web/static-templates/i/plus-sprite1.png
  56. 二进制
      web/static-templates/i/primary-plus.gif
  57. 二进制
      web/static-templates/i/primary-plus_active.png
  58. 二进制
      web/static-templates/i/section-status-sprite-6.png
  59. 二进制
      web/static-templates/i/select-arrow-2011-12-18.png
  60. 二进制
      web/static-templates/i/stats-brace.png
  61. 二进制
      web/static-templates/i/stats-curve-grey.png
  62. 二进制
      web/static-templates/i/stats-curve.png
  63. 二进制
      web/static-templates/i/thin-grey-line-3.gif
  64. 二进制
      web/static-templates/i/thin-grey-line-4.gif
  65. 二进制
      web/static-templates/i/vesta-italic-logo.png
  66. 二进制
      web/static-templates/i/vesta-logo-2011-11-16.png
  67. 二进制
      web/static-templates/i/vesta-logo-2011-11-25.png
  68. 二进制
      web/static-templates/i/vesta-logo-2011-12-14.png
  69. 472 435
      web/static-templates/ip.html
  70. 81 0
      web/static-templates/js/PIE.htc
  71. 13 0
      web/static-templates/js/backups-control.js
  72. 3 0
      web/static-templates/js/common.js
  73. 144 144
      web/static-templates/js/custom-form-elements.js
  74. 6240 0
      web/static-templates/js/jquery-1.4.2.js
  75. 236 0
      web/static-templates/js/jquery.ui.widget.js
  76. 75 0
      web/static-templates/js/jquery.usermode.js
  77. 3 0
      web/static-templates/js/ui.checkbox.init.js
  78. 276 0
      web/static-templates/js/ui.checkbox.js
  79. 58 0
      web/static-templates/login-form.html
  80. 1045 0
      web/static-templates/users-2-form.html
  81. 1014 0
      web/static-templates/users-2.html
  82. 694 556
      web/static-templates/web-domain.html

+ 403 - 0
web/static-templates/backups.html

@@ -0,0 +1,403 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | Backups</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+	<script type="text/javascript" src="js/jquery-1.4.2.js"></script>
+	<script type="text/javascript" src="js/backups-control.js"></script>
+	
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="settings-item"><a class="item-title" href="#">Exit</a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>create backup</a>
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="backups-list">
+					<!-- row 1 -->
+					<div class="row first-row backup-details-row">
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<span class="prop-box entry-created">
+									<span class="backup-date">
+										<span class="backup-day">15 Oct 2011</span>
+										<span class="backup-time">00:31</span>
+									</span>
+									<span class="backup-weekday">Friday</span>
+								</span>
+								<span class="prop-box generation-time">
+									<span class="prop-title">Generation time:</span>
+									<span class="prop-value">78 min</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="backup-size">
+									<span class="backup-size-inner">159 Gb</span>
+								</span>
+								<a class="backup-url" href="#">download</a>
+							</div>
+							<div class="props-ext">
+								<div class="backup-actions">
+									<a class="backup-actions-url restore-url" href="#">restore</a>
+									<a class="backup-actions-url detailed-restore-url" href="#">
+										<span class="detailed-restore-title">detailed</span>
+										<span class="detailed-restore-ext">restore</span>
+									</a>
+								</div>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+					
+					<!-- row 2 -->
+					<div class="row backup-details-row">
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<span class="prop-box entry-created">
+									<span class="backup-date">
+										<span class="backup-day">14 Oct 2011</span>
+										<span class="backup-time">00:17</span>
+									</span>
+									<span class="backup-weekday">Thursday</span>
+								</span>
+								<span class="prop-box generation-time">
+									<span class="prop-title">Generation time:</span>
+									<span class="prop-value">12 min</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="backup-size">
+									<span class="backup-size-inner">14 Gb</span>
+								</span>
+								<a class="backup-url" href="#">download</a>
+							</div>
+							<div class="props-ext">
+								<div class="backup-actions">
+									<a class="backup-actions-url restore-url" href="#">restore</a>
+									<a class="backup-actions-url detailed-restore-url" href="#">
+										<span class="detailed-restore-title">detailed</span>
+										<span class="detailed-restore-ext">restore</span>
+									</a>
+								</div>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+					
+					<!-- row 3 -->
+					<div class="row backup-details-row">
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<span class="prop-box entry-created">
+									<span class="backup-date">
+										<span class="backup-day">12 Oct 2011</span>
+										<span class="backup-time">00:23</span>
+									</span>
+									<span class="backup-weekday">Sunday</span>
+								</span>
+								<span class="prop-box generation-time">
+									<span class="prop-title">Generation time:</span>
+									<span class="prop-value">47 min</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="backup-size">
+									<span class="backup-size-inner">637 Gb</span>
+								</span>
+								<a class="backup-url" href="#">download</a>
+							</div>
+							<div class="props-ext">
+								<div class="backup-actions">
+									<a class="backup-actions-url restore-url" href="#">restore</a>
+									<a class="backup-actions-url detailed-restore-url" href="#">
+										<span class="detailed-restore-title">detailed</span>
+										<span class="detailed-restore-ext">restore</span>
+									</a>
+								</div>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+					
+
+					<!-- form -->
+					<div class="b-new-entry b-new-detailed-restore" style="margin-bottom:50px;">
+						<div class="entry-header">Detailed restore</div>
+						<div class="form-row cc">
+						
+						<ul class="backup-tree">
+							<li class="backup-tree-item unchecked">
+								<span class="node-item expanded">ceres</span>
+								<ul class="backup-sections sub-tree">
+									<li class="backup-tree-item unchecked">
+										<span class="node-item expanded">web</span>
+										<ul class="sub-tree">
+											<li class="backup-tree-item">
+												<span class="node-item">readingwriting.com</span>
+											</li>
+											<li class="backup-tree-item checked">
+												<span class="node-item">writing.com</span>
+											</li>
+											<li class="backup-tree-item checked">
+												<span class="node-item checked">singing.com</span>
+											</li>
+										</ul>
+									</li>
+									<li class="backup-tree-item checked">
+										<span class="node-item">db</span>
+									</li>
+									<li class="backup-tree-item checked">
+										<span class="node-item">dns</span>
+									</li>
+									<li class="backup-tree-item checked">
+										<span class="node-item">mail</span>
+									</li>
+									<li class="backup-tree-item checked">
+										<span class="node-item">cron</span>
+									</li>
+									<li class="backup-tree-item checked">
+										<span class="node-item">ip</span>
+									</li>
+								</ul>
+							</li>
+						</ul>
+						
+						</div>
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="restore" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+					
+					<!-- row 3 -->
+					<div class="row backup-details-row backup-details-row_highlighted">
+						<div class="notes-wrap">
+							<span class="restore-ico">Restore process</span> has been added to queue. It could take several hours.
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<span class="prop-box entry-created">
+									<span class="backup-date">
+										<span class="backup-day">12 Oct 2011</span>
+										<span class="backup-time">00:23</span>
+									</span>
+									<span class="backup-weekday">Sunday</span>
+								</span>
+								<span class="prop-box generation-time">
+									<span class="prop-title">Generation time:</span>
+									<span class="prop-value">47 min</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="backup-size">
+									<span class="backup-size-inner">637 Gb</span>
+								</span>
+								<a class="backup-url" href="#">download</a>
+							</div>
+							<div class="props-ext">
+								<div class="backup-actions">
+									<a class="backup-actions-url restore-url" href="#">restore</a>
+									<a class="backup-actions-url detailed-restore-url" href="#">
+										<span class="detailed-restore-title">detailed</span>
+										<span class="detailed-restore-ext">restore</span>
+									</a>
+								</div>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+					
+				</div><!-- // .backups-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+</body>
+</html>

+ 466 - 0
web/static-templates/cron.html

@@ -0,0 +1,466 @@
+<!doctype html>
+<html>
+
+<head>
+	<title>Vesta | Cron</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web Domain</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section active last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+					<!-- div class="b-console-statuses">
+						<div class="b-console-status cc">
+							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
+Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
+							</p>
+							<span class="b-console-status-action">cancel</span>
+							<i class="b-console-status-arrow">&nbsp;</i>							
+						</div>
+					</div -->
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add cron record</a>
+			
+			<div class="row-filters cc">
+				<div class="b-row-selector">
+					<div class="checkbox-selector cc">
+						<input class="styled" type="checkbox" value="" />
+						<span class="selector-title">385 Selected</span>
+					</div>
+					<div class="context-actions">
+						<div class="b-cust-sel b-cust-sel_inactive">
+							<span class="title">Action</span>
+							<div class="cust-sel-arrow"><i>&nbsp;</i></div>
+							<div class="cust-sel-options">
+								<div class="cust-sel-option ico_gray">Suspend</div>
+								<div class="cust-sel-option ico_green">Unsuspend</div>
+								<div class="cust-sel-option ico_red">Delete</div>
+							</div>
+						</div>
+					</div>
+				</div>
+				<!-- visible only for admin -->
+				<div class="domain-groups-selector">
+					<div class="selector-wrap">
+						<strong class="selector-title">Show:</strong>
+						<span class="selected-groups">mine, vesta, Chronos, vasya (and 35 more)</span>
+					</div>
+				</div><!-- // visible only for admin -->
+			</div>
+			
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="cron-list">
+					<!-- row 1 -->
+					<div class="row first-row cron-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="cron-meta">
+								<span class="prop-box cron-min">
+									<span class="prop-title">min</span>
+									<span class="prop-value">0</span>									
+								</span>
+								<span class="prop-box cron-hour">
+									<span class="prop-title">hour</span>
+									<span class="prop-value">0,6,9 &mdash; 15,18</span>									
+								</span>
+								<span class="prop-box cron-day">
+									<span class="prop-title">day of Month</span>
+									<span class="prop-value">*</span>									
+								</span>
+								<span class="prop-box cron-month">
+									<span class="prop-title">Month</span>
+									<span class="prop-value">Jan, Feb, Mar</span>									
+								</span>
+								<span class="prop-box cron-week">
+									<span class="prop-title">day of Week</span>
+									<span class="prop-value">1 &mdash; 5</span>									
+								</span>
+							</div>
+							<div class="cron-command-box">
+								<strong class="cron-command-line">/usr/bin/top -n 1 -b -S</strong>
+							</div>
+							<div class="cron-reported-to">
+								<span class="prop-box cron-report-box">
+									<span class="prop-title">reported to:</span>
+									<span class="prop-value">naumov.socolov@gmail.com,</span>
+									<span class="prop-value">vasysualiy.pupkin@gmail.com,</span>
+									<span class="prop-value">na-derevniu-dedushke@dachniy-poselok-za-mkadom.com,</span>
+									<span class="prop-value">vasysualiy.pupkin@gmail.com</span>									
+								</span>
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row cron-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="cron-meta">
+								<span class="prop-box cron-min">
+									<span class="prop-title">min</span>
+									<span class="prop-value">15</span>
+								</span>
+								<span class="prop-box cron-hour">
+									<span class="prop-title">hour</span>
+									<span class="prop-value">1,3,5 &mdash; 15,19,21,23</span>									
+								</span>
+								<span class="prop-box cron-day">
+									<span class="prop-title">day of Month</span>
+									<span class="prop-value">1,3,5,7,9,11,13,15,17,19</span>
+								</span>
+								<span class="prop-box cron-month">
+									<span class="prop-title">Month</span>
+									<span class="prop-value">*</span>									
+								</span>
+								<span class="prop-box cron-week">
+									<span class="prop-title">day of Week</span>
+									<span class="prop-value">2 &mdash; 7</span>									
+								</span>
+							</div>
+							<div class="cron-command-box">
+								<strong class="cron-command-line">/home/myuser/bin/pinghosts.sh > /home/myuser/pinghosts.log</strong>
+							</div>
+							<div class="cron-reported-to">
+								<span class="prop-box cron-report-box">
+									<span class="prop-title">reported to:</span>
+									<span class="prop-value">billy@microsoft.com</span>
+								</span>
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row cron-details-row checked-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="cron-meta">
+								<span class="prop-box cron-min">
+									<span class="prop-title">min</span>
+									<span class="prop-value">*</span>
+								</span>
+								<span class="prop-box cron-hour">
+									<span class="prop-title">hour</span>
+									<span class="prop-value">*</span>									
+								</span>
+								<span class="prop-box cron-day">
+									<span class="prop-title">day of Month</span>
+									<span class="prop-value">*</span>
+								</span>
+								<span class="prop-box cron-month">
+									<span class="prop-title">Month</span>
+									<span class="prop-value">Jan, Mar, May, Jul, Sep, Nov</span>									
+								</span>
+								<span class="prop-box cron-week">
+									<span class="prop-title">day of Week</span>
+									<span class="prop-value">2 &mdash; 7</span>									
+								</span>
+							</div>
+							<div class="cron-command-box">
+								<strong class="cron-command-line">/home/myuser/bin/pinghosts.sh > /home/myuser/home/myuser/home/myuser/pinghosts.log</strong>
+							</div>
+							<div class="cron-reported-to">
+								<span class="prop-box cron-report-box">
+									<span class="prop-title">reported to:</span>
+									<span class="prop-value">billy@microsoft.com</span>
+								</span>
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<!-- row 4 -->
+					<div class="row cron-details-row suspended-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-suspended-status"><span class="ip-status-text">suspended</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="cron-meta">
+								<span class="prop-box cron-min">
+									<span class="prop-title">min</span>
+									<span class="prop-value">15</span>
+								</span>
+								<span class="prop-box cron-hour">
+									<span class="prop-title">hour</span>
+									<span class="prop-value">1,3,5 &mdash; 15,19,21,23</span>									
+								</span>
+								<span class="prop-box cron-day">
+									<span class="prop-title">day of Month</span>
+									<span class="prop-value">1,3,5,7,9,11,13,15,17,19</span>
+								</span>
+								<span class="prop-box cron-month">
+									<span class="prop-title">Month</span>
+									<span class="prop-value">*</span>									
+								</span>
+								<span class="prop-box cron-week">
+									<span class="prop-title">day of Week</span>
+									<span class="prop-value">2 &mdash; 7</span>									
+								</span>
+							</div>
+							<div class="cron-command-box">
+								<strong class="cron-command-line">/home/myuser/bin/pinghosts.sh > /home/myuser/pinghosts.log</strong>
+							</div>
+							<div class="cron-reported-to">
+								<span class="prop-box cron-report-box">
+									<span class="prop-title">reported to:</span>
+									<span class="prop-value">billy@microsoft.com</span>
+								</span>
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 4 -->
+
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_cron">
+						<div class="entry-header">New cron</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong minute format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row form-row-line run-at-box cc">
+							<span class="row-header">run at:</span>
+							<div class="field-box cron-minute-box">
+								<label class="field-label" for="#">minute:<br />(0&mdash;59)</label>
+								<div class="field-box-inner cc">
+									<input class="text-field" type="text" value="" />
+								</div>
+							</div>
+							<div class="field-box cron-hour-box">
+								<label class="field-label" for="#">hour:<br />(0&mdash;23)</label>
+								<div class="field-box-inner cc">
+									<input class="text-field" type="text" value="" />
+								</div>
+							</div>
+							<div class="field-box cron-day-box">
+								<label class="field-label" for="#">day of Month:<br />(1&mdash;31)</label>
+								<div class="field-box-inner cc">
+									<input class="text-field" type="text" value="" />
+								</div>
+							</div>
+							<div class="field-box cron-month-box">
+								<label class="field-label" for="#">Month:<br />(1&mdash;12)(Jan&mdash;Dec)</label>
+								<div class="field-box-inner cc">
+									<input class="text-field" type="text" value="" />
+								</div>
+							</div>
+							<div class="field-box cron-week-box">
+								<label class="field-label" for="#">day of Week:<br />(1&mdash;7)(Sun&mdash;Sat)</label>
+								<div class="field-box-inner cc">
+									<input class="text-field" type="text" value="" />
+								</div>
+							</div>
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">command:</label>
+							<textarea class="textarea"></textarea>
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">report to: <span class="remark">(devide by comma ",")</span></label>
+							<textarea class="textarea"></textarea>
+						</div>
+						
+						<div class="form-row cc">
+							<label class="field-label" for="#">suspended:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+				</div><!-- // .domain-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+</body>
+</html>

+ 68 - 0
web/static-templates/css/popup.css

@@ -0,0 +1,68 @@
+/* Styles for popups */
+.d-popup{
+	position:absolute;
+	top:100px;
+	left:0;
+	z-index:100;
+	background-color:#ccc;
+	background:url(../i/info-popup-bg-2.png) repeat;
+	
+	width:250px;
+
+	border-radius: 10px;
+	-moz-border-radius: 10px;
+	-webkit-border-radius: 10px;
+}
+.d-popup-inner{
+	padding:20px;
+	color:#fff;	
+}
+.d-popup .close{
+	position:absolute;
+	top:10px;
+	right:10px;
+	
+	display:block;
+	width:14px;
+	height:14px;
+	/*background:url(../i/info-popup-sprite.png) no-repeat;*/
+	background:url(../i/info-popup-sprite-2011-12-14.png) no-repeat 0 -1px;
+	cursor:pointer;
+	font-size:0;
+	line-height:0;
+	text-indent:-9999px;
+	}
+	.d-popup span.close:hover{
+		background-position:0 -17px;
+	}
+	.d-popup span.close:active{
+		background-position:0 -33px;
+	}
+	
+.d-popup-title{
+	font-size:11px;
+	text-transform:uppercase;
+	text-align:center;
+	color:#fffdd4;
+	margin:0 0 9px;
+}
+.d-popup-items{
+	font-size:12px;
+	color:#fff;
+}
+.d-popup-items .item{
+	margin:0 0 9px;
+}
+.d-popup-items a{
+	color:#aaa;
+	padding-right:5px;
+}
+.d-popup .prop-box{
+	display:block;
+}
+.d-popup .prop-title{
+	color:#bbb;
+}
+.d-popup .prop-value{
+	color:#fff;
+} 

+ 205 - 0
web/static-templates/css/vesta-login-form.css

@@ -0,0 +1,205 @@
+/* Page specific styles */
+.page-auth{
+	background:url(../i/auth/auth-bg.png) repeat;
+}
+.cc:after{
+ 	content: ".";
+    display: block;
+    height: 0;
+    clear: both;
+    visibility: hidden;
+}
+*html .cc{
+	zoom:1;
+}
++html .cc{
+	zoom:1;
+}
+.page-auth .b-auth-form{}
+
+.page-auth .b-auth-form{
+	width:525px;
+	margin:7% auto 0;
+	padding:20px 20px 0;
+	background:url(../i/auth/form-bg.png) repeat;
+
+	-webkit-border-radius:15px;
+    -moz-border-radius:15px;
+	border-radius:15px;
+	behavior: url(js/PIE.htc);
+	font-family:Arial, Helvetica, sans-serif;
+}
+.page-auth .b-auth-form-wrap{
+	position:relative;
+	padding-top:30px;
+}
+.page-auth .vesta-logo{
+	position:absolute;
+	top:0;
+	left:0;
+	display:block;
+}
+.page-auth .b-client-title{
+	margin:0 0 45px;
+	padding-left:130px;
+	font-size:35px;
+	background:url(../i/auth/planet-1.png) no-repeat 95px 17px;
+	color:#fff;
+	}
+	.client-title-wrap{
+		position:relative;
+	}
+	.client-title-wrap .planets{
+		display:block;
+		width:91px;
+		height:7px;
+		position:absolute;
+		top:45%;
+		right:-100px;
+		background:url(../i/auth/planet-2.png) no-repeat;		
+	}	
+.page-auth .form-row{
+	margin:0 0 15px;
+}
+.page-auth .last-row{
+	padding:27px 90px 0 133px;
+}
+	.page-auth .field-label{
+		float:left;
+		width:87px;
+		padding-left:45px;
+		color:#e3d785;
+		font-size:12px;
+		line-height:34px;
+		font-family:Arial, Helvetica, sans-serif;
+		text-transform:uppercase;
+		letter-spacing:-.5px;
+	}
+	.page-auth .field-text{
+		width:290px;
+		padding:4px 5px;
+		font-size:20px;
+		border:2px solid #0c6c9c;
+		background:#2d2c28;
+		color:#fff;
+		}
+		.page-auth .field-text:focus{
+			-moz-box-shadow:0 0 8px rgba(76, 147, 189, 0.7);
+			-webkit-box-shadow:0 0 8px rgba(76, 147, 189, 0.7);
+			border-color:rgba(76, 147, 189, 0.85) !important;
+		}
+		
+	.page-auth .b-remember{
+		float:left;
+		padding-top:5px;
+			}
+			.page-auth .remember-label{
+				cursor:pointer;
+				padding:2px 2px 2px 8px;
+				color:#747975;
+				font-size:12px;
+				font-family:Arial, Helvetica, sans-serif;
+			}
+			span.ui-checkbox{
+				display: block;
+				float: left;
+				width: 14px;
+				height: 15px;
+/*				background:url(icon_checkbox.png) 0 -40px no-repeat;*/
+				background:url(../i/auth/checkboxes.png) no-repeat;
+			}
+			.ui-helper-hidden-accessible{
+				display: none;
+			}
+			span.ui-checkbox-state-hover{
+				background-position: 0 -15px;
+			}
+			span.ui-checkbox-state-checked,
+			span.ui-checkbox-state-checked-hover{
+				background-position: 0 -30px;
+			}
+		
+	.page-auth .sumbit-btn{
+		float:right;
+		overflow:visible;
+		height:30px;
+		padding:0 40px;
+		-webkit-border-radius:9px;
+		-moz-border-radius:9px;
+		border-radius:9px;
+		behavior: url(js/PIE.htc);		
+	
+		border:2px solid #292929;
+		background-color:#b8be44;
+		color:#ffffdf;
+		font-size:13px;
+		font-family:Arial, Helvetica, sans-serif;
+		font-weight:bold;
+		line-height:27px;
+		text-transform:uppercase;
+		cursor:pointer;
+		}
+		.page-auth .sumbit-btn:focus{
+			position:relative;
+			top:1px;
+		}
+		.page-auth .sumbit-btn:hover{
+			background-color:#ffcc00;
+			color:#483600;
+			border-color:#000;
+		}
+		.page-auth .sumbit-btn:active{
+			top:0;
+			background-color:#483600;
+			color:#ffcc00;
+			border-color:#000;
+		}
+
+	.page-auth .forgot-pwd{
+		padding:60px 0 10px 137px;
+		font-size:13px;
+		}
+		.page-auth .forgot-pwd-url{
+			color:#6f7571;
+		}
+		.page-auth a.forgot-pwd-url:hover{
+			color:#849e54;
+		}
+		.page-auth a.forgot-pwd-url:active{
+			color:#edca38;
+		}
+
+.page-auth .error-box{
+	border-top:1px dashed #f16d6b;
+	padding:10px 0 0 131px;
+	font-size:14px;
+	font-weight:bold;
+	color:#f16d6b;
+}		
+
+.page-auth .footnotes{
+	margin:0 -20px;
+	padding:15px 20px;
+	font-size:14px;
+	border-top:2px solid #34352f;
+	color:#5a5e5d;
+	}
+	.page-auth .footnotes .additional-info{
+		float:left;
+		font-size:12px;
+		font-family:Georgia, "Times New Roman", Times, serif;
+		font-style:italic;
+	}
+	.page-auth .footnotes .questions-url{
+		color:#5a5e5d;
+	}
+	.page-auth .footnotes a.questions-url:hover{
+		color:#849e54;
+	}
+	.page-auth .footnotes a.questions-url:active{
+		color:#edca38;
+	}
+	.page-auth .footnotes .imprint{
+		float:right;
+		font-style:normal;
+	}	

+ 209 - 0
web/static-templates/css/vesta-login-form_new.css

@@ -0,0 +1,209 @@
+/* Page specific styles */
+.page-auth{
+	background:url(../images/auth/auth-bg.png) repeat;
+}
+.cc:after{
+ 	content: ".";
+    display: block;
+    height: 0;
+    clear: both;
+    visibility: hidden;
+}
+*html .cc{
+	zoom:1;
+}
++html .cc{
+	zoom:1;
+}
+.page-auth .b-auth-form{}
+
+.page-auth .b-auth-form{
+	width:525px;
+	margin:7% auto 0;
+	padding:20px 20px 0;
+	background:url(../images/auth/form-bg.png) repeat;
+
+	-webkit-border-radius:15px;
+    -moz-border-radius:15px;
+	border-radius:15px;
+	behavior: url(js/PIE.htc);
+	font-family:Arial, Helvetica, sans-serif;
+}
+.page-auth .b-auth-form-wrap{
+	position:relative;
+	padding-top:30px;
+}
+.page-auth .vesta-logo{
+	position:absolute;
+	top:0;
+	left:0;
+	display:block;
+}
+.page-auth .b-client-title{
+	margin:0 0 45px;
+	padding-left:130px;
+	font-size:35px;
+	background:url(../images/auth/planet-1.png) no-repeat 85px 27px;
+	color:#fff;
+	}
+	.client-title-wrap{
+		position:relative;
+        text-transform: uppercase;
+        font-size:24px;
+	}
+	.client-title-wrap .planets{
+		display:block;
+		width:91px;
+		height:7px;
+		position:absolute;
+		top:40%;
+		right:-121px;
+		background:url(../images/auth/planet-2.png) no-repeat scroll 0 -1px;		
+	}	
+.page-auth .form-row{
+	margin:0 0 15px;
+}
+.page-auth .last-row{
+	padding:27px 90px 0 133px;
+}
+	.page-auth .field-label{
+		float:left;
+		width:87px;
+		padding-left:45px;
+		color:#e3d785;
+		font-size:12px;
+		line-height:34px;
+		font-family:Arial, Helvetica, sans-serif;
+		text-transform:uppercase;
+		/*letter-spacing:-.5px;*/
+	}
+	.page-auth .field-text{
+		width:290px;
+		padding:4px 5px;
+		font-size:20px;
+		border:2px solid #0c6c9c;
+		background:#2d2c28;
+		color:#fff;
+		}
+		.page-auth .field-text:focus{
+			-moz-box-shadow:0 0 8px rgba(76, 147, 189, 0.7);
+			-webkit-box-shadow:0 0 8px rgba(76, 147, 189, 0.7);
+			border-color:rgba(76, 147, 189, 0.85) !important;
+		}
+		
+	.page-auth .b-remember{
+		float:left;
+		padding-top:5px;
+			}
+			.page-auth .remember-label{
+				cursor:pointer;
+				padding:2px 2px 2px 8px;
+				color:#747975;
+				font-size:12px;
+				font-family:Arial, Helvetica, sans-serif;
+			}
+			span.ui-checkbox{
+				display: block;
+				float: left;
+				width: 14px;
+				height: 15px;
+/*				background:url(icon_checkbox.png) 0 -40px no-repeat;*/
+				background:url(../images/auth/checkboxes.png) no-repeat;
+			}
+			.ui-helper-hidden-accessible{
+				display: none;
+			}
+			span.ui-checkbox-state-hover{
+				background-position: 0 -15px;
+			}
+			span.ui-checkbox-state-checked,
+			span.ui-checkbox-state-checked-hover{
+				background-position: 0 -30px;
+			}
+		
+	.page-auth .sumbit-btn{
+		float:right;
+		overflow:visible;
+		height:30px;
+		padding:0 40px;
+		-webkit-border-radius:9px;
+		-moz-border-radius:9px;
+		border-radius:9px;
+		behavior: url(js/PIE.htc);		
+	
+		border:2px solid #2C2C10;
+		background-color:#BBBF45;
+		color:#ffffdf;
+		font-size:13px;
+		font-family:Arial, Helvetica, sans-serif;
+		font-weight:bold;
+		line-height:27px;
+		text-transform:uppercase;
+		cursor:pointer;
+		}
+		.page-auth .sumbit-btn:focus{
+			position:relative;
+			top:1px;
+		}
+		.page-auth .sumbit-btn:hover{
+			background-color:#ffcc00;
+			color:#483600;
+			border-color:#000;
+		}
+		.page-auth .sumbit-btn:active{
+			top:0;
+			background-color:#96A332;
+			color:#FFFFFF;
+			border-color:#2C2C10;
+		}
+
+	.page-auth .forgot-pwd{
+		padding:60px 0 10px 137px;
+		font-size:13px;
+		}
+		.page-auth .forgot-pwd-url{
+			color:#6f7571;
+		}
+		.page-auth a.forgot-pwd-url:hover{
+			color:#849e54;
+		}
+		.page-auth a.forgot-pwd-url:active{
+			color:#edca38;
+		}
+
+.page-auth .error-box{
+	border-top:1px dashed #f16d6b;
+	padding:10px 0 21px 131px;
+	font-size:14px;
+	font-weight:bold;
+	color:#f16d6b;
+}		
+
+.page-auth .footnotes{
+	margin:0 -20px;
+	padding:15px 20px;
+	font-size:14px;
+	border-top:2px solid #34352f;
+	color:#5a5e5d;
+	}
+	.page-auth .footnotes .additional-info{
+		float:left;
+		font-size:12px;
+		font-family:Georgia, "Times New Roman", Times, serif;
+		font-style:italic;
+	}
+	.page-auth .footnotes .questions-url{
+		color:#5a5e5d;
+	}
+	.page-auth .footnotes a.questions-url:hover{
+		color:#849e54;
+	}
+	.page-auth .footnotes a.questions-url:active{
+		color:#edca38;
+	}
+	.page-auth .footnotes .imprint{
+		float:right;
+		font-style:normal;
+        font-size:11px;
+        padding-top:1px;
+	}	

+ 3177 - 1752
web/static-templates/css/vesta.css

@@ -1,1752 +1,3177 @@
-/*- - - - - - - - - - - - - - - - - - -
-Title  : Vesta
-Author : Eugen Lobicov, eugen.lobicov@gmail.com 
-
-created : November 27, 2009
-last updated : January 22, 2011
-- - - - - - - - - - - - - - - - - - */
-
-html{
-	font-size:100.01%; /* prevent IE's extreme font-resizing bug*/
-}
-
-body{
-	position:relative;
-	font:normal 62.5%/1.5 Arial, Helvetica, sans-serif; 
-	background:#F0F0EE url(../i/thin-grey-line-2.gif) repeat-x;
-	color:#333;
-}
-#page{
-	width:965px;
-	width:955px;
-	margin:5px auto 0;
-	border:1px solid red;
-	border:solid #a9aa98;
-	border-width:0 2px;
-/*	padding:0 0 0 10px;
-	background:url(../i/bg-left.gif) repeat-y;*/
-}
-.outer{
-/*	padding:0 10px 0 0;
-	background:url(../i/bg-right.gif) repeat-y 100% 0;*/
-	padding-bottom:58px;
-	background:#fff url(../i/footer-bg.gif) repeat-x 0 100%;
-}
-#header{
-	overflow:hidden;
-	padding:0 10px;
-	height:26px;
-	border-bottom:2px solid #333527;
-	background-color:#484439;
-}
-.logo-box{
-	float:left;
-}
-.logo,
-.logo a,
-.logo a span{
-	display:block;
-	width:80px;
-	height:26px;
-}
-.logo a{
-	position:relative;
-	overflow:hidden;
-	font-size:1.2em; /*12px */
-	text-decoration:none;
-	color:#fff;
-}
-.logo a span{
-	position:absolute;
-	top:0;
-	left:0;
-	z-index:1;
-	background:url(../i/vesta-logo.png) no-repeat;
-}
-.settings{
-	float:right;
-}
-.settings li{
-	float:left;
-	display:block;
-	margin:0 10px 0 0;
-	font-size:1.2em; /*12px*/
-	line-height:2.084; /* 25px*/
-}
-.settings li a{
-	color:#c6d2d2;
-}
-.settings li a:hover{
-	color:#fefda0;
-	text-decoration:none;
-}
-.settings li a:active{
-	color:#E16734;
-	text-decoration:none;
-}
-
-/*Remove button padding in FF*/
-input::-moz-focus-inner{ 
-	border: 0;
-	padding: 0;
-}
-.cc:after{
- 	content: ".";
-    display: block;
-    height: 0;
-    clear: both;
-    visibility: hidden;
-}
-.hidden{
-	display:none !important;
-}
-
-/* Navigation
-- - - - - - - - - - - - - - - - - - - - */
-#primary-nav-box{
-	clear:both;
-	height:115px;
-	background-color:#ecf3d2;
-}
-.primary-nav{}
-
-.primary-nav .section{
-	position:relative;
-	float:left;
-	display:block;
-	padding-right:1px;
-/*	border-bottom:4px solid #616a57;*/
-/*	background:url(../i/nav-devider-2.png) no-repeat 100% 50%;*/
-	background:url(../i/nav-devider-2.png) no-repeat 100% 50%;
-}
-.primary-nav .last-section{
-	background:none;
-	padding:0;
-}
-.section .section-inner{
-	width:130px;
-	min-height:100px;
-	height:auto !important;
-	height:100px;
-	padding:15px 0 3px 6px;
-	background:url(../i/section-status-sprite-5.gif) no-repeat -420px 115px;
-	}
-.primary-nav .last-section .section-inner{
-	width:133px;
-	width:127px;
-}
-.section .section-title{
-	position:absolute;
-	left:7px;
-	bottom:9px;
-	font-family:Arial, Helvetica, sans-serif;
-	font-size:15px;
-	line-height:1.2;
-	font-weight:bold;
-	text-transform:uppercase;
-	color:#393939;
-	color:#33342e;
-	}
-	.section .section-title .to-section{
-		float:left;
-		margin-right:4px;
-	}
-	.section .section-title .add-entry{
-		position:relative;
-		top:2px;
-		float:left;
-		display:block;
-		width:13px;
-		height:13px;
-		background:url(../i/primarary-collapsed.gif) no-repeat;
-		font-size:0;
-		line-height:0;
-		}
-		.section .section-title .add-entry:hover{
-			background:#B5C968;
-		}
-		
-.dnstpl-nav-item .section-title{
-	background-position:100% 85%;
-}
-.section .def{
-	display:block;
-	font-family:Arial, Helvetica, sans-serif;
-	font-size:12px;
-	color:#8c9c91;
-}
-.section:hover .section-inner{
-	background-position:0 115px;
-	background-color:#F1F7D6;
-	color:#000;
-	cursor:pointer;
-	}
-	.section:hover .section-title{
-		color:#000;
-	}
-.primary-nav .active .section-inner{
-	background-position:-140px 115px;	
-	cursor:default;
-	}
-	.primary-nav .active .def{
-		color:#8c9c91;
-	}
-	.primary-nav .active .section-title{
-		color:#393939;
-	}		
-
-#console{
-	position:relative;
-	clear:both;
-	height:70px;
-	background-color:#a09d98;
-	background:#535049 url(../i/console-box-bg.png) repeat-x;
-	border-bottom:1px solid #7a7967;
-}
-
-.b-console{
-	position:absolute;
-	left:50%;
-}
-
-.b-console-wrap{
-	position:relative;
-	right:50%;
-	width:655px;
-	padding:10px 15px 16px 25px;
-	background:url(../i/console-bg.png) repeat;
-	
-	border-radius: 0 0 5px 5px;
-	-moz-border-radius: 0 0 5px 5px;
-	-webkit-border-top-right-radius: 0;
-	-webkit-border-top-left-radius: 0;
-	-webkit-border-bottom-right-radius: 5px;
-	-webkit-border-bottom-left-radius: 5px;
-}
-	.b-console-form{}
-	
-		.b-console-field{
-			float:left;
-			width:548px;
-			margin-right:15px;
-			padding:5px 10px;
-			border:2px solid #42647f;
-			font-family:Arial, Helvetica, sans-serif;
-			font-size:18px;
-			font-style:italic;
-			font-weight:bold;
-			color:#aaa;
-		}
-		.b-console-field:focus{
-			-moz-box-shadow:0 0 8px rgba(82, 168, 236, 0.5);
-			-webkit-box-shadow:0 0 8px rgba(82, 168, 236, 0.5);
-			border-color:rgba(82, 168, 236, 0.75) !important;
-			color:#333;
-		}	
-		.b-console-btn{
-			float:left;
-			overflow:visible;
-			height:30px;
-			margin:4px 0 0;
-			padding:0 20px;
-			-webkit-border-radius:4px;
-			-moz-border-radius:4px;
-			border-radius:4px;
-			border:0 none;
-			background-color:#fdcd00;
-			color:#4b3600;
-
-			font-size:13px;
-			font-family:Arial, Helvetica, sans-serif;
-			font-weight:bold;
-			line-height:30px;
-			text-transform:uppercase;
-			cursor:pointer;
-	
-			/* a little animation effect on hover for -webkit- */
-			-webkit-transition-property: background;
-			-webkit-transition-duration: 150ms;
-			-webkit-transition-timing-function: ease-in-out; 
-			}
-			.b-console-btn:focus{
-				position:relative;
-				top:1px;
-			}
-			.b-console-btn:hover{
-				background-color:#ffe84c;
-				color:#39351c;
-			}
-			.b-console-btn:active{
-				background-color:#333;
-				color:#fff;
-			}
-
-.b-console-statuses{
-	margin-top:15px;
-}
-	
-	.b-console-status{
-		position:relative;
-		padding:5px 80px 5px 10px;
-		border:2px dashed #999;
-		background-color:#feff99;
-		color:#666;
-		font-size:12px;
-	}
-	.b-console-status-message{
-		float:left;
-		color:#666;
-	}
-	.b-console-status-action{
-		float:right;
-		margin-right:-36px;
-		text-decoration:underline;
-	}
-	.b-console-status-message b{
-		font-weight:bold;
-		color:#333;
-	}	
-	.b-console-status-arrow{
-		position:absolute;
-		top:10px;
-		right:12px;
-		display:block;
-		width:14px;
-		height:8px;
-		background:url(../i/status-arrow.png) no-repeat;
-	}
-	
-
-
-#actions-toolbar{
-	clear:both;
-	position:relative;
-	padding:15px 20px 15px 280px;
-	background-color:#f3f3d9;
-	border-bottom:1px solid #c9cbc8;
-}
-.add-domain,
-.add-btn{
-	position:relative;
-	top:2px;
-	float:left;
-	margin:0 0 0 -260px;
-	border-bottom:1px solid #b5c968;
-	font-family:Georgia, "Times New Roman", Times, serif;
-	font-size:16px;
-/*	line-height:18px;*/
-	line-height:1;
-	text-transform:uppercase;
-	color:#66685d;
-	text-decoration:none;
-}
-.add-domain .icon,
-.add-btn-icon{
-	float:left;
-	display:block;
-	width:11px;
-	height:11px;
-	margin:4px 5px 0 0;
-	background:url(../i/add-entry-plus.gif) no-repeat;	
-	font-size:0;
-	line-height:0;	
-}
-.select-all{
-	padding:0 40px 0 0;
-	font-size:13px;
-	color:#7f7e6c;
-	text-decoration:underline;
-	cursor:pointer;
-	}
-	.select-all:hover{
-		text-decoration:none;
-	}
-.clear-selected{
-	font-size:11px;
-	line-height:10px;
-	text-transform:uppercase;
-	color:#bcb6a6;
-	cursor:pointer;
-	letter-spacing:0.2px;
-	border-bottom:1px solid #bcb6a6;
-	}
-	.clear-selected:hover{
-		color:#000;
-		border-bottom-color:#b85152;
-	}
-	.clear-selected:active{
-		color:#b85152;
-		border-bottom-color:#000;
-	}
-	
-#content{
-	padding:8px 0 50px;
-	background:#fff url(../i/content-separator.png) repeat-x;
-}
-.b-ext-info-wrap{
-	position:relative;
-	min-height:40px;
-	}
-	.b-ext-info{
-		margin:0 0 6px;
-		padding:10px 25px 15px;
-		background:#ddd;
-		font-size:12px;
-		color:#000;
-		text-shadow: 0px 1px 1px #fff;
-	}
-	.b-ext-info-btn{
-		position:relative;
-		left:-1px;
-		width:102px;
-		height:15px;
-		margin-left:-50px;
-		margin:-6px auto 0;
-		background-color:#fff;
-		cursor:pointer;
-		}
-		.b-ext-info-wrap_collapsed .b-ext-info-btn{
-			background:url(../i/more-info-btn.png) no-repeat;		
-		}
-.content-inner{
-	background-color:#fff;
-	padding:0 15px 15px;
-}
-/*
-.domains{
-	border-bottom:1px solid #333;
-	background-color:#fff;
-}
-.domains .item{
-	position:relative;
-	padding:0 20px;
-	background:url(../i/long-dotted-bg.gif) repeat-x;
-}
-.domains .first{
-	margin:0;
-	background:none;
-}
-.item .view{
-	padding:15px 0 10px;
-}
-.item .ip-box{
-	float:left;
-	width:150px;
-	padding-top:12px;
-}
-.ip-box .ip{
-	font-size:1.1em; /*11px*
-	line-height:21px;
-	font-weight:normal;
-	letter-spacing:.175em;
-}
-.ip-box .owner{
-	display:block;
-	font-size:1.2em;
-	color:#999;
-}
-.details .names .primary{ 
-	font-size:20px;
-	font-family:Georgia, "Times New Roman", Times, serif;
-	font-weight:normal;	
-	font-style:normal;
-	color:#000; /* radikal'no cherniy, da! *
-}
-.names .divider{
-	font-size:12px;
-	line-height:2;
-	text-transform:uppercase;
-	color:#999;
-}
-.names .domain-name{
-	padding:0 10px;
-	font-size:12px;	
-	line-height:2;
-	font-style:italic;
-	color:#999;	
-	white-space:nowrap;
-}
-.item .details{
-	margin-left:150px;
-}
-.item .details .status{
-	float:right;
-	width:60%;
-	margin:5px 20px 0 0;
-	color:#999;
-}
-.details .status .logging{
-	float:left;
-}
-.logging .err-log,
-.logging .log,
-.logging .stats{
-	float:left;
-	display:inline;
-	margin:0 20px 0 0;
-	padding-right:25px;
-	background:url(../i/logging-status-sprite.png) no-repeat -100% -100%;
-}
-.logging .off{
-	background-position:100% 0;
-}
-.logging .on{
-	background-position:100% 100%;
-}
-.logging .stats{
-	margin-right:10px;
-}
-.logging .stat-auth{
-	float:left;
-	display:inline;
-	margin:0 10px 0 0;
-	border-bottom:1px solid #9bcad0;
-	color:#999;
-	cursor:pointer;
-}
-.details .status .params{
-	float:right;
-}
-.params .memory,
-.params .t,
-.params .max-weight,
-.params .upload-weight{
-	float:left;
-	display:inline;
-	margin-right:25px;
-}
-.memory{}
-
-.memory dl{
-	overflow:hidden;
-	margin-bottom:2px;
-}
-
-.memory dt{
-	float:left;
-	width:15px;
-}
-.memory dd{
-	float:left;
-}
-.memory .usage{}
-
-.memory .usage .value{
-	float:left;
-	width:30px;
-}
-.memory .usage .divider{
-	padding-right:2px;
-}
-.memory .usage .max{
-	font-weight:bold;
-	border-bottom:1px solid #9bcad0;
-	cursor:pointer;
-}
-.memory .graph{
-	clear:both;
-	position:relative;
-	border:1px solid #ccc;
-	font-size:0;
-	line-height:0;
-}
-.memory .graph .bar{
-	position:relative;
-	display:block;
-	height:2px;
-}
-.critical .bar{
-	background-color:#f00;
-}
-.middle .bar{
-	background-color:#ff9934;
-}
-.low .bar{
-	background-color:#acd45a;
-}
-.params .upload-weight{
-	margin:0;
-}
-.t .value,
-.max-weight .value,
-.upload-weight .value{
-	border-bottom:1px solid #9bcad0;
-	cursor:pointer;
-}
-.item .close{
-	position:absolute;
-	top:30px;
-	right:20px;
-	display:block;
-	width:16px;
-	height:16px;
-	background:url(../i/sprite.png) no-repeat;
-	cursor:pointer;
-}
-.item .close:hover{
-	background-position:-16px 0;
-}
-*/
-/* row hover effect
-- - - - - - - - - - - - - - - - - - - */
-/*
-.domains .item:hover{
-	background-color:#ffffcb;
-}
-.item:hover .names .primary{
-	cursor:pointer;
-	border-bottom:1px dotted #ccc;
-}
-.item:hover .logging .err-log,
-.item:hover .logging .log,
-.item:hover .logging .stats,
-.item:hover .memory dt,
-.item:hover .memory .divider,
-.item:hover .params .title{
-	color:#98bc65;	
-}
-.item:hover .logging .stat-auth,
-.item:hover .memory .max,
-.item:hover .t .value,
-.item:hover .max-weight .value,
-.item:hover .upload-weight .value{
-	color:#333;
-}
-*/
-/* Edit
-- - - - - - - - - - - - - - - - - - - */
-/*
-.edit{
-	position:relative;
-	clear:both;
-	margin:0 -20px;
-	padding:15px 20px 10px;
-	border-top:2px solid #999;
-	background-color:#ffffcb;
-}
-.change-ip-box{
-	margin:0 0 20px;
-}
-.edit .ip-details{
-	float:left;
-	margin-right:20px;	
-}
-.change-ip{
-	width:140px;
-	padding:3px 5px;
-	border:2px solid #9bcad0;
-	font-size:16px;
-} 
-.ip-details .created{
-	display:block;
-	margin:5px 0 0;
-	font-size:12px;	
-}
-.change-domain-name{
-	width:360px;	
-	padding:3px 5px;
-	border:2px solid #9bcad0;
-	font-size:16px;
-	font-weight:bold;
-}
-.edit .domain-name{
-	font-size:20px;
-	font-family:Georgia, "Times New Roman", Times, serif;
-	font-weight:normal;	
-	font-style:normal;
-	color:#000; /* radikal'no cherniy, da! *
-	white-space:nowrap;
-	line-height:2;
-}
-.change-logs-box{
-	float:left;
-	width:170px;
-	margin-right:50px;
-	padding-left:180px;
-}
-.ownership{
-	display:inline;
-	float:left;
-	width:160px;
-	margin:0 0 0 -180px;
-	font-size:12px;
-}
-.ownership .owner{
-	display:block;
-	font-size:16px;
-	font-weight:bold;
-	font-style:italic;
-}
-.change-logs{
-	padding-top:5px;
-}
-.change-logs label{
-	display:block;
-	margin:0 0 9px;
-}
-.change-logs .last{
-	margin:0;
-}
-.change-logs .title{
-	display:block;
-	float:left;
-	width:70px;
-	font-size:14px;
-}
-.change-logs .title b{
-	font-weight:bold;
-}
-.change-logs .checkbox{
-	margin:3px 0 0;
-	border:2px solid #9bcad0;
-}
-.change-logs .stat-auth{
-	position:relative;
-	top:-3px;
-	left:10px;
-	border-bottom:1px solid #9BCAD0;
-	cursor:pointer;
-}
-.change-memory{
-	float:left;
-	width:150px;
-	padding-top:5px;
-	font-size:14px;
-}
-.change-memory dl{
-	margin-bottom:13px;
-}
-.change-memory .value{
-	padding:0 5px;
-	font-style:italic;
-	font-weight:bold;
-	color:#6b930f;
-}
-.change-memory .amount{
-	margin-top:7px;
-}
-.change-memory .amount .max{
-	width:50px;
-	margin-left:10px;
-	padding:2px 5px;
-	border:2px solid #9bcad0;
-	text-align:right;
-}
-.change-memory .graph{
-	clear:both;
-	position:relative;
-	border:1px solid #9c9c82;
-	font-size:0;
-	line-height:0;
-}
-.change-memory .graph .bar{
-	position:relative;
-	display:block;
-	height:2px;
-}
-.change-params{
-	float:right;
-	font-size:14px;
-}
-.change-params li{
-	margin-top:5px;
-	overflow:hidden;
-}
-.change-params .title{
-	float:left;
-	width:165px;
-}
-.change-params .param-value{
-	width:30px;
-	margin-right:5px;
-	padding:1px 5px;
-	border:2px solid #9bcad0;
-	text-align:right;
-
-}
-.aliases{
-	position:relative;
-	padding-top:20px;
-	margin-bottom:20px;
-}
-.aliases .title{
-	float:left;
-	display:block;
-	margin-right:20px;
-	padding-top:3px;
-	font-size:17px;
-}
-.aliases .hint{
-	position:absolute;
-	top:-15px;
-	left:78px;
-	font-style:italic;
-	color:#999;
-}
-.aliases-list{
-	width:90%;
-	padding:3px 5px;
-	border:2px solid #9bcad0;
-	font-size:16px;
-}
-.buttons{}
-
-.buttons .apply{
-    width:auto;
-    overflow:visible;
-    padding:4px 20px 3px 17px;
-	background-color:#feff99;
-    border:1px solid #728b25;
-
-	font-family:"Lucida Grande", Tahoma, Arial, Verdana, sans-serif;
-    font-size:120%;
-    font-weight:bold;
-	text-transform:uppercase;
-
-    line-height:130%;
-    color:#6b9e05;
-	cursor:pointer;
-	
-	float:right;
-}
-.buttons .devider{
-	text-transform:uppercase;
-	float:right;
-	display:block;
-	line-height:24px;
-	margin:0 10px;
-}
-.buttons .cancel{
-	float:right;
-	width:auto;
-	height:20px;
-	padding:0;
-	border:0 none;
-	background:none;
-	color:#e09462;
-	text-decoration:underline;
-	cursor:pointer;
-}
-.hidden{
-	display:none;
-}
-.edit .iSelected{ /* descendant selector for more specific style context *
-	border-color:#59B4FF; /* blue border on focused input *
-	font-weight:bold;
-}
-.edit .not-valid{ /* descendant selector for more specific style context *
-	border-color:#f00; /* RED border on error field *
-}
-
-.edit .edit-help{
-	padding-bottom:1px;
-	font-family:Arial, Helvetica, sans-serif;
-	font-size:14px;
-	color:#a0a094;
-	text-decoration:none;
-	text-transform:uppercase;
-	border-bottom:1px solid #b5b59b;
-}
-.edit .delete{
-	position:absolute;
-	top:15px;
-	right:25px;
-	padding:3px 25px 3px 2px;
-	font-family:Arial, Helvetica, sans-serif;
-	font-size:14px;
-	color:#a0a094;
-	text-transform:uppercase;
-	background:url(../i/delete.gif) no-repeat 100% 50%;
-	cursor:pointer;
-}
-.edit .delete .title{
-	padding-bottom:1px;
-	border-bottom:1px solid #b5b59b;
-}
-*/
-
-/* IP list 
-- - - - - - - - - - - - - - - - - - - - */
-#content{
-	padding-bottom:0;
-}
-.ip-list{}
-
-	.row{
-		padding-top:10px;
-		padding:10px 10px 15px 10px;
-/*		min-height:125px;
-		min-height:110px;*/		
-		background:url(../i/long-dotted-bg.gif) repeat-x;
-	}
-	.first-row{
-		background-image:none;
-	}
-		.row-meta{
-			float:left;
-			width:150px;
-		}
-		.row-details{
-			margin-left:150px;
-/*			background:#e0e0e0;*/
-		}
-		.row-actions-box{
-/*			margin:0 0 5px;*/
-		}
-		
-		.row-actions-box .check-this,
-		.row-actions-box .check-control{
-			float:left;
-			width:10px;
-			height:10px;
-			margin-top:4px;
-/*			background:url(../i/logging-status-sprite.png) no-repeat;*/
-			background:url(../i/check-row-sprite.png) no-repeat;
-		}
-		.row-actions-box .row-operations{
-			float:right;
-		}
-		.ip-status-info{
-			position:relative;
-			display:block;
-			float:left;
-			margin-right:25px;
-			padding-right:15px;
-			font-size:12px;
-			}
-			.ip-status-info .ip-status-text{
-				visibility:hidden;
-			}
-			.row .ip-suspended-status{
-				margin-right:78px;
-				background:url(../i/suspended-ico.png) no-repeat 100% 65%;
-				}
-				.row .ip-suspended-status .ip-status-text{
-					text-transform:uppercase;
-					color:#333;
-					font-size:10px;
-					visibility:visible;
-				}
-		.delete-entry{
-			position:relative;
-			top:2px;
-			display:block;
-			float:left;
-			padding-right:15px;
-			font-size:11px;
-			text-transform:uppercase;			
-			}
-			.delete-entry .delete-entry-text{
-				visibility:hidden;
-			}
-		.entry-created{
-			padding-top:7px;
-			font-size:11px;
-			color:#6f6f6f;
-		}
-		.props-main{
-			float:left;
-			width:425px;
-/*			background:#eee;*/
-			}
-			.props-main .prop-box{
-				margin-bottom:15px;
-			}
-
-		.props-additional{
-			float:left;
-			width:200px;
-			padding:5px 10px 0 0;
-/*			background:#ccc;*/
-		}
-		.props-ext{
-			float:right;
-			width:120px;
-			padding-top:5px;
-/*			background:#d5d5d5;*/
-		}
-		.ip-adr-box{
-			margin:0 0 5px;			
-		}
-		.ip-adr{
-			display:-moz-inline-stack;
-			display:inline-block;
-			vertical-align:top;
-
-			font-size:22px;
-			line-height:1;
-			font-weight:normal;
-			letter-spacing:0.5px;
-		}
-		.ip-adr:active,
-		.ip-adr:focus{
-			color:#9fb749;
-		}
-		.ip-adr .dot{
-			padding:0 3px;
-		}
-		.ip-list .ip-adr{
-			border-bottom:1px solid #fff;
-		}
-		.prop-box{
-			display:-moz-inline-stack;
-			display:inline-block;
-			vertical-align:top;
-
-			min-width:40%;
-			width:auto !important;
-			width:40%;
-			margin:0 0 3px;
-			font-size:10px;
-			}
-			.prop-title{
-				text-transform:uppercase;
-				color:#9c9c9c;
-				font-size:9px;
-				line-height:15px;
-			}
-			.prop-value{
-				padding-left:3px;
-				font-size:12px;
-				color:#777;
-			}
-			.show-records{
-				display:inline-block;
-				padding-right:15px;
-				border-bottom:1px solid #c9cabc;
-				background:url(../i/show-records-ico.png) no-repeat 100% 50%;
-				text-transform:uppercase;
-				line-height:13px;
-				cursor:pointer;
-			}
-			.hide-records{
-				display:inline-block;
-				padding-right:15px;
-				border-bottom:1px solid #c9cabc;
-				background:url(../i/hide-records-ico.png) no-repeat 100% 50%;
-				text-transform:uppercase;
-				line-height:13px;
-				cursor:pointer;				
-			}
-			
-		.props-additional .owner-box{
-			padding-left:45px;
-			}
-			.props-additional .owner-box .prop-title{
-				float:left;
-				display:inline;
-				margin:2px 0 0 -45px;
-			}
-			.props-additional .owner-box .prop-value{
-				padding:0;
-			}			
-
-/* Suspended row
-- - - - - - - - - - - - - - - - - - - */
-.ip-details-suspended{}
-
-.ip-details-suspended:hover{
-	background-color:#fff;
-}
-	.ip-details-suspended .entry-created{
-		color:#ccc;
-	}
-	.ip-details-suspended .ip-adr{
-		color:#ccc;
-		border:none;
-	}
-	.ip-details-suspended:hover .ip-adr{
-		border:none;
-	}
-	.ip-details-suspended:hover .ip-adr:hover{
-		border:none;
-		cursor:default;		
-	}
-.ip-details-suspended .prop-title,
-.ip-details-suspended .prop-value{
-	color:#ccc;
-}
-
-/* Entry adding form
-- - - - - - - - - - - - - - - - - - - */
-.b-new-entry{
-	border-style:solid;
-	border-width:2px 1px 1px;
-	border-color:#999 #ccc #ccc #ccc;
-	
-	background-color:#ffffcb;
-	}
-	.b-new-entry .entry-header{
-		margin:0 0 10px;
-		padding:8px 15px 9px;
-		border-bottom:1px solid #dcdbab;
-		font-size:16px;
-		font-family:Georgia, "Times New Roman", Times, serif;
-		text-transform:uppercase;
-		color:#747668;
-	}
-	.b-new-entry .form-row{
-		position:relative;
-		padding:10px 15px;
-	}
-	.b-new-entry .field-label{
-		float:left;
-		width:180px;
-		font-size:15px;
-		line-height:2;
-		color:#3d504a;
-	}
-	.b-new-entry .text-field{
-		width:265px;
-		margin:0;
-		padding:6px 7px;
-		border:2px solid #b8c2c3;
-		color:#555;
-		font-family:Arial, Helvetica, sans-serif;
-		font-size:14px;
-		font-weight:bold;
-	}
-	.b-new-entry .field-label .remark{
-		position:relative;
-		top:-14px;
-		display:block;
-		font-style:italic;
-		font-size:14px;
-		color:#a3a590;
-	}
-	
-	.b-new-entry .custom-select{}
-	
-	.b-new-entry .textarea{
-		width:685px;
-		height:100px;
-		padding:6px 7px;
-		border:2px solid #b8c2c3;
-		color:#555;
-		font-family:Arial, Helvetica, sans-serif;
-		font-size:14px;
-		font-weight:bold;
-	}	
-	.b-new-entry .ssl-crtfct-box .textarea{
-		margin:10px 0 0;
-	}	
-	.b-new-entry .select{
-		position: absolute;
-		top:auto;
-		left:195px;
-		width: 195px;
-		height: 28px;
-		padding: 0 24px 0 8px;
-		color: #333;
-		font:bold 14px/28px arial,sans-serif;
-		background:#fff url(../i/select-arrow.png) no-repeat 100% 50%;
-		overflow: hidden;
-		border:2px solid #b8c2c3;
-	}
-	.b-new-entry select.styled{
-		top:10px;
-	}
-	.b-new-entry option{
-		font:14px arial,sans-serif;
-	}
-	.b-new-entry .form-options-group{}
-	
-	.b-new-entry .group-header{
-		margin:12px 25px 12px 60px;
-		text-transform:uppercase;
-		color:#9c9c9c;
-		font-size:11px;
-		line-height:15px;
-		height:16px;
-		background:url(../i/dotted.gif) repeat-x 0 50%;
-		}
-		.b-new-entry .group-title-outer{
-			padding:0 15px 0 0;
-			line-height:16px;
-			background:#ffffcb;
-		}
-		.b-new-entry .group-title{
-			padding:2px 15px 2px 0;
-		}
-		.b-new-entry .expanded .group-title{
-			background:#ffffcb url(../i/form-group-expanded.png) no-repeat 100% 50%;
-		}
-		.b-new-entry .collapsed .group-title{
-			background:#ffffcb url(../i/form-group-collapsed.png) no-repeat 100% 50%;		
-		}		
-
-	.b-new-entry .checkbox{
-		display:block;
-		float:left;
-		width:18px;
-		height:18px;
-		margin:6px 0 0;
-		background:url(../i/checkbox.png) no-repeat;
-	}
-	.b-new-entry .stats-settings{
-		padding-left:40px;
-	}
-	.b-new-entry .pwd-box .text-field{
-		float:left;
-		margin:0 15px 0 0;
-	}
-	.b-new-entry_dns .dns-template-box .styled{
-		float:left;
-		margin:0 40px 0 0;
-		margin:0 20px 0 0;		
-		width:230px;
-		cursor:pointer;
-	}	
-	.generate-pwd,
-	.context-settings{
-		position:relative;
-		top:10px;
-		float:left;
-		display:block;
-		color:#5ea2a1;
-		border-bottom:1px solid #cdcea6;
-		text-transform:uppercase;
-		cursor:pointer;
-		
-		font-size:12px;
-		line-height:1;
-		letter-spacing:0.5px;
-	}
-	.generate-pwd:hover,
-	.context-settings:hover{
-		color:#575757;
-		border-bottom-color:#b4c775;
-	}
-	.generate-pwd:active,
-	.context-settings:active{
-		color:#b4c775;	
-	}
-	.b-new-entry .buttons-row{
-		position:relative;
-		margin-top:10px;
-		padding:8px 15px 8px 195px;
-		border-top:1px solid #dcdbad;
-		background:url(../i/form-bottom-bg.png) repeat-x;
-	}
-	.b-new-entry .help-btn{
-		position:absolute;
-		top:13px;
-		left:16px;
-		font-size:11px;
-		line-height:12px;
-		color:#b4b39f;
-		text-transform:uppercase;
-		cursor:pointer;
-		border-bottom:1px solid #b4b39f;
-		}
-		.b-new-entry .help-btn:hover{
-			color:#000;
-			border-bottom-color:#9fb35a;
-		}
-		.b-new-entry .help-btn:active{
-			color:#4B9427;
-		}
-	.b-new-entry .cancel-btn{
-		position:absolute;
-		top:15px;
-		right:20px;
-		font-size:12px;
-		line-height:1;
-		text-transform:uppercase;
-		color:#cc7c4b;
-		cursor:pointer;
-		border-bottom:1px solid #cc7c4b;
-		}
-		.b-new-entry .cancel-btn:hover{
-			color:#000;
-			border-bottom-color:#c5795f;
-		}
-		.b-new-entry .cancel-btn:active{		
-			color:#CC7C4B;
-		}
-	.b-new-entry .add-entry-btn{
-		overflow:visible;
-		height:28px;
-		padding:0 50px;
-		-webkit-border-radius:9px;
-		-moz-border-radius:9px;
-		border-radius:9px;
-		border:2px solid #c8c09c;
-		background-color:#feff99;
-		color:#444428;
-		font-size:14px;
-		font-family:Arial, Helvetica, sans-serif;
-		font-weight:bold;
-		line-height:25px;
-		text-transform:uppercase;
-		cursor:pointer;
-		}
-		.b-new-entry .add-entry-btn:focus{
-			position:relative;
-			top:1px;
-		}
-		.b-new-entry .add-entry-btn:hover{
-			background-color:#feff77;
-			color:#464322;
-			border-color:#9e977b;
-		}
-		.b-new-entry .add-entry-btn:active{
-			background-color:#928d7a;
-			color:#fefe9e;
-			border-color:#87826e;
-		}
-		.b-new-entry .autocomplete-box{
-			position:relative;
-			float:left;
-			padding-right:35px;
-			background:#fff;
-			}
-			.b-new-entry .autocomplete-box .text-field{
-				width:213px;
-			}
-			.b-new-entry .autocomplete-box .arrow{
-				position:absolute;
-				top:0;
-				right:0;
-				display:block;
-				width:32px;
-				height:32px;
-				font-size:0;
-				line-height:0;
-/*				background:#fff url(../i/select-arrow.png) no-repeat 100% 50%;*/
-				background:#fff url(../i/autocomplete-field-arrows-sprite.png) no-repeat;
-				cursor:pointer;
-			}
-			.b-new-entry .autocomplete-box .arrow:hover,
-			.b-new-entry .autocomplete-box .arrow:active,
-			.b-new-entry .autocomplete-box .arrow:focus{
-				background-position:0 -32px;
-			}
-
-		.b-new-entry .form-error{
-			position:relative;
-			margin:-5px 5px 5px;
-			padding:8px 15px;
-			border:1px solid #dcdbad;
-			background:url(../i/form-bottom-bg.png) repeat-x;
-			}
-			.form-error .error-box{
-				padding-left:18px;
-				background:url(../i/error-bullet.png) no-repeat 0 50%;
-			}
-			.form-error .error-box .error-message{
-				color:#9a32ff;
-				font-size:16px;
-				line-height:22px;
-			}
-			.form-error .error-box .help-tip-url{
-				position:relative;
-				top:-1px;
-				font-size:12px;
-				line-height:15px;
-				color:#b4b39f;
-				text-transform:uppercase;
-				text-decoration:none;
-				cursor:pointer;
-				border-bottom:1px solid #b4b39f;
-				}
-				.b-new-entry .help-tip-url:hover{
-					color:#000;
-					border-bottom-color:#9fb35a;
-				}
-
-/* Show/edit dns records form
-- - - - - - - - - - - - - - - - - - - */
-.b-records-list{
-	margin-left:160px;
-	}
-	.b-records-list .entry-header{
-		padding-top:6px;
-		padding-bottom:11px;	
-		} 
-		.b-records-list .hide-records{
-			font-size:10px;
-			font-family:Arial, Helvetica, sans-serif;
-			line-height:13px;
-		}
-	.b-records-list .add-btn{
-		margin:0;
-		float:none;
-	}
-	.b-records-list .form-row{
-		padding-top:5px;
-		padding-bottom:5px;
-	}
-	.b-records-list .add-box{
-		padding-bottom:15px;
-	}
-	.b-records-list .buttons-row{
-		margin-top:20px;
-	}
-	.form-row-line{
-		position:relative;
-	}
-	.form-row-line .field-box{
-		float:left;
-	}
-	.form-row-line .field-devider{
-		float:left;
-		display:block;
-		min-height:30px;
-		margin:0 15px;
-		font-size:15px;
-		line-height:2;
-	}
-	.b-records-list .form-row-line .field-label{
-		float:none;
-		display:block;
-		width:auto;
-		line-height:20px;
-	}
-	.b-records-list .dns-record-box .text-field{
-		width:147px;
-		float:left;
-	}
-	.b-records-list .dns-type-box{
-		margin-right:15px;
-	} 
-	.b-records-list .dns-type-box .select{
-		width:51px;
-		left:221px;
-	}
-	.b-records-list .dns-type-box select.styled{
-		width:87px;
-		cursor:pointer;
-	}
-	.b-records-list .dns-value-box .text-field{
-		width:390px;
-	}	
-	.b-records-list .delete-record{
-		position:relative;
-/*		top:31px;
-		left:10px;*/
-		position:absolute;
-		bottom:15px;
-		right:11px;
-		display:block;
-		float:left;
-		width:11px;
-		height:11px;
-		background:url(../i/delete-ico-off.png) no-repeat;
-	}
-	.b-records-list .delete-record:hover{
-		cursor:pointer;
-		background-image:url(../i/delete-ico.png);
-	}
-	
-
-/* Web-domains list
-- - - - - - - - - - - - - - - - - - - */
-.domains-list{}
-
-	.domains-list .entry-created{
-		padding-top:9px;
-	}
-	.names{
-		margin:0 0 6px;
-		color:#acacac;
-		}
-		.names .alias-title{
-			position:relative;
-			top:-1px;
-			padding-right:3px;
-			padding:0 3px 0 25px;
-			font-size:10px;
-			line-height:1.8;
-			text-transform:uppercase;
-		}
-		.names .domain-name{
-			position:relative;
-			top:-1px;
-			padding:0 3px 0 0;
-			font-size:12px;	
-			line-height:1.5;
-			color:#acacac;	
-			white-space:nowrap;
-		}
-		.row-details .names .primary{ 
-			top:0;
-/*			padding:0 25px 0 0;*/
-			font-size:20px;
-			font-family:Arial, Helvetica, sans-serif;
-			font-weight:normal;	
-			font-style:normal;
-			color:#000; /* radikal'no cherniy, da! */
-		}
-		.names .primary:active{
-			color:#9fb749;			
-		}
-		.domains-list .names .primary,
-		.dns-list .names .primary{
-			border-bottom:1px solid #fff;
-		}
-		
-	.domains-list .props-main{
-		width:345px;
-		}	
-		.domains-list .ip-adr{
-			font-size:16px;
-			color:#888;
-		}
-		.domains-list .ip-adr-box .prop-box{
-			margin-left:20px;
-			}
-/*			.domains-list .ip-adr-box .prop-value{
-				padding:0;
-				cursor:pointer;
-				border-bottom:1px solid #cbcbbf;
-			}		*/
-	.domains-list .props-additional{
-		width:230px;
-		padding-top:0;
-/*		background:#bbb;*/
-	}
-	.domains-list .props-ext{
-		width:170px;
-		padding-top:0;
-/*		background:#ddd;*/
-	}
-	
-.b-usage-box{
-	display:block;
-}
-
-	.b-usage-box .prop-title{
-		float:left;
-		margin:2px 15px 0 0;
-	}
-	.b-usage-box .usage-box{
-		float:left;
-		width:136px;
-	}
-	.b-usage-box .usage-box{
-
-	}
-	.b-usage-box .value-box{
-		float:left;
-		width:75px;
-	}
-	.b-usage-box .max-size{
-		float:right;
-	}
-	.b-usage-box .value{
-		display:block;
-		font-size:11px;
-		line-height:1;
-		color:#999;
-	}
-	.b-usage-box .max-size{
-		position:relative;
-		top:2px;
-		font-size:14px;
-		line-height:1;
-		color:#ababab;
-	}
-	.b-usage-box .max-size .units{
-		font-size:12px;
-		color:#797979;
-	}
-	.graph{
-		position:relative;
-		border:1px solid #b7b7b9;
-		font-size:0;
-		line-height:0;
-		}
-		.graph .bar{
-			position:relative;
-			display:block;
-			height:2px;
-		}
-		.critical .bar{
-			background-color:#f00;
-		}
-		.middle .bar{
-			background-color:#ff9934;
-		}
-		.low .bar{
-			background-color:#9fec00;
-		}
-
-.domains-list .disk-usage{
-	margin:0 0 6px;
-}
-.domains-list .props-additional .prop-box,
-.domains-list .props-ext .prop-box{
-	display:block;
-	margin:0;
-	}		
-	.stats-box{}
-		
-		.stats-box .stats-auth{
-			position:relative;
-			top:3px;
-			display:-moz-inline-stack;
-			display:inline-block;
-			vertical-align:top;
-			
-			margin:0 0 0 5px;
-			padding:0 0 0 10px;
-			font-size:12px;
-			line-height:1.5;
-			color:#777;
-			cursor:pointer;
-		}
-		.stats-box .stats-auth-on{		
-			background:url(../i/auth-plus.png) no-repeat 0 60%;		
-		}
-		.stats-box .stats-auth-text{
-			display:block;
-			line-height:11px;
-			border-bottom:1px solid #cacbbd;		
-		}
-		
-	.nginx-box{}
-		
-		.nginx-box .nginx-ext-list{
-			position:relative;
-			top:3px;
-			display:-moz-inline-stack;
-			display:inline-block;
-			vertical-align:top;
-	
-			margin:0 0 0 5px;
-			border-bottom:1px solid #cacbbd;
-			font-size:12px;
-			line-height:1;
-			color:#777;
-			cursor:pointer;
-		}
-	.template-box{}
-	
-		.template-box .prop-value{
-			padding:0;
-			cursor:pointer;
-			border-bottom:1px solid #cbcbbf;
-		}
-
-/* DNS list
-- - - - - - - - - - - - - - - - - - - */		
-.dns-list{}
-
-	.dns-list .entry-created{
-		padding-top:9px;
-	}
-	.dns-list .props-main{
-		width:295px;
-	}
-	.dns-list .props-additional{
-		width:200px;
-	}	
-	.dns-list .props-ext{
-		width:250px;
-	}
-.dns-list .props-additional .prop-box,
-.dns-list .props-ext .prop-box{
-	display:block;
-	margin:0;
-	}	
-.dns-list .ip-adr-box{
-	margin:0;
-	}
-	.dns-list .ip-adr{
-		font-size:12px;
-		line-height:1.5;
-		color:#777;
-	}
-		
-/* row hover effect
-- - - - - - - - - - - - - - - - - - - */
-.row:hover{
-	background-color:#ffffcb;		
-}
-.ip-list .row:hover .ip-adr,
-.domains-list .row:hover .names .primary,
-.dns-list .row:hover .names .primary{
-	border-bottom-style:dashed;
-	border-bottom-color:#e5e5e5;
-	border-bottom-color:#bbb;	
-}
-.ip-list .row:hover .ip-adr:hover,
-.domains-list .row:hover .names .primary:hover,
-.dns-list .row:hover .names .primary:hover{
-	cursor:pointer;
-	border-bottom-style:solid;
-	border-bottom-color:#b4c775;
-}
-.ip-list .ip-details-suspended:hover .ip-adr,
-.ip-list .ip-details-suspended:hover .ip-adr:hover{
-	border:none;
-	cursor:default;
-}
-.row:hover .ip-status-info{
-	background:url(../i/enabled-ico_.png) no-repeat 100% 50%;
-}
-.row:hover .delete-entry{
-	background:url(../i/delete-ico-off.png) no-repeat 100% 4px;
-}
-.row:hover .ip-suspended-status{
-	background:url(../i/suspended-ico.png) no-repeat 100% 65%;
-}
-.ip-status-info:hover .ip-status-text,
-.delete-entry:hover .delete-entry-text{
-	visibility:visible;
-}
-.row .ip-status-info:hover{
-	background-image:url(../i/enabled-ico-hover.png);
-}
-.row .delete-entry:hover{
-	background-image:url(../i/delete-ico.png);
-	cursor:pointer;
-}
-.delete-entry:hover .delete-entry-text{
-	color:#333;
-}
-.delete-entry .delete-entry-text:hover{
-	cursor:pointer;
-}
-.delete-entry .delete-entry-text:active{
-	color:#f00;
-}
-.row:hover .show-records,
-.row:hover .hide-records,
-.row:hover .template-box .prop-value,
-.domains-list .row:hover .stats-box .stats-auth-text,
-.domains-list .row:hover .nginx-box .nginx-ext-list{
-	color:#6aa0ac;
-	border-bottom-color:#cacbbd;
-}
-.row:hover .template-box .prop-value:hover,
-.row:hover .show-records:hover,
-.hide-records:hover, 
-.domains-list .row:hover .stats-box .stats-auth-text:hover,
-.domains-list .row:hover .nginx-box .nginx-ext-list:hover{
-	color:#575757;
-	border-bottom-color:#b4c775;
-}
-.row:hover .template-box .prop-value:active,
-.row:hover .show-records:active,
-.hide-records:active, 
-.domains-list .row:hover .stats-box .stats-auth-text:active,
-.domains-list .row:hover .nginx-box .nginx-ext-list:active{
-	color:#b4c775;
-}
-
-/* Checked row
-- - - - - - - - - - - - - - - - - - - */
-.checked-row{
-	background-color:#e4f7bf;
-}
-	.checked-row .row-actions-box .check-control{
-		background-position:0 -46px;
-		background-position:0 -30px;		
-	}
-	
-	.domains-list .checked-row .names .primary, 
-	.dns-list .checked-row .names .primary{
-		border-bottom:1px solid #e4f7bf;
-	}
+/*- - - - - - - - - - - - - - - - - - -
+Title  : Vesta
+Author : Eugen Lobicov, eugen.lobicov@gmail.com 
+
+created : November 27, 2009
+last updated : November 16, 2011
+- - - - - - - - - - - - - - - - - - */
+
+html{
+	font-size:100.01%; /* prevent IE's extreme font-resizing bug*/
+}
+
+body{
+	position:relative;
+	font:normal 62.5%/1.5 Helvetica, Arial, sans-serif; 
+	background:#B2AD9C url(../i/thin-grey-line-4.gif) repeat-x;
+	color:#333;
+}
+#page{
+	width:965px;
+	width:955px;
+	margin:3px auto 0;
+	border:1px solid red;
+	border:solid #807D70;
+	border-width:0 1px;
+}
+.outer{
+	padding-bottom:58px;
+	background:#fff url(../i/footer-bg.gif) repeat-x 0 100%;
+}
+#header{
+	padding:0 1px 0 10px;
+	height:26px;
+	border-bottom:2px solid #333527;
+	background-color:#484439;
+}
+.logo-box{
+	float:left;
+}
+.logo,
+.logo a,
+.logo a span{
+	display:block;
+	width:80px;
+	height:26px;
+}
+.logo a{
+	position:relative;
+	overflow:hidden;
+	font-size:1.2em; /*12px */
+	text-decoration:none;
+	color:#fff;
+	display:block;
+	text-indent:-9999px;
+}
+.logo a span{
+	position:absolute;
+	top:1px;
+	left:0;
+	z-index:1;
+	width:72px;
+	height:24px;
+	background:url(../i/vesta-logo-2011-12-14.png) no-repeat;
+}
+.settings{
+	float:right;
+}
+.settings .settings-item,
+.extra-services .service-item{
+	float:left;
+	display:block;
+	padding:0 10px;
+	font-size:9px;
+	line-height:26px;
+	
+	text-transform:uppercase;
+	letter-spacing:1px;
+}
+.settings .item-title,
+.extra-services .item-title{
+	font-family:Arial, Helvetica, san-serif;	
+	font-size:9px;
+	color:#C0BD00;
+	text-decoration:none;
+	border-bottom:1px dotted #68684B;
+}
+.settings a.item-title:hover{
+	color:#fefda0;
+	text-decoration:none;
+}
+.settings a.item-title:active{
+	color:#E16734;
+	text-decoration:none;
+}
+.settings .logged-as{
+	margin:0;
+}
+.settings .logged-as{
+	position:relative;
+	top:1px;
+	padding-right:5px;
+	font-size:16px;
+	line-height:20px;
+	font-family:Georgia, Cambria, "Times New Roman", Times, serif;
+	font-weight:bold;
+	font-style:italic;
+	color:#fff;
+	text-transform:none;
+	border:none;
+	letter-spacing:normal;
+}
+.settings .logout{
+	float:left;
+	display:block;
+	text-transform:uppercase;
+	letter-spacing:1px;
+	line-height:26px;	
+	}
+	.settings .logout .item-title{
+		display:block;
+		padding:0 10px;
+		font-size:9px;
+		line-height:26px;
+		border:none;
+	}
+	.settings .logout .item-title-inner{
+		border-bottom:1px dotted #68684B;
+	}
+	.logout a.item-title:hover{
+		background-color:#a3b82d;
+		color:#ffffc5;
+		}
+		.logout a.item-title:hover .item-title-inner{
+			border:none;
+		}
+	
+	.logout a.item-title:active{
+		background-color:#ffff66;
+		color:#272700;
+	}
+
+	
+.extra-services{
+	float:right;
+	margin-right:59px;
+}
+.extra-services .service-item{
+	position:relative;
+	padding:0 13px;
+	line-height:26px;
+	letter-spacing:normal;
+}
+.extra-services .item-devider{
+	position:absolute;
+	top:-3px;
+	left:0;
+	width:100%;
+	height:3px;
+}
+.extra-services .item-title{
+	font-family:Arial, Helvetica, san-serif;
+	font-size:10px;
+	font-weight:bold;
+	color:#C0E1F3;
+	border-bottom:1px dotted #7D939F;
+}
+.extra-services .active{
+	cursor:default;
+	background:#333;
+	font-weight:bold;
+	}
+	.extra-services .service-item:hover{
+		cursor:pointer;
+	}
+	.extra-services .service-item:hover .item-title{
+		color:#fffa96;
+		border-bottom-color:#fffa96;
+	}
+	.extra-services .service-item:active{
+		background:#333;
+	}
+	.extra-services .service-item:active .item-title{
+		color:#fff;
+		border:none;
+	}
+	.extra-services .active .item-title{
+		color:#fff997;
+		border:none;
+	}
+	.extra-services .active .item-devider{
+		background:#ff6766;
+	}
+
+/*Remove button padding in FF*/
+input::-moz-focus-inner{ 
+	border: 0;
+	padding: 0;
+}
+.cc:after{
+ 	content: ".";
+    display: block;
+    height: 0;
+    clear: both;
+    visibility: hidden;
+}
+.hidden{
+	display:none !important;
+}
+
+/* Navigation
+- - - - - - - - - - - - - - - - - - - - */
+#primary-nav-box{
+	clear:both;
+	height:115px;
+	background-color:#ecf3d2;
+}
+.primary-nav{}
+
+.primary-nav .section{
+	position:relative;
+	float:left;
+	display:block;
+	padding-right:1px;
+	background:url(../i/nav-devider-2.png) no-repeat 100% 50%;
+}
+.primary-nav .last-section{
+	background:none;
+	padding:0;
+}
+.section .section-inner{
+	width:130px;
+	min-height:100px;
+	height:auto !important;
+	height:100px;
+	padding:15px 0 3px 6px;
+	padding:15px 0 0 6px;
+	}
+.primary-nav .last-section .section-inner{
+	width:133px;
+	width:127px;
+}
+.section .section-title{
+	position:absolute;
+	left:7px;
+	bottom:9px;
+	font-family:Arial, Helvetica, sans-serif;
+	font-size:15px;
+	line-height:1.2;
+	font-weight:bold;
+	text-transform:uppercase;
+	color:#393939;
+	color:#33342e;
+	}
+	.section .section-title .to-section{
+		float:left;
+		margin-right:4px;
+	}
+	.section .section-title .add-entry{
+		position:relative;
+		top:2px;
+		float:left;
+		display:block;
+		width:14px;
+		height:14px;
+		background:url(../i/plus-sprite1.png) no-repeat;
+		font-size:0;
+		line-height:0;
+		}
+		.section .section-title .add-entry:hover{
+			background-position:-14px 0;
+			cursor:pointer;
+		}
+
+.section .section-devider{
+	position:absolute;
+	left:0;
+	bottom:0;
+	z-index:10;
+	/*background:url(../i/section-status-sprite-5.gif) no-repeat -420px 115px;	*/
+	display:block;
+	width:100%;
+	height:3px;
+	background:url(../i/section-status-sprite-6.png) no-repeat -420px 100%;
+}
+		
+.dnstpl-nav-item .section-title{
+	background-position:100% 85%;
+}
+.section .def{
+	display:block;
+	font-family:Arial, Helvetica, sans-serif;
+	font-size:12px;
+	color:#8c9c91;
+}
+.section:hover .section-inner{
+	background-color:#F1F7D6;
+	color:#000;
+	cursor:pointer;
+	}
+	.section:hover .section-devider{
+		background-position:0 100%;	
+	}	
+	.section:hover .section-title{
+		color:#000;
+	}
+.primary-nav .active .section-inner{
+	cursor:default;
+	}
+	.primary-nav .active .section-devider{
+		background-position:-140px 100%;
+		height:5px;
+		bottom:-2px;
+	}
+	.primary-nav .active .def{
+		color:#8c9c91;
+	}
+	.primary-nav .active .section-title{
+		color:#393939;
+	}		
+
+#console{
+	position:relative;
+	clear:both;
+	height:70px;
+	background-color:#a09d98;
+	background:#535049 url(../i/console-box-bg.png) repeat-x;
+	border-bottom:1px solid #7a7967;
+	z-index:1;
+}
+
+.b-console{
+	position:absolute;
+	left:50%;
+}
+
+.b-console-wrap{
+	position:relative;
+	right:50%;
+	width:655px;
+	padding:10px 15px 16px 25px;
+	background:url(../i/console-bg.png) repeat;
+	
+	border-radius: 0 0 5px 5px;
+	-moz-border-radius: 0 0 5px 5px;
+	-webkit-border-top-right-radius: 0;
+	-webkit-border-top-left-radius: 0;
+	-webkit-border-bottom-right-radius: 5px;
+	-webkit-border-bottom-left-radius: 5px;
+}
+	.b-console-form{}
+	
+		.b-console-field{
+			float:left;
+			width:548px;
+			margin-right:15px;
+			padding:5px 10px;
+			border:2px solid #42647f;
+			font-family:Arial, Helvetica, sans-serif;
+			font-size:18px;
+			font-style:italic;
+			font-weight:bold;
+			color:#aaa;
+		}
+		.b-console-field:focus{
+			-moz-box-shadow:0 0 8px rgba(82, 168, 236, 0.5);
+			-webkit-box-shadow:0 0 8px rgba(82, 168, 236, 0.5);
+			border-color:rgba(82, 168, 236, 0.75) !important;
+			color:#333;
+		}	
+		.b-console-btn{
+			float:left;
+			overflow:visible;
+			height:30px;
+			margin:4px 0 0;
+			padding:0 20px;
+			-webkit-border-radius:4px;
+			-moz-border-radius:4px;
+			border-radius:4px;
+			border:0 none;
+			background-color:#fdcd00;
+			color:#4b3600;
+
+			font-size:13px;
+			font-family:Arial, Helvetica, sans-serif;
+			font-weight:bold;
+			line-height:30px;
+			text-transform:uppercase;
+			cursor:pointer;
+	
+			/* a little animation effect on hover for -webkit- */
+			-webkit-transition-property: background;
+			-webkit-transition-duration: 150ms;
+			-webkit-transition-timing-function: ease-in-out; 
+			}
+			.b-console-btn:focus{
+				position:relative;
+				top:1px;
+			}
+			.b-console-btn:hover{
+				background-color:#ffe84c;
+				color:#39351c;
+			}
+			.b-console-btn:active{
+				background-color:#333;
+				color:#fff;
+			}
+
+.b-console-statuses{
+	margin-top:15px;
+}
+	
+	.b-console-status{
+		position:relative;
+		padding:5px 80px 5px 10px;
+		border:2px dashed #999;
+		background-color:#feff99;
+		color:#666;
+		font-size:12px;
+	}
+	.b-console-status-message{
+		float:left;
+		color:#666;
+	}
+	.b-console-status-action{
+		float:right;
+		margin-right:-36px;
+		text-decoration:underline;
+	}
+	.b-console-status-message b{
+		font-weight:bold;
+		color:#333;
+	}	
+	.b-console-status-arrow{
+		position:absolute;
+		top:10px;
+		right:12px;
+		display:block;
+		width:14px;
+		height:8px;
+		background:url(../i/status-arrow.png) no-repeat;
+	}
+	
+
+
+#actions-toolbar{
+	clear:both;
+	position:relative;
+	/*padding:15px 20px 15px 280px;*/
+	padding:15px 20px 15px 250px;
+	background-color:#f3f3d9;
+	border-bottom:1px solid #c9cbc8;
+}
+.add-domain,
+.add-btn{
+	position:relative;
+	top:2px;
+	float:left;
+	/*margin:0 0 0 -260px;*/
+	margin:0 0 0 -230px;
+	border-bottom:1px solid #b5c968;
+	font-family:Georgia, "Times New Roman", Times, serif;
+	font-size:16px;
+	line-height:1;
+	text-transform:uppercase;
+	color:#66685d;
+	text-decoration:none;
+}
+.add-domain .icon,
+.add-btn-icon{
+	float:left;
+	display:block;
+	width:11px;
+	height:11px;
+	margin:4px 5px 0 0;
+	background:url(../i/add-entry-plus.gif) no-repeat;	
+	font-size:0;
+	line-height:0;	
+	}
+	.add-btn:hover{
+		color:#000;
+		border-bottom-color:#b85152;
+	}
+	.add-btn:active{
+		color:#b85152;
+		border-bottom-color:#000;
+	}
+	
+/*
+.select-all{
+	padding:0 40px 0 0;
+	font-size:13px;
+	color:#7f7e6c;
+	text-decoration:underline;
+	cursor:pointer;
+	}
+	.select-all:hover{
+		text-decoration:none;
+	}
+.clear-selected{
+	font-size:11px;
+	line-height:10px;
+	text-transform:uppercase;
+	color:#bcb6a6;
+	cursor:pointer;
+	letter-spacing:0.2px;
+	border-bottom:1px solid #bcb6a6;
+	}
+	.clear-selected:hover{
+		color:#000;
+		border-bottom-color:#b85152;
+	}
+	.clear-selected:active{
+		color:#b85152;
+		border-bottom-color:#000;
+	}
+*/
+.db-manager{
+	float:right;
+	margin:5px 0 0 25px;
+	font-size:11px;
+	line-height:1.273; /*14px*/
+	text-transform:uppercase;
+	letter-spacing:0.2px;	
+	border-bottom:1px solid #bcb6a6;
+	text-decoration:none;
+	color:#9b9b8f;
+	}
+	.db-manager .highlighted{
+		font-style:normal;
+		font-weight:bold;
+		color:#4097b3;
+	}
+	.db-manager:hover{
+		color:#4097b3;
+		border-bottom-color:#b85152;		
+	} 
+	.db-manager:active{
+		color:#b85152;
+		border-bottom-color:#4097b3;
+		}
+		.db-manager:active .highlighted{
+			color:#b85152;		
+		} 
+		
+/* Row filters */
+
+.row-filters{}
+	
+	.b-row-selector{
+		float:left;
+		width:240px;
+	}
+
+	.b-row-selector .checkbox-selector{
+		position:relative;
+		top:4px;
+		margin-right:20px;
+	}
+	.b-row-selector .b-cust-sel{
+		width:100px;
+	}
+	
+.checkbox-selector,
+.context-actions{
+	display:-moz-inline-stack;
+	display: inline-block;
+	zoom: 1;
+	*display: inline;
+	vertical-align:top;
+	}
+	.checkbox-selector .checkbox{
+		display:block;
+		float:left;
+		width:11px;
+		height:11px;
+		margin:2px 5px 0 0;
+		background:url(../i/chekbox-selector.png) no-repeat;
+		cursor:pointer;		
+	}
+	.checkbox-selector .selector-title{
+		float:left;
+		font-size:11px;
+		line-height:15px;
+		text-transform:uppercase;
+		color:#5d5d5d;
+		cursor:pointer;
+		white-space:nowrap;
+	}
+	.checkbox-selector:hover .checkbox{
+		background-position:0 -90px;
+	}
+	.checkbox-selector .selector-title:hover{
+		color:#2ea8bd;	
+	}
+	.checkbox-selector .selector-title:active{
+		color:#fc0;
+	}
+	
+/* Custom select */
+.b-cust-sel{
+	position: relative;
+	font-size: 12px;
+
+	background-color: #fff;
+/*  background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eeeeee), color-stop(0.5, white));
+  background-image: -webkit-linear-gradient(center bottom, #eeeeee 0%, white 50%);
+  background-image: -moz-linear-gradient(center bottom, #eeeeee 0%, white 50%);
+  background-image: -o-linear-gradient(top, #eeeeee 0%,#ffffff 50%);
+  background-image: -ms-linear-gradient(top, #eeeeee 0%,#ffffff 50%);
+  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#eeeeee', endColorstr='#ffffff',GradientType=0 );
+  background-image: linear-gradient(top, #eeeeee 0%,#ffffff 50%);
+
+  -moz-background-clip   : padding;
+  -webkit-background-clip: padding-box;
+  background-clip        : padding-box;
+*/
+
+	box-shadow: inset 1px 1px 4px 0px rgba(0, 0, 0, 0.10);
+	-moz-box-shadow: inset 1px 1px 4px 0px rgba(0, 0, 0, 0.10);
+	-webkit-box-shadow: inset 1px 1px 4px 0px rgba(0, 0, 0, 0.10);
+
+  border: 1px solid #c5c4bf;
+  display: block;
+  white-space: nowrap;
+  position: relative;
+  height: 20px;
+  line-height: 20px;
+  padding: 0 0 0 8px;
+  color: #616161;
+  
+}
+.b-cust-sel .title{
+  margin-right: 26px;
+  display: block;
+  overflow: hidden;
+  white-space: nowrap;
+  -o-text-overflow: ellipsis;
+  -ms-text-overflow: ellipsis;
+  text-overflow: ellipsis;
+}
+.cust-sel-arrow{
+  -moz-background-clip   : padding;
+  -webkit-background-clip: padding-box;
+  background-clip        : padding-box;
+  background: #ccc;
+
+/*  background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
+  background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+  background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+  background-image: -o-linear-gradient(bottom, #ccc 0%, #eee 60%);
+  background-image: -ms-linear-gradient(top, #cccccc 0%,#eeeeee 60%);
+  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#cccccc', endColorstr='#eeeeee',GradientType=0 );
+  background-image: linear-gradient(top, #cccccc 0%,#eeeeee 60%);
+*/  
+  
+  background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.6, #f5f4ef));
+  background-image: -webkit-linear-gradient(center bottom, #fff 0%, #f5f4ef 60%);
+  background-image: -moz-linear-gradient(center bottom, #fff 0%, #f5f4ef 60%);
+  background-image: -o-linear-gradient(bottom, #fff 0%, #f5f4ef 60%);
+  background-image: -ms-linear-gradient(top, #cccccc 0%,#f5f4ef 60%);
+  filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#cccccc', endColorstr='#f5f4ef',GradientType=0 );
+  background-image: linear-gradient(top, #cccccc 0%,#f5f4ef 60%);
+  
+  border-left: 1px solid #c5c4bf;
+  position: absolute;
+  right: 0;
+  top: 0;
+  display: block;
+  height: 100%;
+  width: 21px;
+}
+.cust-sel-arrow i{
+  display: block;
+  width: 100%;
+  height: 100%;
+  background:url(../i/custom-arrow.png) no-repeat 50% 50%;		
+}
+.b-cust-sel .cust-sel-options{
+	position:absolute;
+	top:21px;
+	left:-1px;
+	width:100%;
+	padding:5px 0 2px;
+	border:solid #C5C4BF;
+	border-width:0 1px 1px;
+	background:#fff;
+	z-index:100;
+	}
+	.b-cust-sel .cust-sel-option{
+		padding:0 0 4px 18px;
+		background:url(../i/cust-option-bullets.png) no-repeat 5px 7px;
+		color:#828282;
+		cursor:pointer;		
+	}
+	.b-cust-sel .cust-sel-option:hover{
+		color:#333;
+	}
+	.b-cust-sel .ico_gray{
+		background-position:5px 7px;
+	}
+	.b-cust-sel .ico_green{
+		background-position:5px -35px;
+	}
+	.b-cust-sel .ico_red{
+		background-position:5px -79px;
+	}
+
+.b-cust-sel_inactive{
+	background:#f3f3d9;
+	box-shadow: none;
+	-moz-box-shadow: none;
+	-webkit-box-shadow: none;
+	}	
+	.b-cust-sel_inactive .cust-sel-arrow{
+		background:#f3f3d9;
+	}
+	.b-cust-sel_inactive .cust-sel-options{
+		display:none;
+	}
+	
+.domain-groups-selector{
+	float:left;	
+	width:270px;
+	padding-top:2px;
+	font-size:11px;
+	line-height:15px;
+	}
+	.domain-groups-selector .selector-wrap{
+		display:-moz-inline-stack;
+		display: inline-block;
+		zoom: 1;
+		*display: inline;
+		vertical-align:top;
+		padding-right:15px;
+		border-bottom:1px solid #d5d6c4;
+		background:url(../i/custom-arrow.png) no-repeat 100% 6px;
+	}
+	.domain-groups-selector .selector-title{
+		padding-right:5px;
+		font-weight:normal;
+		text-transform:uppercase;
+		color:#8b8b8b;	
+	}
+	.domain-groups-selector .selected-groups{
+		color:#5d5d5d;
+	}
+
+#content{
+	padding:8px 0 50px;
+	background:#fff url(../i/content-separator.png) repeat-x;
+}
+.b-ext-info-wrap{
+	position:relative;
+	min-height:40px;
+	}
+	.b-ext-info{
+		margin:0 0 6px;
+		padding:10px 25px 15px;
+		background:#ddd;
+		font-size:12px;
+		color:#000;
+		text-shadow: 0px 1px 1px #fff;
+	}
+	.b-ext-info-btn{
+		position:relative;
+		left:-1px;
+		width:102px;
+		height:15px;
+		margin-left:-50px;
+		margin:-6px auto 0;
+		background-color:#fff;
+		cursor:pointer;
+		}
+		.b-ext-info-wrap_collapsed .b-ext-info-btn{
+			background:url(../i/more-info-btn.png) no-repeat;		
+		}
+.content-inner{
+	background-color:#fff;
+	padding:0 15px 15px;
+}
+/*
+.domains{
+	border-bottom:1px solid #333;
+	background-color:#fff;
+}
+.domains .item{
+	position:relative;
+	padding:0 20px;
+	background:url(../i/long-dotted-bg.gif) repeat-x;
+}
+.domains .first{
+	margin:0;
+	background:none;
+}
+.item .view{
+	padding:15px 0 10px;
+}
+.item .ip-box{
+	float:left;
+	width:150px;
+	padding-top:12px;
+}
+.ip-box .ip{
+	font-size:1.1em; /*11px*
+	line-height:21px;
+	font-weight:normal;
+	letter-spacing:.175em;
+}
+.ip-box .owner{
+	display:block;
+	font-size:1.2em;
+	color:#999;
+}
+.details .names .primary{ 
+	font-size:20px;
+	font-family:Georgia, "Times New Roman", Times, serif;
+	font-weight:normal;	
+	font-style:normal;
+	color:#000; /* radikal'no cherniy, da! *
+}
+.names .divider{
+	font-size:12px;
+	line-height:2;
+	text-transform:uppercase;
+	color:#999;
+}
+.names .domain-name{
+	padding:0 10px;
+	font-size:12px;	
+	line-height:2;
+	font-style:italic;
+	color:#999;	
+	white-space:nowrap;
+}
+.item .details{
+	margin-left:150px;
+}
+.item .details .status{
+	float:right;
+	width:60%;
+	margin:5px 20px 0 0;
+	color:#999;
+}
+.details .status .logging{
+	float:left;
+}
+.logging .err-log,
+.logging .log,
+.logging .stats{
+	float:left;
+	display:inline;
+	margin:0 20px 0 0;
+	padding-right:25px;
+	background:url(../i/logging-status-sprite.png) no-repeat -100% -100%;
+}
+.logging .off{
+	background-position:100% 0;
+}
+.logging .on{
+	background-position:100% 100%;
+}
+.logging .stats{
+	margin-right:10px;
+}
+.logging .stat-auth{
+	float:left;
+	display:inline;
+	margin:0 10px 0 0;
+	border-bottom:1px solid #9bcad0;
+	color:#999;
+	cursor:pointer;
+}
+.details .status .params{
+	float:right;
+}
+.params .memory,
+.params .t,
+.params .max-weight,
+.params .upload-weight{
+	float:left;
+	display:inline;
+	margin-right:25px;
+}
+.memory{}
+
+.memory dl{
+	overflow:hidden;
+	margin-bottom:2px;
+}
+
+.memory dt{
+	float:left;
+	width:15px;
+}
+.memory dd{
+	float:left;
+}
+.memory .usage{}
+
+.memory .usage .value{
+	float:left;
+	width:30px;
+}
+.memory .usage .divider{
+	padding-right:2px;
+}
+.memory .usage .max{
+	font-weight:bold;
+	border-bottom:1px solid #9bcad0;
+	cursor:pointer;
+}
+.memory .graph{
+	clear:both;
+	position:relative;
+	border:1px solid #ccc;
+	font-size:0;
+	line-height:0;
+}
+.memory .graph .bar{
+	position:relative;
+	display:block;
+	height:2px;
+}
+.critical .bar{
+	background-color:#f00;
+}
+.middle .bar{
+	background-color:#ff9934;
+}
+.low .bar{
+	background-color:#acd45a;
+}
+.params .upload-weight{
+	margin:0;
+}
+.t .value,
+.max-weight .value,
+.upload-weight .value{
+	border-bottom:1px solid #9bcad0;
+	cursor:pointer;
+}
+.item .close{
+	position:absolute;
+	top:30px;
+	right:20px;
+	display:block;
+	width:16px;
+	height:16px;
+	background:url(../i/sprite.png) no-repeat;
+	cursor:pointer;
+}
+.item .close:hover{
+	background-position:-16px 0;
+}
+*/
+/* row hover effect
+- - - - - - - - - - - - - - - - - - - */
+/*
+.domains .item:hover{
+	background-color:#ffffcb;
+}
+.item:hover .names .primary{
+	cursor:pointer;
+	border-bottom:1px dotted #ccc;
+}
+.item:hover .logging .err-log,
+.item:hover .logging .log,
+.item:hover .logging .stats,
+.item:hover .memory dt,
+.item:hover .memory .divider,
+.item:hover .params .title{
+	color:#98bc65;	
+}
+.item:hover .logging .stat-auth,
+.item:hover .memory .max,
+.item:hover .t .value,
+.item:hover .max-weight .value,
+.item:hover .upload-weight .value{
+	color:#333;
+}
+*/
+/* Edit
+- - - - - - - - - - - - - - - - - - - */
+/*
+.edit{
+	position:relative;
+	clear:both;
+	margin:0 -20px;
+	padding:15px 20px 10px;
+	border-top:2px solid #999;
+	background-color:#ffffcb;
+}
+.change-ip-box{
+	margin:0 0 20px;
+}
+.edit .ip-details{
+	float:left;
+	margin-right:20px;	
+}
+.change-ip{
+	width:140px;
+	padding:3px 5px;
+	border:2px solid #9bcad0;
+	font-size:16px;
+} 
+.ip-details .created{
+	display:block;
+	margin:5px 0 0;
+	font-size:12px;	
+}
+.change-domain-name{
+	width:360px;	
+	padding:3px 5px;
+	border:2px solid #9bcad0;
+	font-size:16px;
+	font-weight:bold;
+}
+.edit .domain-name{
+	font-size:20px;
+	font-family:Georgia, "Times New Roman", Times, serif;
+	font-weight:normal;	
+	font-style:normal;
+	color:#000; /* radikal'no cherniy, da! *
+	white-space:nowrap;
+	line-height:2;
+}
+.change-logs-box{
+	float:left;
+	width:170px;
+	margin-right:50px;
+	padding-left:180px;
+}
+.ownership{
+	display:inline;
+	float:left;
+	width:160px;
+	margin:0 0 0 -180px;
+	font-size:12px;
+}
+.ownership .owner{
+	display:block;
+	font-size:16px;
+	font-weight:bold;
+	font-style:italic;
+}
+.change-logs{
+	padding-top:5px;
+}
+.change-logs label{
+	display:block;
+	margin:0 0 9px;
+}
+.change-logs .last{
+	margin:0;
+}
+.change-logs .title{
+	display:block;
+	float:left;
+	width:70px;
+	font-size:14px;
+}
+.change-logs .title b{
+	font-weight:bold;
+}
+.change-logs .checkbox{
+	margin:3px 0 0;
+	border:2px solid #9bcad0;
+}
+.change-logs .stat-auth{
+	position:relative;
+	top:-3px;
+	left:10px;
+	border-bottom:1px solid #9BCAD0;
+	cursor:pointer;
+}
+.change-memory{
+	float:left;
+	width:150px;
+	padding-top:5px;
+	font-size:14px;
+}
+.change-memory dl{
+	margin-bottom:13px;
+}
+.change-memory .value{
+	padding:0 5px;
+	font-style:italic;
+	font-weight:bold;
+	color:#6b930f;
+}
+.change-memory .amount{
+	margin-top:7px;
+}
+.change-memory .amount .max{
+	width:50px;
+	margin-left:10px;
+	padding:2px 5px;
+	border:2px solid #9bcad0;
+	text-align:right;
+}
+.change-memory .graph{
+	clear:both;
+	position:relative;
+	border:1px solid #9c9c82;
+	font-size:0;
+	line-height:0;
+}
+.change-memory .graph .bar{
+	position:relative;
+	display:block;
+	height:2px;
+}
+.change-params{
+	float:right;
+	font-size:14px;
+}
+.change-params li{
+	margin-top:5px;
+	overflow:hidden;
+}
+.change-params .title{
+	float:left;
+	width:165px;
+}
+.change-params .param-value{
+	width:30px;
+	margin-right:5px;
+	padding:1px 5px;
+	border:2px solid #9bcad0;
+	text-align:right;
+
+}
+.aliases{
+	position:relative;
+	padding-top:20px;
+	margin-bottom:20px;
+}
+.aliases .title{
+	float:left;
+	display:block;
+	margin-right:20px;
+	padding-top:3px;
+	font-size:17px;
+}
+.aliases .hint{
+	position:absolute;
+	top:-15px;
+	left:78px;
+	font-style:italic;
+	color:#999;
+}
+.aliases-list{
+	width:90%;
+	padding:3px 5px;
+	border:2px solid #9bcad0;
+	font-size:16px;
+}
+.buttons{}
+
+.buttons .apply{
+    width:auto;
+    overflow:visible;
+    padding:4px 20px 3px 17px;
+	background-color:#feff99;
+    border:1px solid #728b25;
+
+	font-family:"Lucida Grande", Tahoma, Arial, Verdana, sans-serif;
+    font-size:120%;
+    font-weight:bold;
+	text-transform:uppercase;
+
+    line-height:130%;
+    color:#6b9e05;
+	cursor:pointer;
+	
+	float:right;
+}
+.buttons .devider{
+	text-transform:uppercase;
+	float:right;
+	display:block;
+	line-height:24px;
+	margin:0 10px;
+}
+.buttons .cancel{
+	float:right;
+	width:auto;
+	height:20px;
+	padding:0;
+	border:0 none;
+	background:none;
+	color:#e09462;
+	text-decoration:underline;
+	cursor:pointer;
+}
+.hidden{
+	display:none;
+}
+.edit .iSelected{ /* descendant selector for more specific style context *
+	border-color:#59B4FF; /* blue border on focused input *
+	font-weight:bold;
+}
+.edit .not-valid{ /* descendant selector for more specific style context *
+	border-color:#f00; /* RED border on error field *
+}
+
+.edit .edit-help{
+	padding-bottom:1px;
+	font-family:Arial, Helvetica, sans-serif;
+	font-size:14px;
+	color:#a0a094;
+	text-decoration:none;
+	text-transform:uppercase;
+	border-bottom:1px solid #b5b59b;
+}
+.edit .delete{
+	position:absolute;
+	top:15px;
+	right:25px;
+	padding:3px 25px 3px 2px;
+	font-family:Arial, Helvetica, sans-serif;
+	font-size:14px;
+	color:#a0a094;
+	text-transform:uppercase;
+	background:url(../i/delete.gif) no-repeat 100% 50%;
+	cursor:pointer;
+}
+.edit .delete .title{
+	padding-bottom:1px;
+	border-bottom:1px solid #b5b59b;
+}
+*/
+
+/* IP list 
+- - - - - - - - - - - - - - - - - - - - */
+#content{
+	padding-bottom:0;
+}
+.ip-list{}
+
+	.row{
+		padding:6px 10px 26px 10px;
+/*		min-height:125px;
+		min-height:110px;*/		
+		background:url(../i/long-dotted-bg.gif) repeat-x;
+	}
+	.first-row{
+		padding-top:11px;
+		background-image:none;
+	}
+		.row-meta{
+			float:left;
+			width:150px;
+		}
+		.row-details{
+			margin-left:150px;
+/*			background:#e0e0e0;*/
+		}
+		.row-actions-box{}
+		
+		.row-actions-box .check-this,
+		.row-actions-box .check-control{
+			float:left;
+			width:10px;
+			height:10px;
+			margin-top:4px;
+/*			background:url(../i/logging-status-sprite.png) no-repeat;
+			background:url(../i/check-row-sprite.png) no-repeat;*/
+			background:url(../i/check-row-sprite_.png) no-repeat;
+		}
+		.row-actions-box .check-control:hover{
+			cursor:pointer;
+			background-position:0 -89px;
+		}		
+		.row-actions-box .row-operations{
+			float:right;
+		}
+		.ip-status-info{
+			position:relative;
+			display:block;
+			float:left;
+			/*margin-right:25px;*/
+			padding-right:15px;
+			font-size:12px;
+			}
+			.ip-status-info .ip-status-text{
+				visibility:hidden;
+			}
+			.row .ip-suspended-status{
+				margin:0;
+				background:url(../i/suspended-ico.png) no-repeat 100% 65%;
+				}
+				.row .ip-suspended-status .ip-status-text{
+					text-transform:uppercase;
+					color:#333;
+					font-size:10px;
+					visibility:visible;
+				}
+		.delete-entry{
+			position:relative;
+			top:2px;
+			display:block;
+			float:left;
+			padding-right:15px;
+			font-size:11px;
+			text-transform:uppercase;			
+			}
+			.delete-entry .delete-entry-text{
+				visibility:hidden;
+			}
+		.entry-created{
+			padding-top:7px;
+			font-size:11px;
+			color:#6f6f6f;
+		}
+		.props-main{
+			float:left;
+			width:425px;
+/*			background:#eee;*/
+			}
+			.props-main .prop-box{
+				margin-bottom:15px;
+			}
+
+		.props-additional{
+			float:left;
+			width:200px;
+			padding:5px 10px 0 0;
+/*			background:#ccc;*/
+		}
+		.props-ext{
+			float:right;
+			width:120px;
+			padding-top:5px;
+/*			background:#d5d5d5;*/
+		}
+		.ip-adr-box,
+		.user-wrap{
+			margin:0 0 5px;			
+		}
+		.ip-adr{
+			display:-moz-inline-stack;
+			display:inline-block;
+			vertical-align:top;
+
+			font-size:22px;
+			line-height:1;
+			font-weight:normal;
+			letter-spacing:0.5px;
+		}
+		.ip-adr:active,
+		.ip-adr:focus{
+			color:#9fb749;
+		}
+		.ip-adr .dot{
+			padding:0 3px;
+		}
+		.ip-list .ip-adr{
+			border-bottom:1px solid #fff;
+		}
+		.username-box .user{
+			display:-moz-inline-stack;
+			display:inline-block;
+			vertical-align:top;
+
+			margin-right:10px;
+			}
+			.username-box .nickname{
+				display:-moz-inline-stack;
+				display:inline-block;
+				vertical-align:top;
+				margin-right:5px;
+				
+				font-size:20px;
+				line-height:25px;
+				font-family:Arial, Helvetica, sans-serif;
+				color:#000;
+
+			}
+			.username-box .role{
+				display:-moz-inline-stack;
+				display:inline-block;
+				vertical-align:top;
+
+				position:relative;
+				top:2px;
+				
+				font-size:12px;
+				line-height:25px;
+				color:#777;
+			}
+
+		.prop-box{
+			display:-moz-inline-stack;
+			display:inline-block;
+			vertical-align:top;
+
+			min-width:40%;
+/*			width:auto !important;
+			width:40%;*/
+			margin:0 0 3px;
+			font-size:10px;
+			}
+			.prop-title{
+				text-transform:uppercase;
+				color:#9c9c9c;
+				font-size:9px;
+				line-height:15px;
+			}
+			.prop-value{
+				padding-left:3px;
+				font-size:12px;
+				color:#777;
+			}
+			.prop-value-collapsed-childs{
+				padding-right:15px;
+				background:url(../i/group-values-collapsed.png) no-repeat 100% 5px;
+				cursor:pointer;
+			}
+			.show-records{
+				display:inline-block;
+				padding-right:15px;
+				border-bottom:1px solid #c9cabc;
+				background:url(../i/show-records-ico.png) no-repeat 100% 50%;
+				text-transform:uppercase;
+				line-height:13px;
+				cursor:pointer;
+			}
+			.hide-records{
+				display:inline-block;
+				padding-right:15px;
+				border-bottom:1px solid #c9cabc;
+				background:url(../i/hide-records-ico.png) no-repeat 100% 50%;
+				text-transform:uppercase;
+				line-height:13px;
+				cursor:pointer;				
+			}
+
+			.prop-box_group-values{
+				display:block;
+				}
+				.prop-box_group-values .prop-title{
+					float: left;
+					margin:2px 0 0;
+				}
+				.prop-box_group-values .group-values{
+					float:left;
+					margin-left:3px;
+				}
+				.group-values .prop-value{
+					display:block;
+				}
+				.group-values__bullet .prop-value{
+					padding-left:15px;
+					background:url(../i/group-value-bullet.png) no-repeat 5px 8px;
+				}
+				.group-values .group-switcher{
+					padding-right:15px;
+					background:url(../i/group-values-collapsed.png) no-repeat 100% 4px;
+				}
+				.group-values .group-values-count{
+					font-size:12px;
+					font-style:italic;
+					color:#cdcdcd;
+					border-bottom:1px solid #c9cac4;
+					cursor:pointer;
+				}
+			
+		.props-additional .owner-box{
+			padding-left:45px;
+			}
+			.props-additional .owner-box .prop-title{
+				float:left;
+				display:inline;
+				margin:2px 0 0 -45px;
+			}
+			.props-additional .owner-box .prop-value{
+				padding:0;
+			}			
+
+		.ip-list .row{
+			padding-bottom:24px;
+		}
+		.ip-list .row-details{
+			padding-top:9px;
+		}
+		.ip-list .entry-created{
+			padding-top:16px;
+		} 
+		.ip-list .ip-name-box{
+			margin:0;
+		}
+		
+		
+/* Entry adding form
+- - - - - - - - - - - - - - - - - - - */
+.b-new-entry{
+	margin-top:25px;
+	border-style:solid;
+	border-width:2px 1px 1px;
+	border-color:#999 #ccc #ccc #ccc;
+	
+	background-color:#ffffcb;
+	}
+	.b-new-entry .entry-header{
+		margin:0 0 10px;
+		padding:8px 15px 9px;
+		border-bottom:1px solid #dcdbab;
+		font-size:16px;
+		font-family:Georgia, "Times New Roman", Times, serif;
+		text-transform:uppercase;
+		color:#747668;
+	}
+	.b-new-entry .form-row{
+		position:relative;
+		padding:10px 15px;
+	}
+	.b-new-entry .field-label,
+	.b-new-entry .row-header{
+		float:left;
+		width:180px;
+		font-size:15px;
+		line-height:2;
+		color:#3d504a;
+	}
+	.b-new-entry .text-field{
+		float:left;
+		width:265px;
+		margin:0 15px 0 0;
+		padding:6px 7px;
+		border:2px solid #b8c2c3;
+		background:#fff;
+		color:#555;
+		font-family:Arial, Helvetica, sans-serif;
+		font-size:14px;
+		font-weight:bold;
+	}
+	/* for highlighting required fields */
+	.b-new-entry .rule-required{
+	}
+	/* for highlighting disabled fields */
+	.b-new-entry .disabled{
+		border-color:#FFFFCB;
+		background:#FFFFCB;
+	}
+	.b-new-entry .mandatory{
+		padding-right:5px;
+		background:url(../i/asterisk2.png) no-repeat 100% 2px;
+	}
+	
+	.b-new-entry .field-label .remark{
+		position:relative;
+		top:-14px;
+		display:block;
+		font-style:italic;
+		font-size:14px;
+		color:#a3a590;
+	}
+	
+	.b-new-entry .custom-select{}
+	
+	.b-new-entry .textarea{
+		width:685px;
+		height:100px;
+		padding:6px 7px;
+		border:2px solid #b8c2c3;
+		background:#fff;
+		color:#555;
+		font-family:Arial, Helvetica, sans-serif;
+		font-size:14px;
+		font-weight:bold;
+	}
+	.b-new-entry .text-field:focus,
+	.b-new-entry .textarea:focus{
+		-moz-box-shadow:0 0 8px rgba(82, 168, 236, 0.5);
+		-webkit-box-shadow:0 0 8px rgba(82, 168, 236, 0.5);
+		border-color:rgba(82, 168, 236, 0.75) !important;
+		color:#333;
+	}	
+		
+	.b-new-entry .ssl-crtfct-box .textarea{
+		margin:10px 0 0;
+	}	
+	.b-new-entry .select{
+		position: absolute;
+		top:auto;
+		left:195px;
+		width: 195px;
+		height: 28px;
+		padding: 0 24px 0 8px;
+		color: #333;
+		font:bold 14px/28px arial,sans-serif;
+		background:#fff url(../i/select-arrow-2011-12-18.png) no-repeat 100% 50%;
+		overflow: hidden;
+		border:2px solid #b8c2c3;
+	}
+	.b-new-entry select.styled{
+		top:10px;
+	}
+	.b-new-entry option{
+		font:14px arial,sans-serif;
+	}
+	.b-new-entry .form-options-group{}
+	
+	.b-new-entry .group-header{
+		margin:12px 25px 12px 15px;
+		text-transform:uppercase;
+		color:#9c9c9c;
+		font-size:11px;
+		line-height:15px;
+		height:16px;
+		background:url(../i/dotted.gif) repeat-x 0 50%;
+		}
+		.b-new-entry .group-title-outer{
+			display:inline-block;
+			width:165px;
+			padding:0 15px 0 0;
+			line-height:16px;
+			text-align:right;			
+			background:#ffffcb;
+		}
+		.b-new-entry .group-title-inner{
+			padding:2px 13px 2px 0;
+		}
+		.b-new-entry .group-title{
+			border-bottom:1px solid #FFFFCB;		
+		}
+		.b-new-entry .expanded .group-title-inner{
+			background:#ffffcb url(../i/form-group-expanded.png) no-repeat 100% 50%;
+		}
+		.b-new-entry .collapsed .group-title-inner{
+			background:#ffffcb url(../i/form-group-collapsed.png) no-repeat 100% 50%;		
+		}		
+		.b-new-entry .group-header:hover{
+			cursor:pointer;		
+		}
+		.b-new-entry .group-header:hover .group-title,
+		.b-new-entry .group-header .group-title:hover{
+			color:#000;
+			border-bottom-color:#9fb35a;
+		}
+		.b-new-entry .group-header .group-title:active{
+			color:#4B9427;
+		}
+		
+		.b-new-entry .mail-options-group{
+			margin-bottom:27px;
+			}
+			.b-new-entry .mail-options-group .form-row{
+				padding-bottom:0;
+			}
+		
+	.b-new-entry .delete-record{
+		display: block;
+		position:relative;
+		top:11px;
+		float: left;
+		width: 11px;		
+		height: 11px;
+		background: url(../i/delete-ico-off.png) no-repeat;
+		}
+		.b-new-entry .delete-record:hover{
+			cursor:pointer;
+			background-image:url(../i/delete-ico.png);
+		}
+		.b-new-entry .delete-record:active{
+			cursor:pointer;
+			background-image:url(../i/delete-ico-active.png);
+		}
+		
+	
+	.b-new-entry .checkbox{
+		display:block;
+		float:left;
+		width:18px;
+		height:18px;
+		margin:6px 0 0;
+		/*background:url(../i/checkbox-1.png) no-repeat;*/
+		background:url(../i/form-checkboxes.png) no-repeat;
+	}
+	.b-new-entry .checkbox:hover{
+		background-position:0 -100px;
+	}	
+	.b-new-entry .stats-settings{
+		padding-left:40px;
+	}
+	.b-new-entry .db-credentials .field-label{
+		text-indent:40px;
+	}
+	/*.b-new-entry .pwd-box .text-field{
+		float:left;
+		margin:0 15px 0 0;
+	}*/
+	.b-new-entry_user .lastname-box{
+		margin-bottom:30px;
+	}
+	.b-new-entry_dns .dns-template-box .styled{
+		float:left;
+		margin:0 40px 0 0;
+		margin:0 20px 0 0;		
+		width:230px;
+		cursor:pointer;
+	}
+	.b-new-entry_dns .ttl-field{
+		width:75px;
+	}
+	.generate-pwd,
+	.context-settings{
+		position:relative;
+		top:10px;
+		float:left;
+		display:block;
+		color:#5ea2a1;
+		border-bottom:1px solid #cdcea6;
+		text-transform:uppercase;
+		cursor:pointer;
+		
+		font-size:11px;
+		line-height:1;
+		letter-spacing:0.5px;
+	}
+	.generate-pwd:hover,
+	.context-settings:hover{
+		color:#575757;
+		border-bottom-color:#b4c775;
+	}
+	.generate-pwd:active,
+	.context-settings:active{
+		color:#b4c775;	
+	}
+
+	.b-new-entry .add-ns{
+		display:-moz-inline-stack;
+		display: inline-block;
+		zoom: 1;
+		*display: inline;
+
+		margin:0 0 7px 180px;
+		font-family:Georgia, "Times New Roman", Times, serif;
+		font-size:14px;
+		line-height:1;
+		text-transform:uppercase;
+		color:#66685d;
+		text-decoration:none;
+		}
+		.add-ns .icon{
+			float:left;
+			display:block;
+			width:11px;
+			height:11px;
+			margin:2px 5px 0 0;
+			background:url(../i/add-entry-plus.gif) no-repeat;	
+			font-size:0;
+			line-height:0;	
+		}
+		.add-ns .btn-title{
+			display:inline-block;
+			border-bottom:1px solid #b5c968;
+			}		
+			.add-ns .btn-title:hover{
+				color:#000;
+				border-bottom-color:#b85152;
+			}
+			.add-ns .btn-title:active{
+				color:#b85152;
+				border-bottom-color:#000;
+			}
+	
+	
+	.b-new-entry .buttons-row{
+		position:relative;
+		margin-top:13px;
+		padding:8px 15px 8px 195px;
+		border-top:1px solid #dcdbad;
+		background:url(../i/form-bottom-bg.png) repeat-x;
+	}
+/*	.b-new-entry .help-btn{
+		position:absolute;
+		top:13px;
+		right:20px;		
+		font-size:11px;
+		line-height:12px;
+		color:#b4b39f;
+		text-transform:uppercase;
+		cursor:pointer;
+		border-bottom:1px solid #b4b39f;
+		text-decoration:none;
+		}
+		.b-new-entry .help-btn:hover{
+			color:#000;
+			border-bottom-color:#9fb35a;
+		}
+		.b-new-entry .help-btn:active{
+			color:#4B9427;
+		}
+*/
+
+	.b-new-entry .cancel-btn{
+
+		display:-moz-inline-stack;
+		display: inline-block;
+		zoom: 1;
+		*display: inline;
+		
+		margin-left:30px;
+		font-size:12px;
+		line-height:1;
+		font-weight:bold;
+		
+		text-transform:uppercase;
+		color:#2ca9bd;
+		cursor:pointer;
+		border-bottom:1px solid #2ca9bd;
+		}
+		.b-new-entry .cancel-btn:hover{
+			color:#999;
+			border-bottom-color:#999;
+		}
+		.b-new-entry .cancel-btn:active{		
+			color:#fc0;
+			border-bottom-color:#fc0;
+		}
+		
+	.b-new-entry .delete-btn{
+		position:absolute;
+		top:15px;
+		right:16px;
+		
+		font-size:12px;
+		line-height:14px;
+		text-transform:uppercase;
+		color:#333;
+		letter-spacing:2px;
+		cursor:pointer;
+		border-bottom:1px solid #ff6766;
+		}
+		.b-new-entry .delete-btn:hover{
+			color:#ff6766;
+		}
+		.b-new-entry .delete-btn:active{		
+			color:#fc0;
+			border-bottom-color:#fc0;
+		}
+
+		
+	.b-new-entry .add-entry-btn{
+		overflow:visible;
+		height:28px;
+		padding:0 50px;
+		-webkit-border-radius:9px;
+		-moz-border-radius:9px;
+		border-radius:9px;
+		border:2px solid #c8c09c;
+		background-color:#feff99;
+		color:#444428;
+		font-size:14px;
+		font-family:Arial, Helvetica, sans-serif;
+		font-weight:bold;
+		line-height:25px;
+		text-transform:uppercase;
+		cursor:pointer;
+		}
+		.b-new-entry .add-entry-btn:focus{
+			position:relative;
+			top:1px;
+		}
+		.b-new-entry .add-entry-btn:hover{
+			background-color:#feff77;
+			color:#464322;
+			border-color:#9e977b;
+		}
+		.b-new-entry .add-entry-btn:active{
+			background-color:#928d7a;
+			color:#fefe9e;
+			border-color:#87826e;
+		}
+		.b-new-entry .autocomplete-box{
+			position:relative;
+			float:left;
+			padding-right:35px;
+			background:#fff;
+			}
+			.b-new-entry .autocomplete-box .text-field{
+				width:213px;
+				margin:0;
+			}
+			.b-new-entry .autocomplete-box .arrow{
+				position:absolute;
+				top:0;
+				right:0;
+				display:block;
+				width:32px;
+				height:32px;
+				font-size:0;
+				line-height:0;
+/*				background:#fff url(../i/select-arrow.png) no-repeat 100% 50%;*/
+				background:#fff url(../i/autocomplete-field-arrows-sprite.png) no-repeat;
+				cursor:pointer;
+			}
+			.b-new-entry .autocomplete-box .arrow:hover,
+			.b-new-entry .autocomplete-box .arrow:active,
+			.b-new-entry .autocomplete-box .arrow:focus{
+				background-position:0 -32px;
+			}
+		.b-new-entry .disabled-box,
+		.b-new-entry .disabled-box .text-field{
+			background:#FFFFCB;
+			border-color:#FFFFCB;
+			}
+			.b-new-entry .disabled-box .arrow{
+				display:none;
+			}
+		
+		.b-new-entry .form-error{
+			position:relative;
+			margin:-5px 5px 5px;
+			padding:8px 15px;
+			border:1px solid #dcdbad;
+			background:url(../i/form-bottom-bg.png) repeat-x;
+			}
+			.form-error .error-box{
+				padding-left:18px;
+				background:url(../i/error-bullet.png) no-repeat 0 50%;
+			}
+			.form-error .error-box .error-message{
+				color:#9a32ff;
+				font-size:16px;
+				line-height:22px;
+			}
+			.form-error .error-box .help-tip-url{
+				position:relative;
+				top:-1px;
+				font-size:12px;
+				line-height:15px;
+				color:#b4b39f;
+				text-transform:uppercase;
+				text-decoration:none;
+				cursor:pointer;
+				border-bottom:1px solid #b4b39f;
+				}
+				.b-new-entry .help-tip-url:hover{
+					color:#000;
+					border-bottom-color:#9fb35a;
+				}
+
+	.b-new-entry_cron{}
+	
+	.b-new-entry_cron .form-row{
+		padding-top:7px;
+		padding-bottom:5px;		
+	}
+	.b-new-entry_cron .run-at-box{
+		padding-bottom:7px;
+	}
+	.b-new-entry_cron .run-at-box .row-header{
+		margin-top:35px;
+	}
+	.b-new-entry_cron .form-row-line .field-box{
+		margin-right:14px;
+	}
+	.b-new-entry_cron .form-row-line .cron-week-box{
+		margin:0;
+	}	
+	.b-new-entry_cron .form-row-line .field-label{
+		display:block;
+		float:none;
+		width:auto;
+		line-height:1;
+		padding:0 0 8px;
+		color:#7d7d7d;
+
+		font-size:13px;
+	}
+	.b-new-entry_cron .form-row-line .text-field{
+		width:112px;
+		margin:0;
+	}
+	.b-new-entry_cron .form-row-line .cron-week-box	.text-field{
+		width:109px;
+		margin:0;		
+	}
+	.b-new-entry_cron .textarea{
+		height:60px;
+	}
+
+
+	.b-new-detailed-restore{}
+	
+	.b-new-detailed-restore .add-entry-btn{
+		padding:0 30px;
+	}
+/*	
+	.b-new-detailed-restore .cancel-btn{
+		left:auto;
+		right:16px;
+	}
+*/
+	
+/* Show/edit dns records form
+- - - - - - - - - - - - - - - - - - - */
+.b-records-list{
+	margin-left:160px;
+	}
+	.b-records-list .entry-header{
+		padding-top:6px;
+		padding-bottom:11px;	
+		} 
+		.b-records-list .hide-records{
+			font-size:10px;
+			font-family:Arial, Helvetica, sans-serif;
+			line-height:13px;
+		}
+	.b-records-list .add-btn{
+		margin:0;
+		float:none;
+	}
+	.b-records-list .form-row{
+		padding-top:5px;
+		padding-bottom:5px;
+	}
+	.b-records-list .add-box{
+		padding-bottom:15px;
+	}
+	.b-records-list .buttons-row{
+		margin-top:20px;
+	}
+	.form-row-line{
+		position:relative;
+	}
+	.form-row-line .field-box{
+		float:left;
+	}
+	.form-row-line .field-devider{
+		float:left;
+		display:block;
+		min-height:30px;
+		margin:0 15px;
+		font-size:15px;
+		line-height:2;
+	}
+	.b-records-list .form-row-line .field-label{
+		float:none;
+		display:block;
+		width:auto;
+		line-height:20px;
+	}
+	.b-records-list .dns-record-box .text-field{
+		width:147px;
+		float:left;
+		margin:0;
+	}
+	.b-records-list .dns-type-box{
+		margin-right:15px;
+	} 
+	.b-records-list .dns-type-box .select{
+		width:51px;
+		left:221px;
+	}
+	.b-records-list .dns-type-box select.styled{
+		width:87px;
+		cursor:pointer;
+	}
+	.b-records-list .dns-value-box .text-field{
+		float:none;
+		width:390px;
+		margin:0;
+	}	
+	.b-records-list .delete-record{
+		position:absolute;
+		top: auto;
+		bottom:15px;
+		right:11px;
+		display:block;
+		float:left;
+		width:11px;
+		height:11px;
+		background:url(../i/delete-ico-off.png) no-repeat;
+	}
+
+
+/* Web-domains list
+- - - - - - - - - - - - - - - - - - - */
+.domains-list{}
+	
+	.domains-list .entry-created{
+		padding-top:9px;
+	}
+	.names{
+		margin:0 0 6px;
+		color:#acacac;
+		}
+		.names .alias-title{
+			position:relative;
+			top:-1px;
+			padding-right:3px;
+			padding:0 3px 0 25px;
+			font-size:11px;
+			line-height:18px;
+			text-transform:uppercase;
+		}
+		.names .domain-name{
+			position:relative;
+			top:-1px;
+			padding:0 3px 0 0;
+			font-size:12px;	
+			line-height:1.5;
+			color:#acacac;	
+			white-space:nowrap;
+		}
+		.row-details .names .primary{ 
+			top:0;
+/*			padding:0 25px 0 0;*/
+			font-size:20px;
+			font-family:Arial, Helvetica, sans-serif;
+			font-weight:normal;	
+			font-style:normal;
+			color:#000; /* radikal'no cherniy, da! */
+		}
+		.names .primary:active{
+			color:#9fb749;			
+		}
+		.domains-list .names .primary,
+		.dns-list .names .primary{
+			border-bottom:1px solid #fff;
+		}
+		
+	.domains-list .props-main{
+		width:345px;
+		}	
+		.domains-list .ip-adr{
+			font-size:16px;
+			color:#888;
+		}
+		.domains-list .ip-adr-box .prop-box{
+			margin-left:20px;
+			}
+
+	.domains-list .props-additional{
+		width:230px;
+		padding-top:0;
+/*		background:#bbb;*/
+	}
+	.domains-list .props-ext{
+		width:170px;
+		padding-top:0;
+/*		background:#ddd;*/
+	}
+	
+.b-usage-box{
+	display:block;
+}
+
+	.b-usage-box .prop-title{
+		float:left;
+		margin:2px 15px 0 0;
+	}
+	.b-usage-box .usage-box{
+		float:left;
+		width:136px;
+	}
+	.b-usage-box .usage-box{
+
+	}
+	.b-usage-box .value-box{
+		float:left;
+		width:75px;
+	}
+	.b-usage-box .max-size{
+		float:right;
+	}
+	.b-usage-box .value{
+		display:block;
+		font-size:11px;
+		line-height:1;
+		color:#999;
+	}
+	.b-usage-box .max-size{
+		position:relative;
+		top:2px;
+		font-size:14px;
+		line-height:1;
+		color:#ababab;
+	}
+	.b-usage-box .max-size .units{
+		font-size:12px;
+		color:#797979;
+	}
+	.graph{
+		position:relative;
+		border:1px solid #b7b7b9;
+		font-size:0;
+		line-height:0;
+		}
+		.graph .bar{
+			position:relative;
+			display:block;
+			height:2px;
+		}
+		.critical .bar{
+			background-color:#f00;
+		}
+		.middle .bar{
+			background-color:#ff9934;
+		}
+		.low .bar{
+			background-color:#9fec00;
+		}
+
+/* New graphs */
+.b-stats-box{
+	position:relative;
+	margin-left:-25px;
+	padding-left:25px;
+	background:url(../i/stats-brace.png) no-repeat 0 50%;
+	}
+	.stats-box-title{
+		position:absolute;
+		top:50%;
+		left:-65px;
+		margin-top:-10px;
+		padding-right:25px;		
+		text-transform:uppercase;
+		font-size:9px;
+		line-height:12px;
+		background:url(../i/stats-curve.png) no-repeat 100% 50%;
+		color:#acacac;
+		/*border-bottom:1px solid #acacac;*/
+	}
+.b-usage-box2{
+	display:block;
+	margin:0 0 22px;
+	position:relative;
+	}
+	.b-usage-box2 .prop-title{
+		float:left;
+		margin:2px 15px 0 0;
+	}
+	.b-usage-box2 .usage-box{
+		float:left;
+	}
+	.b-usage-box2 .value-box{
+		padding-top:11px;
+		float:left;
+		width:85px;
+	}
+	.b-usage-box2 .max-size{
+		position:relative;
+		top:11px;
+		float:right;
+		padding:7px 0 0 3px;
+		border-left:1px solid #B7B7B9;
+		font-size:10px;
+		line-height:1;
+		color:#acacac;
+	}
+	.b-usage-box2 .max-size .units{
+		font-size:10px;
+		color:#acacac;
+	}
+	.b-usage-box2 .graph{
+		position:relative;
+		border:solid #b7b7b9;
+		border-width:1px 0 1px 1px;
+		font-size:0;
+		line-height:0;
+		}
+		.b-usage-box2 .value{
+			position:absolute;
+			top:-15px;
+			left:0;
+			z-index:10;
+			display:block;
+			white-space:nowrap;
+			padding:0 0 7px 3px;
+			font-size:11px;
+			line-height:1;
+			background:url(../i/bar-value-mark.png) no-repeat 0 100%;
+			color:#797979;
+			}
+			.b-usage-box2 .value-size{
+				padding-left:3px;			
+			}		
+		.b-usage-box2 .graph .bar{
+			position:relative;
+			display:block;
+			height:2px;
+			background-color:#9fec00;
+		}
+
+	/* Overdraft */
+	.b-usage-box2 .overdraft{}
+		
+		.b-usage-box2 .overdraft .value{
+			margin-left:-1px;
+			color:#F00;
+		}
+		
+		.b-usage-box2 .bar_overdraft{
+			position:absolute;
+			top:-1px;
+			z-index:5;
+			display:block;
+			height:2px;
+			border:solid #b7b7b9;
+			border-width:1px 0;
+			background:#ff9934 url(../i/overrun-border.png) no-repeat 100% 0; 	
+		}		
+
+	
+.domains-list .disk-usage{
+	margin:0 0 6px;
+}
+.domains-list .props-additional .prop-box,
+.domains-list .props-ext .prop-box{
+	display:block;
+	margin:0;
+	}		
+	.stats-box{}
+		
+		.stats-box .stats-auth{
+			position:relative;
+			top:3px;
+			display:-moz-inline-stack;
+			display:inline-block;
+			vertical-align:top;
+			
+			margin:0 0 0 5px;
+			padding:0 0 0 10px;
+			font-size:12px;
+			line-height:1.5;
+			color:#777;
+			cursor:pointer;
+		}
+		.stats-box .stats-auth-on{		
+			background:url(../i/auth-plus.png) no-repeat 0 60%;		
+		}
+		.stats-box .stats-auth-text{
+			display:block;
+			line-height:11px;
+			border-bottom:1px solid #cacbbd;		
+		}
+		
+	.nginx-box{}
+		
+		.nginx-box .nginx-ext-list{
+			position:relative;
+			top:3px;
+			display:-moz-inline-stack;
+			display:inline-block;
+			vertical-align:top;
+	
+			margin:0 0 0 5px;
+			border-bottom:1px solid #cacbbd;
+			font-size:12px;
+			line-height:1;
+			color:#777;
+			cursor:pointer;
+		}
+	.template-box{}
+	
+		.template-box .prop-value{
+			padding:0;
+			cursor:pointer;
+			border-bottom:1px solid #cbcbbf;
+		}
+
+/* DNS list
+- - - - - - - - - - - - - - - - - - - */		
+.dns-list{}
+
+	.dns-list .row-details{
+		padding-bottom:2px;	
+	}
+	.dns-list .entry-created{
+		padding-top:9px;
+	}
+	.dns-list .props-main{
+		width:295px;
+	}
+	.dns-list .props-additional{
+		width:200px;
+	}	
+	.dns-list .props-ext{
+		width:250px;
+	}
+.dns-list .props-additional .prop-box,
+.dns-list .props-ext .prop-box{
+	display:block;
+	margin:0;
+	}	
+.dns-list .ip-adr-box{
+	margin:0;
+	}
+	.dns-list .ip-adr{
+		font-size:12px;
+		line-height:1.5;
+		color:#777;
+	}
+	
+/* Cron list
+- - - - - - - - - - - - - - - - - - - */		
+.cron-list{}
+	
+	.cron-list .row{
+		padding-bottom:24px;
+	}
+	
+	.cron-list .entry-created{
+		padding-top:8px;
+	}
+	.cron-list .cron-meta{
+		margin:-9px 0 9px;
+	}
+	.cron-meta .prop-box{
+		min-width:0;
+		}
+		.cron-meta .prop-title{
+			display:block;
+			text-transform:none;
+			font-size:10px;
+		}
+		.cron-meta .prop-value{
+			padding:0;
+			font-size:16px;
+			color:#7c7c7c;
+		}
+		.cron-meta .cron-min,
+		.cron-meta .cron-hour,
+		.cron-meta .cron-day,
+		.cron-meta .cron-week,
+		.cron-meta .cron-month{
+			min-width:45px;
+			padding-right:20px;
+		}		
+
+	.cron-command-box{
+		margin:0 0 5px;
+		}
+		.cron-command-line{
+			position:relative;
+			padding:0 3px 0 0;
+			font-family:Arial, Helvetica, sans-serif;
+			font-size:20px;
+			line-height:1.5;
+			font-weight:normal;	
+			font-style:normal;
+			color:#000;
+
+		}
+		.cron-command-line:active{
+			color:#9fb749;			
+		}
+		.cron-list .cron-command-line{
+			border-bottom:1px solid #fff;
+		}
+
+	.cron-reported-to{}
+	
+		.cron-reported-to .prop-box{
+			margin:0;
+		}
+		.cron-reported-to .prop-title{
+			padding-right:3px;
+		}
+		.cron-reported-to .prop-value{
+			padding:0 3px 0 0;
+		}
+		
+/* Users list
+- - - - - - - - - - - - - - - - - - - */		
+.users-list{}
+
+	.users-list .row{
+		padding-bottom:17px;
+	}
+	.users-list .row-details{
+		padding-top:3px;
+	}
+	.users-list .entry-created{
+		padding-top:10px;
+	}
+	.users-list .user-wrap{
+		margin:0 0 19px;
+	}
+	.users-list .props-main{
+		width:345px;
+		width:330px;
+		}
+		.users-list .username-box{
+			padding-top:6px;
+			margin:0 0 15px;
+		}
+		.users-list .username-box .user{
+			position:relative;
+			top:-6px;
+		}
+		.users-list .username-box .nickname{
+			border-bottom:1px solid #fff;
+		}
+	
+	.user-backups-box{
+		margin-top:5px;
+		}
+		.user-backups-box .prop-title{
+			border-bottom:1px solid #CBCBBF;
+			font-size:12px;
+			text-transform:capitalize;
+			cursor:pointer;
+			color:#777;
+		}	
+
+	.users-list .props-additional{
+		width:200px;
+		width:225px;
+		}
+		.users-list .props-additional .prop-box,
+		.users-list .props-ext .prop-box{
+			display:block;
+		}
+		.users-list .props-additional .ns1-box,
+		.users-list .props-additional .ns2-box{
+			padding-left:27px;
+		}
+		.users-list .webtpl-box .group-switcher,
+		.users-list .ns-list-box .group-switcher{
+			padding-left:15px;
+		}
+		.users-list .props-additional .ns1-box .prop-title,
+		.users-list .props-additional .ns2-box .prop-title{
+			display: inline;
+			float: left;
+			margin: 2px 0 0 -27px;
+		}
+		.users-list .props-additional .ns1-box .prop-value,
+		.users-list .props-additional .ns2-box .prop-value{
+			padding:0;
+		}
+		
+	.users-list .props-ext{
+		width:190px;
+	}
+	
+	.users-list .db-box,
+	.users-list .dnsdomains-box{
+		margin-top:24px;
+	}
+	.users-list .backups-box{
+		margin:0;
+	}
+	
+	.username-box .prop-box{
+		position:relative;
+		margin:0;
+	}
+	.user-details{
+		font-size:12px;
+		}
+		.user-details .user-email{
+			color:#777;
+			padding-right:5px;
+		}
+		.user-details .user-reports{
+			color:#9c9c9c;
+		}
+		.user-details-box .prop-box{
+			margin:0 0 5px;
+		}
+		.user-details-box .user-name .prop-value,
+		.user-details-box .user-email{
+			font-style:italic;
+			color:#706f6b;
+		}
+	
+/* DB list
+- - - - - - - - - - - - - - - - - - - */		
+.db-list{
+	padding-top:6px;
+}
+
+	.db-list .first-row{
+		padding-top:5px;
+	}
+	.db-list .row-details{
+		padding-top:3px;
+		padding-bottom:2px;
+	}
+	.db-list .db-devider{
+		margin-top:15px;
+		position:relative;
+		display:block;
+		border-bottom:1px solid #e0e0e0;
+		}
+		.db-list .db-devider-title{
+			display:block;
+			position:absolute;
+			top:-8px;
+			left:-50%;
+			width:200%;
+			}
+			.db-list .db-devider-outer{
+				display:block;
+				position:absolute;
+				left:50%;
+			}
+			.db-list .db-devider-inner{
+				background:#fff;
+				position:relative;
+				left:-50%;
+				padding:0 10px;
+
+				font-size:11px;
+				font-weight:bold;
+				text-transform:uppercase;
+				color:#4097B3;
+			}
+			
+	.db-list .props-main{
+		width:210px;
+		padding-right:10px;
+	}
+	.db-list .props-additional{
+		width:340px;
+		padding-top:6px;
+	}
+	.db-list .props-ext{
+		width:185px;
+		padding-top:6px;		
+	}
+	.db-name{
+		position:relative;
+		margin:0 0 6px;
+		padding:0 3px 0 0;
+		}
+		.db-name-box .db-name{
+			font-size:20px;
+			font-family:Arial, Helvetica, sans-serif;
+			font-weight:normal;	
+			font-style:normal;
+			line-height:27px;
+		}
+		.db-name:active{
+			color:#9fb749;			
+		}
+		.db-list .db-name{
+			border-bottom:1px solid #fff;
+		}
+
+	.db-list .ownership .prop-box{
+		margin:9px 0 0;
+	}
+	.db-list .ownership .prop-value{
+		padding:0;
+		font-size:11px;
+		font-style:italic;
+	}
+	.db-list .entry-created{
+		padding:0;
+	}
+	.db-user-box{
+		margin:0 0 10px;
+	}
+	.db-user-box .db-user{
+		position:relative;
+		display:block;
+		float:left;
+		margin-right:25px;
+		padding-right:20px;
+
+		font-size:12px;
+		line-height:1.25; /*15px*/
+		font-style:italic;
+		color:#999;
+		}
+		.db-user-box .db-user:hover{
+			color:#f00;
+		}
+	.db-user-box .change-pwd{
+		position:relative;
+		top:1px;
+		display:inline-block;
+		border-bottom:1px solid #c9cabc;
+		text-transform:uppercase;
+		line-height:13px;
+		cursor:pointer;
+		visibility:hidden;
+	}
+	.add-db-user{
+		border-bottom:1px solid #c9cabc;
+		text-transform:uppercase;
+		line-height:13px;
+		padding-left:10px;
+		background:url(../i/auth-plus.png) no-repeat 0 50%;
+		color:#555;
+		cursor:pointer;
+	}
+	.backup-db{
+		float:left;
+		position:relative;
+		top:2px;
+		display:-moz-inline-stack;
+		display:inline-block;
+		vertical-align:top;
+	
+		border-bottom:1px solid #cacbbd;
+		font-size:12px;
+		line-height:13px;
+		color:#777;
+		cursor:pointer;
+	}
+	.db-list .b-usage-box{
+		float:right;
+		position:relative;
+		top:1px;
+		}	
+		.db-list .b-usage-box .usage-box{
+			width:auto;
+		}
+		.db-list .b-usage-box .value,
+		.db-list .b-usage-box .max-size{
+			color:#797979;
+		}
+		.db-list .b-usage-box .value-box{
+			width:60px;
+			margin-right:5px;
+		}
+		.db-list .b-usage-box .max-size{
+			float:left;
+		}
+		.db-list .b-usage-box .max-size .units{
+			color:#ABABAB;
+		}
+
+/* Backups list
+- - - - - - - - - - - - - - - - - - - */		
+.backups-list{}
+
+	.backups-list .row{
+		padding:25px 10px 15px;
+	}
+	.backups-list .ownership{
+		padding:5px 0 0;
+	}
+	.backups-list .props-main{
+		padding-top:5px;
+	}
+	.backups-list .props-main .prop-box{
+		margin:0;
+	} 
+	.backups-list .props-additional{
+		width:165px;
+		padding:4px 0 0;
+	}
+	.backups-list .props-ext{
+		width:165px;
+		padding:0;
+	}
+	.backups-list .entry-created{
+		width:185px;
+		padding:0;
+	}
+	.backups-list .backup-date,
+	.backups-list .backup-weekday{
+		display:-moz-inline-stack;
+		display:inline-block;
+		vertical-align:top;
+		}
+		.backups-list .backup-date .backup-day{
+			display:block;
+			width:105px;
+			font-size:14px;
+			font-family:Arial,Helvetica,sans-serif;
+			font-weight:bold;
+			line-height:20px;
+			color:#47443f;
+		}
+		.backups-list .backup-weekday{
+			padding-top:4px;
+			color:#408abb;
+		}
+		.backups-list .backup-time,
+		.backups-list .generation-time .prop-value{
+			font-size:10px;
+			color:#999;
+		}
+		.backups-list .generation-time .prop-value{
+			color:#9C9C9C;
+		}
+	
+	.backups-list .generation-time{
+		padding-top:4px;
+	}
+	.backups-list .backup-size{
+		display:-moz-inline-stack;
+		display:inline-block;
+		padding-right:12px;
+		
+		font-size:10px;
+		line-height:24px;
+
+		background:url(../i/green-bracket-l.png) no-repeat 0 50%;
+		color:#595959;
+	}
+	.backups-list .backup-size-inner{
+		display:-moz-inline-stack;
+		display:inline-block;
+
+		padding:0 10px;
+		background:url(../i/green-bracket-r.png) no-repeat 100% 50%;
+	}
+	.backups-list .backup-url,
+	.backups-list .backup-actions{
+		font-size:13px;
+		color:#999;
+	}
+	.backups-list .backup-actions{
+		background:#ccc;
+	}
+	.backups-list .backup-actions-url{
+		float:right;
+		display:-moz-inline-stack;
+		display:inline-block;
+		vertical-align:top;
+
+		-webkit-border-radius:9px;
+		-moz-border-radius:9px;
+		border-radius:9px;
+		
+		border:2px solid #fff;
+		color:#999;
+		line-height:26px;		
+		}
+		.backups-list .row a.backup-actions-url:hover{
+			padding:0 12px;
+
+			border-color:#c8c09c;
+			background-color:#feff99;
+			color:#444428;
+			font-size:14px;
+			font-family:Arial, Helvetica, sans-serif;
+			font-weight:bold;
+			cursor:pointer;
+			text-decoration:none;
+			text-transform:uppercase;			
+		}
+
+		.backups-list .detailed-restore-ext{
+			display:none;
+		}
+		
+		.backups-list a.detailed-restore-url:hover .detailed-restore-title{
+			text-transform:none;
+		}
+		.backups-list a.detailed-restore-url:hover .detailed-restore-ext{
+			display:inline-block;
+		}
+		
+	.backups-list .restore-url{
+		margin-left:10px;
+		color:#93b749;
+	}
+	
+	.backup-tree{
+		padding-left:130px;
+	}
+	
+	.backup-tree .backup-tree-item{
+		padding:0 0 7px 25px;
+		background:url(../i/backup-checkbox.png) no-repeat 0 .5em;
+	}
+	.backup-tree .unchecked{
+		background:url(../i/backup-checkbox-unchecked.png) no-repeat 0 .5em;
+	}
+	.backup-tree .checked{
+		background:url(../i/backup-checkbox-checked.png) no-repeat 0 .5em;
+	}
+	
+	.backup-tree .backup-sections,
+	.backup-tree .backup-sections .sub-tree{
+		padding:10px 0 0 25px;
+	}
+	
+	.backup-tree .node-item{
+		font-size:13px;
+		font-weight:bold;
+		padding-left:15px;
+		background:url(../i/backup-collapsed-ico.png) no-repeat 0 .3em;
+		border-bottom:1px dashed #cfd19f;
+		color:#5a6962;
+		cursor:pointer;
+		}
+		.backup-tree .node-item:hover{
+			color:#ffcf0b;
+		}
+		
+	.backup-tree .expanded{
+		background:url(../i/backup-expand-ico.png) no-repeat 0 .45em;
+	}
+	.backup-tree .backup-sections .sub-tree .node-item{
+		font-style:italic;
+		color:#abad85;
+		padding:0;
+		background:none;
+		border:none;
+		}
+		.backup-tree .backup-sections .sub-tree .node-item:hover{
+			color:#abad85;
+		}
+	
+	.backup-tree .backup-sections .sub-tree .checked .node-item{
+		color:#5a6962;
+		font-style:normal;	
+	}
+
+/* Highlighted backup row */
+.backup-details-row_highlighted,
+.backups-list .backup-details-row_highlighted:hover{
+	background:#666;
+	}
+	.backup-details-row_highlighted .notes-wrap{
+		font-size:14px;
+		line-height:25px;
+		font-weight:bold;
+		text-transform:uppercase;
+		color:#bad23e;
+		text-align:center;
+		padding:0 0 10px;
+	}
+	.backup-details-row_highlighted .restore-ico{
+		padding:4px 0 4px 30px;
+		line-height:25px;
+		background:url(../i/backup-restore-ico.png) no-repeat;
+	}
+	.backup-details-row_highlighted .backup-time{
+		color:#fff;
+	}
+	.backup-details-row_highlighted .ownership .prop-value{
+		color:#c8c8c8;
+	}
+	.backups-list .backup-details-row_highlighted .backup-day{
+		color:#fff;
+	}
+	.backups-list .backup-details-row_highlighted .backup-size{
+		color:#ccc;
+	}
+	.backups-list .backup-details-row_highlighted .backup-actions{
+		display:none;
+	}
+	
+/* row hover effect
+- - - - - - - - - - - - - - - - - - - */
+.row:hover{
+	background-color:#ffffcb;		
+}
+.ip-list .row:hover .ip-adr,
+.domains-list .row:hover .names .primary,
+.dns-list .row:hover .names .primary,
+.cron-list .row:hover .cron-command-line,
+.users-list .row:hover .username-box .nickname,
+.db-list .row:hover .db-name{
+	border-bottom-style:dashed;
+	border-bottom-color:#e5e5e5;
+	border-bottom-color:#bbb;	
+}
+.ip-list .row:hover .ip-adr:hover,
+.domains-list .row:hover .names .primary:hover,
+.dns-list .row:hover .names .primary:hover,
+.cron-list .row:hover .cron-command-line:hover,
+.users-list .row:hover .username-box .nickname:hover,
+.db-list .row:hover .db-name:hover{
+	cursor:pointer;
+	border-bottom-style:solid;
+	border-bottom-color:#b4c775;
+}
+.ip-list .ip-details-suspended:hover .ip-adr,
+.ip-list .ip-details-suspended:hover .ip-adr:hover{
+	border:none;
+	cursor:default;
+}
+.backups-list .row:hover .backup-actions-url{
+	border-color:#ffffcb;
+}
+
+.row:hover .ip-status-info{
+	background:url(../i/enabled-ico_.png) no-repeat 100% 50%;
+}
+.row:hover .delete-entry,
+.row:hover .db-user-box .db-user{
+	background:url(../i/delete-ico-off.png) no-repeat 100% 4px;
+}
+.row:hover .ip-suspended-status{
+	background:url(../i/suspended-ico.png) no-repeat 100% 65%;
+}
+.ip-status-info:hover .ip-status-text,
+.delete-entry:hover .delete-entry-text,
+.row:hover .db-user-box .change-pwd{
+	visibility:visible;
+}
+.row .ip-status-info:hover{
+	background-image:url(../i/enabled-ico-hover.png);
+}
+.row .ip-suspended-status:hover{
+	background-image:url(../i/suspended-ico.png);
+}
+.row .delete-entry:hover,
+.row .db-user-box .db-user:hover{
+	background-image:url(../i/delete-ico.png);
+	cursor:pointer;
+}
+.row .delete-entry:active{
+	background-image:url(../i/delete-ico-active.png);
+	cursor:pointer;
+}
+.delete-entry:hover .delete-entry-text{
+	color:#333;
+}
+.delete-entry .delete-entry-text:hover{
+	cursor:pointer;
+}
+.delete-entry .delete-entry-text:active{
+	color:#f00;
+}
+.row:hover .show-records,
+.row:hover .hide-records,
+.row:hover .template-box .prop-value,
+.domains-list .row:hover .stats-box .stats-auth-text,
+.domains-list .row:hover .nginx-box .nginx-ext-list,
+.row:hover .db-user-box .change-pwd,
+.row:hover .add-db-user,
+.row:hover .backup-db,
+.row:hover .user-backups-box .prop-title{
+	color:#6aa0ac;
+	border-bottom-color:#cacbbd;
+}
+.row:hover .template-box .prop-value:hover,
+.row:hover .show-records:hover,
+.hide-records:hover, 
+.domains-list .row:hover .stats-box .stats-auth-text:hover,
+.domains-list .row:hover .nginx-box .nginx-ext-list:hover,
+.row .db-user-box .change-pwd:hover,
+.row .add-db-user:hover,
+.row .backup-db:hover,
+.row .user-backups-box:hover .prop-title{
+	color:#575757;
+	border-bottom-color:#b4c775;
+}
+.row .template-box .prop-value:active,
+.row .show-records:active,
+.hide-records:active, 
+.domains-list .row:hover .stats-box .stats-auth-text:active,
+.domains-list .row:hover .nginx-box .nginx-ext-list:active,
+.domains-list .row:hover .template-box .prop-value:active,
+.users-list .username-box .nickname:active,
+.users-list .user-backups-box .prop-title:active,
+.row .db-user-box .change-pwd:active,
+.row .add-db-user:active,
+.row .backup-db:active,
+.row .user-backups-box .prop-title:active{
+	color:#b4c775;
+}
+
+/* Checked row
+- - - - - - - - - - - - - - - - - - - */
+.checked-row{
+	background-color:#e4f7bf;
+}
+	.checked-row .row-actions-box .check-control{
+		background-position:0 -30px;		
+	}
+	
+	.domains-list .checked-row .names .primary, 
+	.dns-list .checked-row .names .primary,
+	.cron-list .checked-row .cron-command-line,
+	.users-list .checked-row .username-box .nickname,
+	.db-list .checked-row .db-name{
+		border-bottom:1px solid #e4f7bf;
+	}
+	
+/* Suspended row
+- - - - - - - - - - - - - - - - - - - */
+.ip-details-suspended,
+.suspended-row{}
+
+.ip-details-suspended:hover,
+.suspended-row:hover{
+	background-color:#fff;
+}
+	.ip-details-suspended .entry-created,
+	.suspended-row .entry-created,
+	.suspended-row .username-box .role{
+		color:#ccc;
+	}
+	.ip-details-suspended .ip-adr,
+	.suspended-row .ip-adr,
+	.suspended-row .cron-command-line,
+	.suspended-row .username-box,
+	.suspended-row .username-box .nickname,
+	.suspended-row .user-name .prop-value,
+	.suspended-row .user-backups-box .prop-title,
+	.suspended-row .user-details .user-email,
+	.suspended-row .user-details .user-reports,
+	.suspended-row .template-box .prop-value,
+	.suspended-row .stats-box-title,
+	.suspended-row .stats-box .stats-auth,
+	.suspended-row .nginx-box .nginx-ext-list{
+		color:#ccc;
+		border:none;
+	}
+	.ip-details-suspended:hover .ip-adr,
+	.suspended-row:hover .ip-adr,
+	.suspended-row:hover .names .primary,
+	.domains-list .suspended-row:hover .names .primary, 
+	.dns-list .suspended-row:hover .names .primary,
+	.cron-list .suspended-row:hover .cron-command-line,
+	.users-list .suspended-row:hover .username-box .nickname,
+	.users-list .suspended-row:hover .user-backups-box .prop-title,
+	.suspended-row .stats-box .stats-auth-text{
+		border:none;
+	}
+	.ip-details-suspended:hover .ip-adr:hover,
+	.suspended-row:hover .ip-adr:hover,
+	.cron-list .suspended-row:hover .cron-command-line:hover,
+	.users-list .suspended-row:hover .username-box .nickname:hover,
+	.users-list .suspended-row:hover .user-backups-box .prop-title:hover,
+	.cron-list .suspended-row:hover .cron-command-line{
+		border:none;
+		cursor:default;		
+	}
+	.users-list .suspended-row .username-box .nickname:active,
+	.users-list .suspended-row .user-backups-box .prop-title:active{
+		color:#ccc;
+	}
+
+.ip-details-suspended .prop-title,
+.ip-details-suspended .prop-value,
+.suspended-row .prop-title,
+.suspended-row .prop-value,
+.suspended-row .b-usage-box .value,
+.suspended-row .b-usage-box .max-size,
+.suspended-row .b-usage-box .max-size .units,
+.suspended-row .b-usage-box2 .value,
+.suspended-row .b-usage-box2 .max-size,
+.suspended-row .names .primary{
+	color:#ccc;
+}
+.suspended-row .b-usage-box .bar,
+.suspended-row .b-usage-box2 .graph .bar {
+	background-color:#ccc;
+}
+.suspended-row:hover .show-records,
+.suspended-row:hover .hide-records,
+.suspended-row:hover .template-box .prop-value,
+.domains-list .suspended-row:hover .stats-box .stats-auth-text,
+.domains-list .suspended-row:hover .nginx-box .nginx-ext-list,
+.suspended-row:hover .user-backups-box .prop-title,
+.suspended-row:hover .template-box .prop-value:hover,
+.suspended-row:hover .show-records:hover,
+.suspended-row .hide-records:hover, 
+.domains-list .suspended-row:hover .stats-box .stats-auth-text:hover,
+.domains-list .suspended-row:hover .nginx-box .nginx-ext-list:hover,
+.domains-list .suspended-row:hover .names .primary:hover,
+.dns-list .suspended-row:hover .names .primary:hover{
+	color:#ccc;
+	border:none;
+	cursor:default;
+}
+.suspended-row:hover .template-box .prop-value:active,
+.suspended-row:hover .show-records:active,
+.suspended-row .hide-records:active, 
+.domains-list .suspended-row:hover .stats-box .stats-auth-text:active,
+.domains-list .suspended-row:hover .nginx-box .nginx-ext-list:active,
+.users-list .suspended-row .username-box .nickname:active,
+.users-list .suspended-row .user-backups-box .prop-title:active{
+	color:#ccc;
+}	
+.suspended-row .stats-box-title{
+	background-image:url(../i/stats-curve-grey.png);
+}

+ 700 - 0
web/static-templates/db.html

@@ -0,0 +1,700 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | Databases</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web Domain</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+					<!-- div class="b-console-statuses">
+						<div class="b-console-status cc">
+							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
+Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
+							</p>
+							<span class="b-console-status-action">cancel</span>
+							<i class="b-console-status-arrow">&nbsp;</i>							
+						</div>
+					</div -->
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add database</a>
+			<div class="row-filters cc">
+				<div class="b-row-selector">
+					<div class="checkbox-selector cc">
+						<input class="styled" type="checkbox" value="" />
+						<span class="selector-title">385 Selected</span>
+					</div>
+					<div class="context-actions">
+						<div class="b-cust-sel b-cust-sel_inactive">
+							<span class="title">Action</span>
+							<div class="cust-sel-arrow"><i>&nbsp;</i></div>
+							<div class="cust-sel-options">
+								<div class="cust-sel-option ico_gray">Suspend</div>
+								<div class="cust-sel-option ico_green">Unsuspend</div>
+								<div class="cust-sel-option ico_red">Delete</div>
+							</div>
+						</div>
+					</div>
+				</div>
+				<!-- visible only for admin -->
+				<div class="domain-groups-selector">
+					<div class="selector-wrap">
+						<strong class="selector-title">Show:</strong>
+						<span class="selected-groups">mine, vesta, Chronos, vasya (and 35 more)</span>
+					</div>
+				</div><!-- // visible only for admin -->
+			</div>
+
+			<a class="db-manager" href="#">Php<em class="highlighted">pg</em>admin</a>			
+			<a class="db-manager" href="#">Php<em class="highlighted">my</em>admin</a>
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="db-list">
+					<div class="db-devider">
+						<span class="db-devider-title">
+							<span class="db-devider-outer">
+								<span class="db-devider-inner">MySQL</span>
+							</span>
+						</span>
+					</div>	
+					<!-- row 1 -->
+					<div class="row first-row db-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-value">Javier Henneman</span>
+								</span>
+							</div>
+							<div class="entry-created">05.03.2011</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="db-name-box">
+									<span class="db-name">Clinton Brazeal Super DB</span>
+								</div>
+							</div>
+							<div class="props-additional">
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">naumov-socolov</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">socialmediaexaminer (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<span class="add-db-user">Add user</span>
+							</div>
+							<div class="props-ext">
+								<span class="backup-db">backup</span>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">12</span>
+											<div class="graph middle">
+												<span class="bar" style="width:55%;"></span>
+											</div>
+										</div>
+										<div class="max-size">300 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row db-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-value">Allan Cumberland</span>
+								</span>
+							</div>
+							<div class="entry-created">06.03.2011</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="db-name-box">
+									<span class="db-name">Example database name</span>
+								</div>
+							</div>
+							<div class="props-additional">
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Lance Lafata</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Tania Maietta (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Tyrone Diangelo</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Elinor Boissonneault (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<span class="add-db-user">Add user</span>
+							</div>
+							<div class="props-ext">
+								<span class="backup-db">backup</span>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">280</span>
+											<div class="graph critical">
+												<span class="bar" style="width:85%;"></span>
+											</div>
+										</div>
+										<div class="max-size">300 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row db-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-value">Dick Costolo</span>
+								</span>
+							</div>
+							<div class="entry-created">11.05.2011</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="db-name-box">
+									<span class="db-name">Twitter User Object</span>
+								</div>
+							</div>
+							<div class="props-additional">
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Evan Williams</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Jack Dorsey</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Biz Stone</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Abdur Chowdhury</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Jason Goldman</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Sean Garrett</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Greg Pass (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<span class="add-db-user">Add user</span>
+							</div>
+							<div class="props-ext">
+								<span class="backup-db">backup</span>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">280</span>
+											<div class="graph critical">
+												<span class="bar" style="width:85%;"></span>
+											</div>
+										</div>
+										<div class="max-size">300 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<div class="db-devider">
+						<span class="db-devider-title">
+							<span class="db-devider-outer">
+								<span class="db-devider-inner">Postgres</span>
+							</span>
+						</span>
+					</div>	
+
+					<!-- row 1 -->
+					<div class="row first-row db-details-row checked-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-value">Richard Yoo</span>
+								</span>
+							</div>
+							<div class="entry-created">05.03.2011</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="db-name-box">
+									<span class="db-name">Edgebuzz</span>
+								</div>
+							</div>
+							<div class="props-additional">
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Pat Condon</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Graham Weston (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Mark Roenigk</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Bruce Knooihuizen (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">John Engates</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Lanham Napier</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<span class="add-db-user">Add user</span>
+							</div>
+							<div class="props-ext">
+								<span class="backup-db">backup</span>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">12</span>
+											<div class="graph middle">
+												<span class="bar" style="width:55%;"></span>
+											</div>
+										</div>
+										<div class="max-size">300 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row db-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-value">General Hugh Shelton</span>
+								</span>
+							</div>
+							<div class="entry-created">05.03.2011</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="db-name-box">
+									<span class="db-name">Bubbledog</span>
+								</div>
+							</div>
+							<div class="props-additional">
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Jim Whitehurst</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Naren Gupta (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Jeff Clarke</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Micheline Chau (read only)</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Jeff Clarke</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<span class="add-db-user">Add user</span>
+							</div>
+							<div class="props-ext">
+								<span class="backup-db">backup</span>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">45</span>
+											<div class="graph middle">
+												<span class="bar" style="width:35%;"></span>
+											</div>
+										</div>
+										<div class="max-size">300 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+					
+					<!-- row 3 -->
+					<div class="row db-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-value">Mark Shuttleworth</span>
+								</span>
+							</div>
+							<div class="entry-created">05.03.2011</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="db-name-box">
+									<span class="db-name">Feednation</span>
+								</div>
+							</div>
+							<div class="props-additional">
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Jason Fried</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">David Heinemeier Hansson</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<div class="db-user-box cc">
+									<span class="db-user-wrap">
+										<span class="db-user">Stephen Campbell</span>
+									</span>
+									<span class="change-pwd">change password</span>										
+								</div>
+								<span class="add-db-user">Add user</span>
+							</div>
+							<div class="props-ext">
+								<span class="backup-db">backup</span>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">12</span>
+											<div class="graph low">
+												<span class="bar" style="width:15%;"></span>
+											</div>
+										</div>
+										<div class="max-size">300 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+							</div>
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_db">
+						<div class="entry-header">New database</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Database named "ReadWriteWeb" already exists.</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">db type:</label>
+							<select class="styled" name="db-type">
+								<option value="1" selected="selected">MySQL</option>
+								<option value="2">Postgres</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#"><span class="mandatory">db name:</span></label>
+							<input class="text-field rule-required" type="text" value="ReadWriteWeb" />
+						</div>
+						<div class="db-credentials">
+							<div class="form-row cc">
+								<label class="field-label" for="#"><span class="mandatory">username</span></label>
+								<input class="text-field rule-required" type="text" value="" />
+							</div>
+							<div class="form-row pwd-box cc">
+								<label class="field-label" for="#">password:</label>
+								<input class="text-field disabled" type="text" value="g179x2vpvfamn7v" />
+								<span class="generate-pwd">Generate</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">db host:</label>
+							<select class="styled" name="db-host">
+								<option value="1">user</option>
+								<option value="2" selected="selected">smashingmagazine.com</option>
+							</select>
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">suspended:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+				</div><!-- // .domain-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+</body>
+</html>

+ 504 - 450
web/static-templates/dns.html

@@ -1,450 +1,504 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
-
-<head>
-	<title>Vesta | DNS</title>
-	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
-	<meta http-equiv="imagetoolbar" content="false" />
-
-	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
-	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
-
-	<!--[if lt IE 8]>
-		<link rel="stylesheet" type="text/css" href="css/ie.css" />
-    <![endif]-->
-
-	<script type="text/javascript" src="js/custom-form-elements.js"></script>
-</head>
-
-<body>
-<div id="page">
-	<div class="outer">
-		<div id="header">
-			<div class="logo-box">
-				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
-			</div>
-			<ul class="settings">
-				<li><a href="#">settings</a></li>
-				<li><a href="#">exit</a></li>
-			</ul>
-		</div>
-		<div id="primary-nav-box">
-			<ul class="primary-nav cc">
-				<li class="section">
-					<div class="section-inner">
-						<dl class="users-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Users</span> 
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">386 users</span>
-								<span class="def">7 blocked</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="domains-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Web Domain</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">580 domains</span>
-								<span class="def">22 out of mem</span>
-								<span class="def">3 waiting</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="mail-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Mail</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">320 domains</span>
-								<span class="def">1209 mailboxes</span>
-								<span class="def">25 full</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="db-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">DB</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">7 db</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section active">
-					<div class="section-inner">
-						<dl class="dns-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Dns</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">289 records</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="dnstpl-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">IP</span> 
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">7 templates</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section last-section">
-					<div class="section-inner">
-						<dl class="cron-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Cron</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">15 records</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-			</ul>
-		</div>
-		<div id="console">
-			<div class="b-console">
-				<div class="b-console-wrap">
-					<form class="b-console-form cc" action="#" method="post">
-						<fieldset>
-							<input class="b-console-field" type="text" value="/"/>
-							<input class="b-console-btn" type="submit" value="Go" />
-						</fieldset>
-					</form>
-					<!-- div class="b-console-statuses">
-						<div class="b-console-status cc">
-							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
-Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
-							</p>
-							<span class="b-console-status-action">cancel</span>
-							<i class="b-console-status-arrow">&nbsp;</i>							
-						</div>
-					</div -->
-				</div>
-				<div class="b-console-results"></div>
-			</div>
-		</div>
-		<!-- actions toolbar -->
-		<div id="actions-toolbar" class="cc">
-			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add dns</a>
-			<span class="select-all">select all</span>
-			<span class="clear-selected">Delete selected</span>
-		</div><!-- // actions toolbar -->
-		<div id="content">
-			<!-- additional info block -->
-			<div class="b-ext-info-wrap b-ext-info-wrap_collapsed">
-				<div class="b-ext-info">
-<p>Механическая природа пододвигается под устойчивый силовой трёхосный гироскопический стабилизатор, что увязывается со структурно-тектонической обстановкой, гидродинамическими условиями и литолого-минералогическим составом пород. Фосфоритообразование методически опускает уходящий огненный пояс, исходя из суммы моментов. Инерциальная навигация, в соответствии с основным законом динамики, представляет собой тальк, пользуясь последними системами уравнений. Имея такие данные, можно сделать существенный вывод о том, что маховик неустойчив.</p>
-				</div>
-				<div class="b-ext-info-btn"></div>
-			</div><!-- // additional info block -->
-			<div class="content-inner">
-				<div class="dns-list">
-					<!-- row 1 -->
-					<div class="row first-row dns-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="names">
-									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
-								</div>
-								<div class="show-records">Show records</div>
-							</div>
-							<div class="props-additional">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ttl-box">
-									<span class="prop-title">ttl:</span>
-									<span class="prop-value">7200</span>
-								</span>
-								<span class="prop-box soa-box">
-									<span class="prop-title">soa:</span>
-									<span class="prop-value">n1.readwriteweb.com</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 1 -->
-
-					<!-- row 2 -->
-					<div class="row dns-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="names">
-									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
-								</div>
-								<div class="show-records">Show records</div>
-							</div>
-							<div class="props-additional">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ttl-box">
-									<span class="prop-title">ttl:</span>
-									<span class="prop-value">7200</span>
-								</span>
-								<span class="prop-box soa-box">
-									<span class="prop-title">soa:</span>
-									<span class="prop-value">n1.readwriteweb.com</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 2 -->
-
-					<!-- row 3 -->
-					<div class="row dns-details-row checked-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="names">
-									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
-								</div>
-								<div class="show-records">Show records</div>
-							</div>
-							<div class="props-additional">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ttl-box">
-									<span class="prop-title">ttl:</span>
-									<span class="prop-value">7200</span>
-								</span>
-								<span class="prop-box soa-box">
-									<span class="prop-title">soa:</span>
-									<span class="prop-value">n1.readwriteweb.com</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 3 -->
-
-					<!-- row 4 -->
-					<div class="row dns-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="names">
-									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
-								</div>
-								<div class="show-records hidden">Show records</div>
-							</div>
-							<div class="props-additional">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ttl-box">
-									<span class="prop-title">ttl:</span>
-									<span class="prop-value">7200</span>
-								</span>
-								<span class="prop-box soa-box">
-									<span class="prop-title">soa:</span>
-									<span class="prop-value">n1.readwriteweb.com</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 4 -->
-
-					<!-- show/edit dns records contextual form -->
-					<div class="b-new-entry b-records-list">
-						<div class="entry-header">
-							<div class="hide-records">Hide records</div>
-						</div>
-						<div class="form-error">
-							<div class="error-box">
-								<span class="error-message">Wrong record format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
-							</div>
-						</div>
-						<div class="form-row add-box cc">
-							<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add dns record</a>
-						</div>
-
-						<div class="form-row form-row-line cc">
-							<div class="field-box dns-record-box">
-								<label class="field-label" for="#">record:</label>
-								<div class="field-box-inner cc">
-									<input class="text-field" type="text" value="" />
-									<div class="field-devider">in</div>
-								</div>
-							</div>
-
-							<div class="field-box dns-type-box">
-								<label class="field-label" for="#">type:</label>
-								<select class="styled" name="dns-type-1">
-									<option value="1" selected="selected">A</option>
-									<option value="2">B</option>
-									<option value="3">C</option>
-								</select>
-							</div>
-							<div class="field-box dns-value-box">
-								<label class="field-label" for="#">value:</label>
-								<input class="text-field" type="text" value="" />
-							</div>
-							<div class="delete-record"></div>
-						</div>				
-
-						<div class="form-row form-row-line cc">
-							<div class="field-box dns-record-box">
-								<input class="text-field" type="text" value="" />
-							</div>
-							<div class="field-devider">in</div>
-							<div class="field-box dns-type-box">
-								<select class="styled" name="dns-type-2">
-									<option value="1" selected="selected">A</option>
-									<option value="2">B</option>
-									<option value="3">C</option>
-								</select>
-							</div>
-							<div class="field-box dns-value-box">
-								<input class="text-field" type="text" value="" />
-							</div>
-							<div class="delete-record"></div>
-						</div>				
-
-						<div class="form-row form-row-line cc">
-							<div class="field-box dns-record-box">
-								<input class="text-field" type="text" value="" />
-							</div>
-							<div class="field-devider">in</div>
-							<div class="field-box dns-type-box">
-								<select class="styled" name="dns-type-3">
-									<option value="1" selected="selected">A</option>
-									<option value="2">B</option>
-									<option value="3">C</option>
-								</select>
-							</div>
-							<div class="field-box dns-value-box">
-								<input class="text-field" type="text" value="" />
-							</div>
-							<div class="delete-record"></div>
-						</div>				
-
-						<div class="form-row buttons-row cc">
-							<input class="add-entry-btn" type="submit" value="save" />
-							<span class="cancel-btn">Cancel</span>
-							<span class="help-btn">Help</span>
-						</div>
-					</div><!-- // form -->
-
-					<!-- form -->
-					<div class="b-new-entry b-new-entry_dns" style="margin-top:25px;">
-						<div class="entry-header">New dns</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">domain:</label>
-							<input class="text-field" type="text" value="www.digital-photography-school.com" />
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">ip address:</label>
-							<div class="autocomplete-box">
-								<input class="text-field" type="text" value="192.168.64.19" />
-								<i class="arrow">&nbsp;</i>
-							</div>
-						</div>
-						<div class="form-row dns-template-box cc">
-							<label class="field-label" for="#">template:</label>
-							<select class="styled" name="template">
-								<option value="1" selected="selected">default</option>
-								<option value="2">custom</option>
-								<option value="3">advanced</option>
-							</select>
-							<span class="context-settings">View template settings</span>
-						</div>
-						
-						<div class="form-row buttons-row cc">
-							<input class="add-entry-btn" type="submit" value="add" />
-							<span class="cancel-btn">Cancel</span>
-							<span class="help-btn">Help</span>
-						</div>
-					</div><!-- // form -->
-				</div><!-- // .domain-list -->
-			</div>
-		</div><!-- // #content -->
-	</div>
-</div>
-</body>
-</html>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | DNS</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web Domain</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+					<!-- div class="b-console-statuses">
+						<div class="b-console-status cc">
+							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
+Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
+							</p>
+							<span class="b-console-status-action">cancel</span>
+							<i class="b-console-status-arrow">&nbsp;</i>							
+						</div>
+					</div -->
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add dns</a>
+			
+			<div class="row-filters cc">
+				<div class="b-row-selector">
+					<div class="checkbox-selector cc">
+						<input class="styled" type="checkbox" value="" />
+						<span class="selector-title">385 Selected</span>
+					</div>
+					<div class="context-actions">
+						<div class="b-cust-sel b-cust-sel_inactive">
+							<span class="title">Action</span>
+							<div class="cust-sel-arrow"><i>&nbsp;</i></div>
+							<div class="cust-sel-options">
+								<div class="cust-sel-option ico_gray">Suspend</div>
+								<div class="cust-sel-option ico_green">Unsuspend</div>
+								<div class="cust-sel-option ico_red">Delete</div>
+							</div>
+						</div>
+					</div>
+				</div>
+				<!-- visible only for admin -->
+				<div class="domain-groups-selector">
+					<div class="selector-wrap">
+						<strong class="selector-title">Show:</strong>
+						<span class="selected-groups">mine, vesta, Chronos, vasya (and 35 more)</span>
+					</div>
+				</div><!-- // visible only for admin -->
+			</div>
+			
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="dns-list">
+					<!-- row 1 -->
+					<div class="row first-row dns-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="names">
+									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
+								</div>
+								<div class="show-records">Show records</div>
+							</div>
+							<div class="props-additional">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ttl-box">
+									<span class="prop-title">ttl:</span>
+									<span class="prop-value">7200</span>
+								</span>
+								<span class="prop-box soa-box">
+									<span class="prop-title">soa:</span>
+									<span class="prop-value">n1.readwriteweb.com</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row dns-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="names">
+									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
+								</div>
+								<div class="show-records">Show records</div>
+							</div>
+							<div class="props-additional">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ttl-box">
+									<span class="prop-title">ttl:</span>
+									<span class="prop-value">7200</span>
+								</span>
+								<span class="prop-box soa-box">
+									<span class="prop-title">soa:</span>
+									<span class="prop-value">n1.readwriteweb.com</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row dns-details-row checked-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="names">
+									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
+								</div>
+								<div class="show-records">Show records</div>
+							</div>
+							<div class="props-additional">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ttl-box">
+									<span class="prop-title">ttl:</span>
+									<span class="prop-value">7200</span>
+								</span>
+								<span class="prop-box soa-box">
+									<span class="prop-title">soa:</span>
+									<span class="prop-value">n1.readwriteweb.com</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<!-- row 4 -->
+					<div class="row dns-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="names">
+									<strong class="domain-name primary">naumov-socolov.co.uk</strong>
+								</div>
+								<div class="show-records hidden">Show records</div>
+							</div>
+							<div class="props-additional">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ttl-box">
+									<span class="prop-title">ttl:</span>
+									<span class="prop-value">7200</span>
+								</span>
+								<span class="prop-box soa-box">
+									<span class="prop-title">soa:</span>
+									<span class="prop-value">n1.readwriteweb.com</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 4 -->
+
+					<!-- show/edit dns records contextual form -->
+					<div class="b-new-entry b-records-list">
+						<div class="entry-header">
+							<div class="hide-records">Hide records</div>
+						</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong record format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row add-box cc">
+							<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add dns record</a>
+						</div>
+
+						<div class="form-row form-row-line cc">
+							<div class="field-box dns-record-box">
+								<label class="field-label" for="#">record:</label>
+								<div class="field-box-inner cc">
+									<input class="text-field" type="text" value="" />
+									<div class="field-devider">in</div>
+								</div>
+							</div>
+
+							<div class="field-box dns-type-box">
+								<label class="field-label" for="#">type:</label>
+								<select class="styled" name="dns-type-1">
+									<option value="1" selected="selected">A</option>
+									<option value="2">B</option>
+									<option value="3">C</option>
+								</select>
+							</div>
+							<div class="field-box dns-value-box">
+								<label class="field-label" for="#">value:</label>
+								<input class="text-field" type="text" value="" />
+							</div>
+							<div class="delete-record"></div>
+						</div>				
+
+						<div class="form-row form-row-line cc">
+							<div class="field-box dns-record-box">
+								<input class="text-field" type="text" value="" />
+							</div>
+							<div class="field-devider">in</div>
+							<div class="field-box dns-type-box">
+								<select class="styled" name="dns-type-2">
+									<option value="1" selected="selected">A</option>
+									<option value="2">B</option>
+									<option value="3">C</option>
+								</select>
+							</div>
+							<div class="field-box dns-value-box">
+								<input class="text-field" type="text" value="" />
+							</div>
+							<div class="delete-record"></div>
+						</div>				
+
+						<div class="form-row form-row-line cc">
+							<div class="field-box dns-record-box">
+								<input class="text-field" type="text" value="" />
+							</div>
+							<div class="field-devider">in</div>
+							<div class="field-box dns-type-box">
+								<select class="styled" name="dns-type-3">
+									<option value="1" selected="selected">A</option>
+									<option value="2">B</option>
+									<option value="3">C</option>
+								</select>
+							</div>
+							<div class="field-box dns-value-box">
+								<input class="text-field" type="text" value="" />
+							</div>
+							<div class="delete-record"></div>
+						</div>
+						
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="save" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_dns">
+						<div class="entry-header">New dns</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong record format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">domain:</label>
+							<input class="text-field" type="text" value="www.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ip address:</label>
+							<div class="autocomplete-box">
+								<input class="text-field" type="text" value="192.168.64.19" />
+								<i class="arrow">&nbsp;</i>
+							</div>
+						</div>
+						<div class="form-row dns-template-box cc">
+							<label class="field-label" for="#">template:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">default</option>
+								<option value="2">custom</option>
+								<option value="3">advanced</option>
+							</select>
+							<span class="context-settings">View template settings</span>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ttl:</label>
+							<input class="text-field ttl-field" type="text" value="" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">soa:</label>
+							<input class="text-field" type="text" value="www.digital-photography-school.com" />
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">suspended:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+				</div><!-- // .domain-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+</body>
+</html>

二进制
web/static-templates/i/_asterisk.gif


二进制
web/static-templates/i/asterisk1.png


二进制
web/static-templates/i/asterisk2.png


二进制
web/static-templates/i/auth/auth-bg.png


二进制
web/static-templates/i/auth/checkboxes.png


二进制
web/static-templates/i/auth/form-bg.png


二进制
web/static-templates/i/auth/logo.png


二进制
web/static-templates/i/auth/planet-1.png


二进制
web/static-templates/i/auth/planet-2.png


二进制
web/static-templates/i/autocomplete-field-arrows-sprite.png


二进制
web/static-templates/i/backup-checkbox-checked.png


二进制
web/static-templates/i/backup-checkbox-unchecked.png


二进制
web/static-templates/i/backup-checkbox.png


二进制
web/static-templates/i/backup-checkboxes.png


二进制
web/static-templates/i/backup-collapsed-ico.png


二进制
web/static-templates/i/backup-expand-ico.png


二进制
web/static-templates/i/backup-ico.png


二进制
web/static-templates/i/backup-restore-ico.png


二进制
web/static-templates/i/bar-value-mark.png


二进制
web/static-templates/i/check-row-sprite-2011-12-18.png


二进制
web/static-templates/i/check-row-sprite_.png


二进制
web/static-templates/i/checkbox-1.png


二进制
web/static-templates/i/checkboxes-2011-12-18.png


二进制
web/static-templates/i/chekbox-selector.png


二进制
web/static-templates/i/chosen-sprite.png


二进制
web/static-templates/i/cust-option-bullets.png


二进制
web/static-templates/i/custom-arrow.png


二进制
web/static-templates/i/delete-ico-active.png


二进制
web/static-templates/i/fav.ico


二进制
web/static-templates/i/form-checkboxes.png


二进制
web/static-templates/i/form-group-collapsed.png


二进制
web/static-templates/i/form-group-collapsed_.png


二进制
web/static-templates/i/green-bracket-l-highlighted.png


二进制
web/static-templates/i/green-bracket-l.png


二进制
web/static-templates/i/green-bracket-r-highlighted.png


二进制
web/static-templates/i/green-bracket-r.png


二进制
web/static-templates/i/group-value-bullet.png


二进制
web/static-templates/i/group-values-collapsed.png


二进制
web/static-templates/i/info-popup-bg-1.png


二进制
web/static-templates/i/info-popup-bg-2.png


二进制
web/static-templates/i/info-popup-bg.png


二进制
web/static-templates/i/info-popup-sprite-2011-12-14.png


二进制
web/static-templates/i/info-popup-sprite.png


二进制
web/static-templates/i/old-add-entry-plus.gif


二进制
web/static-templates/i/overrun-border.png


二进制
web/static-templates/i/plus-sprite.png


二进制
web/static-templates/i/plus-sprite1.png


二进制
web/static-templates/i/primary-plus.gif


二进制
web/static-templates/i/primary-plus_active.png


二进制
web/static-templates/i/section-status-sprite-6.png


二进制
web/static-templates/i/select-arrow-2011-12-18.png


二进制
web/static-templates/i/stats-brace.png


二进制
web/static-templates/i/stats-curve-grey.png


二进制
web/static-templates/i/stats-curve.png


二进制
web/static-templates/i/thin-grey-line-3.gif


二进制
web/static-templates/i/thin-grey-line-4.gif


二进制
web/static-templates/i/vesta-italic-logo.png


二进制
web/static-templates/i/vesta-logo-2011-11-16.png


二进制
web/static-templates/i/vesta-logo-2011-11-25.png


二进制
web/static-templates/i/vesta-logo-2011-12-14.png


+ 472 - 435
web/static-templates/ip.html

@@ -1,435 +1,472 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
-
-<head>
-	<title>Vesta | IP</title>
-	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
-	<meta http-equiv="imagetoolbar" content="false" />
-
-	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
-	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
-
-	<!--[if lt IE 8]>
-		<link rel="stylesheet" type="text/css" href="css/ie.css" />
-    <![endif]-->
-
-	<script type="text/javascript" src="js/custom-form-elements.js"></script>
-</head>
-
-<body>
-<div id="page">
-	<div class="outer">
-		<div id="header">
-			<div class="logo-box">
-				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
-			</div>
-			<ul class="settings">
-				<li><a href="#">settings</a></li>
-				<li><a href="#">exit</a></li>
-			</ul>
-		</div>
-		<div id="primary-nav-box">
-			<ul class="primary-nav cc">
-				<li class="section">
-					<div class="section-inner">
-						<dl class="users-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Users</span> 
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">386 users</span>
-								<span class="def">7 blocked</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="domains-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Web Domain</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">580 domains</span>
-								<span class="def">22 out of mem</span>
-								<span class="def">3 waiting</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="mail-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Mail</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">320 domains</span>
-								<span class="def">1209 mailboxes</span>
-								<span class="def">25 full</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="db-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">DB</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">7 db</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section active">
-					<div class="section-inner">
-						<dl class="dns-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Dns</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">289 records</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="dnstpl-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">IP</span> 
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">7 templates</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section last-section">
-					<div class="section-inner">
-						<dl class="cron-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Cron</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">15 records</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-			</ul>
-		</div>
-		<div id="console">
-			<div class="b-console">
-				<div class="b-console-wrap">
-					<form class="b-console-form cc" action="#" method="post">
-						<fieldset>
-							<input class="b-console-field" type="text" value="/"/>
-							<input class="b-console-btn" type="submit" value="Go" />
-						</fieldset>
-					</form>
-					<!-- div class="b-console-statuses">
-						<div class="b-console-status cc">
-							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
-Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
-							</p>
-							<span class="b-console-status-action">cancel</span>
-							<i class="b-console-status-arrow">&nbsp;</i>							
-						</div>
-					</div -->
-				</div>
-				<div class="b-console-results"></div>
-			</div>
-		</div>
-		<!-- actions toolbar -->
-		<div id="actions-toolbar" class="cc">
-			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add ip address</a>
-			<span class="select-all">select all</span>
-			<span class="clear-selected">Delete selected</span>
-		</div><!-- // actions toolbar -->
-		<div id="content">
-			<!-- additional info block -->
-			<div class="b-ext-info-wrap b-ext-info-wrap_collapsed">
-				<div class="b-ext-info">
-<p>Механическая природа пододвигается под устойчивый силовой трёхосный гироскопический стабилизатор, что увязывается со структурно-тектонической обстановкой, гидродинамическими условиями и литолого-минералогическим составом пород. Фосфоритообразование методически опускает уходящий огненный пояс, исходя из суммы моментов. Инерциальная навигация, в соответствии с основным законом динамики, представляет собой тальк, пользуясь последними системами уравнений. Имея такие данные, можно сделать существенный вывод о том, что маховик неустойчив.</p>
-				</div>
-				<div class="b-ext-info-btn"></div>
-			</div><!-- // additional info block -->
-			<div class="content-inner">
-				<div class="ip-list">
-					<!-- row 1 -->
-					<div class="row first-row ip-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-								</div>
-								<span class="prop-box">
-									<span class="prop-title">netmask:</span>
-									<span class="prop-value">255.255.255.0</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">interface:</span>
-									<span class="prop-value">eth1</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">name:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-							</div>
-							<div class="props-additional">
-								<span class="prop-box owner-box">
-									<span class="prop-title">owner:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">status:</span>
-									<span class="prop-value">shared</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box">
-									<span class="prop-title">sys users:</span>
-									<span class="prop-value">9 999</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">web domains:</span>
-									<span class="prop-value">2 346</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 1 -->
-
-					<!-- row 2 -->
-					<div class="row ip-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-								</div>
-								<span class="prop-box">
-									<span class="prop-title">netmask:</span>
-									<span class="prop-value">255.255.255.0</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">interface:</span>
-									<span class="prop-value">eth1</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">name:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-							</div>
-							<div class="props-additional">
-								<span class="prop-box owner-box">
-									<span class="prop-title">owner:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">status:</span>
-									<span class="prop-value">shared</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box">
-									<span class="prop-title">sys users:</span>
-									<span class="prop-value">9 999</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">web domains:</span>
-									<span class="prop-value">2 346</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 2 -->
-
-					<!-- row 3 -->
-					<div class="row ip-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-								</div>
-								<span class="prop-box">
-									<span class="prop-title">netmask:</span>
-									<span class="prop-value">255.255.255.0</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">interface:</span>
-									<span class="prop-value">eth1</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">name:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-							</div>
-							<div class="props-additional">
-								<span class="prop-box owner-box">
-									<span class="prop-title">owner:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">status:</span>
-									<span class="prop-value">shared</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box">
-									<span class="prop-title">sys users:</span>
-									<span class="prop-value">9 999</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">web domains:</span>
-									<span class="prop-value">2 346</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 3 -->
-
-					<!-- row 4, suspended status -->
-					<div class="row ip-details-row ip-details-suspended">
-						<div class="row-actions-box cc">
-							<div class="check-this"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-suspended-status"><span class="ip-status-text">suspended</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-								</div>
-								<span class="prop-box">
-									<span class="prop-title">netmask:</span>
-									<span class="prop-value">255.255.255.0</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">interface:</span>
-									<span class="prop-value">eth1</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">name:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-							</div>
-							<div class="props-additional">
-								<span class="prop-box owner-box">
-									<span class="prop-title">owner:</span>
-									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">status:</span>
-									<span class="prop-value">shared</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box">
-									<span class="prop-title">sys users:</span>
-									<span class="prop-value">9 999</span>
-								</span>
-								<span class="prop-box">
-									<span class="prop-title">web domains:</span>
-									<span class="prop-value">2 346</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 4 -->
-
-
-					<!-- form -->
-					<div class="b-new-entry b-new-entry_ip">
-						<div class="entry-header">New ip address</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">ip address:</label>
-							<input class="text-field" type="text" value="192.168.64.19" />
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">owner:</label>
-							<select class="styled" name="ownership">
-								<option value="1" selected="selected">vesta</option>
-								<option value="2">new mexico</option>
-								<option value="3">land of magic</option>
-							</select>
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">status:</label>
-							<select class="styled">
-								<option value="1" selected="selected">shared</option>
-								<option value="2">suspended</option>
-								<option value="3">other</option>
-							</select>
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">name:</label>
-							<input class="text-field" type="text" value="super-puper-hoster.long-name.co.uk" />
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">interface:</label>
-							<select class="styled">
-								<option value="1" selected="selected">eth1</option>
-								<option value="2">eth2</option>
-								<option value="3">eth3</option>
-							</select>
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">netmask:</label>
-							<div class="autocomplete-box">
-								<input class="text-field" type="text" value="" />
-								<i class="arrow">&nbsp;</i>
-							</div>
-						</div>
-						<div class="form-row buttons-row cc">
-							<input class="add-entry-btn" type="submit" value="add" />
-							<span class="cancel-btn">Cancel</span>
-							<span class="help-btn">Help</span>
-						</div>
-					</div><!-- // form -->
-				</div><!-- // .ip-list -->
-			</div>
-		</div><!-- // #content -->
-	</div>
-</div>
-</body>
-</html>
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | IP</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web Domain</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+					<!-- div class="b-console-statuses">
+						<div class="b-console-status cc">
+							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
+Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
+							</p>
+							<span class="b-console-status-action">cancel</span>
+							<i class="b-console-status-arrow">&nbsp;</i>							
+						</div>
+					</div -->
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add ip address</a>
+			
+			<div class="row-filters cc">
+				<div class="b-row-selector">
+					<div class="checkbox-selector cc">
+						<input class="styled" type="checkbox" value="" />
+						<span class="selector-title">385 Selected</span>
+					</div>
+					<div class="context-actions">
+						<div class="b-cust-sel b-cust-sel_inactive">
+							<span class="title">Action</span>
+							<div class="cust-sel-arrow"><i>&nbsp;</i></div>
+							<div class="cust-sel-options">
+								<div class="cust-sel-option ico_gray">Suspend</div>
+								<div class="cust-sel-option ico_green">Unsuspend</div>
+								<div class="cust-sel-option ico_red">Delete</div>
+							</div>
+						</div>
+					</div>
+				</div>
+				<!-- visible only for admin -->
+				<div class="domain-groups-selector">
+					<div class="selector-wrap">
+						<strong class="selector-title">Show:</strong>
+						<span class="selected-groups">mine, vesta, Chronos, vasya (and 35 more)</span>
+					</div>
+				</div><!-- // visible only for admin -->
+			</div>
+
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="ip-list">
+					<!-- row 1 -->
+					<div class="row first-row ip-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+								</div>
+								<span class="prop-box">
+									<span class="prop-title">netmask:</span>
+									<span class="prop-value">255.255.255.0</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">interface:</span>
+									<span class="prop-value">eth1</span>
+								</span>
+								<span class="prop-box ip-name-box">
+									<span class="prop-title">name:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="prop-box owner-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">status:</span>
+									<span class="prop-value">shared</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box">
+									<span class="prop-title">sys users:</span>
+									<span class="prop-value">9 999</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">2 346</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row ip-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+								</div>
+								<span class="prop-box">
+									<span class="prop-title">netmask:</span>
+									<span class="prop-value">255.255.255.0</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">interface:</span>
+									<span class="prop-value">eth1</span>
+								</span>
+								<span class="prop-box ip-name-box">
+									<span class="prop-title">name:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="prop-box owner-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">status:</span>
+									<span class="prop-value">shared</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box">
+									<span class="prop-title">sys users:</span>
+									<span class="prop-value">9 999</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">2 346</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row ip-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+								</div>
+								<span class="prop-box">
+									<span class="prop-title">netmask:</span>
+									<span class="prop-value">255.255.255.0</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">interface:</span>
+									<span class="prop-value">eth1</span>
+								</span>
+								<span class="prop-box ip-name-box">
+									<span class="prop-title">name:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="prop-box owner-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">status:</span>
+									<span class="prop-value">shared</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box">
+									<span class="prop-title">sys users:</span>
+									<span class="prop-value">9 999</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">2 346</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<!-- row 4, suspended status -->
+					<div class="row ip-details-row ip-details-suspended">
+						<div class="row-actions-box cc">
+							<div class="check-this"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-suspended-status"><span class="ip-status-text">suspended</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+								</div>
+								<span class="prop-box">
+									<span class="prop-title">netmask:</span>
+									<span class="prop-value">255.255.255.0</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">interface:</span>
+									<span class="prop-value">eth1</span>
+								</span>
+								<span class="prop-box ip-name-box">
+									<span class="prop-title">name:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+							</div>
+							<div class="props-additional">
+								<span class="prop-box owner-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">shared1.hosting-with-very-long-name.co.uk</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">status:</span>
+									<span class="prop-value">shared</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box">
+									<span class="prop-title">sys users:</span>
+									<span class="prop-value">9 999</span>
+								</span>
+								<span class="prop-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">2 346</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 4 -->
+
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_ip">
+						<div class="entry-header">New ip address</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ip address:</label>
+							<input class="text-field" type="text" value="192.168.64.19" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">owner:</label>
+							<select class="styled" name="ownership">
+								<option value="1" selected="selected">vesta</option>
+								<option value="2">new mexico</option>
+								<option value="3">land of magic</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">status:</label>
+							<select class="styled">
+								<option value="1" selected="selected">shared</option>
+								<option value="2">suspended</option>
+								<option value="3">other</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">name:</label>
+							<input class="text-field" type="text" value="super-puper-hoster.long-name.co.uk" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">interface:</label>
+							<select class="styled">
+								<option value="1" selected="selected">eth1</option>
+								<option value="2">eth2</option>
+								<option value="3">eth3</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">netmask:</label>
+							<div class="autocomplete-box disabled-box">
+								<input class="text-field" type="text" value="" disabled="disabled" />
+								<i class="arrow">&nbsp;</i>
+							</div>
+						</div>
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+				</div><!-- // .ip-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+</body>
+</html>

+ 81 - 0
web/static-templates/js/PIE.htc

@@ -0,0 +1,81 @@
+<!--
+PIE: CSS3 rendering for IE
+Version 1.0beta4
+http://css3pie.com
+Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
+-->
+<PUBLIC:COMPONENT lightWeight="true">
+<PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
+<PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
+<PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
+
+<script type="text/javascript">
+var doc = element.document;var g=window.PIE;
+if(!g){g=window.PIE={F:"-pie-",Sa:"Pie",Pa:"pie_",Jb:{TD:1,TH:1}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(L){}g.J=function(){for(var a=4,b=doc.createElement("div"),c=b.getElementsByTagName("i");b.innerHTML="<!--[if gt IE "+ ++a+"]><i></i><![endif]--\>",c[0];);return a}();if(g.J===6)g.F=g.F.replace(/^-/,"");g.Ab=doc.documentMode||g.J;(function(){var a,b=0,c={};g.p={Ga:function(e){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+e)},
+ta:function(e){return e&&e._pieId||(e._pieId=++b)},fb:function(e){var f,h,j,d,i=arguments;f=1;for(h=i.length;f<h;f++){d=i[f];for(j in d)if(d.hasOwnProperty(j))e[j]=d[j]}return e},Pb:function(e,f,h){var j=c[e],d,i;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([f,h]):f.call(h,j);else{i=c[e]=[[f,h]];d=new Image;d.onload=function(){j=c[e]={i:d.width,f:d.height};for(var k=0,m=i.length;k<m;k++)i[k][0].call(i[k][1],j);d.onload=null};d.src=e}}}})();g.ia=function(){this.hb=[];this.Db={}};
+g.ia.prototype={aa:function(a){var b=g.p.ta(a),c=this.Db,e=this.hb;if(!(b in c)){c[b]=e.length;e.push(a)}},Ma:function(a){a=g.p.ta(a);var b=this.Db;if(a&&a in b){delete this.hb[b[a]];delete b[a]}},Ia:function(){for(var a=this.hb,b=a.length;b--;)a[b]&&a[b]()}};g.ya=new g.ia;g.ya.Tc=function(){var a=this;if(!a.Uc){setInterval(function(){a.Ia()},250);a.Uc=1}};g.G=new g.ia;window.attachEvent("onbeforeunload",function(){g.G.Ia()});g.G.Ea=function(a,b,c){a.attachEvent(b,c);this.aa(function(){a.detachEvent(b,
+c)})};(function(){function a(){g.za.Ia()}g.za=new g.ia;g.G.Ea(window,"onresize",a)})();(function(){function a(){g.Ra.Ia()}g.Ra=new g.ia;g.G.Ea(window,"onscroll",a);g.za.aa(a)})();(function(){function a(){c=g.Qa.wc()}function b(){if(c){for(var e=0,f=c.length;e<f;e++)g.attach(c[e]);c=0}}var c;g.G.Ea(window,"onbeforeprint",a);g.G.Ea(window,"onafterprint",b)})();g.hd=function(){function a(i){this.V=i}var b=doc.createElement("length-calc"),c=doc.documentElement,e=b.style,f={},h=["mm","cm","in","pt","pc"],
+j=h.length,d={};e.position="absolute";e.top=e.left="-9999px";for(c.appendChild(b);j--;){b.style.width="100"+h[j];f[h[j]]=b.offsetWidth/100}c.removeChild(b);a.prototype={ib:/(px|em|ex|mm|cm|in|pt|pc|%)$/,vb:function(){var i=this.Lc;if(i===void 0)i=this.Lc=parseFloat(this.V);return i},ab:function(){var i=this.ad;if(!i)i=this.ad=(i=this.V.match(this.ib))&&i[0]||"px";return i},a:function(i,k){var m=this.vb(),l=this.ab();switch(l){case "px":return m;case "%":return m*(typeof k==="function"?k():k)/100;
+case "em":return m*this.tb(i);case "ex":return m*this.tb(i)/2;default:return m*f[l]}},tb:function(i){var k=i.currentStyle.fontSize;if(k.indexOf("px")>0)return parseFloat(k);else{b.style.width="1em";i.appendChild(b);k=b.offsetWidth;b.parentNode===i&&i.removeChild(b);return k}}};g.k=function(i){return d[i]||(d[i]=new a(i))};return a}();g.Na=function(){function a(f){this.U=f}var b=g.k("50%"),c={top:1,center:1,bottom:1},e={left:1,center:1,right:1};a.prototype={Dc:function(){if(!this.sb){var f=this.U,
+h=f.length,j=g.u,d=j.ja,i=g.k("0");d=d.fa;i=["left",i,"top",i];if(h===1){f.push(new j.Ta(d,"center"));h++}if(h===2){d&(f[0].h|f[1].h)&&f[0].d in c&&f[1].d in e&&f.push(f.shift());if(f[0].h&d)if(f[0].d==="center")i[1]=b;else i[0]=f[0].d;else if(f[0].Y())i[1]=g.k(f[0].d);if(f[1].h&d)if(f[1].d==="center")i[3]=b;else i[2]=f[1].d;else if(f[1].Y())i[3]=g.k(f[1].d)}this.sb=i}return this.sb},coords:function(f,h,j){var d=this.Dc(),i=d[1].a(f,h);f=d[3].a(f,j);return{x:d[0]==="right"?h-i:i,y:d[2]==="bottom"?
+j-f:f}}};return a}();g.Rb=function(){function a(b){this.V=b}a.prototype={ib:/[a-z]+$/i,ab:function(){return this.lc||(this.lc=this.V.match(this.ib)[0].toLowerCase())},vc:function(){var b=this.fc,c;if(b===undefined){b=this.ab();c=parseFloat(this.V,10);b=this.fc=b==="deg"?c:b==="rad"?c/Math.PI*180:b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();g.$b=function(){function a(c){this.V=c}var b={};a.Sc=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.gb=
+{aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",
+darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",
+indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",
+mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",
+peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",
+whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ca){var c=this.V,e;if(e=c.match(a.Sc)){this.Ca="rgb("+e[1]+","+e[2]+","+e[3]+")";this.qb=parseFloat(e[4])}else{if((e=c.toLowerCase())in a.gb)c="#"+a.gb[e];this.Ca=c;this.qb=c==="transparent"?0:1}}},O:function(c){this.parse();return this.Ca==="currentColor"?c.currentStyle.color:this.Ca},la:function(){this.parse();return this.qb}};g.pa=function(c){return b[c]||(b[c]=new a(c))};return a}();g.u=function(){function a(c){this.Ha=
+c;this.ch=0;this.U=[];this.wa=0}var b=a.ja={xa:1,ob:2,ea:4,ac:8,pb:16,fa:32,A:64,ga:128,ha:256,Aa:512,dc:1024,URL:2048};a.Ta=function(c,e){this.h=c;this.d=e};a.Ta.prototype={db:function(){return this.h&b.A||this.h&b.ga&&this.d==="0"},Y:function(){return this.db()||this.h&b.Aa}};a.prototype={dd:/\s/,Mc:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,zb:/^\-?[_a-z][\w-]*/i,Yc:/^("([^"]*)"|'([^']*)')/,Fc:/^#([\da-f]{6}|[\da-f]{3})/i,bd:{px:b.A,em:b.A,ex:b.A,mm:b.A,cm:b.A,
+"in":b.A,pt:b.A,pc:b.A,deg:b.xa,rad:b.xa,grad:b.xa},sc:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function e(t,n){t=new a.Ta(t,n);if(!c){k.U.push(t);k.wa++}return t}function f(){k.wa++;return null}var h,j,d,i,k=this;if(this.wa<this.U.length)return this.U[this.wa++];for(;this.dd.test(this.Ha.charAt(this.ch));)this.ch++;if(this.ch>=this.Ha.length)return f();j=this.ch;h=this.Ha.substring(this.ch);d=h.charAt(0);switch(d){case "#":if(i=h.match(this.Fc)){this.ch+=i[0].length;return e(b.ea,i[0])}break;
+case '"':case "'":if(i=h.match(this.Yc)){this.ch+=i[0].length;return e(b.dc,i[2]||i[3]||"")}break;case "/":case ",":this.ch++;return e(b.ha,d);case "u":if(i=h.match(this.url)){this.ch+=i[0].length;return e(b.URL,i[2]||i[3]||i[4]||"")}}if(i=h.match(this.Mc)){d=i[0];this.ch+=d.length;if(h.charAt(d.length)==="%"){this.ch++;return e(b.Aa,d+"%")}if(i=h.substring(d.length).match(this.zb)){d+=i[0];this.ch+=i[0].length;return e(this.bd[i[0].toLowerCase()]||b.ac,d)}return e(b.ga,d)}if(i=h.match(this.zb)){d=
+i[0];this.ch+=d.length;if(d.toLowerCase()in g.$b.gb||d==="currentColor")return e(b.ea,d);if(h.charAt(d.length)==="("){this.ch++;if(d.toLowerCase()in this.sc){h=function(t){return t&&t.h&b.ga};i=function(t){return t&&t.h&(b.ga|b.Aa)};var m=function(t,n){return t&&t.d===n},l=function(){return k.next(1)};if((d.charAt(0)==="r"?i(l()):h(l()))&&m(l(),",")&&i(l())&&m(l(),",")&&i(l())&&(d==="rgb"||d==="hsa"||m(l(),",")&&h(l()))&&m(l(),")"))return e(b.ea,this.Ha.substring(j,this.ch));return f()}return e(b.pb,
+d)}return e(b.fa,d)}this.ch++;return e(b.ob,d)},z:function(){return this.U[this.wa-- -2]},all:function(){for(;this.next(););return this.U},da:function(c,e){for(var f=[],h,j;h=this.next();){if(c(h)){j=true;this.z();break}f.push(h)}return e&&!j?null:f}};return a}();var M=function(a){this.e=a};M.prototype={K:0,Qc:function(){var a=this.Ua,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Vc:function(){var a=this.Ua,b;return!a||(b=this.o())&&(a.i!==b.i||a.f!==b.f)},ub:function(){var a=this.e.getBoundingClientRect();
+return{x:a.left,y:a.top,i:a.right-a.left,f:a.bottom-a.top}},o:function(){return this.K?this.Da||(this.Da=this.ub()):this.ub()},Ec:function(){return!!this.Ua},Ja:function(){++this.K},La:function(){if(!--this.K){if(this.Da)this.Ua=this.Da;this.Da=null}}};(function(){function a(b){var c=g.p.ta(b);return function(){if(this.K){var e=this.rb||(this.rb={});return c in e?e[c]:(e[c]=b.call(this))}else return b.call(this)}}g.s={K:0,$:function(b){function c(e){this.e=e}g.p.fb(c.prototype,g.s,b);c.kc={};return c},
+m:function(){var b=this.qa(),c=this.constructor.kc;return b?b in c?c[b]:(c[b]=this.ba(b)):null},qa:a(function(){var b=this.e,c=this.constructor,e=b.style;b=b.currentStyle;var f=this.na,h=this.va,j=c.ic||(c.ic=g.F+f);c=c.jc||(c.jc=g.Sa+h.charAt(0).toUpperCase()+h.substring(1));return e[c]||b.getAttribute(j)||e[h]||b.getAttribute(f)}),g:a(function(){return!!this.m()}),D:a(function(){var b=this.qa(),c=b!==this.gc;this.gc=b;return c}),ma:a,Ja:function(){++this.K},La:function(){--this.K||delete this.rb}}})();
+g.Tb=g.s.$({na:g.F+"background",va:g.Sa+"Background",nc:{scroll:1,fixed:1,local:1},Ka:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},Nc:{"padding-box":1,"border-box":1,"content-box":1},rc:{"padding-box":1,"border-box":1},Rc:{top:1,right:1,bottom:1,left:1,center:1},Wc:{contain:1,cover:1},ba:function(a){function b(u){return u.Y()||u.h&i&&u.d in t}function c(u){return u.Y()&&g.k(u.d)||u.d==="auto"&&"auto"}var e=this.e.currentStyle,f,h,j=g.u.ja,d=j.ha,i=j.fa,k=j.ea,m,l,t=this.Rc,n,p,s=null;if(this.$a()){a=
+new g.u(a);s={M:[]};for(h={};f=a.next();){m=f.h;l=f.d;if(!h.P&&m&j.pb&&l==="linear-gradient"){n={ca:[],P:l};for(p={};f=a.next();){m=f.h;l=f.d;if(m&j.ob&&l===")"){p.color&&n.ca.push(p);n.ca.length>1&&g.p.fb(h,n);break}if(m&k){if(n.Xa||n.bb){f=a.z();if(f.h!==d)break;a.next()}p={color:g.pa(l)};f=a.next();if(f.Y())p.Fb=g.k(f.d);else a.z()}else if(m&j.xa&&!n.Xa&&!p.color&&!n.ca.length)n.Xa=new g.Rb(f.d);else if(b(f)&&!n.bb&&!p.color&&!n.ca.length){a.z();n.bb=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&
+d&&l===","){if(p.color){n.ca.push(p);p={}}}else break}}else if(!h.P&&m&j.URL){h.Cb=l;h.P="image"}else if(b(f)&&!h.size){a.z();h.Ya=new g.Na(a.da(function(u){return!b(u)},false))}else if(m&i)if(l in this.Ka)h.Bb=l;else if(l in this.Nc){h.kd=l;if(l in this.rc)h.clip=l}else{if(l in this.nc)h.jd=l}else if(m&k&&!s.color)s.color=g.pa(l);else if(m&d)if(l==="/"){f=a.next();m=f.h;l=f.d;if(m&i&&l in this.Wc)h.size=l;else if(l=c(f))h.size={i:l,f:c(a.next())||a.z()&&l}}else{if(l===","&&h.P){s.M.push(h);h={}}}else return null}h.P&&
+s.M.push(h)}else this.Nb(function(){var u=e.backgroundPositionX,w=e.backgroundPositionY,r=e.backgroundImage,o=e.backgroundColor;s={};if(o!=="transparent")s.color=g.pa(o);if(r!=="none")s.M=[{P:"image",Cb:(new g.u(r)).next().d,Bb:e.backgroundRepeat,Ya:new g.Na((new g.u(u+" "+w)).all())}]});return s&&(s.color||s.M&&s.M[0])?s:null},Nb:function(a){var b=this.e.runtimeStyle,c=b.backgroundImage,e=b.backgroundColor;if(c)b.backgroundImage="";if(e)b.backgroundColor="";a=a.call(this);if(c)b.backgroundImage=
+c;if(e)b.backgroundColor=e;return a},qa:g.s.ma(function(){return this.$a()||this.Nb(function(){var a=this.e.currentStyle;return a.backgroundColor+" "+a.backgroundImage+" "+a.backgroundRepeat+" "+a.backgroundPositionX+" "+a.backgroundPositionY})}),$a:g.s.ma(function(){var a=this.e;return a.style[this.va]||a.currentStyle.getAttribute(this.na)}),Eb:function(){var a=0;if(g.J<7){a=this.e;a=""+(a.style[g.Sa+"PngFix"]||a.currentStyle.getAttribute(g.F+"png-fix"))==="true"}return a},g:g.s.ma(function(){return(this.$a()||
+this.Eb())&&!!this.m()})});g.Xb=g.s.$({Ib:["Top","Right","Bottom","Left"],Kc:{thin:"1px",medium:"3px",thick:"5px"},ba:function(){var a={},b={},c={},e=false,f=true,h=true,j=true;this.Ob(function(){for(var d=this.e.currentStyle,i=0,k,m,l,t,n,p,s;i<4;i++){l=this.Ib[i];s=l.charAt(0).toLowerCase();k=b[s]=d["border"+l+"Style"];m=d["border"+l+"Color"];l=d["border"+l+"Width"];if(i>0){if(k!==t)h=false;if(m!==n)f=false;if(l!==p)j=false}t=k;n=m;p=l;c[s]=g.pa(m);l=a[s]=g.k(b[s]==="none"?"0":this.Kc[l]||l);if(l.a(this.e)>
+0)e=true}});return e?{nb:a,Zc:b,tc:c,ed:j,uc:f,$c:h}:null},qa:g.s.ma(function(){var a=this.e,b=a.currentStyle,c;a.tagName in g.Jb&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Ob(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Ob:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,e=b.borderColor;if(c)b.borderWidth="";if(e)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(e)b.borderColor=e;return a}});(function(){g.Oa=g.s.$({na:"border-radius",
+va:"borderRadius",ba:function(b){var c=null,e,f,h,j,d=false;if(b){f=new g.u(b);var i=function(){for(var k=[],m;(h=f.next())&&h.Y();){j=g.k(h.d);m=j.vb();if(m<0)return null;if(m>0)d=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=i()){if(h){if(h.h&g.u.ja.ha&&h.d==="/")e=i()}else e=b;if(d&&b&&e)c={x:b,y:e}}}return c}});var a=g.k("0");a={tl:a,tr:a,br:a,bl:a};g.Oa.Qb={x:a,y:a}})();g.Vb=g.s.$({na:"border-image",va:"borderImage",Ka:{stretch:1,
+round:1,repeat:1,space:1},ba:function(a){var b=null,c,e,f,h,j,d,i=0,k,m=g.u.ja,l=m.fa,t=m.ga,n=m.A,p=m.Aa;if(a){c=new g.u(a);b={};for(var s=function(r){return r&&r.h&m.ha&&r.d==="/"},u=function(r){return r&&r.h&l&&r.d==="fill"},w=function(){h=c.da(function(r){return!(r.h&(t|p))});if(u(c.next())&&!b.fill)b.fill=true;else c.z();if(s(c.next())){i++;j=c.da(function(){return!(e.h&(t|p|n))&&!(e.h&l&&e.d==="auto")});if(s(c.next())){i++;d=c.da(function(){return!(e.h&(t|n))})}}else c.z()};e=c.next();){a=e.h;
+f=e.d;if(a&(t|p)&&!h){c.z();w()}else if(u(e)&&!b.fill){b.fill=true;w()}else if(a&l&&this.Ka[f]&&!b.repeat){b.repeat={f:f};if(e=c.next())if(e.h&l&&this.Ka[e.d])b.repeat.kb=e.d;else c.z()}else if(a&m.URL&&!b.src)b.src=f;else return null}if(!b.src||!h||h.length<1||h.length>4||j&&j.length>4||i===1&&j.length<1||d&&d.length>4||i===2&&d.length<1)return null;if(!b.repeat)b.repeat={f:"stretch"};if(!b.repeat.kb)b.repeat.kb=b.repeat.f;a=function(r,o){return{T:o(r[0]),S:o(r[1]||r[0]),L:o(r[2]||r[0]),Q:o(r[3]||
+r[1]||r[0])}};b.slice=a(h,function(r){return g.k(r.h&t?r.d+"px":r.d)});b.width=j&&j.length>0?a(j,function(r){return r.h&(n|p)?g.k(r.d):r.d}):(k=this.e.currentStyle)&&{T:g.k(k.borderTopWidth),S:g.k(k.borderRightWidth),L:g.k(k.borderBottomWidth),Q:g.k(k.borderLeftWidth)};b.ua=a(d||[0],function(r){return r.h&n?g.k(r.d):r.d})}return b}});g.Zb=g.s.$({na:"box-shadow",va:"boxShadow",ba:function(a){var b,c=g.k,e=g.u.ja,f;if(a){f=new g.u(a);b={ua:[],cb:[]};for(a=function(){for(var h,j,d,i,k,m;h=f.next();){d=
+h.d;j=h.h;if(j&e.ha&&d===",")break;else if(h.db()&&!k){f.z();k=f.da(function(l){return!l.db()})}else if(j&e.ea&&!i)i=d;else if(j&e.fa&&d==="inset"&&!m)m=true;else return false}h=k&&k.length;if(h>1&&h<5){(m?b.cb:b.ua).push({fd:c(k[0].d),gd:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Xc:c(k[3]?k[3].d:"0"),color:g.pa(i||"currentColor")});return true}return false};a(););}return b&&(b.cb.length||b.ua.length)?b:null}});g.ec=g.s.$({qa:g.s.ma(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),
+ba:function(){var a=this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,e;b.visibility="";e=a.visibility;b.visibility=c;return{cd:e!=="hidden",xc:a.display!=="none"}},g:function(){return false}});g.B={Z:function(a){function b(c,e,f,h){this.e=c;this.q=e;this.j=f;this.parent=h}g.p.fb(b.prototype,g.B,a);return b},eb:false,R:function(){return false},Kb:function(){this.n();this.g()&&this.X()},jb:function(){this.eb=true},Lb:function(){this.g()?this.X():this.n()},Wa:function(a,b){this.Hb(a);for(var c=
+this.ka||(this.ka=[]),e=a+1,f=c.length,h;e<f;e++)if(h=c[e])break;c[a]=b;this.w().insertBefore(b,h||null)},ra:function(a){var b=this.ka;return b&&b[a]||null},Hb:function(a){var b=this.ra(a),c=this.Ba;if(b&&c){c.removeChild(b);this.ka[a]=null}},sa:function(a,b,c,e){var f=this.Va||(this.Va={}),h=f[a];if(!h){h=f[a]=g.p.Ga("shape");if(b)h.appendChild(h[b]=g.p.Ga(b));if(e){c=this.ra(e);if(!c){this.Wa(e,doc.createElement("group"+e));c=this.ra(e)}}c.appendChild(h);a=h.style;a.position="absolute";a.left=a.top=
+0;a.behavior="url(#default#VML)"}return h},Za:function(a){var b=this.Va,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},xb:function(a){var b=this.e,c=this.q.o(),e=c.i,f=c.f,h,j,d,i,k,m;c=a.x.tl.a(b,e);h=a.y.tl.a(b,f);j=a.x.tr.a(b,e);d=a.y.tr.a(b,f);i=a.x.br.a(b,e);k=a.y.br.a(b,f);m=a.x.bl.a(b,e);a=a.y.bl.a(b,f);e=Math.min(e/(c+j),f/(d+k),e/(m+i),f/(h+a));if(e<1){c*=e;h*=e;j*=e;d*=e;i*=e;k*=e;m*=e;a*=e}return{x:{tl:c,tr:j,br:i,bl:m},y:{tl:h,tr:d,br:k,bl:a}}},oa:function(a,b,c){b=
+b||1;var e,f,h=this.q.o();f=h.i*b;h=h.f*b;var j=this.j.v,d=Math.floor,i=Math.ceil,k=a?a.T*b:0,m=a?a.S*b:0,l=a?a.L*b:0;a=a?a.Q*b:0;var t,n,p,s,u;if(c||j.g()){e=this.xb(c||j.m());c=e.x.tl*b;j=e.y.tl*b;t=e.x.tr*b;n=e.y.tr*b;p=e.x.br*b;s=e.y.br*b;u=e.x.bl*b;b=e.y.bl*b;f="m"+d(a)+","+d(j)+"qy"+d(c)+","+d(k)+"l"+i(f-t)+","+d(k)+"qx"+i(f-m)+","+d(n)+"l"+i(f-m)+","+i(h-s)+"qy"+i(f-p)+","+i(h-l)+"l"+d(u)+","+i(h-l)+"qx"+d(a)+","+i(h-b)+" x e"}else f="m"+d(a)+","+d(k)+"l"+i(f-m)+","+d(k)+"l"+i(f-m)+","+i(h-
+l)+"l"+d(a)+","+i(h-l)+"xe";return f},w:function(){var a=this.parent.ra(this.C),b;if(!a){a=doc.createElement(this.Fa);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.Wa(this.C,a)}return a},n:function(){this.parent.Hb(this.C);delete this.Va;delete this.ka}};g.cc=g.B.Z({g:function(){var a=this.oc;for(var b in a)if(a.hasOwnProperty(b)&&a[b].g())return true;return false},R:function(){return this.j.lb.D()},jb:function(){if(this.g()){var a=this.wb(),b=a,c;a=a.currentStyle;var e=a.position,f=
+this.w().style,h=0,j=0;j=this.q.o();if(e==="fixed"&&g.J>6){h=j.x;j=j.y;b=e}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;h=j.x-c.left-(parseFloat(b.borderLeftWidth)||0);j=j.y-c.top-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;h=j.x+b.scrollLeft-b.clientLeft;j=j.y+b.scrollTop-b.clientTop}b="absolute"}f.position=b;f.left=h;f.top=j;f.zIndex=e==="static"?-1:a.zIndex;this.eb=true}},Lb:function(){},Mb:function(){var a=
+this.j.lb.m();this.w().style.display=a.cd&&a.xc?"":"none"},Kb:function(){this.g()?this.Mb():this.n()},wb:function(){var a=this.e;return a.tagName in g.Jb?a.offsetParent:a},w:function(){var a=this.Ba,b;if(!a){b=this.wb();a=this.Ba=doc.createElement("css3-container");a.style.direction="ltr";this.Mb();b.parentNode.insertBefore(a,b)}return a},n:function(){var a=this.Ba,b;if(a&&(b=a.parentNode))b.removeChild(a);delete this.Ba;delete this.ka}});g.Sb=g.B.Z({C:2,Fa:"background",R:function(){var a=this.j;
+return a.H.D()||a.v.D()},g:function(){var a=this.j;return a.N.g()||a.v.g()||a.H.g()||a.W.g()&&a.W.m().cb},X:function(){var a=this.q.o();if(a.i&&a.f){this.yc();this.zc()}},yc:function(){var a=this.j.H.m(),b=this.q.o(),c=this.e,e=a&&a.color,f,h;if(e&&e.la()>0){this.yb();a=this.sa("bgColor","fill",this.w(),1);f=b.i;b=b.f;a.stroked=false;a.coordsize=f*2+","+b*2;a.coordorigin="1,1";a.path=this.oa(null,2);h=a.style;h.width=f;h.height=b;a.fill.color=e.O(c);c=e.la();if(c<1)a.fill.opacity=c}else this.Za("bgColor")},
+zc:function(){var a=this.j.H.m(),b=this.q.o();a=a&&a.M;var c,e,f,h,j;if(a){this.yb();e=b.i;f=b.f;for(j=a.length;j--;){b=a[j];c=this.sa("bgImage"+j,"fill",this.w(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=e*2+","+f*2;c.coordorigin="1,1";c.path=this.oa(0,2);h=c.style;h.width=e;h.height=f;if(b.P==="linear-gradient")this.mc(c,b);else{c.fill.src=b.Cb;this.Pc(c,j)}}}for(j=a?a.length:0;this.Za("bgImage"+j++););},Pc:function(a,b){g.p.Pb(a.fill.src,function(c){var e=a.fill,f=this.e,
+h=this.q.o(),j=h.i;h=h.f;var d=this.j,i=d.I.m(),k=i&&i.nb;i=k?k.t.a(f):0;var m=k?k.r.a(f):0,l=k?k.b.a(f):0;k=k?k.l.a(f):0;d=d.H.m().M[b];f=d.Ya?d.Ya.coords(f,j-c.i-k-m,h-c.f-i-l):{x:0,y:0};d=d.Bb;l=m=0;var t=j+1,n=h+1,p=g.J===8?0:1;k=Math.round(f.x)+k+0.5;i=Math.round(f.y)+i+0.5;e.position=k/j+","+i/h;if(d&&d!=="repeat"){if(d==="repeat-x"||d==="no-repeat"){m=i+1;n=i+c.f+p}if(d==="repeat-y"||d==="no-repeat"){l=k+1;t=k+c.i+p}a.style.clip="rect("+m+"px,"+t+"px,"+n+"px,"+l+"px)"}},this)},mc:function(a,
+b){function c(B,C,z,F,H){if(z===0||z===180)return[F,C];else if(z===90||z===270)return[B,H];else{z=Math.tan(-z*t/180);B=z*B-C;C=-1/z;F=C*F-H;H=C-z;return[(F-B)/H,(z*F-C*B)/H]}}function e(){w=m>=90&&m<270?i:0;r=m<180?k:0;o=i-w;x=k-r}function f(){for(;m<0;)m+=360;m%=360}function h(B,C){var z=C[0]-B[0];B=C[1]-B[1];return Math.abs(z===0?B:B===0?z:Math.sqrt(z*z+B*B))}var j=this.e,d=this.q.o(),i=d.i,k=d.f;a=a.fill;var m=b.Xa,l=b.bb;b=b.ca;d=b.length;var t=Math.PI,n,p,s,u,w,r,o,x,q,y,A,D;if(l){l=l.coords(j,
+i,k);n=l.x;p=l.y}if(m){m=m.vc();f();e();if(!l){n=w;p=r}l=c(n,p,m,o,x);s=l[0];u=l[1]}else if(l){s=i-n;u=k-p}else{n=p=s=0;u=k}l=s-n;q=u-p;if(m===void 0){m=!l?q<0?90:270:!q?l<0?180:0:-Math.atan2(q,l)/t*180;f();e()}l=m%90?Math.atan2(l*i/k,q)/t*180:m+90;l+=180;l%=360;y=h([n,p],[s,u]);s=h([w,r],c(w,r,m,o,x));u=[];p=h([n,p],c(n,p,m,w,r))/s*100;n=[];for(q=0;q<d;q++)n.push(b[q].Fb?b[q].Fb.a(j,y):q===0?0:q===d-1?y:null);for(q=1;q<d;q++){if(n[q]===null){A=n[q-1];y=q;do D=n[++y];while(D===null);n[q]=A+(D-A)/
+(y-q+1)}n[q]=Math.max(n[q],n[q-1])}for(q=0;q<d;q++)u.push(p+n[q]/s*100+"% "+b[q].color.O(j));a.angle=l;a.type="gradient";a.method="sigma";a.color=b[0].color.O(j);a.color2=b[d-1].color.O(j);a.colors.value=u.join(",")},yb:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},n:function(){g.B.n.call(this);var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});g.Wb=g.B.Z({C:4,Fa:"border",qc:{TABLE:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,
+IMG:1,HR:1,FIELDSET:1},Jc:{submit:1,button:1,reset:1},R:function(){var a=this.j;return a.I.D()||a.v.D()},g:function(){var a=this.j;return(a.N.g()||a.v.g()||a.H.g())&&a.I.g()},X:function(){var a=this.e,b=this.j.I.m(),c=this.q.o(),e=c.i;c=c.f;var f,h,j,d,i;if(b){this.Hc();b=this.Bc(2);d=0;for(i=b.length;d<i;d++){j=b[d];f=this.sa("borderPiece"+d,j.stroke?"stroke":"fill",this.w());f.coordsize=e*2+","+c*2;f.coordorigin="1,1";f.path=j.path;h=f.style;h.width=e;h.height=c;f.filled=!!j.fill;f.stroked=!!j.stroke;
+if(j.stroke){f=f.stroke;f.weight=j.mb+"px";f.color=j.color.O(a);f.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";f.linestyle=j.stroke==="double"&&j.mb>2?"ThinThin":"Single"}else f.fill.color=j.fill.O(a)}for(;this.Za("borderPiece"+d++););}},Hc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,e=a.tagName,f=g.J===6,h;if(f&&e in this.qc||e==="BUTTON"||e==="INPUT"&&a.type in this.Jc){c.borderWidth="";e=this.j.I.Ib;for(h=e.length;h--;){f=e[h];c["padding"+f]="";c["padding"+
+f]=g.k(b["padding"+f]).a(a)+g.k(b["border"+f+"Width"]).a(a)+(!g.J===8&&h%2?1:0)}c.borderWidth=0}else if(f){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");e=b.style;e.visibility="visible";for(e.zoom=1;e=a.firstChild;)b.appendChild(e);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},Bc:function(a){var b=this.e,c,e,f,h=this.j.I,j=[],d,i,k,m,l=Math.round,t,n,p;if(h.g()){c=h.m();h=c.nb;n=c.Zc;p=c.tc;if(c.ed&&c.$c&&c.uc){if(p.t.la()>
+0){c=h.t.a(b);k=c/2;j.push({path:this.oa({T:k,S:k,L:k,Q:k},a),stroke:n.t,color:p.t,mb:c})}}else{a=a||1;c=this.q.o();e=c.i;f=c.f;c=l(h.t.a(b));k=l(h.r.a(b));m=l(h.b.a(b));b=l(h.l.a(b));var s={t:c,r:k,b:m,l:b};b=this.j.v;if(b.g())t=this.xb(b.m());d=Math.floor;i=Math.ceil;var u=function(o,x){return t?t[o][x]:0},w=function(o,x,q,y,A,D){var B=u("x",o),C=u("y",o),z=o.charAt(1)==="r";o=o.charAt(0)==="b";return B>0&&C>0?(D?"al":"ae")+(z?i(e-B):d(B))*a+","+(o?i(f-C):d(C))*a+","+(d(B)-x)*a+","+(d(C)-q)*a+","+
+y*65535+","+2949075*(A?1:-1):(D?"m":"l")+(z?e-x:x)*a+","+(o?f-q:q)*a},r=function(o,x,q,y){var A=o==="t"?d(u("x","tl"))*a+","+i(x)*a:o==="r"?i(e-x)*a+","+d(u("y","tr"))*a:o==="b"?i(e-u("x","br"))*a+","+d(f-x)*a:d(x)*a+","+i(f-u("y","bl"))*a;o=o==="t"?i(e-u("x","tr"))*a+","+i(x)*a:o==="r"?i(e-x)*a+","+i(f-u("y","br"))*a:o==="b"?d(u("x","bl"))*a+","+d(f-x)*a:d(x)*a+","+d(u("y","tl"))*a;return q?(y?"m"+o:"")+"l"+A:(y?"m"+A:"")+"l"+o};b=function(o,x,q,y,A,D){var B=o==="l"||o==="r",C=s[o],z,F;if(C>0&&n[o]!==
+"none"&&p[o].la()>0){z=s[B?o:x];x=s[B?x:o];F=s[B?o:q];q=s[B?q:o];if(n[o]==="dashed"||n[o]==="dotted"){j.push({path:w(y,z,x,D+45,0,1)+w(y,0,0,D,1,0),fill:p[o]});j.push({path:r(o,C/2,0,1),stroke:n[o],mb:C,color:p[o]});j.push({path:w(A,F,q,D,0,1)+w(A,0,0,D-45,1,0),fill:p[o]})}else j.push({path:w(y,z,x,D+45,0,1)+r(o,C,0,0)+w(A,F,q,D,0,0)+(n[o]==="double"&&C>2?w(A,F-d(F/3),q-d(q/3),D-45,1,0)+r(o,i(C/3*2),1,0)+w(y,z-d(z/3),x-d(x/3),D,1,0)+"x "+w(y,d(z/3),d(x/3),D+45,0,1)+r(o,d(C/3),1,0)+w(A,d(F/3),d(q/
+3),D,0,0):"")+w(A,0,0,D-45,1,0)+r(o,0,1,0)+w(y,0,0,D,1,0),fill:p[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},n:function(){g.B.n.call(this);this.e.runtimeStyle.borderColor=""}});g.Ub=g.B.Z({C:5,Oc:["t","tr","r","br","b","bl","l","tl","c"],R:function(){return this.j.N.D()},g:function(){return this.j.N.g()},X:function(){this.w();var a=this.j.N.m(),b=this.q.o(),c=this.e,e=this.Gb;g.p.Pb(a.src,function(f){function h(w,
+r,o,x,q){w=e[w].style;var y=Math.max;w.width=y(r,0);w.height=y(o,0);w.left=x;w.top=q}function j(w,r,o){for(var x=0,q=w.length;x<q;x++)e[w[x]].imagedata[r]=o}var d=b.i,i=b.f,k=a.width,m=k.T.a(c),l=k.S.a(c),t=k.L.a(c);k=k.Q.a(c);var n=a.slice,p=n.T.a(c),s=n.S.a(c),u=n.L.a(c);n=n.Q.a(c);h("tl",k,m,0,0);h("t",d-k-l,m,k,0);h("tr",l,m,d-l,0);h("r",l,i-m-t,d-l,m);h("br",l,t,d-l,i-t);h("b",d-k-l,t,k,i-t);h("bl",k,t,0,i-t);h("l",k,i-m-t,0,m);h("c",d-k-l,i-m-t,k,m);j(["tl","t","tr"],"cropBottom",(f.f-p)/f.f);
+j(["tl","l","bl"],"cropRight",(f.i-n)/f.i);j(["bl","b","br"],"cropTop",(f.f-u)/f.f);j(["tr","r","br"],"cropLeft",(f.i-s)/f.i);if(a.repeat.kb==="stretch"){j(["l","r","c"],"cropTop",p/f.f);j(["l","r","c"],"cropBottom",u/f.f)}if(a.repeat.f==="stretch"){j(["t","b","c"],"cropLeft",n/f.i);j(["t","b","c"],"cropRight",s/f.i)}e.c.style.display=a.fill?"":"none"},this)},w:function(){var a=this.parent.ra(this.C),b,c,e,f=this.Oc,h=f.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";
+this.Gb={};for(e=0;e<h;e++){c=this.Gb[f[e]]=g.p.Ga("rect");c.appendChild(g.p.Ga("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.j.N.m().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.Wa(this.C,a)}return a}});g.Yb=g.B.Z({C:1,Fa:"outset-box-shadow",R:function(){var a=this.j;return a.W.D()||a.v.D()},g:function(){var a=this.j.W;return a.g()&&a.m().ua[0]},X:function(){function a(z,F,H,K,J,v,E){z=b.sa("shadow"+z+F,"fill",
+e,j-z);F=z.fill;z.coordsize=m*2+","+l*2;z.coordorigin="1,1";z.stroked=false;z.filled=true;F.color=J.O(c);if(v){F.type="gradienttitle";F.color2=F.color;F.opacity=0}z.path=E;u=z.style;u.left=H;u.top=K;u.width=m;u.height=l;return z}var b=this,c=this.e,e=this.w(),f=this.j,h=f.W.m().ua;f=f.v.m();var j=h.length,d=j,i,k=this.q.o(),m=k.i,l=k.f;k=g.J===8?1:0;for(var t=["tl","tr","br","bl"],n,p,s,u,w,r,o,x,q,y,A,D,B,C;d--;){p=h[d];w=p.fd.a(c);r=p.gd.a(c);i=p.Xc.a(c);o=p.blur.a(c);p=p.color;x=-i-o;if(!f&&o)f=
+g.Oa.Qb;x=this.oa({T:x,S:x,L:x,Q:x},2,f);if(o){q=(i+o)*2+m;y=(i+o)*2+l;A=o*2/q;D=o*2/y;if(o-i>m/2||o-i>l/2)for(i=4;i--;){n=t[i];B=n.charAt(0)==="b";C=n.charAt(1)==="r";n=a(d,n,w,r,p,o,x);s=n.fill;s.focusposition=(C?1-A:A)+","+(B?1-D:D);s.focussize="0,0";n.style.clip="rect("+((B?y/2:0)+k)+"px,"+(C?q:q/2)+"px,"+(B?y:y/2)+"px,"+((C?q/2:0)+k)+"px)"}else{n=a(d,"",w,r,p,o,x);s=n.fill;s.focusposition=A+","+D;s.focussize=1-A*2+","+(1-D*2)}}else{n=a(d,"",w,r,p,o,x);w=p.la();if(w<1)n.fill.opacity=w}}}});g.bc=
+g.B.Z({C:6,Fa:"imgEl",R:function(){var a=this.j;return this.e.src!==this.hc||a.v.D()},g:function(){var a=this.j;return a.v.g()||a.H.Eb()},X:function(){this.hc=j;this.Gc();var a=this.sa("img","fill",this.w()),b=a.fill,c=this.q.o(),e=c.i;c=c.f;var f=this.j.I.m();f=f&&f.nb;var h=this.e,j=h.src,d=Math.round;a.stroked=false;b.type="frame";b.src=j;b.position=(e?0.5/e:0)+","+(c?0.5/c:0);a.coordsize=e*2+","+c*2;a.coordorigin="1,1";a.path=this.oa(f?{T:d(f.t.a(h)),S:d(f.r.a(h)),L:d(f.b.a(h)),Q:d(f.l.a(h))}:
+0,2);a=a.style;a.width=e;a.height=c},Gc:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},n:function(){g.B.n.call(this);this.e.runtimeStyle.filter=""}});g.Qa=function(){function a(d){function i(){if(!z){var v,E,G=d.currentStyle,I=G.getAttribute(c)==="true";J=G.getAttribute(e);J=g.Ab===8?J!=="false":J==="true";if(!C){C=1;d.runtimeStyle.zoom=1;G=d;for(var O=1;G=G.previousSibling;)if(G.nodeType===1){O=0;break}if(O)d.className+=" "+g.Pa+"first-child"}y.Ja();if(I&&(E=y.o())&&(v=doc.documentElement||
+doc.body)&&(E.y>v.clientHeight||E.x>v.clientWidth||E.y+E.f<0||E.x+E.i<0)){if(!H){H=1;g.Ra.aa(i)}}else{z=1;H=C=0;g.Ra.Ma(i);A={H:new g.Tb(d),I:new g.Xb(d),N:new g.Vb(d),v:new g.Oa(d),W:new g.Zb(d),lb:new g.ec(d)};D=[A.H,A.I,A.N,A.v,A.W,A.lb];v=new g.cc(d,y,A);E=[new g.Yb(d,y,A,v),new g.Sb(d,y,A,v),new g.Wb(d,y,A,v),new g.Ub(d,y,A,v)];d.tagName==="IMG"&&E.push(new g.bc(d,y,A,v));v.oc=E;q=[v].concat(E);if(v=d.currentStyle.getAttribute(g.F+"watch-ancestors")){B=[];v=parseInt(v,10);E=0;for(I=d.parentNode;I&&
+(v==="NaN"||E++<v);){B.push(I);I.attachEvent("onpropertychange",u);I.attachEvent("onmouseenter",p);I.attachEvent("onmouseleave",s);I=I.parentNode}}if(J){g.ya.aa(m);g.ya.Tc()}m(1)}if(!F){F=1;d.attachEvent("onmove",k);d.attachEvent("onresize",k);d.attachEvent("onpropertychange",l);d.attachEvent("onmouseenter",p);d.attachEvent("onmouseleave",s);g.za.aa(k);g.G.aa(o)}y.La()}}function k(){y&&y.Ec()&&m()}function m(v){if(!K)if(z){var E,G;w();if(v||y.Qc()){E=0;for(G=q.length;E<G;E++)q[E].jb()}if(v||y.Vc()){E=
+0;for(G=q.length;E<G;E++)q[E].Lb()}r()}else C||i()}function l(){var v,E,G;v=event;if(!K&&!(v&&v.propertyName in j))if(z){w();v=0;for(E=q.length;v<E;v++){G=q[v];G.eb||G.jb();G.R()&&G.Kb()}r()}else C||i()}function t(){if(d)d.className+=f}function n(){if(d)d.className=d.className.replace(h,"")}function p(){setTimeout(t,0)}function s(){setTimeout(n,0)}function u(){var v=event.propertyName;if(v==="className"||v==="id")l()}function w(){y.Ja();for(var v=D.length;v--;)D[v].Ja()}function r(){for(var v=D.length;v--;)D[v].La();
+y.La()}function o(){if(F){if(B)for(var v=0,E=B.length,G;v<E;v++){G=B[v];G.detachEvent("onpropertychange",u);G.detachEvent("onmouseenter",p);G.detachEvent("onmouseleave",s)}d.detachEvent("onmove",m);d.detachEvent("onresize",m);d.detachEvent("onpropertychange",l);d.detachEvent("onmouseenter",p);d.detachEvent("onmouseleave",s);g.G.Ma(o);F=0}}function x(){if(!K){var v,E;o();K=1;if(q){v=0;for(E=q.length;v<E;v++)q[v].n()}J&&g.ya.Ma(m);g.za.Ma(m);q=y=A=D=B=d=null}}var q,y=new M(d),A,D,B,C,z,F,H,K,J;this.Ic=
+i;this.update=m;this.n=x;this.Ac=d}var b={},c=g.F+"lazy-init",e=g.F+"poll",f=" "+g.Pa+"hover",h=new RegExp("\\b"+g.Pa+"hover\\b","g"),j={background:1,bgColor:1,display:1};a.Cc=function(d){var i=g.p.ta(d);return b[i]||(b[i]=new a(d))};a.n=function(d){d=g.p.ta(d);var i=b[d];if(i){i.n();delete b[d]}};a.wc=function(){var d=[],i;if(b){for(var k in b)if(b.hasOwnProperty(k)){i=b[k];d.push(i.Ac);i.n()}b={}}return d};return a}();g.attach=function(a){g.Ab<9&&g.Qa.Cc(a).Ic()};g.detach=function(a){g.Qa.n(a)}};
+var N=window.PIE,P=element;function init(){N&&doc.media!=="print"&&N.attach(P)}function cleanup(){if(N){N.detach(P);N=P=0}}P.readyState==="complete"&&init();
+</script>
+</PUBLIC:COMPONENT>

+ 13 - 0
web/static-templates/js/backups-control.js

@@ -0,0 +1,13 @@
+$(document).ready(function(){
+
+var area = $('.backups-list .detailed-restore-url');
+
+
+area.hover(
+	function() {
+		$(this).prev().hide();
+	}, 
+	function() {
+		$(this).prev().show();
+	});
+});

+ 3 - 0
web/static-templates/js/common.js

@@ -0,0 +1,3 @@
+$(document).ready(function(){
+	$('.remember-me').checkBox();
+});

+ 144 - 144
web/static-templates/js/custom-form-elements.js

@@ -1,144 +1,144 @@
-/*
-
-CUSTOM FORM ELEMENTS
-
-Created by Ryan Fait
-www.ryanfait.com
-
-The only things you may need to change in this file are the following
-variables: checkboxHeight, radioHeight and selectWidth (lines 24, 25, 26)
-
-The numbers you set for checkboxHeight and radioHeight should be one quarter
-of the total height of the image want to use for checkboxes and radio
-buttons. Both images should contain the four stages of both inputs stacked
-on top of each other in this order: unchecked, unchecked-clicked, checked,
-checked-clicked.
-
-You may need to adjust your images a bit if there is a slight vertical
-movement during the different stages of the button activation.
-
-The value of selectWidth should be the width of your select list image.
-
-Visit http://ryanfait.com/ for more information.
-
-*/
-
-var checkboxHeight = "25";
-var radioHeight = "25";
-var selectWidth = "210";
-
-
-/* No need to change anything after this */
-
-
-document.write('<style type="text/css">input.styled { display: none; } select.styled { position: relative; width: ' + selectWidth + 'px; opacity: 0; filter: alpha(opacity=0); z-index: 5; } .disabled { opacity: 0.5; filter: alpha(opacity=50); }</style>');
-
-var Custom = {
-	init: function() {
-		var inputs = document.getElementsByTagName("input"), span = Array(), textnode, option, active;
-		for(a = 0; a < inputs.length; a++) {
-			if((inputs[a].type == "checkbox" || inputs[a].type == "radio") && inputs[a].className == "styled") {
-				span[a] = document.createElement("span");
-				span[a].className = inputs[a].type;
-
-				if(inputs[a].checked == true) {
-					if(inputs[a].type == "checkbox") {
-						position = "0 -" + (checkboxHeight*2) + "px";
-						span[a].style.backgroundPosition = position;
-					} else {
-						position = "0 -" + (radioHeight*2) + "px";
-						span[a].style.backgroundPosition = position;
-					}
-				}
-				inputs[a].parentNode.insertBefore(span[a], inputs[a]);
-				inputs[a].onchange = Custom.clear;
-				if(!inputs[a].getAttribute("disabled")) {
-					span[a].onmousedown = Custom.pushed;
-					span[a].onmouseup = Custom.check;
-				} else {
-					span[a].className = span[a].className += " disabled";
-				}
-			}
-		}
-		inputs = document.getElementsByTagName("select");
-		for(a = 0; a < inputs.length; a++) {
-			if(inputs[a].className == "styled") {
-				option = inputs[a].getElementsByTagName("option");
-				active = option[0].childNodes[0].nodeValue;
-				textnode = document.createTextNode(active);
-				for(b = 0; b < option.length; b++) {
-					if(option[b].selected == true) {
-						textnode = document.createTextNode(option[b].childNodes[0].nodeValue);
-					}
-				}
-				span[a] = document.createElement("span");
-				span[a].className = "select";
-				span[a].id = "select" + inputs[a].name;
-				span[a].appendChild(textnode);
-				inputs[a].parentNode.insertBefore(span[a], inputs[a]);
-				if(!inputs[a].getAttribute("disabled")) {
-					inputs[a].onchange = Custom.choose;
-				} else {
-					inputs[a].previousSibling.className = inputs[a].previousSibling.className += " disabled";
-				}
-			}
-		}
-		document.onmouseup = Custom.clear;
-	},
-	pushed: function() {
-		element = this.nextSibling;
-		if(element.checked == true && element.type == "checkbox") {
-			this.style.backgroundPosition = "0 -" + checkboxHeight*3 + "px";
-		} else if(element.checked == true && element.type == "radio") {
-			this.style.backgroundPosition = "0 -" + radioHeight*3 + "px";
-		} else if(element.checked != true && element.type == "checkbox") {
-			this.style.backgroundPosition = "0 -" + checkboxHeight + "px";
-		} else {
-			this.style.backgroundPosition = "0 -" + radioHeight + "px";
-		}
-	},
-	check: function() {
-		element = this.nextSibling;
-		if(element.checked == true && element.type == "checkbox") {
-			this.style.backgroundPosition = "0 0";
-			element.checked = false;
-		} else {
-			if(element.type == "checkbox") {
-				this.style.backgroundPosition = "0 -" + checkboxHeight*2 + "px";
-			} else {
-				this.style.backgroundPosition = "0 -" + radioHeight*2 + "px";
-				group = this.nextSibling.name;
-				inputs = document.getElementsByTagName("input");
-				for(a = 0; a < inputs.length; a++) {
-					if(inputs[a].name == group && inputs[a] != this.nextSibling) {
-						inputs[a].previousSibling.style.backgroundPosition = "0 0";
-					}
-				}
-			}
-			element.checked = true;
-		}
-	},
-	clear: function() {
-		inputs = document.getElementsByTagName("input");
-		for(var b = 0; b < inputs.length; b++) {
-			if(inputs[b].type == "checkbox" && inputs[b].checked == true && inputs[b].className == "styled") {
-				inputs[b].previousSibling.style.backgroundPosition = "0 -" + checkboxHeight*2 + "px";
-			} else if(inputs[b].type == "checkbox" && inputs[b].className == "styled") {
-				inputs[b].previousSibling.style.backgroundPosition = "0 0";
-			} else if(inputs[b].type == "radio" && inputs[b].checked == true && inputs[b].className == "styled") {
-				inputs[b].previousSibling.style.backgroundPosition = "0 -" + radioHeight*2 + "px";
-			} else if(inputs[b].type == "radio" && inputs[b].className == "styled") {
-				inputs[b].previousSibling.style.backgroundPosition = "0 0";
-			}
-		}
-	},
-	choose: function() {
-		option = this.getElementsByTagName("option");
-		for(d = 0; d < option.length; d++) {
-			if(option[d].selected == true) 
-				document.getElementById("select" + this.name).childNodes[0].nodeValue = option[d].childNodes[0].nodeValue;
-			}
-		}
-	}
-}
-window.onload = Custom.init;
+/*
+
+CUSTOM FORM ELEMENTS
+
+Created by Ryan Fait
+www.ryanfait.com
+
+The only things you may need to change in this file are the following
+variables: checkboxHeight, radioHeight and selectWidth (lines 24, 25, 26)
+
+The numbers you set for checkboxHeight and radioHeight should be one quarter
+of the total height of the image want to use for checkboxes and radio
+buttons. Both images should contain the four stages of both inputs stacked
+on top of each other in this order: unchecked, unchecked-clicked, checked,
+checked-clicked.
+
+You may need to adjust your images a bit if there is a slight vertical
+movement during the different stages of the button activation.
+
+The value of selectWidth should be the width of your select list image.
+
+Visit http://ryanfait.com/ for more information.
+
+*/
+
+var checkboxHeight = "25";
+var radioHeight = "25";
+var selectWidth = "210";
+
+
+/* No need to change anything after this */
+
+
+document.write('<style type="text/css">input.styled { display: none; } select.styled { position: relative; width: ' + selectWidth + 'px; opacity: 0; filter: alpha(opacity=0); z-index: 5; }</style>');
+
+var Custom = {
+	init: function() {
+		var inputs = document.getElementsByTagName("input"), span = Array(), textnode, option, active;
+		for(a = 0; a < inputs.length; a++) {
+			if((inputs[a].type == "checkbox" || inputs[a].type == "radio") && inputs[a].className == "styled") {
+				span[a] = document.createElement("span");
+				span[a].className = inputs[a].type;
+
+				if(inputs[a].checked == true) {
+					if(inputs[a].type == "checkbox") {
+						position = "0 -" + (checkboxHeight*2) + "px";
+						span[a].style.backgroundPosition = position;
+					} else {
+						position = "0 -" + (radioHeight*2) + "px";
+						span[a].style.backgroundPosition = position;
+					}
+				}
+				inputs[a].parentNode.insertBefore(span[a], inputs[a]);
+				inputs[a].onchange = Custom.clear;
+				if(!inputs[a].getAttribute("disabled")) {
+					span[a].onmousedown = Custom.pushed;
+					span[a].onmouseup = Custom.check;
+				} else {
+					span[a].className = span[a].className += " disabled";
+				}
+			}
+		}
+		inputs = document.getElementsByTagName("select");
+		for(a = 0; a < inputs.length; a++) {
+			if(inputs[a].className == "styled") {
+				option = inputs[a].getElementsByTagName("option");
+				active = option[0].childNodes[0].nodeValue;
+				textnode = document.createTextNode(active);
+				for(b = 0; b < option.length; b++) {
+					if(option[b].selected == true) {
+						textnode = document.createTextNode(option[b].childNodes[0].nodeValue);
+					}
+				}
+				span[a] = document.createElement("span");
+				span[a].className = "select";
+				span[a].id = "select" + inputs[a].name;
+				span[a].appendChild(textnode);
+				inputs[a].parentNode.insertBefore(span[a], inputs[a]);
+				if(!inputs[a].getAttribute("disabled")) {
+					inputs[a].onchange = Custom.choose;
+				} else {
+					inputs[a].previousSibling.className = inputs[a].previousSibling.className += " disabled";
+				}
+			}
+		}
+		document.onmouseup = Custom.clear;
+	},
+	pushed: function() {
+		element = this.nextSibling;
+		if(element.checked == true && element.type == "checkbox") {
+			this.style.backgroundPosition = "0 -" + checkboxHeight*3 + "px";
+		} else if(element.checked == true && element.type == "radio") {
+			this.style.backgroundPosition = "0 -" + radioHeight*3 + "px";
+		} else if(element.checked != true && element.type == "checkbox") {
+			this.style.backgroundPosition = "0 -" + checkboxHeight + "px";
+		} else {
+			this.style.backgroundPosition = "0 -" + radioHeight + "px";
+		}
+	},
+	check: function() {
+		element = this.nextSibling;
+		if(element.checked == true && element.type == "checkbox") {
+			this.style.backgroundPosition = "0 0";
+			element.checked = false;
+		} else {
+			if(element.type == "checkbox") {
+				this.style.backgroundPosition = "0 -" + checkboxHeight*2 + "px";
+			} else {
+				this.style.backgroundPosition = "0 -" + radioHeight*2 + "px";
+				group = this.nextSibling.name;
+				inputs = document.getElementsByTagName("input");
+				for(a = 0; a < inputs.length; a++) {
+					if(inputs[a].name == group && inputs[a] != this.nextSibling) {
+						inputs[a].previousSibling.style.backgroundPosition = "0 0";
+					}
+				}
+			}
+			element.checked = true;
+		}
+	},
+	clear: function() {
+		inputs = document.getElementsByTagName("input");
+		for(var b = 0; b < inputs.length; b++) {
+			if(inputs[b].type == "checkbox" && inputs[b].checked == true && inputs[b].className == "styled") {
+				inputs[b].previousSibling.style.backgroundPosition = "0 -" + checkboxHeight*2 + "px";
+			} else if(inputs[b].type == "checkbox" && inputs[b].className == "styled") {
+				inputs[b].previousSibling.style.backgroundPosition = "0 0";
+			} else if(inputs[b].type == "radio" && inputs[b].checked == true && inputs[b].className == "styled") {
+				inputs[b].previousSibling.style.backgroundPosition = "0 -" + radioHeight*2 + "px";
+			} else if(inputs[b].type == "radio" && inputs[b].className == "styled") {
+				inputs[b].previousSibling.style.backgroundPosition = "0 0";
+			}
+		}
+	},
+	choose: function() {
+		option = this.getElementsByTagName("option");
+		for(d = 0; d < option.length; d++) {
+			if(option[d].selected == true) {
+				document.getElementById("select" + this.name).childNodes[0].nodeValue = option[d].childNodes[0].nodeValue;
+			}
+		}
+	}
+}
+window.onload = Custom.init;

+ 6240 - 0
web/static-templates/js/jquery-1.4.2.js

@@ -0,0 +1,6240 @@
+/*!
+ * jQuery JavaScript Library v1.4.2
+ * http://jquery.com/
+ *
+ * Copyright 2010, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2010, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Sat Feb 13 22:33:48 2010 -0500
+ */
+(function( window, undefined ) {
+
+// Define a local copy of jQuery
+var jQuery = function( selector, context ) {
+		// The jQuery object is actually just the init constructor 'enhanced'
+		return new jQuery.fn.init( selector, context );
+	},
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$,
+
+	// Use the correct document accordingly with window argument (sandbox)
+	document = window.document,
+
+	// A central reference to the root jQuery(document)
+	rootjQuery,
+
+	// A simple way to check for HTML strings or ID strings
+	// (both of which we optimize for)
+	quickExpr = /^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,
+
+	// Is it a simple selector
+	isSimple = /^.[^:#\[\.,]*$/,
+
+	// Check if a string has a non-whitespace character in it
+	rnotwhite = /\S/,
+
+	// Used for trimming whitespace
+	rtrim = /^(\s|\u00A0)+|(\s|\u00A0)+$/g,
+
+	// Match a standalone tag
+	rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+
+	// Keep a UserAgent string for use with jQuery.browser
+	userAgent = navigator.userAgent,
+
+	// For matching the engine and version of the browser
+	browserMatch,
+	
+	// Has the ready events already been bound?
+	readyBound = false,
+	
+	// The functions to execute on DOM ready
+	readyList = [],
+
+	// The ready event handler
+	DOMContentLoaded,
+
+	// Save a reference to some core methods
+	toString = Object.prototype.toString,
+	hasOwnProperty = Object.prototype.hasOwnProperty,
+	push = Array.prototype.push,
+	slice = Array.prototype.slice,
+	indexOf = Array.prototype.indexOf;
+
+jQuery.fn = jQuery.prototype = {
+	init: function( selector, context ) {
+		var match, elem, ret, doc;
+
+		// Handle $(""), $(null), or $(undefined)
+		if ( !selector ) {
+			return this;
+		}
+
+		// Handle $(DOMElement)
+		if ( selector.nodeType ) {
+			this.context = this[0] = selector;
+			this.length = 1;
+			return this;
+		}
+		
+		// The body element only exists once, optimize finding it
+		if ( selector === "body" && !context ) {
+			this.context = document;
+			this[0] = document.body;
+			this.selector = "body";
+			this.length = 1;
+			return this;
+		}
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			// Are we dealing with HTML string or an ID?
+			match = quickExpr.exec( selector );
+
+			// Verify a match, and that no context was specified for #id
+			if ( match && (match[1] || !context) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[1] ) {
+					doc = (context ? context.ownerDocument || context : document);
+
+					// If a single string is passed in and it's a single tag
+					// just do a createElement and skip the rest
+					ret = rsingleTag.exec( selector );
+
+					if ( ret ) {
+						if ( jQuery.isPlainObject( context ) ) {
+							selector = [ document.createElement( ret[1] ) ];
+							jQuery.fn.attr.call( selector, context, true );
+
+						} else {
+							selector = [ doc.createElement( ret[1] ) ];
+						}
+
+					} else {
+						ret = buildFragment( [ match[1] ], [ doc ] );
+						selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes;
+					}
+					
+					return jQuery.merge( this, selector );
+					
+				// HANDLE: $("#id")
+				} else {
+					elem = document.getElementById( match[2] );
+
+					if ( elem ) {
+						// Handle the case where IE and Opera return items
+						// by name instead of ID
+						if ( elem.id !== match[2] ) {
+							return rootjQuery.find( selector );
+						}
+
+						// Otherwise, we inject the element directly into the jQuery object
+						this.length = 1;
+						this[0] = elem;
+					}
+
+					this.context = document;
+					this.selector = selector;
+					return this;
+				}
+
+			// HANDLE: $("TAG")
+			} else if ( !context && /^\w+$/.test( selector ) ) {
+				this.selector = selector;
+				this.context = document;
+				selector = document.getElementsByTagName( selector );
+				return jQuery.merge( this, selector );
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return (context || rootjQuery).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return jQuery( context ).find( selector );
+			}
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( jQuery.isFunction( selector ) ) {
+			return rootjQuery.ready( selector );
+		}
+
+		if (selector.selector !== undefined) {
+			this.selector = selector.selector;
+			this.context = selector.context;
+		}
+
+		return jQuery.makeArray( selector, this );
+	},
+
+	// Start with an empty selector
+	selector: "",
+
+	// The current version of jQuery being used
+	jquery: "1.4.2",
+
+	// The default length of a jQuery object is 0
+	length: 0,
+
+	// The number of elements contained in the matched element set
+	size: function() {
+		return this.length;
+	},
+
+	toArray: function() {
+		return slice.call( this, 0 );
+	},
+
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+		return num == null ?
+
+			// Return a 'clean' array
+			this.toArray() :
+
+			// Return just the object
+			( num < 0 ? this.slice(num)[ 0 ] : this[ num ] );
+	},
+
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems, name, selector ) {
+		// Build a new jQuery matched element set
+		var ret = jQuery();
+
+		if ( jQuery.isArray( elems ) ) {
+			push.apply( ret, elems );
+		
+		} else {
+			jQuery.merge( ret, elems );
+		}
+
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+
+		ret.context = this.context;
+
+		if ( name === "find" ) {
+			ret.selector = this.selector + (this.selector ? " " : "") + selector;
+		} else if ( name ) {
+			ret.selector = this.selector + "." + name + "(" + selector + ")";
+		}
+
+		// Return the newly-formed element set
+		return ret;
+	},
+
+	// Execute a callback for every element in the matched set.
+	// (You can seed the arguments with an array of args, but this is
+	// only used internally.)
+	each: function( callback, args ) {
+		return jQuery.each( this, callback, args );
+	},
+	
+	ready: function( fn ) {
+		// Attach the listeners
+		jQuery.bindReady();
+
+		// If the DOM is already ready
+		if ( jQuery.isReady ) {
+			// Execute the function immediately
+			fn.call( document, jQuery );
+
+		// Otherwise, remember the function for later
+		} else if ( readyList ) {
+			// Add the function to the wait list
+			readyList.push( fn );
+		}
+
+		return this;
+	},
+	
+	eq: function( i ) {
+		return i === -1 ?
+			this.slice( i ) :
+			this.slice( i, +i + 1 );
+	},
+
+	first: function() {
+		return this.eq( 0 );
+	},
+
+	last: function() {
+		return this.eq( -1 );
+	},
+
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ),
+			"slice", slice.call(arguments).join(",") );
+	},
+
+	map: function( callback ) {
+		return this.pushStack( jQuery.map(this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		}));
+	},
+	
+	end: function() {
+		return this.prevObject || jQuery(null);
+	},
+
+	// For internal use only.
+	// Behaves like an Array's method, not like a jQuery method.
+	push: push,
+	sort: [].sort,
+	splice: [].splice
+};
+
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+
+jQuery.extend = jQuery.fn.extend = function() {
+	// copy reference to target object
+	var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options, name, src, copy;
+
+	// Handle a deep copy situation
+	if ( typeof target === "boolean" ) {
+		deep = target;
+		target = arguments[1] || {};
+		// skip the boolean and the target
+		i = 2;
+	}
+
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+		target = {};
+	}
+
+	// extend jQuery itself if only one argument is passed
+	if ( length === i ) {
+		target = this;
+		--i;
+	}
+
+	for ( ; i < length; i++ ) {
+		// Only deal with non-null/undefined values
+		if ( (options = arguments[ i ]) != null ) {
+			// Extend the base object
+			for ( name in options ) {
+				src = target[ name ];
+				copy = options[ name ];
+
+				// Prevent never-ending loop
+				if ( target === copy ) {
+					continue;
+				}
+
+				// Recurse if we're merging object literal values or arrays
+				if ( deep && copy && ( jQuery.isPlainObject(copy) || jQuery.isArray(copy) ) ) {
+					var clone = src && ( jQuery.isPlainObject(src) || jQuery.isArray(src) ) ? src
+						: jQuery.isArray(copy) ? [] : {};
+
+					// Never move original objects, clone them
+					target[ name ] = jQuery.extend( deep, clone, copy );
+
+				// Don't bring in undefined values
+				} else if ( copy !== undefined ) {
+					target[ name ] = copy;
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};
+
+jQuery.extend({
+	noConflict: function( deep ) {
+		window.$ = _$;
+
+		if ( deep ) {
+			window.jQuery = _jQuery;
+		}
+
+		return jQuery;
+	},
+	
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+	
+	// Handle when the DOM is ready
+	ready: function() {
+		// Make sure that the DOM is not already loaded
+		if ( !jQuery.isReady ) {
+			// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+			if ( !document.body ) {
+				return setTimeout( jQuery.ready, 13 );
+			}
+
+			// Remember that the DOM is ready
+			jQuery.isReady = true;
+
+			// If there are functions bound, to execute
+			if ( readyList ) {
+				// Execute all of them
+				var fn, i = 0;
+				while ( (fn = readyList[ i++ ]) ) {
+					fn.call( document, jQuery );
+				}
+
+				// Reset the list of functions
+				readyList = null;
+			}
+
+			// Trigger any bound ready events
+			if ( jQuery.fn.triggerHandler ) {
+				jQuery( document ).triggerHandler( "ready" );
+			}
+		}
+	},
+	
+	bindReady: function() {
+		if ( readyBound ) {
+			return;
+		}
+
+		readyBound = true;
+
+		// Catch cases where $(document).ready() is called after the
+		// browser event has already occurred.
+		if ( document.readyState === "complete" ) {
+			return jQuery.ready();
+		}
+
+		// Mozilla, Opera and webkit nightlies currently support this event
+		if ( document.addEventListener ) {
+			// Use the handy event callback
+			document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+			
+			// A fallback to window.onload, that will always work
+			window.addEventListener( "load", jQuery.ready, false );
+
+		// If IE event model is used
+		} else if ( document.attachEvent ) {
+			// ensure firing before onload,
+			// maybe late but safe also for iframes
+			document.attachEvent("onreadystatechange", DOMContentLoaded);
+			
+			// A fallback to window.onload, that will always work
+			window.attachEvent( "onload", jQuery.ready );
+
+			// If IE and not a frame
+			// continually check to see if the document is ready
+			var toplevel = false;
+
+			try {
+				toplevel = window.frameElement == null;
+			} catch(e) {}
+
+			if ( document.documentElement.doScroll && toplevel ) {
+				doScrollCheck();
+			}
+		}
+	},
+
+	// See test/unit/core.js for details concerning isFunction.
+	// Since version 1.3, DOM methods and functions like alert
+	// aren't supported. They return false on IE (#2968).
+	isFunction: function( obj ) {
+		return toString.call(obj) === "[object Function]";
+	},
+
+	isArray: function( obj ) {
+		return toString.call(obj) === "[object Array]";
+	},
+
+	isPlainObject: function( obj ) {
+		// Must be an Object.
+		// Because of IE, we also have to check the presence of the constructor property.
+		// Make sure that DOM nodes and window objects don't pass through, as well
+		if ( !obj || toString.call(obj) !== "[object Object]" || obj.nodeType || obj.setInterval ) {
+			return false;
+		}
+		
+		// Not own constructor property must be Object
+		if ( obj.constructor
+			&& !hasOwnProperty.call(obj, "constructor")
+			&& !hasOwnProperty.call(obj.constructor.prototype, "isPrototypeOf") ) {
+			return false;
+		}
+		
+		// Own properties are enumerated firstly, so to speed up,
+		// if last one is own, then all properties are own.
+	
+		var key;
+		for ( key in obj ) {}
+		
+		return key === undefined || hasOwnProperty.call( obj, key );
+	},
+
+	isEmptyObject: function( obj ) {
+		for ( var name in obj ) {
+			return false;
+		}
+		return true;
+	},
+	
+	error: function( msg ) {
+		throw msg;
+	},
+	
+	parseJSON: function( data ) {
+		if ( typeof data !== "string" || !data ) {
+			return null;
+		}
+
+		// Make sure leading/trailing whitespace is removed (IE can't handle it)
+		data = jQuery.trim( data );
+		
+		// Make sure the incoming data is actual JSON
+		// Logic borrowed from http://json.org/json2.js
+		if ( /^[\],:{}\s]*$/.test(data.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, "@")
+			.replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, "]")
+			.replace(/(?:^|:|,)(?:\s*\[)+/g, "")) ) {
+
+			// Try to use the native JSON parser first
+			return window.JSON && window.JSON.parse ?
+				window.JSON.parse( data ) :
+				(new Function("return " + data))();
+
+		} else {
+			jQuery.error( "Invalid JSON: " + data );
+		}
+	},
+
+	noop: function() {},
+
+	// Evalulates a script in a global context
+	globalEval: function( data ) {
+		if ( data && rnotwhite.test(data) ) {
+			// Inspired by code by Andrea Giammarchi
+			// http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
+			var head = document.getElementsByTagName("head")[0] || document.documentElement,
+				script = document.createElement("script");
+
+			script.type = "text/javascript";
+
+			if ( jQuery.support.scriptEval ) {
+				script.appendChild( document.createTextNode( data ) );
+			} else {
+				script.text = data;
+			}
+
+			// Use insertBefore instead of appendChild to circumvent an IE6 bug.
+			// This arises when a base node is used (#2709).
+			head.insertBefore( script, head.firstChild );
+			head.removeChild( script );
+		}
+	},
+
+	nodeName: function( elem, name ) {
+		return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
+	},
+
+	// args is for internal usage only
+	each: function( object, callback, args ) {
+		var name, i = 0,
+			length = object.length,
+			isObj = length === undefined || jQuery.isFunction(object);
+
+		if ( args ) {
+			if ( isObj ) {
+				for ( name in object ) {
+					if ( callback.apply( object[ name ], args ) === false ) {
+						break;
+					}
+				}
+			} else {
+				for ( ; i < length; ) {
+					if ( callback.apply( object[ i++ ], args ) === false ) {
+						break;
+					}
+				}
+			}
+
+		// A special, fast, case for the most common use of each
+		} else {
+			if ( isObj ) {
+				for ( name in object ) {
+					if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
+						break;
+					}
+				}
+			} else {
+				for ( var value = object[0];
+					i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
+			}
+		}
+
+		return object;
+	},
+
+	trim: function( text ) {
+		return (text || "").replace( rtrim, "" );
+	},
+
+	// results is for internal usage only
+	makeArray: function( array, results ) {
+		var ret = results || [];
+
+		if ( array != null ) {
+			// The window, strings (and functions) also have 'length'
+			// The extra typeof function check is to prevent crashes
+			// in Safari 2 (See: #3039)
+			if ( array.length == null || typeof array === "string" || jQuery.isFunction(array) || (typeof array !== "function" && array.setInterval) ) {
+				push.call( ret, array );
+			} else {
+				jQuery.merge( ret, array );
+			}
+		}
+
+		return ret;
+	},
+
+	inArray: function( elem, array ) {
+		if ( array.indexOf ) {
+			return array.indexOf( elem );
+		}
+
+		for ( var i = 0, length = array.length; i < length; i++ ) {
+			if ( array[ i ] === elem ) {
+				return i;
+			}
+		}
+
+		return -1;
+	},
+
+	merge: function( first, second ) {
+		var i = first.length, j = 0;
+
+		if ( typeof second.length === "number" ) {
+			for ( var l = second.length; j < l; j++ ) {
+				first[ i++ ] = second[ j ];
+			}
+		
+		} else {
+			while ( second[j] !== undefined ) {
+				first[ i++ ] = second[ j++ ];
+			}
+		}
+
+		first.length = i;
+
+		return first;
+	},
+
+	grep: function( elems, callback, inv ) {
+		var ret = [];
+
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			if ( !inv !== !callback( elems[ i ], i ) ) {
+				ret.push( elems[ i ] );
+			}
+		}
+
+		return ret;
+	},
+
+	// arg is for internal usage only
+	map: function( elems, callback, arg ) {
+		var ret = [], value;
+
+		// Go through the array, translating each of the items to their
+		// new value (or values).
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			value = callback( elems[ i ], i, arg );
+
+			if ( value != null ) {
+				ret[ ret.length ] = value;
+			}
+		}
+
+		return ret.concat.apply( [], ret );
+	},
+
+	// A global GUID counter for objects
+	guid: 1,
+
+	proxy: function( fn, proxy, thisObject ) {
+		if ( arguments.length === 2 ) {
+			if ( typeof proxy === "string" ) {
+				thisObject = fn;
+				fn = thisObject[ proxy ];
+				proxy = undefined;
+
+			} else if ( proxy && !jQuery.isFunction( proxy ) ) {
+				thisObject = proxy;
+				proxy = undefined;
+			}
+		}
+
+		if ( !proxy && fn ) {
+			proxy = function() {
+				return fn.apply( thisObject || this, arguments );
+			};
+		}
+
+		// Set the guid of unique handler to the same of original handler, so it can be removed
+		if ( fn ) {
+			proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+		}
+
+		// So proxy can be declared as an argument
+		return proxy;
+	},
+
+	// Use of jQuery.browser is frowned upon.
+	// More details: http://docs.jquery.com/Utilities/jQuery.browser
+	uaMatch: function( ua ) {
+		ua = ua.toLowerCase();
+
+		var match = /(webkit)[ \/]([\w.]+)/.exec( ua ) ||
+			/(opera)(?:.*version)?[ \/]([\w.]+)/.exec( ua ) ||
+			/(msie) ([\w.]+)/.exec( ua ) ||
+			!/compatible/.test( ua ) && /(mozilla)(?:.*? rv:([\w.]+))?/.exec( ua ) ||
+		  	[];
+
+		return { browser: match[1] || "", version: match[2] || "0" };
+	},
+
+	browser: {}
+});
+
+browserMatch = jQuery.uaMatch( userAgent );
+if ( browserMatch.browser ) {
+	jQuery.browser[ browserMatch.browser ] = true;
+	jQuery.browser.version = browserMatch.version;
+}
+
+// Deprecated, use jQuery.browser.webkit instead
+if ( jQuery.browser.webkit ) {
+	jQuery.browser.safari = true;
+}
+
+if ( indexOf ) {
+	jQuery.inArray = function( elem, array ) {
+		return indexOf.call( array, elem );
+	};
+}
+
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
+
+// Cleanup functions for the document ready method
+if ( document.addEventListener ) {
+	DOMContentLoaded = function() {
+		document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+		jQuery.ready();
+	};
+
+} else if ( document.attachEvent ) {
+	DOMContentLoaded = function() {
+		// Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+		if ( document.readyState === "complete" ) {
+			document.detachEvent( "onreadystatechange", DOMContentLoaded );
+			jQuery.ready();
+		}
+	};
+}
+
+// The DOM ready check for Internet Explorer
+function doScrollCheck() {
+	if ( jQuery.isReady ) {
+		return;
+	}
+
+	try {
+		// If IE is used, use the trick by Diego Perini
+		// http://javascript.nwbox.com/IEContentLoaded/
+		document.documentElement.doScroll("left");
+	} catch( error ) {
+		setTimeout( doScrollCheck, 1 );
+		return;
+	}
+
+	// and execute any waiting functions
+	jQuery.ready();
+}
+
+function evalScript( i, elem ) {
+	if ( elem.src ) {
+		jQuery.ajax({
+			url: elem.src,
+			async: false,
+			dataType: "script"
+		});
+	} else {
+		jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+	}
+
+	if ( elem.parentNode ) {
+		elem.parentNode.removeChild( elem );
+	}
+}
+
+// Mutifunctional method to get and set values to a collection
+// The value/s can be optionally by executed if its a function
+function access( elems, key, value, exec, fn, pass ) {
+	var length = elems.length;
+	
+	// Setting many attributes
+	if ( typeof key === "object" ) {
+		for ( var k in key ) {
+			access( elems, k, key[k], exec, fn, value );
+		}
+		return elems;
+	}
+	
+	// Setting one attribute
+	if ( value !== undefined ) {
+		// Optionally, function values get executed if exec is true
+		exec = !pass && exec && jQuery.isFunction(value);
+		
+		for ( var i = 0; i < length; i++ ) {
+			fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+		}
+		
+		return elems;
+	}
+	
+	// Getting an attribute
+	return length ? fn( elems[0], key ) : undefined;
+}
+
+function now() {
+	return (new Date).getTime();
+}
+(function() {
+
+	jQuery.support = {};
+
+	var root = document.documentElement,
+		script = document.createElement("script"),
+		div = document.createElement("div"),
+		id = "script" + now();
+
+	div.style.display = "none";
+	div.innerHTML = "   <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+
+	var all = div.getElementsByTagName("*"),
+		a = div.getElementsByTagName("a")[0];
+
+	// Can't get basic test support
+	if ( !all || !all.length || !a ) {
+		return;
+	}
+
+	jQuery.support = {
+		// IE strips leading whitespace when .innerHTML is used
+		leadingWhitespace: div.firstChild.nodeType === 3,
+
+		// Make sure that tbody elements aren't automatically inserted
+		// IE will insert them into empty tables
+		tbody: !div.getElementsByTagName("tbody").length,
+
+		// Make sure that link elements get serialized correctly by innerHTML
+		// This requires a wrapper element in IE
+		htmlSerialize: !!div.getElementsByTagName("link").length,
+
+		// Get the style information from getAttribute
+		// (IE uses .cssText insted)
+		style: /red/.test( a.getAttribute("style") ),
+
+		// Make sure that URLs aren't manipulated
+		// (IE normalizes it by default)
+		hrefNormalized: a.getAttribute("href") === "/a",
+
+		// Make sure that element opacity exists
+		// (IE uses filter instead)
+		// Use a regex to work around a WebKit issue. See #5145
+		opacity: /^0.55$/.test( a.style.opacity ),
+
+		// Verify style float existence
+		// (IE uses styleFloat instead of cssFloat)
+		cssFloat: !!a.style.cssFloat,
+
+		// Make sure that if no value is specified for a checkbox
+		// that it defaults to "on".
+		// (WebKit defaults to "" instead)
+		checkOn: div.getElementsByTagName("input")[0].value === "on",
+
+		// Make sure that a selected-by-default option has a working selected property.
+		// (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+		optSelected: document.createElement("select").appendChild( document.createElement("option") ).selected,
+
+		parentNode: div.removeChild( div.appendChild( document.createElement("div") ) ).parentNode === null,
+
+		// Will be defined later
+		deleteExpando: true,
+		checkClone: false,
+		scriptEval: false,
+		noCloneEvent: true,
+		boxModel: null
+	};
+
+	script.type = "text/javascript";
+	try {
+		script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
+	} catch(e) {}
+
+	root.insertBefore( script, root.firstChild );
+
+	// Make sure that the execution of code works by injecting a script
+	// tag with appendChild/createTextNode
+	// (IE doesn't support this, fails, and uses .text instead)
+	if ( window[ id ] ) {
+		jQuery.support.scriptEval = true;
+		delete window[ id ];
+	}
+
+	// Test to see if it's possible to delete an expando from an element
+	// Fails in Internet Explorer
+	try {
+		delete script.test;
+	
+	} catch(e) {
+		jQuery.support.deleteExpando = false;
+	}
+
+	root.removeChild( script );
+
+	if ( div.attachEvent && div.fireEvent ) {
+		div.attachEvent("onclick", function click() {
+			// Cloning a node shouldn't copy over any
+			// bound event handlers (IE does this)
+			jQuery.support.noCloneEvent = false;
+			div.detachEvent("onclick", click);
+		});
+		div.cloneNode(true).fireEvent("onclick");
+	}
+
+	div = document.createElement("div");
+	div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
+
+	var fragment = document.createDocumentFragment();
+	fragment.appendChild( div.firstChild );
+
+	// WebKit doesn't clone checked state correctly in fragments
+	jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
+
+	// Figure out if the W3C box model works as expected
+	// document.body must exist before we can do this
+	jQuery(function() {
+		var div = document.createElement("div");
+		div.style.width = div.style.paddingLeft = "1px";
+
+		document.body.appendChild( div );
+		jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
+		document.body.removeChild( div ).style.display = 'none';
+
+		div = null;
+	});
+
+	// Technique from Juriy Zaytsev
+	// http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
+	var eventSupported = function( eventName ) { 
+		var el = document.createElement("div"); 
+		eventName = "on" + eventName; 
+
+		var isSupported = (eventName in el); 
+		if ( !isSupported ) { 
+			el.setAttribute(eventName, "return;"); 
+			isSupported = typeof el[eventName] === "function"; 
+		} 
+		el = null; 
+
+		return isSupported; 
+	};
+	
+	jQuery.support.submitBubbles = eventSupported("submit");
+	jQuery.support.changeBubbles = eventSupported("change");
+
+	// release memory in IE
+	root = script = div = all = a = null;
+})();
+
+jQuery.props = {
+	"for": "htmlFor",
+	"class": "className",
+	readonly: "readOnly",
+	maxlength: "maxLength",
+	cellspacing: "cellSpacing",
+	rowspan: "rowSpan",
+	colspan: "colSpan",
+	tabindex: "tabIndex",
+	usemap: "useMap",
+	frameborder: "frameBorder"
+};
+var expando = "jQuery" + now(), uuid = 0, windowData = {};
+
+jQuery.extend({
+	cache: {},
+	
+	expando:expando,
+
+	// The following elements throw uncatchable exceptions if you
+	// attempt to add expando properties to them.
+	noData: {
+		"embed": true,
+		"object": true,
+		"applet": true
+	},
+
+	data: function( elem, name, data ) {
+		if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+			return;
+		}
+
+		elem = elem == window ?
+			windowData :
+			elem;
+
+		var id = elem[ expando ], cache = jQuery.cache, thisCache;
+
+		if ( !id && typeof name === "string" && data === undefined ) {
+			return null;
+		}
+
+		// Compute a unique ID for the element
+		if ( !id ) { 
+			id = ++uuid;
+		}
+
+		// Avoid generating a new cache unless none exists and we
+		// want to manipulate it.
+		if ( typeof name === "object" ) {
+			elem[ expando ] = id;
+			thisCache = cache[ id ] = jQuery.extend(true, {}, name);
+
+		} else if ( !cache[ id ] ) {
+			elem[ expando ] = id;
+			cache[ id ] = {};
+		}
+
+		thisCache = cache[ id ];
+
+		// Prevent overriding the named cache with undefined values
+		if ( data !== undefined ) {
+			thisCache[ name ] = data;
+		}
+
+		return typeof name === "string" ? thisCache[ name ] : thisCache;
+	},
+
+	removeData: function( elem, name ) {
+		if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+			return;
+		}
+
+		elem = elem == window ?
+			windowData :
+			elem;
+
+		var id = elem[ expando ], cache = jQuery.cache, thisCache = cache[ id ];
+
+		// If we want to remove a specific section of the element's data
+		if ( name ) {
+			if ( thisCache ) {
+				// Remove the section of cache data
+				delete thisCache[ name ];
+
+				// If we've removed all the data, remove the element's cache
+				if ( jQuery.isEmptyObject(thisCache) ) {
+					jQuery.removeData( elem );
+				}
+			}
+
+		// Otherwise, we want to remove all of the element's data
+		} else {
+			if ( jQuery.support.deleteExpando ) {
+				delete elem[ jQuery.expando ];
+
+			} else if ( elem.removeAttribute ) {
+				elem.removeAttribute( jQuery.expando );
+			}
+
+			// Completely remove the data cache
+			delete cache[ id ];
+		}
+	}
+});
+
+jQuery.fn.extend({
+	data: function( key, value ) {
+		if ( typeof key === "undefined" && this.length ) {
+			return jQuery.data( this[0] );
+
+		} else if ( typeof key === "object" ) {
+			return this.each(function() {
+				jQuery.data( this, key );
+			});
+		}
+
+		var parts = key.split(".");
+		parts[1] = parts[1] ? "." + parts[1] : "";
+
+		if ( value === undefined ) {
+			var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+
+			if ( data === undefined && this.length ) {
+				data = jQuery.data( this[0], key );
+			}
+			return data === undefined && parts[1] ?
+				this.data( parts[0] ) :
+				data;
+		} else {
+			return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function() {
+				jQuery.data( this, key, value );
+			});
+		}
+	},
+
+	removeData: function( key ) {
+		return this.each(function() {
+			jQuery.removeData( this, key );
+		});
+	}
+});
+jQuery.extend({
+	queue: function( elem, type, data ) {
+		if ( !elem ) {
+			return;
+		}
+
+		type = (type || "fx") + "queue";
+		var q = jQuery.data( elem, type );
+
+		// Speed up dequeue by getting out quickly if this is just a lookup
+		if ( !data ) {
+			return q || [];
+		}
+
+		if ( !q || jQuery.isArray(data) ) {
+			q = jQuery.data( elem, type, jQuery.makeArray(data) );
+
+		} else {
+			q.push( data );
+		}
+
+		return q;
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ), fn = queue.shift();
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+		}
+
+		if ( fn ) {
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift("inprogress");
+			}
+
+			fn.call(elem, function() {
+				jQuery.dequeue(elem, type);
+			});
+		}
+	}
+});
+
+jQuery.fn.extend({
+	queue: function( type, data ) {
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+		}
+
+		if ( data === undefined ) {
+			return jQuery.queue( this[0], type );
+		}
+		return this.each(function( i, elem ) {
+			var queue = jQuery.queue( this, type, data );
+
+			if ( type === "fx" && queue[0] !== "inprogress" ) {
+				jQuery.dequeue( this, type );
+			}
+		});
+	},
+	dequeue: function( type ) {
+		return this.each(function() {
+			jQuery.dequeue( this, type );
+		});
+	},
+
+	// Based off of the plugin by Clint Helfers, with permission.
+	// http://blindsignals.com/index.php/2009/07/jquery-delay/
+	delay: function( time, type ) {
+		time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
+		type = type || "fx";
+
+		return this.queue( type, function() {
+			var elem = this;
+			setTimeout(function() {
+				jQuery.dequeue( elem, type );
+			}, time );
+		});
+	},
+
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	}
+});
+var rclass = /[\n\t]/g,
+	rspace = /\s+/,
+	rreturn = /\r/g,
+	rspecialurl = /href|src|style/,
+	rtype = /(button|input)/i,
+	rfocusable = /(button|input|object|select|textarea)/i,
+	rclickable = /^(a|area)$/i,
+	rradiocheck = /radio|checkbox/;
+
+jQuery.fn.extend({
+	attr: function( name, value ) {
+		return access( this, name, value, true, jQuery.attr );
+	},
+
+	removeAttr: function( name, fn ) {
+		return this.each(function(){
+			jQuery.attr( this, name, "" );
+			if ( this.nodeType === 1 ) {
+				this.removeAttribute( name );
+			}
+		});
+	},
+
+	addClass: function( value ) {
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.addClass( value.call(this, i, self.attr("class")) );
+			});
+		}
+
+		if ( value && typeof value === "string" ) {
+			var classNames = (value || "").split( rspace );
+
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var elem = this[i];
+
+				if ( elem.nodeType === 1 ) {
+					if ( !elem.className ) {
+						elem.className = value;
+
+					} else {
+						var className = " " + elem.className + " ", setClass = elem.className;
+						for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+							if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
+								setClass += " " + classNames[c];
+							}
+						}
+						elem.className = jQuery.trim( setClass );
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	removeClass: function( value ) {
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.removeClass( value.call(this, i, self.attr("class")) );
+			});
+		}
+
+		if ( (value && typeof value === "string") || value === undefined ) {
+			var classNames = (value || "").split(rspace);
+
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var elem = this[i];
+
+				if ( elem.nodeType === 1 && elem.className ) {
+					if ( value ) {
+						var className = (" " + elem.className + " ").replace(rclass, " ");
+						for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+							className = className.replace(" " + classNames[c] + " ", " ");
+						}
+						elem.className = jQuery.trim( className );
+
+					} else {
+						elem.className = "";
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	toggleClass: function( value, stateVal ) {
+		var type = typeof value, isBool = typeof stateVal === "boolean";
+
+		if ( jQuery.isFunction( value ) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal );
+			});
+		}
+
+		return this.each(function() {
+			if ( type === "string" ) {
+				// toggle individual class names
+				var className, i = 0, self = jQuery(this),
+					state = stateVal,
+					classNames = value.split( rspace );
+
+				while ( (className = classNames[ i++ ]) ) {
+					// check each className given, space seperated list
+					state = isBool ? state : !self.hasClass( className );
+					self[ state ? "addClass" : "removeClass" ]( className );
+				}
+
+			} else if ( type === "undefined" || type === "boolean" ) {
+				if ( this.className ) {
+					// store className if set
+					jQuery.data( this, "__className__", this.className );
+				}
+
+				// toggle whole className
+				this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || "";
+			}
+		});
+	},
+
+	hasClass: function( selector ) {
+		var className = " " + selector + " ";
+		for ( var i = 0, l = this.length; i < l; i++ ) {
+			if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+				return true;
+			}
+		}
+
+		return false;
+	},
+
+	val: function( value ) {
+		if ( value === undefined ) {
+			var elem = this[0];
+
+			if ( elem ) {
+				if ( jQuery.nodeName( elem, "option" ) ) {
+					return (elem.attributes.value || {}).specified ? elem.value : elem.text;
+				}
+
+				// We need to handle select boxes special
+				if ( jQuery.nodeName( elem, "select" ) ) {
+					var index = elem.selectedIndex,
+						values = [],
+						options = elem.options,
+						one = elem.type === "select-one";
+
+					// Nothing was selected
+					if ( index < 0 ) {
+						return null;
+					}
+
+					// Loop through all the selected options
+					for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+						var option = options[ i ];
+
+						if ( option.selected ) {
+							// Get the specifc value for the option
+							value = jQuery(option).val();
+
+							// We don't need an array for one selects
+							if ( one ) {
+								return value;
+							}
+
+							// Multi-Selects return an array
+							values.push( value );
+						}
+					}
+
+					return values;
+				}
+
+				// Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+				if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
+					return elem.getAttribute("value") === null ? "on" : elem.value;
+				}
+				
+
+				// Everything else, we just grab the value
+				return (elem.value || "").replace(rreturn, "");
+
+			}
+
+			return undefined;
+		}
+
+		var isFunction = jQuery.isFunction(value);
+
+		return this.each(function(i) {
+			var self = jQuery(this), val = value;
+
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
+
+			if ( isFunction ) {
+				val = value.call(this, i, self.val());
+			}
+
+			// Typecast each time if the value is a Function and the appended
+			// value is therefore different each time.
+			if ( typeof val === "number" ) {
+				val += "";
+			}
+
+			if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
+				this.checked = jQuery.inArray( self.val(), val ) >= 0;
+
+			} else if ( jQuery.nodeName( this, "select" ) ) {
+				var values = jQuery.makeArray(val);
+
+				jQuery( "option", this ).each(function() {
+					this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+				});
+
+				if ( !values.length ) {
+					this.selectedIndex = -1;
+				}
+
+			} else {
+				this.value = val;
+			}
+		});
+	}
+});
+
+jQuery.extend({
+	attrFn: {
+		val: true,
+		css: true,
+		html: true,
+		text: true,
+		data: true,
+		width: true,
+		height: true,
+		offset: true
+	},
+		
+	attr: function( elem, name, value, pass ) {
+		// don't set attributes on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return undefined;
+		}
+
+		if ( pass && name in jQuery.attrFn ) {
+			return jQuery(elem)[name](value);
+		}
+
+		var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ),
+			// Whether we are setting (or getting)
+			set = value !== undefined;
+
+		// Try to normalize/fix the name
+		name = notxml && jQuery.props[ name ] || name;
+
+		// Only do all the following if this is a node (faster for style)
+		if ( elem.nodeType === 1 ) {
+			// These attributes require special treatment
+			var special = rspecialurl.test( name );
+
+			// Safari mis-reports the default selected property of an option
+			// Accessing the parent's selectedIndex property fixes it
+			if ( name === "selected" && !jQuery.support.optSelected ) {
+				var parent = elem.parentNode;
+				if ( parent ) {
+					parent.selectedIndex;
+	
+					// Make sure that it also works with optgroups, see #5701
+					if ( parent.parentNode ) {
+						parent.parentNode.selectedIndex;
+					}
+				}
+			}
+
+			// If applicable, access the attribute via the DOM 0 way
+			if ( name in elem && notxml && !special ) {
+				if ( set ) {
+					// We can't allow the type property to be changed (since it causes problems in IE)
+					if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
+						jQuery.error( "type property can't be changed" );
+					}
+
+					elem[ name ] = value;
+				}
+
+				// browsers index elements by id/name on forms, give priority to attributes.
+				if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
+					return elem.getAttributeNode( name ).nodeValue;
+				}
+
+				// elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+				// http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+				if ( name === "tabIndex" ) {
+					var attributeNode = elem.getAttributeNode( "tabIndex" );
+
+					return attributeNode && attributeNode.specified ?
+						attributeNode.value :
+						rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+							0 :
+							undefined;
+				}
+
+				return elem[ name ];
+			}
+
+			if ( !jQuery.support.style && notxml && name === "style" ) {
+				if ( set ) {
+					elem.style.cssText = "" + value;
+				}
+
+				return elem.style.cssText;
+			}
+
+			if ( set ) {
+				// convert the value to a string (all browsers do this but IE) see #1070
+				elem.setAttribute( name, "" + value );
+			}
+
+			var attr = !jQuery.support.hrefNormalized && notxml && special ?
+					// Some attributes require a special call on IE
+					elem.getAttribute( name, 2 ) :
+					elem.getAttribute( name );
+
+			// Non-existent attributes return null, we normalize to undefined
+			return attr === null ? undefined : attr;
+		}
+
+		// elem is actually elem.style ... set the style
+		// Using attr for specific style information is now deprecated. Use style instead.
+		return jQuery.style( elem, name, value );
+	}
+});
+var rnamespaces = /\.(.*)$/,
+	fcleanup = function( nm ) {
+		return nm.replace(/[^\w\s\.\|`]/g, function( ch ) {
+			return "\\" + ch;
+		});
+	};
+
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+	// Bind an event to an element
+	// Original by Dean Edwards
+	add: function( elem, types, handler, data ) {
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		// For whatever reason, IE has trouble passing the window object
+		// around, causing it to be cloned in the process
+		if ( elem.setInterval && ( elem !== window && !elem.frameElement ) ) {
+			elem = window;
+		}
+
+		var handleObjIn, handleObj;
+
+		if ( handler.handler ) {
+			handleObjIn = handler;
+			handler = handleObjIn.handler;
+		}
+
+		// Make sure that the function being executed has a unique ID
+		if ( !handler.guid ) {
+			handler.guid = jQuery.guid++;
+		}
+
+		// Init the element's event structure
+		var elemData = jQuery.data( elem );
+
+		// If no elemData is found then we must be trying to bind to one of the
+		// banned noData elements
+		if ( !elemData ) {
+			return;
+		}
+
+		var events = elemData.events = elemData.events || {},
+			eventHandle = elemData.handle, eventHandle;
+
+		if ( !eventHandle ) {
+			elemData.handle = eventHandle = function() {
+				// Handle the second event of a trigger and when
+				// an event is called after a page has unloaded
+				return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+					jQuery.event.handle.apply( eventHandle.elem, arguments ) :
+					undefined;
+			};
+		}
+
+		// Add elem as a property of the handle function
+		// This is to prevent a memory leak with non-native events in IE.
+		eventHandle.elem = elem;
+
+		// Handle multiple events separated by a space
+		// jQuery(...).bind("mouseover mouseout", fn);
+		types = types.split(" ");
+
+		var type, i = 0, namespaces;
+
+		while ( (type = types[ i++ ]) ) {
+			handleObj = handleObjIn ?
+				jQuery.extend({}, handleObjIn) :
+				{ handler: handler, data: data };
+
+			// Namespaced event handlers
+			if ( type.indexOf(".") > -1 ) {
+				namespaces = type.split(".");
+				type = namespaces.shift();
+				handleObj.namespace = namespaces.slice(0).sort().join(".");
+
+			} else {
+				namespaces = [];
+				handleObj.namespace = "";
+			}
+
+			handleObj.type = type;
+			handleObj.guid = handler.guid;
+
+			// Get the current list of functions bound to this event
+			var handlers = events[ type ],
+				special = jQuery.event.special[ type ] || {};
+
+			// Init the event handler queue
+			if ( !handlers ) {
+				handlers = events[ type ] = [];
+
+				// Check for a special event handler
+				// Only use addEventListener/attachEvent if the special
+				// events handler returns false
+				if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+					// Bind the global event handler to the element
+					if ( elem.addEventListener ) {
+						elem.addEventListener( type, eventHandle, false );
+
+					} else if ( elem.attachEvent ) {
+						elem.attachEvent( "on" + type, eventHandle );
+					}
+				}
+			}
+			
+			if ( special.add ) { 
+				special.add.call( elem, handleObj ); 
+
+				if ( !handleObj.handler.guid ) {
+					handleObj.handler.guid = handler.guid;
+				}
+			}
+
+			// Add the function to the element's handler list
+			handlers.push( handleObj );
+
+			// Keep track of which events have been used, for global triggering
+			jQuery.event.global[ type ] = true;
+		}
+
+		// Nullify elem to prevent memory leaks in IE
+		elem = null;
+	},
+
+	global: {},
+
+	// Detach an event or set of events from an element
+	remove: function( elem, types, handler, pos ) {
+		// don't do events on text and comment nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		var ret, type, fn, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
+			elemData = jQuery.data( elem ),
+			events = elemData && elemData.events;
+
+		if ( !elemData || !events ) {
+			return;
+		}
+
+		// types is actually an event object here
+		if ( types && types.type ) {
+			handler = types.handler;
+			types = types.type;
+		}
+
+		// Unbind all events for the element
+		if ( !types || typeof types === "string" && types.charAt(0) === "." ) {
+			types = types || "";
+
+			for ( type in events ) {
+				jQuery.event.remove( elem, type + types );
+			}
+
+			return;
+		}
+
+		// Handle multiple events separated by a space
+		// jQuery(...).unbind("mouseover mouseout", fn);
+		types = types.split(" ");
+
+		while ( (type = types[ i++ ]) ) {
+			origType = type;
+			handleObj = null;
+			all = type.indexOf(".") < 0;
+			namespaces = [];
+
+			if ( !all ) {
+				// Namespaced event handlers
+				namespaces = type.split(".");
+				type = namespaces.shift();
+
+				namespace = new RegExp("(^|\\.)" + 
+					jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)")
+			}
+
+			eventType = events[ type ];
+
+			if ( !eventType ) {
+				continue;
+			}
+
+			if ( !handler ) {
+				for ( var j = 0; j < eventType.length; j++ ) {
+					handleObj = eventType[ j ];
+
+					if ( all || namespace.test( handleObj.namespace ) ) {
+						jQuery.event.remove( elem, origType, handleObj.handler, j );
+						eventType.splice( j--, 1 );
+					}
+				}
+
+				continue;
+			}
+
+			special = jQuery.event.special[ type ] || {};
+
+			for ( var j = pos || 0; j < eventType.length; j++ ) {
+				handleObj = eventType[ j ];
+
+				if ( handler.guid === handleObj.guid ) {
+					// remove the given handler for the given type
+					if ( all || namespace.test( handleObj.namespace ) ) {
+						if ( pos == null ) {
+							eventType.splice( j--, 1 );
+						}
+
+						if ( special.remove ) {
+							special.remove.call( elem, handleObj );
+						}
+					}
+
+					if ( pos != null ) {
+						break;
+					}
+				}
+			}
+
+			// remove generic event handler if no more handlers exist
+			if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
+				if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+					removeEvent( elem, type, elemData.handle );
+				}
+
+				ret = null;
+				delete events[ type ];
+			}
+		}
+
+		// Remove the expando if it's no longer used
+		if ( jQuery.isEmptyObject( events ) ) {
+			var handle = elemData.handle;
+			if ( handle ) {
+				handle.elem = null;
+			}
+
+			delete elemData.events;
+			delete elemData.handle;
+
+			if ( jQuery.isEmptyObject( elemData ) ) {
+				jQuery.removeData( elem );
+			}
+		}
+	},
+
+	// bubbling is internal
+	trigger: function( event, data, elem /*, bubbling */ ) {
+		// Event object or event type
+		var type = event.type || event,
+			bubbling = arguments[3];
+
+		if ( !bubbling ) {
+			event = typeof event === "object" ?
+				// jQuery.Event object
+				event[expando] ? event :
+				// Object literal
+				jQuery.extend( jQuery.Event(type), event ) :
+				// Just the event type (string)
+				jQuery.Event(type);
+
+			if ( type.indexOf("!") >= 0 ) {
+				event.type = type = type.slice(0, -1);
+				event.exclusive = true;
+			}
+
+			// Handle a global trigger
+			if ( !elem ) {
+				// Don't bubble custom events when global (to avoid too much overhead)
+				event.stopPropagation();
+
+				// Only trigger if we've ever bound an event for it
+				if ( jQuery.event.global[ type ] ) {
+					jQuery.each( jQuery.cache, function() {
+						if ( this.events && this.events[type] ) {
+							jQuery.event.trigger( event, data, this.handle.elem );
+						}
+					});
+				}
+			}
+
+			// Handle triggering a single element
+
+			// don't do events on text and comment nodes
+			if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+				return undefined;
+			}
+
+			// Clean up in case it is reused
+			event.result = undefined;
+			event.target = elem;
+
+			// Clone the incoming data, if any
+			data = jQuery.makeArray( data );
+			data.unshift( event );
+		}
+
+		event.currentTarget = elem;
+
+		// Trigger the event, it is assumed that "handle" is a function
+		var handle = jQuery.data( elem, "handle" );
+		if ( handle ) {
+			handle.apply( elem, data );
+		}
+
+		var parent = elem.parentNode || elem.ownerDocument;
+
+		// Trigger an inline bound script
+		try {
+			if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
+				if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
+					event.result = false;
+				}
+			}
+
+		// prevent IE from throwing an error for some elements with some event types, see #3533
+		} catch (e) {}
+
+		if ( !event.isPropagationStopped() && parent ) {
+			jQuery.event.trigger( event, data, parent, true );
+
+		} else if ( !event.isDefaultPrevented() ) {
+			var target = event.target, old,
+				isClick = jQuery.nodeName(target, "a") && type === "click",
+				special = jQuery.event.special[ type ] || {};
+
+			if ( (!special._default || special._default.call( elem, event ) === false) && 
+				!isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
+
+				try {
+					if ( target[ type ] ) {
+						// Make sure that we don't accidentally re-trigger the onFOO events
+						old = target[ "on" + type ];
+
+						if ( old ) {
+							target[ "on" + type ] = null;
+						}
+
+						jQuery.event.triggered = true;
+						target[ type ]();
+					}
+
+				// prevent IE from throwing an error for some elements with some event types, see #3533
+				} catch (e) {}
+
+				if ( old ) {
+					target[ "on" + type ] = old;
+				}
+
+				jQuery.event.triggered = false;
+			}
+		}
+	},
+
+	handle: function( event ) {
+		var all, handlers, namespaces, namespace, events;
+
+		event = arguments[0] = jQuery.event.fix( event || window.event );
+		event.currentTarget = this;
+
+		// Namespaced event handlers
+		all = event.type.indexOf(".") < 0 && !event.exclusive;
+
+		if ( !all ) {
+			namespaces = event.type.split(".");
+			event.type = namespaces.shift();
+			namespace = new RegExp("(^|\\.)" + namespaces.slice(0).sort().join("\\.(?:.*\\.)?") + "(\\.|$)");
+		}
+
+		var events = jQuery.data(this, "events"), handlers = events[ event.type ];
+
+		if ( events && handlers ) {
+			// Clone the handlers to prevent manipulation
+			handlers = handlers.slice(0);
+
+			for ( var j = 0, l = handlers.length; j < l; j++ ) {
+				var handleObj = handlers[ j ];
+
+				// Filter the functions by class
+				if ( all || namespace.test( handleObj.namespace ) ) {
+					// Pass in a reference to the handler function itself
+					// So that we can later remove it
+					event.handler = handleObj.handler;
+					event.data = handleObj.data;
+					event.handleObj = handleObj;
+	
+					var ret = handleObj.handler.apply( this, arguments );
+
+					if ( ret !== undefined ) {
+						event.result = ret;
+						if ( ret === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+
+					if ( event.isImmediatePropagationStopped() ) {
+						break;
+					}
+				}
+			}
+		}
+
+		return event.result;
+	},
+
+	props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+	fix: function( event ) {
+		if ( event[ expando ] ) {
+			return event;
+		}
+
+		// store a copy of the original event object
+		// and "clone" to set read-only properties
+		var originalEvent = event;
+		event = jQuery.Event( originalEvent );
+
+		for ( var i = this.props.length, prop; i; ) {
+			prop = this.props[ --i ];
+			event[ prop ] = originalEvent[ prop ];
+		}
+
+		// Fix target property, if necessary
+		if ( !event.target ) {
+			event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+		}
+
+		// check if target is a textnode (safari)
+		if ( event.target.nodeType === 3 ) {
+			event.target = event.target.parentNode;
+		}
+
+		// Add relatedTarget, if necessary
+		if ( !event.relatedTarget && event.fromElement ) {
+			event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
+		}
+
+		// Calculate pageX/Y if missing and clientX/Y available
+		if ( event.pageX == null && event.clientX != null ) {
+			var doc = document.documentElement, body = document.body;
+			event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
+			event.pageY = event.clientY + (doc && doc.scrollTop  || body && body.scrollTop  || 0) - (doc && doc.clientTop  || body && body.clientTop  || 0);
+		}
+
+		// Add which for key events
+		if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) {
+			event.which = event.charCode || event.keyCode;
+		}
+
+		// Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+		if ( !event.metaKey && event.ctrlKey ) {
+			event.metaKey = event.ctrlKey;
+		}
+
+		// Add which for click: 1 === left; 2 === middle; 3 === right
+		// Note: button is not normalized, so don't use it
+		if ( !event.which && event.button !== undefined ) {
+			event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+		}
+
+		return event;
+	},
+
+	// Deprecated, use jQuery.guid instead
+	guid: 1E8,
+
+	// Deprecated, use jQuery.proxy instead
+	proxy: jQuery.proxy,
+
+	special: {
+		ready: {
+			// Make sure the ready event is setup
+			setup: jQuery.bindReady,
+			teardown: jQuery.noop
+		},
+
+		live: {
+			add: function( handleObj ) {
+				jQuery.event.add( this, handleObj.origType, jQuery.extend({}, handleObj, {handler: liveHandler}) ); 
+			},
+
+			remove: function( handleObj ) {
+				var remove = true,
+					type = handleObj.origType.replace(rnamespaces, "");
+				
+				jQuery.each( jQuery.data(this, "events").live || [], function() {
+					if ( type === this.origType.replace(rnamespaces, "") ) {
+						remove = false;
+						return false;
+					}
+				});
+
+				if ( remove ) {
+					jQuery.event.remove( this, handleObj.origType, liveHandler );
+				}
+			}
+
+		},
+
+		beforeunload: {
+			setup: function( data, namespaces, eventHandle ) {
+				// We only want to do this special case on windows
+				if ( this.setInterval ) {
+					this.onbeforeunload = eventHandle;
+				}
+
+				return false;
+			},
+			teardown: function( namespaces, eventHandle ) {
+				if ( this.onbeforeunload === eventHandle ) {
+					this.onbeforeunload = null;
+				}
+			}
+		}
+	}
+};
+
+var removeEvent = document.removeEventListener ?
+	function( elem, type, handle ) {
+		elem.removeEventListener( type, handle, false );
+	} : 
+	function( elem, type, handle ) {
+		elem.detachEvent( "on" + type, handle );
+	};
+
+jQuery.Event = function( src ) {
+	// Allow instantiation without the 'new' keyword
+	if ( !this.preventDefault ) {
+		return new jQuery.Event( src );
+	}
+
+	// Event object
+	if ( src && src.type ) {
+		this.originalEvent = src;
+		this.type = src.type;
+	// Event type
+	} else {
+		this.type = src;
+	}
+
+	// timeStamp is buggy for some events on Firefox(#3843)
+	// So we won't rely on the native value
+	this.timeStamp = now();
+
+	// Mark it as fixed
+	this[ expando ] = true;
+};
+
+function returnFalse() {
+	return false;
+}
+function returnTrue() {
+	return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+	preventDefault: function() {
+		this.isDefaultPrevented = returnTrue;
+
+		var e = this.originalEvent;
+		if ( !e ) {
+			return;
+		}
+		
+		// if preventDefault exists run it on the original event
+		if ( e.preventDefault ) {
+			e.preventDefault();
+		}
+		// otherwise set the returnValue property of the original event to false (IE)
+		e.returnValue = false;
+	},
+	stopPropagation: function() {
+		this.isPropagationStopped = returnTrue;
+
+		var e = this.originalEvent;
+		if ( !e ) {
+			return;
+		}
+		// if stopPropagation exists run it on the original event
+		if ( e.stopPropagation ) {
+			e.stopPropagation();
+		}
+		// otherwise set the cancelBubble property of the original event to true (IE)
+		e.cancelBubble = true;
+	},
+	stopImmediatePropagation: function() {
+		this.isImmediatePropagationStopped = returnTrue;
+		this.stopPropagation();
+	},
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse
+};
+
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function( event ) {
+	// Check if mouse(over|out) are still within the same parent element
+	var parent = event.relatedTarget;
+
+	// Firefox sometimes assigns relatedTarget a XUL element
+	// which we cannot access the parentNode property of
+	try {
+		// Traverse up the tree
+		while ( parent && parent !== this ) {
+			parent = parent.parentNode;
+		}
+
+		if ( parent !== this ) {
+			// set the correct event type
+			event.type = event.data;
+
+			// handle event if we actually just moused on to a non sub-element
+			jQuery.event.handle.apply( this, arguments );
+		}
+
+	// assuming we've left the element since we most likely mousedover a xul element
+	} catch(e) { }
+},
+
+// In case of event delegation, we only need to rename the event.type,
+// liveHandler will take care of the rest.
+delegate = function( event ) {
+	event.type = event.data;
+	jQuery.event.handle.apply( this, arguments );
+};
+
+// Create mouseenter and mouseleave events
+jQuery.each({
+	mouseenter: "mouseover",
+	mouseleave: "mouseout"
+}, function( orig, fix ) {
+	jQuery.event.special[ orig ] = {
+		setup: function( data ) {
+			jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
+		},
+		teardown: function( data ) {
+			jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
+		}
+	};
+});
+
+// submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+	jQuery.event.special.submit = {
+		setup: function( data, namespaces ) {
+			if ( this.nodeName.toLowerCase() !== "form" ) {
+				jQuery.event.add(this, "click.specialSubmit", function( e ) {
+					var elem = e.target, type = elem.type;
+
+					if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
+						return trigger( "submit", this, arguments );
+					}
+				});
+	 
+				jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
+					var elem = e.target, type = elem.type;
+
+					if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
+						return trigger( "submit", this, arguments );
+					}
+				});
+
+			} else {
+				return false;
+			}
+		},
+
+		teardown: function( namespaces ) {
+			jQuery.event.remove( this, ".specialSubmit" );
+		}
+	};
+
+}
+
+// change delegation, happens here so we have bind.
+if ( !jQuery.support.changeBubbles ) {
+
+	var formElems = /textarea|input|select/i,
+
+	changeFilters,
+
+	getVal = function( elem ) {
+		var type = elem.type, val = elem.value;
+
+		if ( type === "radio" || type === "checkbox" ) {
+			val = elem.checked;
+
+		} else if ( type === "select-multiple" ) {
+			val = elem.selectedIndex > -1 ?
+				jQuery.map( elem.options, function( elem ) {
+					return elem.selected;
+				}).join("-") :
+				"";
+
+		} else if ( elem.nodeName.toLowerCase() === "select" ) {
+			val = elem.selectedIndex;
+		}
+
+		return val;
+	},
+
+	testChange = function testChange( e ) {
+		var elem = e.target, data, val;
+
+		if ( !formElems.test( elem.nodeName ) || elem.readOnly ) {
+			return;
+		}
+
+		data = jQuery.data( elem, "_change_data" );
+		val = getVal(elem);
+
+		// the current data will be also retrieved by beforeactivate
+		if ( e.type !== "focusout" || elem.type !== "radio" ) {
+			jQuery.data( elem, "_change_data", val );
+		}
+		
+		if ( data === undefined || val === data ) {
+			return;
+		}
+
+		if ( data != null || val ) {
+			e.type = "change";
+			return jQuery.event.trigger( e, arguments[1], elem );
+		}
+	};
+
+	jQuery.event.special.change = {
+		filters: {
+			focusout: testChange, 
+
+			click: function( e ) {
+				var elem = e.target, type = elem.type;
+
+				if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) {
+					return testChange.call( this, e );
+				}
+			},
+
+			// Change has to be called before submit
+			// Keydown will be called before keypress, which is used in submit-event delegation
+			keydown: function( e ) {
+				var elem = e.target, type = elem.type;
+
+				if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") ||
+					(e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
+					type === "select-multiple" ) {
+					return testChange.call( this, e );
+				}
+			},
+
+			// Beforeactivate happens also before the previous element is blurred
+			// with this event you can't trigger a change event, but you can store
+			// information/focus[in] is not needed anymore
+			beforeactivate: function( e ) {
+				var elem = e.target;
+				jQuery.data( elem, "_change_data", getVal(elem) );
+			}
+		},
+
+		setup: function( data, namespaces ) {
+			if ( this.type === "file" ) {
+				return false;
+			}
+
+			for ( var type in changeFilters ) {
+				jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
+			}
+
+			return formElems.test( this.nodeName );
+		},
+
+		teardown: function( namespaces ) {
+			jQuery.event.remove( this, ".specialChange" );
+
+			return formElems.test( this.nodeName );
+		}
+	};
+
+	changeFilters = jQuery.event.special.change.filters;
+}
+
+function trigger( type, elem, args ) {
+	args[0].type = type;
+	return jQuery.event.handle.apply( elem, args );
+}
+
+// Create "bubbling" focus and blur events
+if ( document.addEventListener ) {
+	jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+		jQuery.event.special[ fix ] = {
+			setup: function() {
+				this.addEventListener( orig, handler, true );
+			}, 
+			teardown: function() { 
+				this.removeEventListener( orig, handler, true );
+			}
+		};
+
+		function handler( e ) { 
+			e = jQuery.event.fix( e );
+			e.type = fix;
+			return jQuery.event.handle.call( this, e );
+		}
+	});
+}
+
+jQuery.each(["bind", "one"], function( i, name ) {
+	jQuery.fn[ name ] = function( type, data, fn ) {
+		// Handle object literals
+		if ( typeof type === "object" ) {
+			for ( var key in type ) {
+				this[ name ](key, data, type[key], fn);
+			}
+			return this;
+		}
+		
+		if ( jQuery.isFunction( data ) ) {
+			fn = data;
+			data = undefined;
+		}
+
+		var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
+			jQuery( this ).unbind( event, handler );
+			return fn.apply( this, arguments );
+		}) : fn;
+
+		if ( type === "unload" && name !== "one" ) {
+			this.one( type, data, fn );
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				jQuery.event.add( this[i], type, handler, data );
+			}
+		}
+
+		return this;
+	};
+});
+
+jQuery.fn.extend({
+	unbind: function( type, fn ) {
+		// Handle object literals
+		if ( typeof type === "object" && !type.preventDefault ) {
+			for ( var key in type ) {
+				this.unbind(key, type[key]);
+			}
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				jQuery.event.remove( this[i], type, fn );
+			}
+		}
+
+		return this;
+	},
+	
+	delegate: function( selector, types, data, fn ) {
+		return this.live( types, data, fn, selector );
+	},
+	
+	undelegate: function( selector, types, fn ) {
+		if ( arguments.length === 0 ) {
+				return this.unbind( "live" );
+		
+		} else {
+			return this.die( types, null, fn, selector );
+		}
+	},
+	
+	trigger: function( type, data ) {
+		return this.each(function() {
+			jQuery.event.trigger( type, data, this );
+		});
+	},
+
+	triggerHandler: function( type, data ) {
+		if ( this[0] ) {
+			var event = jQuery.Event( type );
+			event.preventDefault();
+			event.stopPropagation();
+			jQuery.event.trigger( event, data, this[0] );
+			return event.result;
+		}
+	},
+
+	toggle: function( fn ) {
+		// Save reference to arguments for access in closure
+		var args = arguments, i = 1;
+
+		// link all the functions, so any of them can unbind this click handler
+		while ( i < args.length ) {
+			jQuery.proxy( fn, args[ i++ ] );
+		}
+
+		return this.click( jQuery.proxy( fn, function( event ) {
+			// Figure out which function to execute
+			var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+			jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+			// Make sure that clicks stop
+			event.preventDefault();
+
+			// and execute the function
+			return args[ lastToggle ].apply( this, arguments ) || false;
+		}));
+	},
+
+	hover: function( fnOver, fnOut ) {
+		return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+	}
+});
+
+var liveMap = {
+	focus: "focusin",
+	blur: "focusout",
+	mouseenter: "mouseover",
+	mouseleave: "mouseout"
+};
+
+jQuery.each(["live", "die"], function( i, name ) {
+	jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
+		var type, i = 0, match, namespaces, preType,
+			selector = origSelector || this.selector,
+			context = origSelector ? this : jQuery( this.context );
+
+		if ( jQuery.isFunction( data ) ) {
+			fn = data;
+			data = undefined;
+		}
+
+		types = (types || "").split(" ");
+
+		while ( (type = types[ i++ ]) != null ) {
+			match = rnamespaces.exec( type );
+			namespaces = "";
+
+			if ( match )  {
+				namespaces = match[0];
+				type = type.replace( rnamespaces, "" );
+			}
+
+			if ( type === "hover" ) {
+				types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
+				continue;
+			}
+
+			preType = type;
+
+			if ( type === "focus" || type === "blur" ) {
+				types.push( liveMap[ type ] + namespaces );
+				type = type + namespaces;
+
+			} else {
+				type = (liveMap[ type ] || type) + namespaces;
+			}
+
+			if ( name === "live" ) {
+				// bind live handler
+				context.each(function(){
+					jQuery.event.add( this, liveConvert( type, selector ),
+						{ data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
+				});
+
+			} else {
+				// unbind live handler
+				context.unbind( liveConvert( type, selector ), fn );
+			}
+		}
+		
+		return this;
+	}
+});
+
+function liveHandler( event ) {
+	var stop, elems = [], selectors = [], args = arguments,
+		related, match, handleObj, elem, j, i, l, data,
+		events = jQuery.data( this, "events" );
+
+	// Make sure we avoid non-left-click bubbling in Firefox (#3861)
+	if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) {
+		return;
+	}
+
+	event.liveFired = this;
+
+	var live = events.live.slice(0);
+
+	for ( j = 0; j < live.length; j++ ) {
+		handleObj = live[j];
+
+		if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
+			selectors.push( handleObj.selector );
+
+		} else {
+			live.splice( j--, 1 );
+		}
+	}
+
+	match = jQuery( event.target ).closest( selectors, event.currentTarget );
+
+	for ( i = 0, l = match.length; i < l; i++ ) {
+		for ( j = 0; j < live.length; j++ ) {
+			handleObj = live[j];
+
+			if ( match[i].selector === handleObj.selector ) {
+				elem = match[i].elem;
+				related = null;
+
+				// Those two events require additional checking
+				if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
+					related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
+				}
+
+				if ( !related || related !== elem ) {
+					elems.push({ elem: elem, handleObj: handleObj });
+				}
+			}
+		}
+	}
+
+	for ( i = 0, l = elems.length; i < l; i++ ) {
+		match = elems[i];
+		event.currentTarget = match.elem;
+		event.data = match.handleObj.data;
+		event.handleObj = match.handleObj;
+
+		if ( match.handleObj.origHandler.apply( match.elem, args ) === false ) {
+			stop = false;
+			break;
+		}
+	}
+
+	return stop;
+}
+
+function liveConvert( type, selector ) {
+	return "live." + (type && type !== "*" ? type + "." : "") + selector.replace(/\./g, "`").replace(/ /g, "&");
+}
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup error").split(" "), function( i, name ) {
+
+	// Handle event binding
+	jQuery.fn[ name ] = function( fn ) {
+		return fn ? this.bind( name, fn ) : this.trigger( name );
+	};
+
+	if ( jQuery.attrFn ) {
+		jQuery.attrFn[ name ] = true;
+	}
+});
+
+// Prevent memory leaks in IE
+// Window isn't included so as not to unbind existing unload events
+// More info:
+//  - http://isaacschlueter.com/2006/10/msie-memory-leaks/
+if ( window.attachEvent && !window.addEventListener ) {
+	window.attachEvent("onunload", function() {
+		for ( var id in jQuery.cache ) {
+			if ( jQuery.cache[ id ].handle ) {
+				// Try/Catch is to handle iframes being unloaded, see #4280
+				try {
+					jQuery.event.remove( jQuery.cache[ id ].handle.elem );
+				} catch(e) {}
+			}
+		}
+	});
+}
+/*!
+ * Sizzle CSS Selector Engine - v1.0
+ *  Copyright 2009, The Dojo Foundation
+ *  Released under the MIT, BSD, and GPL Licenses.
+ *  More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+	done = 0,
+	toString = Object.prototype.toString,
+	hasDuplicate = false,
+	baseHasDuplicate = true;
+
+// Here we check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+//   Thus far that includes Google Chrome.
+[0, 0].sort(function(){
+	baseHasDuplicate = false;
+	return 0;
+});
+
+var Sizzle = function(selector, context, results, seed) {
+	results = results || [];
+	var origContext = context = context || document;
+
+	if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+		return [];
+	}
+	
+	if ( !selector || typeof selector !== "string" ) {
+		return results;
+	}
+
+	var parts = [], m, set, checkSet, extra, prune = true, contextXML = isXML(context),
+		soFar = selector;
+	
+	// Reset the position of the chunker regexp (start from head)
+	while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) {
+		soFar = m[3];
+		
+		parts.push( m[1] );
+		
+		if ( m[2] ) {
+			extra = m[3];
+			break;
+		}
+	}
+
+	if ( parts.length > 1 && origPOS.exec( selector ) ) {
+		if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+			set = posProcess( parts[0] + parts[1], context );
+		} else {
+			set = Expr.relative[ parts[0] ] ?
+				[ context ] :
+				Sizzle( parts.shift(), context );
+
+			while ( parts.length ) {
+				selector = parts.shift();
+
+				if ( Expr.relative[ selector ] ) {
+					selector += parts.shift();
+				}
+				
+				set = posProcess( selector, set );
+			}
+		}
+	} else {
+		// Take a shortcut and set the context if the root selector is an ID
+		// (but not if it'll be faster if the inner selector is an ID)
+		if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+				Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+			var ret = Sizzle.find( parts.shift(), context, contextXML );
+			context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0];
+		}
+
+		if ( context ) {
+			var ret = seed ?
+				{ expr: parts.pop(), set: makeArray(seed) } :
+				Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+			set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set;
+
+			if ( parts.length > 0 ) {
+				checkSet = makeArray(set);
+			} else {
+				prune = false;
+			}
+
+			while ( parts.length ) {
+				var cur = parts.pop(), pop = cur;
+
+				if ( !Expr.relative[ cur ] ) {
+					cur = "";
+				} else {
+					pop = parts.pop();
+				}
+
+				if ( pop == null ) {
+					pop = context;
+				}
+
+				Expr.relative[ cur ]( checkSet, pop, contextXML );
+			}
+		} else {
+			checkSet = parts = [];
+		}
+	}
+
+	if ( !checkSet ) {
+		checkSet = set;
+	}
+
+	if ( !checkSet ) {
+		Sizzle.error( cur || selector );
+	}
+
+	if ( toString.call(checkSet) === "[object Array]" ) {
+		if ( !prune ) {
+			results.push.apply( results, checkSet );
+		} else if ( context && context.nodeType === 1 ) {
+			for ( var i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+					results.push( set[i] );
+				}
+			}
+		} else {
+			for ( var i = 0; checkSet[i] != null; i++ ) {
+				if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+					results.push( set[i] );
+				}
+			}
+		}
+	} else {
+		makeArray( checkSet, results );
+	}
+
+	if ( extra ) {
+		Sizzle( extra, origContext, results, seed );
+		Sizzle.uniqueSort( results );
+	}
+
+	return results;
+};
+
+Sizzle.uniqueSort = function(results){
+	if ( sortOrder ) {
+		hasDuplicate = baseHasDuplicate;
+		results.sort(sortOrder);
+
+		if ( hasDuplicate ) {
+			for ( var i = 1; i < results.length; i++ ) {
+				if ( results[i] === results[i-1] ) {
+					results.splice(i--, 1);
+				}
+			}
+		}
+	}
+
+	return results;
+};
+
+Sizzle.matches = function(expr, set){
+	return Sizzle(expr, null, null, set);
+};
+
+Sizzle.find = function(expr, context, isXML){
+	var set, match;
+
+	if ( !expr ) {
+		return [];
+	}
+
+	for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
+		var type = Expr.order[i], match;
+		
+		if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+			var left = match[1];
+			match.splice(1,1);
+
+			if ( left.substr( left.length - 1 ) !== "\\" ) {
+				match[1] = (match[1] || "").replace(/\\/g, "");
+				set = Expr.find[ type ]( match, context, isXML );
+				if ( set != null ) {
+					expr = expr.replace( Expr.match[ type ], "" );
+					break;
+				}
+			}
+		}
+	}
+
+	if ( !set ) {
+		set = context.getElementsByTagName("*");
+	}
+
+	return {set: set, expr: expr};
+};
+
+Sizzle.filter = function(expr, set, inplace, not){
+	var old = expr, result = [], curLoop = set, match, anyFound,
+		isXMLFilter = set && set[0] && isXML(set[0]);
+
+	while ( expr && set.length ) {
+		for ( var type in Expr.filter ) {
+			if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
+				var filter = Expr.filter[ type ], found, item, left = match[1];
+				anyFound = false;
+
+				match.splice(1,1);
+
+				if ( left.substr( left.length - 1 ) === "\\" ) {
+					continue;
+				}
+
+				if ( curLoop === result ) {
+					result = [];
+				}
+
+				if ( Expr.preFilter[ type ] ) {
+					match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter );
+
+					if ( !match ) {
+						anyFound = found = true;
+					} else if ( match === true ) {
+						continue;
+					}
+				}
+
+				if ( match ) {
+					for ( var i = 0; (item = curLoop[i]) != null; i++ ) {
+						if ( item ) {
+							found = filter( item, match, i, curLoop );
+							var pass = not ^ !!found;
+
+							if ( inplace && found != null ) {
+								if ( pass ) {
+									anyFound = true;
+								} else {
+									curLoop[i] = false;
+								}
+							} else if ( pass ) {
+								result.push( item );
+								anyFound = true;
+							}
+						}
+					}
+				}
+
+				if ( found !== undefined ) {
+					if ( !inplace ) {
+						curLoop = result;
+					}
+
+					expr = expr.replace( Expr.match[ type ], "" );
+
+					if ( !anyFound ) {
+						return [];
+					}
+
+					break;
+				}
+			}
+		}
+
+		// Improper expression
+		if ( expr === old ) {
+			if ( anyFound == null ) {
+				Sizzle.error( expr );
+			} else {
+				break;
+			}
+		}
+
+		old = expr;
+	}
+
+	return curLoop;
+};
+
+Sizzle.error = function( msg ) {
+	throw "Syntax error, unrecognized expression: " + msg;
+};
+
+var Expr = Sizzle.selectors = {
+	order: [ "ID", "NAME", "TAG" ],
+	match: {
+		ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+		CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+		NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,
+		ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
+		TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,
+		CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
+		POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
+		PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
+	},
+	leftMatch: {},
+	attrMap: {
+		"class": "className",
+		"for": "htmlFor"
+	},
+	attrHandle: {
+		href: function(elem){
+			return elem.getAttribute("href");
+		}
+	},
+	relative: {
+		"+": function(checkSet, part){
+			var isPartStr = typeof part === "string",
+				isTag = isPartStr && !/\W/.test(part),
+				isPartStrNotTag = isPartStr && !isTag;
+
+			if ( isTag ) {
+				part = part.toLowerCase();
+			}
+
+			for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
+				if ( (elem = checkSet[i]) ) {
+					while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
+
+					checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
+						elem || false :
+						elem === part;
+				}
+			}
+
+			if ( isPartStrNotTag ) {
+				Sizzle.filter( part, checkSet, true );
+			}
+		},
+		">": function(checkSet, part){
+			var isPartStr = typeof part === "string";
+
+			if ( isPartStr && !/\W/.test(part) ) {
+				part = part.toLowerCase();
+
+				for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+					var elem = checkSet[i];
+					if ( elem ) {
+						var parent = elem.parentNode;
+						checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
+					}
+				}
+			} else {
+				for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+					var elem = checkSet[i];
+					if ( elem ) {
+						checkSet[i] = isPartStr ?
+							elem.parentNode :
+							elem.parentNode === part;
+					}
+				}
+
+				if ( isPartStr ) {
+					Sizzle.filter( part, checkSet, true );
+				}
+			}
+		},
+		"": function(checkSet, part, isXML){
+			var doneName = done++, checkFn = dirCheck;
+
+			if ( typeof part === "string" && !/\W/.test(part) ) {
+				var nodeCheck = part = part.toLowerCase();
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML);
+		},
+		"~": function(checkSet, part, isXML){
+			var doneName = done++, checkFn = dirCheck;
+
+			if ( typeof part === "string" && !/\W/.test(part) ) {
+				var nodeCheck = part = part.toLowerCase();
+				checkFn = dirNodeCheck;
+			}
+
+			checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML);
+		}
+	},
+	find: {
+		ID: function(match, context, isXML){
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				return m ? [m] : [];
+			}
+		},
+		NAME: function(match, context){
+			if ( typeof context.getElementsByName !== "undefined" ) {
+				var ret = [], results = context.getElementsByName(match[1]);
+
+				for ( var i = 0, l = results.length; i < l; i++ ) {
+					if ( results[i].getAttribute("name") === match[1] ) {
+						ret.push( results[i] );
+					}
+				}
+
+				return ret.length === 0 ? null : ret;
+			}
+		},
+		TAG: function(match, context){
+			return context.getElementsByTagName(match[1]);
+		}
+	},
+	preFilter: {
+		CLASS: function(match, curLoop, inplace, result, not, isXML){
+			match = " " + match[1].replace(/\\/g, "") + " ";
+
+			if ( isXML ) {
+				return match;
+			}
+
+			for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
+				if ( elem ) {
+					if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) {
+						if ( !inplace ) {
+							result.push( elem );
+						}
+					} else if ( inplace ) {
+						curLoop[i] = false;
+					}
+				}
+			}
+
+			return false;
+		},
+		ID: function(match){
+			return match[1].replace(/\\/g, "");
+		},
+		TAG: function(match, curLoop){
+			return match[1].toLowerCase();
+		},
+		CHILD: function(match){
+			if ( match[1] === "nth" ) {
+				// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+				var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+					match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
+					!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
+
+				// calculate the numbers (first)n+(last) including if they are negative
+				match[2] = (test[1] + (test[2] || 1)) - 0;
+				match[3] = test[3] - 0;
+			}
+
+			// TODO: Move to normal caching system
+			match[0] = done++;
+
+			return match;
+		},
+		ATTR: function(match, curLoop, inplace, result, not, isXML){
+			var name = match[1].replace(/\\/g, "");
+			
+			if ( !isXML && Expr.attrMap[name] ) {
+				match[1] = Expr.attrMap[name];
+			}
+
+			if ( match[2] === "~=" ) {
+				match[4] = " " + match[4] + " ";
+			}
+
+			return match;
+		},
+		PSEUDO: function(match, curLoop, inplace, result, not){
+			if ( match[1] === "not" ) {
+				// If we're dealing with a complex expression, or a simple one
+				if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
+					match[3] = Sizzle(match[3], null, null, curLoop);
+				} else {
+					var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
+					if ( !inplace ) {
+						result.push.apply( result, ret );
+					}
+					return false;
+				}
+			} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
+				return true;
+			}
+			
+			return match;
+		},
+		POS: function(match){
+			match.unshift( true );
+			return match;
+		}
+	},
+	filters: {
+		enabled: function(elem){
+			return elem.disabled === false && elem.type !== "hidden";
+		},
+		disabled: function(elem){
+			return elem.disabled === true;
+		},
+		checked: function(elem){
+			return elem.checked === true;
+		},
+		selected: function(elem){
+			// Accessing this property makes selected-by-default
+			// options in Safari work properly
+			elem.parentNode.selectedIndex;
+			return elem.selected === true;
+		},
+		parent: function(elem){
+			return !!elem.firstChild;
+		},
+		empty: function(elem){
+			return !elem.firstChild;
+		},
+		has: function(elem, i, match){
+			return !!Sizzle( match[3], elem ).length;
+		},
+		header: function(elem){
+			return /h\d/i.test( elem.nodeName );
+		},
+		text: function(elem){
+			return "text" === elem.type;
+		},
+		radio: function(elem){
+			return "radio" === elem.type;
+		},
+		checkbox: function(elem){
+			return "checkbox" === elem.type;
+		},
+		file: function(elem){
+			return "file" === elem.type;
+		},
+		password: function(elem){
+			return "password" === elem.type;
+		},
+		submit: function(elem){
+			return "submit" === elem.type;
+		},
+		image: function(elem){
+			return "image" === elem.type;
+		},
+		reset: function(elem){
+			return "reset" === elem.type;
+		},
+		button: function(elem){
+			return "button" === elem.type || elem.nodeName.toLowerCase() === "button";
+		},
+		input: function(elem){
+			return /input|select|textarea|button/i.test(elem.nodeName);
+		}
+	},
+	setFilters: {
+		first: function(elem, i){
+			return i === 0;
+		},
+		last: function(elem, i, match, array){
+			return i === array.length - 1;
+		},
+		even: function(elem, i){
+			return i % 2 === 0;
+		},
+		odd: function(elem, i){
+			return i % 2 === 1;
+		},
+		lt: function(elem, i, match){
+			return i < match[3] - 0;
+		},
+		gt: function(elem, i, match){
+			return i > match[3] - 0;
+		},
+		nth: function(elem, i, match){
+			return match[3] - 0 === i;
+		},
+		eq: function(elem, i, match){
+			return match[3] - 0 === i;
+		}
+	},
+	filter: {
+		PSEUDO: function(elem, match, i, array){
+			var name = match[1], filter = Expr.filters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			} else if ( name === "contains" ) {
+				return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0;
+			} else if ( name === "not" ) {
+				var not = match[3];
+
+				for ( var i = 0, l = not.length; i < l; i++ ) {
+					if ( not[i] === elem ) {
+						return false;
+					}
+				}
+
+				return true;
+			} else {
+				Sizzle.error( "Syntax error, unrecognized expression: " + name );
+			}
+		},
+		CHILD: function(elem, match){
+			var type = match[1], node = elem;
+			switch (type) {
+				case 'only':
+				case 'first':
+					while ( (node = node.previousSibling) )	 {
+						if ( node.nodeType === 1 ) { 
+							return false; 
+						}
+					}
+					if ( type === "first" ) { 
+						return true; 
+					}
+					node = elem;
+				case 'last':
+					while ( (node = node.nextSibling) )	 {
+						if ( node.nodeType === 1 ) { 
+							return false; 
+						}
+					}
+					return true;
+				case 'nth':
+					var first = match[2], last = match[3];
+
+					if ( first === 1 && last === 0 ) {
+						return true;
+					}
+					
+					var doneName = match[0],
+						parent = elem.parentNode;
+	
+					if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
+						var count = 0;
+						for ( node = parent.firstChild; node; node = node.nextSibling ) {
+							if ( node.nodeType === 1 ) {
+								node.nodeIndex = ++count;
+							}
+						} 
+						parent.sizcache = doneName;
+					}
+					
+					var diff = elem.nodeIndex - last;
+					if ( first === 0 ) {
+						return diff === 0;
+					} else {
+						return ( diff % first === 0 && diff / first >= 0 );
+					}
+			}
+		},
+		ID: function(elem, match){
+			return elem.nodeType === 1 && elem.getAttribute("id") === match;
+		},
+		TAG: function(elem, match){
+			return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
+		},
+		CLASS: function(elem, match){
+			return (" " + (elem.className || elem.getAttribute("class")) + " ")
+				.indexOf( match ) > -1;
+		},
+		ATTR: function(elem, match){
+			var name = match[1],
+				result = Expr.attrHandle[ name ] ?
+					Expr.attrHandle[ name ]( elem ) :
+					elem[ name ] != null ?
+						elem[ name ] :
+						elem.getAttribute( name ),
+				value = result + "",
+				type = match[2],
+				check = match[4];
+
+			return result == null ?
+				type === "!=" :
+				type === "=" ?
+				value === check :
+				type === "*=" ?
+				value.indexOf(check) >= 0 :
+				type === "~=" ?
+				(" " + value + " ").indexOf(check) >= 0 :
+				!check ?
+				value && result !== false :
+				type === "!=" ?
+				value !== check :
+				type === "^=" ?
+				value.indexOf(check) === 0 :
+				type === "$=" ?
+				value.substr(value.length - check.length) === check :
+				type === "|=" ?
+				value === check || value.substr(0, check.length + 1) === check + "-" :
+				false;
+		},
+		POS: function(elem, match, i, array){
+			var name = match[2], filter = Expr.setFilters[ name ];
+
+			if ( filter ) {
+				return filter( elem, i, match, array );
+			}
+		}
+	}
+};
+
+var origPOS = Expr.match.POS;
+
+for ( var type in Expr.match ) {
+	Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+	Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, function(all, num){
+		return "\\" + (num - 0 + 1);
+	}));
+}
+
+var makeArray = function(array, results) {
+	array = Array.prototype.slice.call( array, 0 );
+
+	if ( results ) {
+		results.push.apply( results, array );
+		return results;
+	}
+	
+	return array;
+};
+
+// Perform a simple check to determine if the browser is capable of
+// converting a NodeList to an array using builtin methods.
+// Also verifies that the returned array holds DOM nodes
+// (which is not the case in the Blackberry browser)
+try {
+	Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
+
+// Provide a fallback method if it does not work
+} catch(e){
+	makeArray = function(array, results) {
+		var ret = results || [];
+
+		if ( toString.call(array) === "[object Array]" ) {
+			Array.prototype.push.apply( ret, array );
+		} else {
+			if ( typeof array.length === "number" ) {
+				for ( var i = 0, l = array.length; i < l; i++ ) {
+					ret.push( array[i] );
+				}
+			} else {
+				for ( var i = 0; array[i]; i++ ) {
+					ret.push( array[i] );
+				}
+			}
+		}
+
+		return ret;
+	};
+}
+
+var sortOrder;
+
+if ( document.documentElement.compareDocumentPosition ) {
+	sortOrder = function( a, b ) {
+		if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return a.compareDocumentPosition ? -1 : 1;
+		}
+
+		var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+} else if ( "sourceIndex" in document.documentElement ) {
+	sortOrder = function( a, b ) {
+		if ( !a.sourceIndex || !b.sourceIndex ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return a.sourceIndex ? -1 : 1;
+		}
+
+		var ret = a.sourceIndex - b.sourceIndex;
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+} else if ( document.createRange ) {
+	sortOrder = function( a, b ) {
+		if ( !a.ownerDocument || !b.ownerDocument ) {
+			if ( a == b ) {
+				hasDuplicate = true;
+			}
+			return a.ownerDocument ? -1 : 1;
+		}
+
+		var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
+		aRange.setStart(a, 0);
+		aRange.setEnd(a, 0);
+		bRange.setStart(b, 0);
+		bRange.setEnd(b, 0);
+		var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
+		if ( ret === 0 ) {
+			hasDuplicate = true;
+		}
+		return ret;
+	};
+}
+
+// Utility function for retreiving the text value of an array of DOM nodes
+function getText( elems ) {
+	var ret = "", elem;
+
+	for ( var i = 0; elems[i]; i++ ) {
+		elem = elems[i];
+
+		// Get the text from text nodes and CDATA nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
+			ret += elem.nodeValue;
+
+		// Traverse everything else, except comment nodes
+		} else if ( elem.nodeType !== 8 ) {
+			ret += getText( elem.childNodes );
+		}
+	}
+
+	return ret;
+}
+
+// Check to see if the browser returns elements by name when
+// querying by getElementById (and provide a workaround)
+(function(){
+	// We're going to inject a fake input element with a specified name
+	var form = document.createElement("div"),
+		id = "script" + (new Date).getTime();
+	form.innerHTML = "<a name='" + id + "'/>";
+
+	// Inject it into the root element, check its status, and remove it quickly
+	var root = document.documentElement;
+	root.insertBefore( form, root.firstChild );
+
+	// The workaround has to do additional checks after a getElementById
+	// Which slows things down for other browsers (hence the branching)
+	if ( document.getElementById( id ) ) {
+		Expr.find.ID = function(match, context, isXML){
+			if ( typeof context.getElementById !== "undefined" && !isXML ) {
+				var m = context.getElementById(match[1]);
+				return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : [];
+			}
+		};
+
+		Expr.filter.ID = function(elem, match){
+			var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id");
+			return elem.nodeType === 1 && node && node.nodeValue === match;
+		};
+	}
+
+	root.removeChild( form );
+	root = form = null; // release memory in IE
+})();
+
+(function(){
+	// Check to see if the browser returns only elements
+	// when doing getElementsByTagName("*")
+
+	// Create a fake element
+	var div = document.createElement("div");
+	div.appendChild( document.createComment("") );
+
+	// Make sure no comments are found
+	if ( div.getElementsByTagName("*").length > 0 ) {
+		Expr.find.TAG = function(match, context){
+			var results = context.getElementsByTagName(match[1]);
+
+			// Filter out possible comments
+			if ( match[1] === "*" ) {
+				var tmp = [];
+
+				for ( var i = 0; results[i]; i++ ) {
+					if ( results[i].nodeType === 1 ) {
+						tmp.push( results[i] );
+					}
+				}
+
+				results = tmp;
+			}
+
+			return results;
+		};
+	}
+
+	// Check to see if an attribute returns normalized href attributes
+	div.innerHTML = "<a href='#'></a>";
+	if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" &&
+			div.firstChild.getAttribute("href") !== "#" ) {
+		Expr.attrHandle.href = function(elem){
+			return elem.getAttribute("href", 2);
+		};
+	}
+
+	div = null; // release memory in IE
+})();
+
+if ( document.querySelectorAll ) {
+	(function(){
+		var oldSizzle = Sizzle, div = document.createElement("div");
+		div.innerHTML = "<p class='TEST'></p>";
+
+		// Safari can't handle uppercase or unicode characters when
+		// in quirks mode.
+		if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+			return;
+		}
+	
+		Sizzle = function(query, context, extra, seed){
+			context = context || document;
+
+			// Only use querySelectorAll on non-XML documents
+			// (ID selectors don't work in non-HTML documents)
+			if ( !seed && context.nodeType === 9 && !isXML(context) ) {
+				try {
+					return makeArray( context.querySelectorAll(query), extra );
+				} catch(e){}
+			}
+		
+			return oldSizzle(query, context, extra, seed);
+		};
+
+		for ( var prop in oldSizzle ) {
+			Sizzle[ prop ] = oldSizzle[ prop ];
+		}
+
+		div = null; // release memory in IE
+	})();
+}
+
+(function(){
+	var div = document.createElement("div");
+
+	div.innerHTML = "<div class='test e'></div><div class='test'></div>";
+
+	// Opera can't find a second classname (in 9.6)
+	// Also, make sure that getElementsByClassName actually exists
+	if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
+		return;
+	}
+
+	// Safari caches class attributes, doesn't catch changes (in 3.2)
+	div.lastChild.className = "e";
+
+	if ( div.getElementsByClassName("e").length === 1 ) {
+		return;
+	}
+	
+	Expr.order.splice(1, 0, "CLASS");
+	Expr.find.CLASS = function(match, context, isXML) {
+		if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
+			return context.getElementsByClassName(match[1]);
+		}
+	};
+
+	div = null; // release memory in IE
+})();
+
+function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+		if ( elem ) {
+			elem = elem[dir];
+			var match = false;
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 && !isXML ){
+					elem.sizcache = doneName;
+					elem.sizset = i;
+				}
+
+				if ( elem.nodeName.toLowerCase() === cur ) {
+					match = elem;
+					break;
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
+	for ( var i = 0, l = checkSet.length; i < l; i++ ) {
+		var elem = checkSet[i];
+		if ( elem ) {
+			elem = elem[dir];
+			var match = false;
+
+			while ( elem ) {
+				if ( elem.sizcache === doneName ) {
+					match = checkSet[elem.sizset];
+					break;
+				}
+
+				if ( elem.nodeType === 1 ) {
+					if ( !isXML ) {
+						elem.sizcache = doneName;
+						elem.sizset = i;
+					}
+					if ( typeof cur !== "string" ) {
+						if ( elem === cur ) {
+							match = true;
+							break;
+						}
+
+					} else if ( Sizzle.filter( cur, [elem] ).length > 0 ) {
+						match = elem;
+						break;
+					}
+				}
+
+				elem = elem[dir];
+			}
+
+			checkSet[i] = match;
+		}
+	}
+}
+
+var contains = document.compareDocumentPosition ? function(a, b){
+	return !!(a.compareDocumentPosition(b) & 16);
+} : function(a, b){
+	return a !== b && (a.contains ? a.contains(b) : true);
+};
+
+var isXML = function(elem){
+	// documentElement is verified for cases where it doesn't yet exist
+	// (such as loading iframes in IE - #4833) 
+	var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+	return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+var posProcess = function(selector, context){
+	var tmpSet = [], later = "", match,
+		root = context.nodeType ? [context] : context;
+
+	// Position selectors must be done after the filter
+	// And so must :not(positional) so we move all PSEUDOs to the end
+	while ( (match = Expr.match.PSEUDO.exec( selector )) ) {
+		later += match[0];
+		selector = selector.replace( Expr.match.PSEUDO, "" );
+	}
+
+	selector = Expr.relative[selector] ? selector + "*" : selector;
+
+	for ( var i = 0, l = root.length; i < l; i++ ) {
+		Sizzle( selector, root[i], tmpSet );
+	}
+
+	return Sizzle.filter( later, tmpSet );
+};
+
+// EXPOSE
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+jQuery.expr[":"] = jQuery.expr.filters;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = getText;
+jQuery.isXMLDoc = isXML;
+jQuery.contains = contains;
+
+return;
+
+window.Sizzle = Sizzle;
+
+})();
+var runtil = /Until$/,
+	rparentsprev = /^(?:parents|prevUntil|prevAll)/,
+	// Note: This RegExp should be improved, or likely pulled from Sizzle
+	rmultiselector = /,/,
+	slice = Array.prototype.slice;
+
+// Implement the identical functionality for filter and not
+var winnow = function( elements, qualifier, keep ) {
+	if ( jQuery.isFunction( qualifier ) ) {
+		return jQuery.grep(elements, function( elem, i ) {
+			return !!qualifier.call( elem, i, elem ) === keep;
+		});
+
+	} else if ( qualifier.nodeType ) {
+		return jQuery.grep(elements, function( elem, i ) {
+			return (elem === qualifier) === keep;
+		});
+
+	} else if ( typeof qualifier === "string" ) {
+		var filtered = jQuery.grep(elements, function( elem ) {
+			return elem.nodeType === 1;
+		});
+
+		if ( isSimple.test( qualifier ) ) {
+			return jQuery.filter(qualifier, filtered, !keep);
+		} else {
+			qualifier = jQuery.filter( qualifier, filtered );
+		}
+	}
+
+	return jQuery.grep(elements, function( elem, i ) {
+		return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
+	});
+};
+
+jQuery.fn.extend({
+	find: function( selector ) {
+		var ret = this.pushStack( "", "find", selector ), length = 0;
+
+		for ( var i = 0, l = this.length; i < l; i++ ) {
+			length = ret.length;
+			jQuery.find( selector, this[i], ret );
+
+			if ( i > 0 ) {
+				// Make sure that the results are unique
+				for ( var n = length; n < ret.length; n++ ) {
+					for ( var r = 0; r < length; r++ ) {
+						if ( ret[r] === ret[n] ) {
+							ret.splice(n--, 1);
+							break;
+						}
+					}
+				}
+			}
+		}
+
+		return ret;
+	},
+
+	has: function( target ) {
+		var targets = jQuery( target );
+		return this.filter(function() {
+			for ( var i = 0, l = targets.length; i < l; i++ ) {
+				if ( jQuery.contains( this, targets[i] ) ) {
+					return true;
+				}
+			}
+		});
+	},
+
+	not: function( selector ) {
+		return this.pushStack( winnow(this, selector, false), "not", selector);
+	},
+
+	filter: function( selector ) {
+		return this.pushStack( winnow(this, selector, true), "filter", selector );
+	},
+	
+	is: function( selector ) {
+		return !!selector && jQuery.filter( selector, this ).length > 0;
+	},
+
+	closest: function( selectors, context ) {
+		if ( jQuery.isArray( selectors ) ) {
+			var ret = [], cur = this[0], match, matches = {}, selector;
+
+			if ( cur && selectors.length ) {
+				for ( var i = 0, l = selectors.length; i < l; i++ ) {
+					selector = selectors[i];
+
+					if ( !matches[selector] ) {
+						matches[selector] = jQuery.expr.match.POS.test( selector ) ? 
+							jQuery( selector, context || this.context ) :
+							selector;
+					}
+				}
+
+				while ( cur && cur.ownerDocument && cur !== context ) {
+					for ( selector in matches ) {
+						match = matches[selector];
+
+						if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
+							ret.push({ selector: selector, elem: cur });
+							delete matches[selector];
+						}
+					}
+					cur = cur.parentNode;
+				}
+			}
+
+			return ret;
+		}
+
+		var pos = jQuery.expr.match.POS.test( selectors ) ? 
+			jQuery( selectors, context || this.context ) : null;
+
+		return this.map(function( i, cur ) {
+			while ( cur && cur.ownerDocument && cur !== context ) {
+				if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selectors) ) {
+					return cur;
+				}
+				cur = cur.parentNode;
+			}
+			return null;
+		});
+	},
+	
+	// Determine the position of an element within
+	// the matched set of elements
+	index: function( elem ) {
+		if ( !elem || typeof elem === "string" ) {
+			return jQuery.inArray( this[0],
+				// If it receives a string, the selector is used
+				// If it receives nothing, the siblings are used
+				elem ? jQuery( elem ) : this.parent().children() );
+		}
+		// Locate the position of the desired element
+		return jQuery.inArray(
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[0] : elem, this );
+	},
+
+	add: function( selector, context ) {
+		var set = typeof selector === "string" ?
+				jQuery( selector, context || this.context ) :
+				jQuery.makeArray( selector ),
+			all = jQuery.merge( this.get(), set );
+
+		return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+			all :
+			jQuery.unique( all ) );
+	},
+
+	andSelf: function() {
+		return this.add( this.prevObject );
+	}
+});
+
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+	return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
+
+jQuery.each({
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return jQuery.dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return jQuery.nth( elem, 2, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return jQuery.nth( elem, 2, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return jQuery.dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return jQuery.dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, i, until ) {
+		return jQuery.dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return jQuery.sibling( elem.parentNode.firstChild, elem );
+	},
+	children: function( elem ) {
+		return jQuery.sibling( elem.firstChild );
+	},
+	contents: function( elem ) {
+		return jQuery.nodeName( elem, "iframe" ) ?
+			elem.contentDocument || elem.contentWindow.document :
+			jQuery.makeArray( elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var ret = jQuery.map( this, fn, until );
+		
+		if ( !runtil.test( name ) ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			ret = jQuery.filter( selector, ret );
+		}
+
+		ret = this.length > 1 ? jQuery.unique( ret ) : ret;
+
+		if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
+			ret = ret.reverse();
+		}
+
+		return this.pushStack( ret, name, slice.call(arguments).join(",") );
+	};
+});
+
+jQuery.extend({
+	filter: function( expr, elems, not ) {
+		if ( not ) {
+			expr = ":not(" + expr + ")";
+		}
+
+		return jQuery.find.matches(expr, elems);
+	},
+	
+	dir: function( elem, dir, until ) {
+		var matched = [], cur = elem[dir];
+		while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+			if ( cur.nodeType === 1 ) {
+				matched.push( cur );
+			}
+			cur = cur[dir];
+		}
+		return matched;
+	},
+
+	nth: function( cur, result, dir, elem ) {
+		result = result || 1;
+		var num = 0;
+
+		for ( ; cur; cur = cur[dir] ) {
+			if ( cur.nodeType === 1 && ++num === result ) {
+				break;
+			}
+		}
+
+		return cur;
+	},
+
+	sibling: function( n, elem ) {
+		var r = [];
+
+		for ( ; n; n = n.nextSibling ) {
+			if ( n.nodeType === 1 && n !== elem ) {
+				r.push( n );
+			}
+		}
+
+		return r;
+	}
+});
+var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
+	rleadingWhitespace = /^\s+/,
+	rxhtmlTag = /(<([\w:]+)[^>]*?)\/>/g,
+	rselfClosing = /^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,
+	rtagName = /<([\w:]+)/,
+	rtbody = /<tbody/i,
+	rhtml = /<|&#?\w+;/,
+	rnocache = /<script|<object|<embed|<option|<style/i,
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,  // checked="checked" or checked (html5)
+	fcloseTag = function( all, front, tag ) {
+		return rselfClosing.test( tag ) ?
+			all :
+			front + "></" + tag + ">";
+	},
+	wrapMap = {
+		option: [ 1, "<select multiple='multiple'>", "</select>" ],
+		legend: [ 1, "<fieldset>", "</fieldset>" ],
+		thead: [ 1, "<table>", "</table>" ],
+		tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+		td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+		col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+		area: [ 1, "<map>", "</map>" ],
+		_default: [ 0, "", "" ]
+	};
+
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// IE can't serialize <link> and <script> tags normally
+if ( !jQuery.support.htmlSerialize ) {
+	wrapMap._default = [ 1, "div<div>", "</div>" ];
+}
+
+jQuery.fn.extend({
+	text: function( text ) {
+		if ( jQuery.isFunction(text) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				self.text( text.call(this, i, self.text()) );
+			});
+		}
+
+		if ( typeof text !== "object" && text !== undefined ) {
+			return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+		}
+
+		return jQuery.text( this );
+	},
+
+	wrapAll: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each(function(i) {
+				jQuery(this).wrapAll( html.call(this, i) );
+			});
+		}
+
+		if ( this[0] ) {
+			// The elements to wrap the target around
+			var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
+
+			if ( this[0].parentNode ) {
+				wrap.insertBefore( this[0] );
+			}
+
+			wrap.map(function() {
+				var elem = this;
+
+				while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+					elem = elem.firstChild;
+				}
+
+				return elem;
+			}).append(this);
+		}
+
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( jQuery.isFunction( html ) ) {
+			return this.each(function(i) {
+				jQuery(this).wrapInner( html.call(this, i) );
+			});
+		}
+
+		return this.each(function() {
+			var self = jQuery( this ), contents = self.contents();
+
+			if ( contents.length ) {
+				contents.wrapAll( html );
+
+			} else {
+				self.append( html );
+			}
+		});
+	},
+
+	wrap: function( html ) {
+		return this.each(function() {
+			jQuery( this ).wrapAll( html );
+		});
+	},
+
+	unwrap: function() {
+		return this.parent().each(function() {
+			if ( !jQuery.nodeName( this, "body" ) ) {
+				jQuery( this ).replaceWith( this.childNodes );
+			}
+		}).end();
+	},
+
+	append: function() {
+		return this.domManip(arguments, true, function( elem ) {
+			if ( this.nodeType === 1 ) {
+				this.appendChild( elem );
+			}
+		});
+	},
+
+	prepend: function() {
+		return this.domManip(arguments, true, function( elem ) {
+			if ( this.nodeType === 1 ) {
+				this.insertBefore( elem, this.firstChild );
+			}
+		});
+	},
+
+	before: function() {
+		if ( this[0] && this[0].parentNode ) {
+			return this.domManip(arguments, false, function( elem ) {
+				this.parentNode.insertBefore( elem, this );
+			});
+		} else if ( arguments.length ) {
+			var set = jQuery(arguments[0]);
+			set.push.apply( set, this.toArray() );
+			return this.pushStack( set, "before", arguments );
+		}
+	},
+
+	after: function() {
+		if ( this[0] && this[0].parentNode ) {
+			return this.domManip(arguments, false, function( elem ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			});
+		} else if ( arguments.length ) {
+			var set = this.pushStack( this, "after", arguments );
+			set.push.apply( set, jQuery(arguments[0]).toArray() );
+			return set;
+		}
+	},
+	
+	// keepData is for internal use only--do not document
+	remove: function( selector, keepData ) {
+		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+			if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+				if ( !keepData && elem.nodeType === 1 ) {
+					jQuery.cleanData( elem.getElementsByTagName("*") );
+					jQuery.cleanData( [ elem ] );
+				}
+
+				if ( elem.parentNode ) {
+					 elem.parentNode.removeChild( elem );
+				}
+			}
+		}
+		
+		return this;
+	},
+
+	empty: function() {
+		for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+			// Remove element nodes and prevent memory leaks
+			if ( elem.nodeType === 1 ) {
+				jQuery.cleanData( elem.getElementsByTagName("*") );
+			}
+
+			// Remove any remaining nodes
+			while ( elem.firstChild ) {
+				elem.removeChild( elem.firstChild );
+			}
+		}
+		
+		return this;
+	},
+
+	clone: function( events ) {
+		// Do the clone
+		var ret = this.map(function() {
+			if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
+				// IE copies events bound via attachEvent when
+				// using cloneNode. Calling detachEvent on the
+				// clone will also remove the events from the orignal
+				// In order to get around this, we use innerHTML.
+				// Unfortunately, this means some modifications to
+				// attributes in IE that are actually only stored
+				// as properties will not be copied (such as the
+				// the name attribute on an input).
+				var html = this.outerHTML, ownerDocument = this.ownerDocument;
+				if ( !html ) {
+					var div = ownerDocument.createElement("div");
+					div.appendChild( this.cloneNode(true) );
+					html = div.innerHTML;
+				}
+
+				return jQuery.clean([html.replace(rinlinejQuery, "")
+					// Handle the case in IE 8 where action=/test/> self-closes a tag
+					.replace(/=([^="'>\s]+\/)>/g, '="$1">')
+					.replace(rleadingWhitespace, "")], ownerDocument)[0];
+			} else {
+				return this.cloneNode(true);
+			}
+		});
+
+		// Copy the events from the original to the clone
+		if ( events === true ) {
+			cloneCopyEvent( this, ret );
+			cloneCopyEvent( this.find("*"), ret.find("*") );
+		}
+
+		// Return the cloned set
+		return ret;
+	},
+
+	html: function( value ) {
+		if ( value === undefined ) {
+			return this[0] && this[0].nodeType === 1 ?
+				this[0].innerHTML.replace(rinlinejQuery, "") :
+				null;
+
+		// See if we can take a shortcut and just use innerHTML
+		} else if ( typeof value === "string" && !rnocache.test( value ) &&
+			(jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
+			!wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
+
+			value = value.replace(rxhtmlTag, fcloseTag);
+
+			try {
+				for ( var i = 0, l = this.length; i < l; i++ ) {
+					// Remove element nodes and prevent memory leaks
+					if ( this[i].nodeType === 1 ) {
+						jQuery.cleanData( this[i].getElementsByTagName("*") );
+						this[i].innerHTML = value;
+					}
+				}
+
+			// If using innerHTML throws an exception, use the fallback method
+			} catch(e) {
+				this.empty().append( value );
+			}
+
+		} else if ( jQuery.isFunction( value ) ) {
+			this.each(function(i){
+				var self = jQuery(this), old = self.html();
+				self.empty().append(function(){
+					return value.call( this, i, old );
+				});
+			});
+
+		} else {
+			this.empty().append( value );
+		}
+
+		return this;
+	},
+
+	replaceWith: function( value ) {
+		if ( this[0] && this[0].parentNode ) {
+			// Make sure that the elements are removed from the DOM before they are inserted
+			// this can help fix replacing a parent with child elements
+			if ( jQuery.isFunction( value ) ) {
+				return this.each(function(i) {
+					var self = jQuery(this), old = self.html();
+					self.replaceWith( value.call( this, i, old ) );
+				});
+			}
+
+			if ( typeof value !== "string" ) {
+				value = jQuery(value).detach();
+			}
+
+			return this.each(function() {
+				var next = this.nextSibling, parent = this.parentNode;
+
+				jQuery(this).remove();
+
+				if ( next ) {
+					jQuery(next).before( value );
+				} else {
+					jQuery(parent).append( value );
+				}
+			});
+		} else {
+			return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
+		}
+	},
+
+	detach: function( selector ) {
+		return this.remove( selector, true );
+	},
+
+	domManip: function( args, table, callback ) {
+		var results, first, value = args[0], scripts = [], fragment, parent;
+
+		// We can't cloneNode fragments that contain checked, in WebKit
+		if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
+			return this.each(function() {
+				jQuery(this).domManip( args, table, callback, true );
+			});
+		}
+
+		if ( jQuery.isFunction(value) ) {
+			return this.each(function(i) {
+				var self = jQuery(this);
+				args[0] = value.call(this, i, table ? self.html() : undefined);
+				self.domManip( args, table, callback );
+			});
+		}
+
+		if ( this[0] ) {
+			parent = value && value.parentNode;
+
+			// If we're in a fragment, just use that instead of building a new one
+			if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
+				results = { fragment: parent };
+
+			} else {
+				results = buildFragment( args, this, scripts );
+			}
+			
+			fragment = results.fragment;
+			
+			if ( fragment.childNodes.length === 1 ) {
+				first = fragment = fragment.firstChild;
+			} else {
+				first = fragment.firstChild;
+			}
+
+			if ( first ) {
+				table = table && jQuery.nodeName( first, "tr" );
+
+				for ( var i = 0, l = this.length; i < l; i++ ) {
+					callback.call(
+						table ?
+							root(this[i], first) :
+							this[i],
+						i > 0 || results.cacheable || this.length > 1  ?
+							fragment.cloneNode(true) :
+							fragment
+					);
+				}
+			}
+
+			if ( scripts.length ) {
+				jQuery.each( scripts, evalScript );
+			}
+		}
+
+		return this;
+
+		function root( elem, cur ) {
+			return jQuery.nodeName(elem, "table") ?
+				(elem.getElementsByTagName("tbody")[0] ||
+				elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+				elem;
+		}
+	}
+});
+
+function cloneCopyEvent(orig, ret) {
+	var i = 0;
+
+	ret.each(function() {
+		if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) {
+			return;
+		}
+
+		var oldData = jQuery.data( orig[i++] ), curData = jQuery.data( this, oldData ), events = oldData && oldData.events;
+
+		if ( events ) {
+			delete curData.handle;
+			curData.events = {};
+
+			for ( var type in events ) {
+				for ( var handler in events[ type ] ) {
+					jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
+				}
+			}
+		}
+	});
+}
+
+function buildFragment( args, nodes, scripts ) {
+	var fragment, cacheable, cacheresults,
+		doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document);
+
+	// Only cache "small" (1/2 KB) strings that are associated with the main document
+	// Cloning options loses the selected state, so don't cache them
+	// IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+	// Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+	if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
+		!rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
+
+		cacheable = true;
+		cacheresults = jQuery.fragments[ args[0] ];
+		if ( cacheresults ) {
+			if ( cacheresults !== 1 ) {
+				fragment = cacheresults;
+			}
+		}
+	}
+
+	if ( !fragment ) {
+		fragment = doc.createDocumentFragment();
+		jQuery.clean( args, doc, fragment, scripts );
+	}
+
+	if ( cacheable ) {
+		jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
+	}
+
+	return { fragment: fragment, cacheable: cacheable };
+}
+
+jQuery.fragments = {};
+
+jQuery.each({
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var ret = [], insert = jQuery( selector ),
+			parent = this.length === 1 && this[0].parentNode;
+		
+		if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+			insert[ original ]( this[0] );
+			return this;
+			
+		} else {
+			for ( var i = 0, l = insert.length; i < l; i++ ) {
+				var elems = (i > 0 ? this.clone(true) : this).get();
+				jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
+				ret = ret.concat( elems );
+			}
+		
+			return this.pushStack( ret, name, insert.selector );
+		}
+	};
+});
+
+jQuery.extend({
+	clean: function( elems, context, fragment, scripts ) {
+		context = context || document;
+
+		// !context.createElement fails in IE with an error but returns typeof 'object'
+		if ( typeof context.createElement === "undefined" ) {
+			context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+		}
+
+		var ret = [];
+
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			if ( typeof elem === "number" ) {
+				elem += "";
+			}
+
+			if ( !elem ) {
+				continue;
+			}
+
+			// Convert html string into DOM nodes
+			if ( typeof elem === "string" && !rhtml.test( elem ) ) {
+				elem = context.createTextNode( elem );
+
+			} else if ( typeof elem === "string" ) {
+				// Fix "XHTML"-style tags in all browsers
+				elem = elem.replace(rxhtmlTag, fcloseTag);
+
+				// Trim whitespace, otherwise indexOf won't work as expected
+				var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
+					wrap = wrapMap[ tag ] || wrapMap._default,
+					depth = wrap[0],
+					div = context.createElement("div");
+
+				// Go to html and back, then peel off extra wrappers
+				div.innerHTML = wrap[1] + elem + wrap[2];
+
+				// Move to the right depth
+				while ( depth-- ) {
+					div = div.lastChild;
+				}
+
+				// Remove IE's autoinserted <tbody> from table fragments
+				if ( !jQuery.support.tbody ) {
+
+					// String was a <table>, *may* have spurious <tbody>
+					var hasBody = rtbody.test(elem),
+						tbody = tag === "table" && !hasBody ?
+							div.firstChild && div.firstChild.childNodes :
+
+							// String was a bare <thead> or <tfoot>
+							wrap[1] === "<table>" && !hasBody ?
+								div.childNodes :
+								[];
+
+					for ( var j = tbody.length - 1; j >= 0 ; --j ) {
+						if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+							tbody[ j ].parentNode.removeChild( tbody[ j ] );
+						}
+					}
+
+				}
+
+				// IE completely kills leading whitespace when innerHTML is used
+				if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+					div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+				}
+
+				elem = div.childNodes;
+			}
+
+			if ( elem.nodeType ) {
+				ret.push( elem );
+			} else {
+				ret = jQuery.merge( ret, elem );
+			}
+		}
+
+		if ( fragment ) {
+			for ( var i = 0; ret[i]; i++ ) {
+				if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+					scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+				
+				} else {
+					if ( ret[i].nodeType === 1 ) {
+						ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+					}
+					fragment.appendChild( ret[i] );
+				}
+			}
+		}
+
+		return ret;
+	},
+	
+	cleanData: function( elems ) {
+		var data, id, cache = jQuery.cache,
+			special = jQuery.event.special,
+			deleteExpando = jQuery.support.deleteExpando;
+		
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			id = elem[ jQuery.expando ];
+			
+			if ( id ) {
+				data = cache[ id ];
+				
+				if ( data.events ) {
+					for ( var type in data.events ) {
+						if ( special[ type ] ) {
+							jQuery.event.remove( elem, type );
+
+						} else {
+							removeEvent( elem, type, data.handle );
+						}
+					}
+				}
+				
+				if ( deleteExpando ) {
+					delete elem[ jQuery.expando ];
+
+				} else if ( elem.removeAttribute ) {
+					elem.removeAttribute( jQuery.expando );
+				}
+				
+				delete cache[ id ];
+			}
+		}
+	}
+});
+// exclude the following css properties to add px
+var rexclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
+	ralpha = /alpha\([^)]*\)/,
+	ropacity = /opacity=([^)]*)/,
+	rfloat = /float/i,
+	rdashAlpha = /-([a-z])/ig,
+	rupper = /([A-Z])/g,
+	rnumpx = /^-?\d+(?:px)?$/i,
+	rnum = /^-?\d/,
+
+	cssShow = { position: "absolute", visibility: "hidden", display:"block" },
+	cssWidth = [ "Left", "Right" ],
+	cssHeight = [ "Top", "Bottom" ],
+
+	// cache check for defaultView.getComputedStyle
+	getComputedStyle = document.defaultView && document.defaultView.getComputedStyle,
+	// normalize float css property
+	styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat",
+	fcamelCase = function( all, letter ) {
+		return letter.toUpperCase();
+	};
+
+jQuery.fn.css = function( name, value ) {
+	return access( this, name, value, true, function( elem, name, value ) {
+		if ( value === undefined ) {
+			return jQuery.curCSS( elem, name );
+		}
+		
+		if ( typeof value === "number" && !rexclude.test(name) ) {
+			value += "px";
+		}
+
+		jQuery.style( elem, name, value );
+	});
+};
+
+jQuery.extend({
+	style: function( elem, name, value ) {
+		// don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return undefined;
+		}
+
+		// ignore negative width and height values #1599
+		if ( (name === "width" || name === "height") && parseFloat(value) < 0 ) {
+			value = undefined;
+		}
+
+		var style = elem.style || elem, set = value !== undefined;
+
+		// IE uses filters for opacity
+		if ( !jQuery.support.opacity && name === "opacity" ) {
+			if ( set ) {
+				// IE has trouble with opacity if it does not have layout
+				// Force it by setting the zoom level
+				style.zoom = 1;
+
+				// Set the alpha filter to set the opacity
+				var opacity = parseInt( value, 10 ) + "" === "NaN" ? "" : "alpha(opacity=" + value * 100 + ")";
+				var filter = style.filter || jQuery.curCSS( elem, "filter" ) || "";
+				style.filter = ralpha.test(filter) ? filter.replace(ralpha, opacity) : opacity;
+			}
+
+			return style.filter && style.filter.indexOf("opacity=") >= 0 ?
+				(parseFloat( ropacity.exec(style.filter)[1] ) / 100) + "":
+				"";
+		}
+
+		// Make sure we're using the right name for getting the float value
+		if ( rfloat.test( name ) ) {
+			name = styleFloat;
+		}
+
+		name = name.replace(rdashAlpha, fcamelCase);
+
+		if ( set ) {
+			style[ name ] = value;
+		}
+
+		return style[ name ];
+	},
+
+	css: function( elem, name, force, extra ) {
+		if ( name === "width" || name === "height" ) {
+			var val, props = cssShow, which = name === "width" ? cssWidth : cssHeight;
+
+			function getWH() {
+				val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
+
+				if ( extra === "border" ) {
+					return;
+				}
+
+				jQuery.each( which, function() {
+					if ( !extra ) {
+						val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
+					}
+
+					if ( extra === "margin" ) {
+						val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0;
+					} else {
+						val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+					}
+				});
+			}
+
+			if ( elem.offsetWidth !== 0 ) {
+				getWH();
+			} else {
+				jQuery.swap( elem, props, getWH );
+			}
+
+			return Math.max(0, Math.round(val));
+		}
+
+		return jQuery.curCSS( elem, name, force );
+	},
+
+	curCSS: function( elem, name, force ) {
+		var ret, style = elem.style, filter;
+
+		// IE uses filters for opacity
+		if ( !jQuery.support.opacity && name === "opacity" && elem.currentStyle ) {
+			ret = ropacity.test(elem.currentStyle.filter || "") ?
+				(parseFloat(RegExp.$1) / 100) + "" :
+				"";
+
+			return ret === "" ?
+				"1" :
+				ret;
+		}
+
+		// Make sure we're using the right name for getting the float value
+		if ( rfloat.test( name ) ) {
+			name = styleFloat;
+		}
+
+		if ( !force && style && style[ name ] ) {
+			ret = style[ name ];
+
+		} else if ( getComputedStyle ) {
+
+			// Only "float" is needed here
+			if ( rfloat.test( name ) ) {
+				name = "float";
+			}
+
+			name = name.replace( rupper, "-$1" ).toLowerCase();
+
+			var defaultView = elem.ownerDocument.defaultView;
+
+			if ( !defaultView ) {
+				return null;
+			}
+
+			var computedStyle = defaultView.getComputedStyle( elem, null );
+
+			if ( computedStyle ) {
+				ret = computedStyle.getPropertyValue( name );
+			}
+
+			// We should always get a number back from opacity
+			if ( name === "opacity" && ret === "" ) {
+				ret = "1";
+			}
+
+		} else if ( elem.currentStyle ) {
+			var camelCase = name.replace(rdashAlpha, fcamelCase);
+
+			ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+
+			// From the awesome hack by Dean Edwards
+			// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+
+			// If we're not dealing with a regular pixel number
+			// but a number that has a weird ending, we need to convert it to pixels
+			if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+				// Remember the original values
+				var left = style.left, rsLeft = elem.runtimeStyle.left;
+
+				// Put in the new values to get a computed value out
+				elem.runtimeStyle.left = elem.currentStyle.left;
+				style.left = camelCase === "fontSize" ? "1em" : (ret || 0);
+				ret = style.pixelLeft + "px";
+
+				// Revert the changed values
+				style.left = left;
+				elem.runtimeStyle.left = rsLeft;
+			}
+		}
+
+		return ret;
+	},
+
+	// A method for quickly swapping in/out CSS properties to get correct calculations
+	swap: function( elem, options, callback ) {
+		var old = {};
+
+		// Remember the old values, and insert the new ones
+		for ( var name in options ) {
+			old[ name ] = elem.style[ name ];
+			elem.style[ name ] = options[ name ];
+		}
+
+		callback.call( elem );
+
+		// Revert the old values
+		for ( var name in options ) {
+			elem.style[ name ] = old[ name ];
+		}
+	}
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+	jQuery.expr.filters.hidden = function( elem ) {
+		var width = elem.offsetWidth, height = elem.offsetHeight,
+			skip = elem.nodeName.toLowerCase() === "tr";
+
+		return width === 0 && height === 0 && !skip ?
+			true :
+			width > 0 && height > 0 && !skip ?
+				false :
+				jQuery.curCSS(elem, "display") === "none";
+	};
+
+	jQuery.expr.filters.visible = function( elem ) {
+		return !jQuery.expr.filters.hidden( elem );
+	};
+}
+var jsc = now(),
+	rscript = /<script(.|\s)*?\/script>/gi,
+	rselectTextarea = /select|textarea/i,
+	rinput = /color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,
+	jsre = /=\?(&|$)/,
+	rquery = /\?/,
+	rts = /(\?|&)_=.*?(&|$)/,
+	rurl = /^(\w+:)?\/\/([^\/?#]+)/,
+	r20 = /%20/g,
+
+	// Keep a copy of the old load method
+	_load = jQuery.fn.load;
+
+jQuery.fn.extend({
+	load: function( url, params, callback ) {
+		if ( typeof url !== "string" ) {
+			return _load.call( this, url );
+
+		// Don't do a request if no elements are being requested
+		} else if ( !this.length ) {
+			return this;
+		}
+
+		var off = url.indexOf(" ");
+		if ( off >= 0 ) {
+			var selector = url.slice(off, url.length);
+			url = url.slice(0, off);
+		}
+
+		// Default to a GET request
+		var type = "GET";
+
+		// If the second parameter was provided
+		if ( params ) {
+			// If it's a function
+			if ( jQuery.isFunction( params ) ) {
+				// We assume that it's the callback
+				callback = params;
+				params = null;
+
+			// Otherwise, build a param string
+			} else if ( typeof params === "object" ) {
+				params = jQuery.param( params, jQuery.ajaxSettings.traditional );
+				type = "POST";
+			}
+		}
+
+		var self = this;
+
+		// Request the remote document
+		jQuery.ajax({
+			url: url,
+			type: type,
+			dataType: "html",
+			data: params,
+			complete: function( res, status ) {
+				// If successful, inject the HTML into all the matched elements
+				if ( status === "success" || status === "notmodified" ) {
+					// See if a selector was specified
+					self.html( selector ?
+						// Create a dummy div to hold the results
+						jQuery("<div />")
+							// inject the contents of the document in, removing the scripts
+							// to avoid any 'Permission Denied' errors in IE
+							.append(res.responseText.replace(rscript, ""))
+
+							// Locate the specified elements
+							.find(selector) :
+
+						// If not, just inject the full result
+						res.responseText );
+				}
+
+				if ( callback ) {
+					self.each( callback, [res.responseText, status, res] );
+				}
+			}
+		});
+
+		return this;
+	},
+
+	serialize: function() {
+		return jQuery.param(this.serializeArray());
+	},
+	serializeArray: function() {
+		return this.map(function() {
+			return this.elements ? jQuery.makeArray(this.elements) : this;
+		})
+		.filter(function() {
+			return this.name && !this.disabled &&
+				(this.checked || rselectTextarea.test(this.nodeName) ||
+					rinput.test(this.type));
+		})
+		.map(function( i, elem ) {
+			var val = jQuery(this).val();
+
+			return val == null ?
+				null :
+				jQuery.isArray(val) ?
+					jQuery.map( val, function( val, i ) {
+						return { name: elem.name, value: val };
+					}) :
+					{ name: elem.name, value: val };
+		}).get();
+	}
+});
+
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) {
+	jQuery.fn[o] = function( f ) {
+		return this.bind(o, f);
+	};
+});
+
+jQuery.extend({
+
+	get: function( url, data, callback, type ) {
+		// shift arguments if data argument was omited
+		if ( jQuery.isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = null;
+		}
+
+		return jQuery.ajax({
+			type: "GET",
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	},
+
+	getScript: function( url, callback ) {
+		return jQuery.get(url, null, callback, "script");
+	},
+
+	getJSON: function( url, data, callback ) {
+		return jQuery.get(url, data, callback, "json");
+	},
+
+	post: function( url, data, callback, type ) {
+		// shift arguments if data argument was omited
+		if ( jQuery.isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = {};
+		}
+
+		return jQuery.ajax({
+			type: "POST",
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	},
+
+	ajaxSetup: function( settings ) {
+		jQuery.extend( jQuery.ajaxSettings, settings );
+	},
+
+	ajaxSettings: {
+		url: location.href,
+		global: true,
+		type: "GET",
+		contentType: "application/x-www-form-urlencoded",
+		processData: true,
+		async: true,
+		/*
+		timeout: 0,
+		data: null,
+		username: null,
+		password: null,
+		traditional: false,
+		*/
+		// Create the request object; Microsoft failed to properly
+		// implement the XMLHttpRequest in IE7 (can't request local files),
+		// so we use the ActiveXObject when it is available
+		// This function can be overriden by calling jQuery.ajaxSetup
+		xhr: window.XMLHttpRequest && (window.location.protocol !== "file:" || !window.ActiveXObject) ?
+			function() {
+				return new window.XMLHttpRequest();
+			} :
+			function() {
+				try {
+					return new window.ActiveXObject("Microsoft.XMLHTTP");
+				} catch(e) {}
+			},
+		accepts: {
+			xml: "application/xml, text/xml",
+			html: "text/html",
+			script: "text/javascript, application/javascript",
+			json: "application/json, text/javascript",
+			text: "text/plain",
+			_default: "*/*"
+		}
+	},
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {},
+
+	ajax: function( origSettings ) {
+		var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings);
+		
+		var jsonp, status, data,
+			callbackContext = origSettings && origSettings.context || s,
+			type = s.type.toUpperCase();
+
+		// convert data if not already a string
+		if ( s.data && s.processData && typeof s.data !== "string" ) {
+			s.data = jQuery.param( s.data, s.traditional );
+		}
+
+		// Handle JSONP Parameter Callbacks
+		if ( s.dataType === "jsonp" ) {
+			if ( type === "GET" ) {
+				if ( !jsre.test( s.url ) ) {
+					s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+				}
+			} else if ( !s.data || !jsre.test(s.data) ) {
+				s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+			}
+			s.dataType = "json";
+		}
+
+		// Build temporary JSONP function
+		if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) {
+			jsonp = s.jsonpCallback || ("jsonp" + jsc++);
+
+			// Replace the =? sequence both in the query string and the data
+			if ( s.data ) {
+				s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+			}
+
+			s.url = s.url.replace(jsre, "=" + jsonp + "$1");
+
+			// We need to make sure
+			// that a JSONP style response is executed properly
+			s.dataType = "script";
+
+			// Handle JSONP-style loading
+			window[ jsonp ] = window[ jsonp ] || function( tmp ) {
+				data = tmp;
+				success();
+				complete();
+				// Garbage collect
+				window[ jsonp ] = undefined;
+
+				try {
+					delete window[ jsonp ];
+				} catch(e) {}
+
+				if ( head ) {
+					head.removeChild( script );
+				}
+			};
+		}
+
+		if ( s.dataType === "script" && s.cache === null ) {
+			s.cache = false;
+		}
+
+		if ( s.cache === false && type === "GET" ) {
+			var ts = now();
+
+			// try replacing _= if it is there
+			var ret = s.url.replace(rts, "$1_=" + ts + "$2");
+
+			// if nothing was replaced, add timestamp to the end
+			s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : "");
+		}
+
+		// If data is available, append data to url for get requests
+		if ( s.data && type === "GET" ) {
+			s.url += (rquery.test(s.url) ? "&" : "?") + s.data;
+		}
+
+		// Watch for a new set of requests
+		if ( s.global && ! jQuery.active++ ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
+
+		// Matches an absolute URL, and saves the domain
+		var parts = rurl.exec( s.url ),
+			remote = parts && (parts[1] && parts[1] !== location.protocol || parts[2] !== location.host);
+
+		// If we're requesting a remote document
+		// and trying to load JSON or Script with a GET
+		if ( s.dataType === "script" && type === "GET" && remote ) {
+			var head = document.getElementsByTagName("head")[0] || document.documentElement;
+			var script = document.createElement("script");
+			script.src = s.url;
+			if ( s.scriptCharset ) {
+				script.charset = s.scriptCharset;
+			}
+
+			// Handle Script loading
+			if ( !jsonp ) {
+				var done = false;
+
+				// Attach handlers for all browsers
+				script.onload = script.onreadystatechange = function() {
+					if ( !done && (!this.readyState ||
+							this.readyState === "loaded" || this.readyState === "complete") ) {
+						done = true;
+						success();
+						complete();
+
+						// Handle memory leak in IE
+						script.onload = script.onreadystatechange = null;
+						if ( head && script.parentNode ) {
+							head.removeChild( script );
+						}
+					}
+				};
+			}
+
+			// Use insertBefore instead of appendChild  to circumvent an IE6 bug.
+			// This arises when a base node is used (#2709 and #4378).
+			head.insertBefore( script, head.firstChild );
+
+			// We handle everything using the script element injection
+			return undefined;
+		}
+
+		var requestDone = false;
+
+		// Create the request object
+		var xhr = s.xhr();
+
+		if ( !xhr ) {
+			return;
+		}
+
+		// Open the socket
+		// Passing null username, generates a login popup on Opera (#2865)
+		if ( s.username ) {
+			xhr.open(type, s.url, s.async, s.username, s.password);
+		} else {
+			xhr.open(type, s.url, s.async);
+		}
+
+		// Need an extra try/catch for cross domain requests in Firefox 3
+		try {
+			// Set the correct header, if data is being sent
+			if ( s.data || origSettings && origSettings.contentType ) {
+				xhr.setRequestHeader("Content-Type", s.contentType);
+			}
+
+			// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+			if ( s.ifModified ) {
+				if ( jQuery.lastModified[s.url] ) {
+					xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]);
+				}
+
+				if ( jQuery.etag[s.url] ) {
+					xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]);
+				}
+			}
+
+			// Set header so the called script knows that it's an XMLHttpRequest
+			// Only send the header if it's not a remote XHR
+			if ( !remote ) {
+				xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+			}
+
+			// Set the Accepts header for the server, depending on the dataType
+			xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
+				s.accepts[ s.dataType ] + ", */*" :
+				s.accepts._default );
+		} catch(e) {}
+
+		// Allow custom headers/mimetypes and early abort
+		if ( s.beforeSend && s.beforeSend.call(callbackContext, xhr, s) === false ) {
+			// Handle the global AJAX counter
+			if ( s.global && ! --jQuery.active ) {
+				jQuery.event.trigger( "ajaxStop" );
+			}
+
+			// close opended socket
+			xhr.abort();
+			return false;
+		}
+
+		if ( s.global ) {
+			trigger("ajaxSend", [xhr, s]);
+		}
+
+		// Wait for a response to come back
+		var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) {
+			// The request was aborted
+			if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) {
+				// Opera doesn't call onreadystatechange before this point
+				// so we simulate the call
+				if ( !requestDone ) {
+					complete();
+				}
+
+				requestDone = true;
+				if ( xhr ) {
+					xhr.onreadystatechange = jQuery.noop;
+				}
+
+			// The transfer is complete and the data is available, or the request timed out
+			} else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) {
+				requestDone = true;
+				xhr.onreadystatechange = jQuery.noop;
+
+				status = isTimeout === "timeout" ?
+					"timeout" :
+					!jQuery.httpSuccess( xhr ) ?
+						"error" :
+						s.ifModified && jQuery.httpNotModified( xhr, s.url ) ?
+							"notmodified" :
+							"success";
+
+				var errMsg;
+
+				if ( status === "success" ) {
+					// Watch for, and catch, XML document parse errors
+					try {
+						// process the data (runs the xml through httpData regardless of callback)
+						data = jQuery.httpData( xhr, s.dataType, s );
+					} catch(err) {
+						status = "parsererror";
+						errMsg = err;
+					}
+				}
+
+				// Make sure that the request was successful or notmodified
+				if ( status === "success" || status === "notmodified" ) {
+					// JSONP handles its own success callback
+					if ( !jsonp ) {
+						success();
+					}
+				} else {
+					jQuery.handleError(s, xhr, status, errMsg);
+				}
+
+				// Fire the complete handlers
+				complete();
+
+				if ( isTimeout === "timeout" ) {
+					xhr.abort();
+				}
+
+				// Stop memory leaks
+				if ( s.async ) {
+					xhr = null;
+				}
+			}
+		};
+
+		// Override the abort handler, if we can (IE doesn't allow it, but that's OK)
+		// Opera doesn't fire onreadystatechange at all on abort
+		try {
+			var oldAbort = xhr.abort;
+			xhr.abort = function() {
+				if ( xhr ) {
+					oldAbort.call( xhr );
+				}
+
+				onreadystatechange( "abort" );
+			};
+		} catch(e) { }
+
+		// Timeout checker
+		if ( s.async && s.timeout > 0 ) {
+			setTimeout(function() {
+				// Check to see if the request is still happening
+				if ( xhr && !requestDone ) {
+					onreadystatechange( "timeout" );
+				}
+			}, s.timeout);
+		}
+
+		// Send the data
+		try {
+			xhr.send( type === "POST" || type === "PUT" || type === "DELETE" ? s.data : null );
+		} catch(e) {
+			jQuery.handleError(s, xhr, null, e);
+			// Fire the complete handlers
+			complete();
+		}
+
+		// firefox 1.5 doesn't fire statechange for sync requests
+		if ( !s.async ) {
+			onreadystatechange();
+		}
+
+		function success() {
+			// If a local callback was specified, fire it and pass it the data
+			if ( s.success ) {
+				s.success.call( callbackContext, data, status, xhr );
+			}
+
+			// Fire the global callback
+			if ( s.global ) {
+				trigger( "ajaxSuccess", [xhr, s] );
+			}
+		}
+
+		function complete() {
+			// Process result
+			if ( s.complete ) {
+				s.complete.call( callbackContext, xhr, status);
+			}
+
+			// The request was completed
+			if ( s.global ) {
+				trigger( "ajaxComplete", [xhr, s] );
+			}
+
+			// Handle the global AJAX counter
+			if ( s.global && ! --jQuery.active ) {
+				jQuery.event.trigger( "ajaxStop" );
+			}
+		}
+		
+		function trigger(type, args) {
+			(s.context ? jQuery(s.context) : jQuery.event).trigger(type, args);
+		}
+
+		// return XMLHttpRequest to allow aborting the request etc.
+		return xhr;
+	},
+
+	handleError: function( s, xhr, status, e ) {
+		// If a local callback was specified, fire it
+		if ( s.error ) {
+			s.error.call( s.context || s, xhr, status, e );
+		}
+
+		// Fire the global callback
+		if ( s.global ) {
+			(s.context ? jQuery(s.context) : jQuery.event).trigger( "ajaxError", [xhr, s, e] );
+		}
+	},
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Determines if an XMLHttpRequest was successful or not
+	httpSuccess: function( xhr ) {
+		try {
+			// IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
+			return !xhr.status && location.protocol === "file:" ||
+				// Opera returns 0 when status is 304
+				( xhr.status >= 200 && xhr.status < 300 ) ||
+				xhr.status === 304 || xhr.status === 1223 || xhr.status === 0;
+		} catch(e) {}
+
+		return false;
+	},
+
+	// Determines if an XMLHttpRequest returns NotModified
+	httpNotModified: function( xhr, url ) {
+		var lastModified = xhr.getResponseHeader("Last-Modified"),
+			etag = xhr.getResponseHeader("Etag");
+
+		if ( lastModified ) {
+			jQuery.lastModified[url] = lastModified;
+		}
+
+		if ( etag ) {
+			jQuery.etag[url] = etag;
+		}
+
+		// Opera returns 0 when status is 304
+		return xhr.status === 304 || xhr.status === 0;
+	},
+
+	httpData: function( xhr, type, s ) {
+		var ct = xhr.getResponseHeader("content-type") || "",
+			xml = type === "xml" || !type && ct.indexOf("xml") >= 0,
+			data = xml ? xhr.responseXML : xhr.responseText;
+
+		if ( xml && data.documentElement.nodeName === "parsererror" ) {
+			jQuery.error( "parsererror" );
+		}
+
+		// Allow a pre-filtering function to sanitize the response
+		// s is checked to keep backwards compatibility
+		if ( s && s.dataFilter ) {
+			data = s.dataFilter( data, type );
+		}
+
+		// The filter can actually parse the response
+		if ( typeof data === "string" ) {
+			// Get the JavaScript object, if JSON is used.
+			if ( type === "json" || !type && ct.indexOf("json") >= 0 ) {
+				data = jQuery.parseJSON( data );
+
+			// If the type is "script", eval it in global context
+			} else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) {
+				jQuery.globalEval( data );
+			}
+		}
+
+		return data;
+	},
+
+	// Serialize an array of form elements or a set of
+	// key/values into a query string
+	param: function( a, traditional ) {
+		var s = [];
+		
+		// Set traditional to true for jQuery <= 1.3.2 behavior.
+		if ( traditional === undefined ) {
+			traditional = jQuery.ajaxSettings.traditional;
+		}
+		
+		// If an array was passed in, assume that it is an array of form elements.
+		if ( jQuery.isArray(a) || a.jquery ) {
+			// Serialize the form elements
+			jQuery.each( a, function() {
+				add( this.name, this.value );
+			});
+			
+		} else {
+			// If traditional, encode the "old" way (the way 1.3.2 or older
+			// did it), otherwise encode params recursively.
+			for ( var prefix in a ) {
+				buildParams( prefix, a[prefix] );
+			}
+		}
+
+		// Return the resulting serialization
+		return s.join("&").replace(r20, "+");
+
+		function buildParams( prefix, obj ) {
+			if ( jQuery.isArray(obj) ) {
+				// Serialize array item.
+				jQuery.each( obj, function( i, v ) {
+					if ( traditional || /\[\]$/.test( prefix ) ) {
+						// Treat each array item as a scalar.
+						add( prefix, v );
+					} else {
+						// If array item is non-scalar (array or object), encode its
+						// numeric index to resolve deserialization ambiguity issues.
+						// Note that rack (as of 1.0.0) can't currently deserialize
+						// nested arrays properly, and attempting to do so may cause
+						// a server error. Possible fixes are to modify rack's
+						// deserialization algorithm or to provide an option or flag
+						// to force array serialization to be shallow.
+						buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v );
+					}
+				});
+					
+			} else if ( !traditional && obj != null && typeof obj === "object" ) {
+				// Serialize object item.
+				jQuery.each( obj, function( k, v ) {
+					buildParams( prefix + "[" + k + "]", v );
+				});
+					
+			} else {
+				// Serialize scalar item.
+				add( prefix, obj );
+			}
+		}
+
+		function add( key, value ) {
+			// If value is a function, invoke it and return its value
+			value = jQuery.isFunction(value) ? value() : value;
+			s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
+		}
+	}
+});
+var elemdisplay = {},
+	rfxtypes = /toggle|show|hide/,
+	rfxnum = /^([+-]=)?([\d+-.]+)(.*)$/,
+	timerId,
+	fxAttrs = [
+		// height animations
+		[ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ],
+		// width animations
+		[ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ],
+		// opacity animations
+		[ "opacity" ]
+	];
+
+jQuery.fn.extend({
+	show: function( speed, callback ) {
+		if ( speed || speed === 0) {
+			return this.animate( genFx("show", 3), speed, callback);
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var old = jQuery.data(this[i], "olddisplay");
+
+				this[i].style.display = old || "";
+
+				if ( jQuery.css(this[i], "display") === "none" ) {
+					var nodeName = this[i].nodeName, display;
+
+					if ( elemdisplay[ nodeName ] ) {
+						display = elemdisplay[ nodeName ];
+
+					} else {
+						var elem = jQuery("<" + nodeName + " />").appendTo("body");
+
+						display = elem.css("display");
+
+						if ( display === "none" ) {
+							display = "block";
+						}
+
+						elem.remove();
+
+						elemdisplay[ nodeName ] = display;
+					}
+
+					jQuery.data(this[i], "olddisplay", display);
+				}
+			}
+
+			// Set the display of the elements in a second loop
+			// to avoid the constant reflow
+			for ( var j = 0, k = this.length; j < k; j++ ) {
+				this[j].style.display = jQuery.data(this[j], "olddisplay") || "";
+			}
+
+			return this;
+		}
+	},
+
+	hide: function( speed, callback ) {
+		if ( speed || speed === 0 ) {
+			return this.animate( genFx("hide", 3), speed, callback);
+
+		} else {
+			for ( var i = 0, l = this.length; i < l; i++ ) {
+				var old = jQuery.data(this[i], "olddisplay");
+				if ( !old && old !== "none" ) {
+					jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display"));
+				}
+			}
+
+			// Set the display of the elements in a second loop
+			// to avoid the constant reflow
+			for ( var j = 0, k = this.length; j < k; j++ ) {
+				this[j].style.display = "none";
+			}
+
+			return this;
+		}
+	},
+
+	// Save the old toggle function
+	_toggle: jQuery.fn.toggle,
+
+	toggle: function( fn, fn2 ) {
+		var bool = typeof fn === "boolean";
+
+		if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
+			this._toggle.apply( this, arguments );
+
+		} else if ( fn == null || bool ) {
+			this.each(function() {
+				var state = bool ? fn : jQuery(this).is(":hidden");
+				jQuery(this)[ state ? "show" : "hide" ]();
+			});
+
+		} else {
+			this.animate(genFx("toggle", 3), fn, fn2);
+		}
+
+		return this;
+	},
+
+	fadeTo: function( speed, to, callback ) {
+		return this.filter(":hidden").css("opacity", 0).show().end()
+					.animate({opacity: to}, speed, callback);
+	},
+
+	animate: function( prop, speed, easing, callback ) {
+		var optall = jQuery.speed(speed, easing, callback);
+
+		if ( jQuery.isEmptyObject( prop ) ) {
+			return this.each( optall.complete );
+		}
+
+		return this[ optall.queue === false ? "each" : "queue" ](function() {
+			var opt = jQuery.extend({}, optall), p,
+				hidden = this.nodeType === 1 && jQuery(this).is(":hidden"),
+				self = this;
+
+			for ( p in prop ) {
+				var name = p.replace(rdashAlpha, fcamelCase);
+
+				if ( p !== name ) {
+					prop[ name ] = prop[ p ];
+					delete prop[ p ];
+					p = name;
+				}
+
+				if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) {
+					return opt.complete.call(this);
+				}
+
+				if ( ( p === "height" || p === "width" ) && this.style ) {
+					// Store display property
+					opt.display = jQuery.css(this, "display");
+
+					// Make sure that nothing sneaks out
+					opt.overflow = this.style.overflow;
+				}
+
+				if ( jQuery.isArray( prop[p] ) ) {
+					// Create (if needed) and add to specialEasing
+					(opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1];
+					prop[p] = prop[p][0];
+				}
+			}
+
+			if ( opt.overflow != null ) {
+				this.style.overflow = "hidden";
+			}
+
+			opt.curAnim = jQuery.extend({}, prop);
+
+			jQuery.each( prop, function( name, val ) {
+				var e = new jQuery.fx( self, opt, name );
+
+				if ( rfxtypes.test(val) ) {
+					e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+
+				} else {
+					var parts = rfxnum.exec(val),
+						start = e.cur(true) || 0;
+
+					if ( parts ) {
+						var end = parseFloat( parts[2] ),
+							unit = parts[3] || "px";
+
+						// We need to compute starting value
+						if ( unit !== "px" ) {
+							self.style[ name ] = (end || 1) + unit;
+							start = ((end || 1) / e.cur(true)) * start;
+							self.style[ name ] = start + unit;
+						}
+
+						// If a +=/-= token was provided, we're doing a relative animation
+						if ( parts[1] ) {
+							end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
+						}
+
+						e.custom( start, end, unit );
+
+					} else {
+						e.custom( start, val, "" );
+					}
+				}
+			});
+
+			// For JS strict compliance
+			return true;
+		});
+	},
+
+	stop: function( clearQueue, gotoEnd ) {
+		var timers = jQuery.timers;
+
+		if ( clearQueue ) {
+			this.queue([]);
+		}
+
+		this.each(function() {
+			// go in reverse order so anything added to the queue during the loop is ignored
+			for ( var i = timers.length - 1; i >= 0; i-- ) {
+				if ( timers[i].elem === this ) {
+					if (gotoEnd) {
+						// force the next step to be the last
+						timers[i](true);
+					}
+
+					timers.splice(i, 1);
+				}
+			}
+		});
+
+		// start the next in the queue if the last step wasn't forced
+		if ( !gotoEnd ) {
+			this.dequeue();
+		}
+
+		return this;
+	}
+
+});
+
+// Generate shortcuts for custom animations
+jQuery.each({
+	slideDown: genFx("show", 1),
+	slideUp: genFx("hide", 1),
+	slideToggle: genFx("toggle", 1),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, callback ) {
+		return this.animate( props, speed, callback );
+	};
+});
+
+jQuery.extend({
+	speed: function( speed, easing, fn ) {
+		var opt = speed && typeof speed === "object" ? speed : {
+			complete: fn || !fn && easing ||
+				jQuery.isFunction( speed ) && speed,
+			duration: speed,
+			easing: fn && easing || easing && !jQuery.isFunction(easing) && easing
+		};
+
+		opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration :
+			jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default;
+
+		// Queueing
+		opt.old = opt.complete;
+		opt.complete = function() {
+			if ( opt.queue !== false ) {
+				jQuery(this).dequeue();
+			}
+			if ( jQuery.isFunction( opt.old ) ) {
+				opt.old.call( this );
+			}
+		};
+
+		return opt;
+	},
+
+	easing: {
+		linear: function( p, n, firstNum, diff ) {
+			return firstNum + diff * p;
+		},
+		swing: function( p, n, firstNum, diff ) {
+			return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+		}
+	},
+
+	timers: [],
+
+	fx: function( elem, options, prop ) {
+		this.options = options;
+		this.elem = elem;
+		this.prop = prop;
+
+		if ( !options.orig ) {
+			options.orig = {};
+		}
+	}
+
+});
+
+jQuery.fx.prototype = {
+	// Simple function for setting a style value
+	update: function() {
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
+
+		(jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+
+		// Set display property to block for height/width animations
+		if ( ( this.prop === "height" || this.prop === "width" ) && this.elem.style ) {
+			this.elem.style.display = "block";
+		}
+	},
+
+	// Get the current size
+	cur: function( force ) {
+		if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
+			return this.elem[ this.prop ];
+		}
+
+		var r = parseFloat(jQuery.css(this.elem, this.prop, force));
+		return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
+	},
+
+	// Start an animation from one number to another
+	custom: function( from, to, unit ) {
+		this.startTime = now();
+		this.start = from;
+		this.end = to;
+		this.unit = unit || this.unit || "px";
+		this.now = this.start;
+		this.pos = this.state = 0;
+
+		var self = this;
+		function t( gotoEnd ) {
+			return self.step(gotoEnd);
+		}
+
+		t.elem = this.elem;
+
+		if ( t() && jQuery.timers.push(t) && !timerId ) {
+			timerId = setInterval(jQuery.fx.tick, 13);
+		}
+	},
+
+	// Simple 'show' function
+	show: function() {
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+		this.options.show = true;
+
+		// Begin the animation
+		// Make sure that we start at a small width/height to avoid any
+		// flash of content
+		this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur());
+
+		// Start by showing the element
+		jQuery( this.elem ).show();
+	},
+
+	// Simple 'hide' function
+	hide: function() {
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
+		this.options.hide = true;
+
+		// Begin the animation
+		this.custom(this.cur(), 0);
+	},
+
+	// Each step of an animation
+	step: function( gotoEnd ) {
+		var t = now(), done = true;
+
+		if ( gotoEnd || t >= this.options.duration + this.startTime ) {
+			this.now = this.end;
+			this.pos = this.state = 1;
+			this.update();
+
+			this.options.curAnim[ this.prop ] = true;
+
+			for ( var i in this.options.curAnim ) {
+				if ( this.options.curAnim[i] !== true ) {
+					done = false;
+				}
+			}
+
+			if ( done ) {
+				if ( this.options.display != null ) {
+					// Reset the overflow
+					this.elem.style.overflow = this.options.overflow;
+
+					// Reset the display
+					var old = jQuery.data(this.elem, "olddisplay");
+					this.elem.style.display = old ? old : this.options.display;
+
+					if ( jQuery.css(this.elem, "display") === "none" ) {
+						this.elem.style.display = "block";
+					}
+				}
+
+				// Hide the element if the "hide" operation was done
+				if ( this.options.hide ) {
+					jQuery(this.elem).hide();
+				}
+
+				// Reset the properties, if the item has been hidden or shown
+				if ( this.options.hide || this.options.show ) {
+					for ( var p in this.options.curAnim ) {
+						jQuery.style(this.elem, p, this.options.orig[p]);
+					}
+				}
+
+				// Execute the complete function
+				this.options.complete.call( this.elem );
+			}
+
+			return false;
+
+		} else {
+			var n = t - this.startTime;
+			this.state = n / this.options.duration;
+
+			// Perform the easing function, defaults to swing
+			var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
+			var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear");
+			this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration);
+			this.now = this.start + ((this.end - this.start) * this.pos);
+
+			// Perform the next step of the animation
+			this.update();
+		}
+
+		return true;
+	}
+};
+
+jQuery.extend( jQuery.fx, {
+	tick: function() {
+		var timers = jQuery.timers;
+
+		for ( var i = 0; i < timers.length; i++ ) {
+			if ( !timers[i]() ) {
+				timers.splice(i--, 1);
+			}
+		}
+
+		if ( !timers.length ) {
+			jQuery.fx.stop();
+		}
+	},
+		
+	stop: function() {
+		clearInterval( timerId );
+		timerId = null;
+	},
+	
+	speeds: {
+		slow: 600,
+ 		fast: 200,
+ 		// Default speed
+ 		_default: 400
+	},
+
+	step: {
+		opacity: function( fx ) {
+			jQuery.style(fx.elem, "opacity", fx.now);
+		},
+
+		_default: function( fx ) {
+			if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
+				fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
+			} else {
+				fx.elem[ fx.prop ] = fx.now;
+			}
+		}
+	}
+});
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+	jQuery.expr.filters.animated = function( elem ) {
+		return jQuery.grep(jQuery.timers, function( fn ) {
+			return elem === fn.elem;
+		}).length;
+	};
+}
+
+function genFx( type, num ) {
+	var obj = {};
+
+	jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
+		obj[ this ] = type;
+	});
+
+	return obj;
+}
+if ( "getBoundingClientRect" in document.documentElement ) {
+	jQuery.fn.offset = function( options ) {
+		var elem = this[0];
+
+		if ( options ) { 
+			return this.each(function( i ) {
+				jQuery.offset.setOffset( this, options, i );
+			});
+		}
+
+		if ( !elem || !elem.ownerDocument ) {
+			return null;
+		}
+
+		if ( elem === elem.ownerDocument.body ) {
+			return jQuery.offset.bodyOffset( elem );
+		}
+
+		var box = elem.getBoundingClientRect(), doc = elem.ownerDocument, body = doc.body, docElem = doc.documentElement,
+			clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0,
+			top  = box.top  + (self.pageYOffset || jQuery.support.boxModel && docElem.scrollTop  || body.scrollTop ) - clientTop,
+			left = box.left + (self.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+
+		return { top: top, left: left };
+	};
+
+} else {
+	jQuery.fn.offset = function( options ) {
+		var elem = this[0];
+
+		if ( options ) { 
+			return this.each(function( i ) {
+				jQuery.offset.setOffset( this, options, i );
+			});
+		}
+
+		if ( !elem || !elem.ownerDocument ) {
+			return null;
+		}
+
+		if ( elem === elem.ownerDocument.body ) {
+			return jQuery.offset.bodyOffset( elem );
+		}
+
+		jQuery.offset.initialize();
+
+		var offsetParent = elem.offsetParent, prevOffsetParent = elem,
+			doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement,
+			body = doc.body, defaultView = doc.defaultView,
+			prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
+			top = elem.offsetTop, left = elem.offsetLeft;
+
+		while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
+			if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+				break;
+			}
+
+			computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
+			top  -= elem.scrollTop;
+			left -= elem.scrollLeft;
+
+			if ( elem === offsetParent ) {
+				top  += elem.offsetTop;
+				left += elem.offsetLeft;
+
+				if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.nodeName)) ) {
+					top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
+					left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+				}
+
+				prevOffsetParent = offsetParent, offsetParent = elem.offsetParent;
+			}
+
+			if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
+				top  += parseFloat( computedStyle.borderTopWidth  ) || 0;
+				left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+			}
+
+			prevComputedStyle = computedStyle;
+		}
+
+		if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
+			top  += body.offsetTop;
+			left += body.offsetLeft;
+		}
+
+		if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+			top  += Math.max( docElem.scrollTop, body.scrollTop );
+			left += Math.max( docElem.scrollLeft, body.scrollLeft );
+		}
+
+		return { top: top, left: left };
+	};
+}
+
+jQuery.offset = {
+	initialize: function() {
+		var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.curCSS(body, "marginTop", true) ) || 0,
+			html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+
+		jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
+
+		container.innerHTML = html;
+		body.insertBefore( container, body.firstChild );
+		innerDiv = container.firstChild;
+		checkDiv = innerDiv.firstChild;
+		td = innerDiv.nextSibling.firstChild.firstChild;
+
+		this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
+		this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
+
+		checkDiv.style.position = "fixed", checkDiv.style.top = "20px";
+		// safari subtracts parent border width here which is 5px
+		this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
+		checkDiv.style.position = checkDiv.style.top = "";
+
+		innerDiv.style.overflow = "hidden", innerDiv.style.position = "relative";
+		this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
+
+		this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
+
+		body.removeChild( container );
+		body = container = innerDiv = checkDiv = table = td = null;
+		jQuery.offset.initialize = jQuery.noop;
+	},
+
+	bodyOffset: function( body ) {
+		var top = body.offsetTop, left = body.offsetLeft;
+
+		jQuery.offset.initialize();
+
+		if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
+			top  += parseFloat( jQuery.curCSS(body, "marginTop",  true) ) || 0;
+			left += parseFloat( jQuery.curCSS(body, "marginLeft", true) ) || 0;
+		}
+
+		return { top: top, left: left };
+	},
+	
+	setOffset: function( elem, options, i ) {
+		// set position first, in-case top/left are set even on static elem
+		if ( /static/.test( jQuery.curCSS( elem, "position" ) ) ) {
+			elem.style.position = "relative";
+		}
+		var curElem   = jQuery( elem ),
+			curOffset = curElem.offset(),
+			curTop    = parseInt( jQuery.curCSS( elem, "top",  true ), 10 ) || 0,
+			curLeft   = parseInt( jQuery.curCSS( elem, "left", true ), 10 ) || 0;
+
+		if ( jQuery.isFunction( options ) ) {
+			options = options.call( elem, i, curOffset );
+		}
+
+		var props = {
+			top:  (options.top  - curOffset.top)  + curTop,
+			left: (options.left - curOffset.left) + curLeft
+		};
+		
+		if ( "using" in options ) {
+			options.using.call( elem, props );
+		} else {
+			curElem.css( props );
+		}
+	}
+};
+
+
+jQuery.fn.extend({
+	position: function() {
+		if ( !this[0] ) {
+			return null;
+		}
+
+		var elem = this[0],
+
+		// Get *real* offsetParent
+		offsetParent = this.offsetParent(),
+
+		// Get correct offsets
+		offset       = this.offset(),
+		parentOffset = /^body|html$/i.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+		// Subtract element margins
+		// note: when an element has margin: auto the offsetLeft and marginLeft
+		// are the same in Safari causing offset.left to incorrectly be 0
+		offset.top  -= parseFloat( jQuery.curCSS(elem, "marginTop",  true) ) || 0;
+		offset.left -= parseFloat( jQuery.curCSS(elem, "marginLeft", true) ) || 0;
+
+		// Add offsetParent borders
+		parentOffset.top  += parseFloat( jQuery.curCSS(offsetParent[0], "borderTopWidth",  true) ) || 0;
+		parentOffset.left += parseFloat( jQuery.curCSS(offsetParent[0], "borderLeftWidth", true) ) || 0;
+
+		// Subtract the two offsets
+		return {
+			top:  offset.top  - parentOffset.top,
+			left: offset.left - parentOffset.left
+		};
+	},
+
+	offsetParent: function() {
+		return this.map(function() {
+			var offsetParent = this.offsetParent || document.body;
+			while ( offsetParent && (!/^body|html$/i.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+				offsetParent = offsetParent.offsetParent;
+			}
+			return offsetParent;
+		});
+	}
+});
+
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( ["Left", "Top"], function( i, name ) {
+	var method = "scroll" + name;
+
+	jQuery.fn[ method ] = function(val) {
+		var elem = this[0], win;
+		
+		if ( !elem ) {
+			return null;
+		}
+
+		if ( val !== undefined ) {
+			// Set the scroll offset
+			return this.each(function() {
+				win = getWindow( this );
+
+				if ( win ) {
+					win.scrollTo(
+						!i ? val : jQuery(win).scrollLeft(),
+						 i ? val : jQuery(win).scrollTop()
+					);
+
+				} else {
+					this[ method ] = val;
+				}
+			});
+		} else {
+			win = getWindow( elem );
+
+			// Return the scroll offset
+			return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
+				jQuery.support.boxModel && win.document.documentElement[ method ] ||
+					win.document.body[ method ] :
+				elem[ method ];
+		}
+	};
+});
+
+function getWindow( elem ) {
+	return ("scrollTo" in elem && elem.document) ?
+		elem :
+		elem.nodeType === 9 ?
+			elem.defaultView || elem.parentWindow :
+			false;
+}
+// Create innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function( i, name ) {
+
+	var type = name.toLowerCase();
+
+	// innerHeight and innerWidth
+	jQuery.fn["inner" + name] = function() {
+		return this[0] ?
+			jQuery.css( this[0], type, false, "padding" ) :
+			null;
+	};
+
+	// outerHeight and outerWidth
+	jQuery.fn["outer" + name] = function( margin ) {
+		return this[0] ?
+			jQuery.css( this[0], type, false, margin ? "margin" : "border" ) :
+			null;
+	};
+
+	jQuery.fn[ type ] = function( size ) {
+		// Get window width or height
+		var elem = this[0];
+		if ( !elem ) {
+			return size == null ? null : this;
+		}
+		
+		if ( jQuery.isFunction( size ) ) {
+			return this.each(function( i ) {
+				var self = jQuery( this );
+				self[ type ]( size.call( this, i, self[ type ]() ) );
+			});
+		}
+
+		return ("scrollTo" in elem && elem.document) ? // does it walk and quack like a window?
+			// Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+			elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] ||
+			elem.document.body[ "client" + name ] :
+
+			// Get document width or height
+			(elem.nodeType === 9) ? // is it a document
+				// Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+				Math.max(
+					elem.documentElement["client" + name],
+					elem.body["scroll" + name], elem.documentElement["scroll" + name],
+					elem.body["offset" + name], elem.documentElement["offset" + name]
+				) :
+
+				// Get or set width or height on the element
+				size === undefined ?
+					// Get width or height on the element
+					jQuery.css( elem, type ) :
+
+					// Set the width or height on the element (default to pixels if value is unitless)
+					this.css( type, typeof size === "string" ? size : size + "px" );
+	};
+
+});
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+
+})(window);

+ 236 - 0
web/static-templates/js/jquery.ui.widget.js

@@ -0,0 +1,236 @@
+/*!
+ * jQuery UI Widget 1.8
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $ ) {
+
+var _remove = $.fn.remove;
+
+$.fn.remove = function( selector, keepData ) {
+	return this.each(function() {
+		if ( !keepData ) {
+			if ( !selector || $.filter( selector, [ this ] ).length ) {
+				$( "*", this ).add( this ).each(function() {
+					$( this ).triggerHandler( "remove" );
+				});
+			}
+		}
+		return _remove.call( $(this), selector, keepData );
+	});
+};
+
+$.widget = function( name, base, prototype ) {
+	var namespace = name.split( "." )[ 0 ],
+		fullName;
+	name = name.split( "." )[ 1 ];
+	fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	// create selector for plugin
+	$.expr[ ":" ][ fullName ] = function( elem ) {
+		return !!$.data( elem, name );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	$[ namespace ][ name ] = function( options, element ) {
+		// allow instantiation without initializing for simple inheritance
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	var basePrototype = new base();
+	// we need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+//	$.each( basePrototype, function( key, val ) {
+//		if ( $.isPlainObject(val) ) {
+//			basePrototype[ key ] = $.extend( {}, val );
+//		}
+//	});
+	basePrototype.options = $.extend( {}, basePrototype.options );
+	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+		namespace: namespace,
+		widgetName: name,
+		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+		widgetBaseClass: fullName
+	}, prototype );
+
+	$.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string",
+			args = Array.prototype.slice.call( arguments, 1 ),
+			returnValue = this;
+
+		// allow multiple hashes to be passed on init
+		options = !isMethodCall && args.length ?
+			$.extend.apply( null, [ true, options ].concat(args) ) :
+			options;
+
+		// prevent calls to internal methods
+		if ( isMethodCall && options.substring( 0, 1 ) === "_" ) {
+			return returnValue;
+		}
+
+		if ( isMethodCall ) {
+			this.each(function() {
+				var instance = $.data( this, name ),
+					methodValue = instance && $.isFunction( instance[options] ) ?
+						instance[ options ].apply( instance, args ) :
+						instance;
+				if ( methodValue !== instance && methodValue !== undefined ) {
+					returnValue = methodValue;
+					return false;
+				}
+			});
+		} else {
+			this.each(function() {
+				var instance = $.data( this, name );
+				if ( instance ) {
+					if ( options ) {
+						instance.option( options );
+					}
+					instance._init();
+				} else {
+					$.data( this, name, new object( options, this ) );
+				}
+			});
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( options, element ) {
+	// allow instantiation without initializing for simple inheritance
+	if ( arguments.length ) {
+		this._createWidget( options, element );
+	}
+};
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	options: {
+		disabled: false
+	},
+	_createWidget: function( options, element ) {
+		// $.widget.bridge stores the plugin instance, but we do it anyway
+		// so that it's stored even before the _create function runs
+		this.element = $( element ).data( this.widgetName, this );
+		this.options = $.extend( true, {},
+			this.options,
+			$.metadata && $.metadata.get( element )[ this.widgetName ],
+			options );
+
+		var self = this;
+		this.element.bind( "remove." + this.widgetName, function() {
+			self.destroy();
+		});
+
+		this._create();
+		this._init();
+	},
+	_create: function() {},
+	_init: function() {},
+
+	destroy: function() {
+		this.element
+			.unbind( "." + this.widgetName )
+			.removeData( this.widgetName );
+		this.widget()
+			.unbind( "." + this.widgetName )
+			.removeAttr( "aria-disabled" )
+			.removeClass(
+				this.widgetBaseClass + "-disabled " +
+				this.namespace + "-state-disabled" );
+	},
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key,
+			self = this;
+
+		if ( arguments.length === 0 ) {
+			// don't return a reference to the internal hash
+			return $.extend( {}, self.options );
+		}
+
+		if  (typeof key === "string" ) {
+			if ( value === undefined ) {
+				return this.options[ key ];
+			}
+			options = {};
+			options[ key ] = value;
+		}
+
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+		});
+
+		return self;
+	},
+	_setOption: function( key, value ) {
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this.widget()
+				[ value ? "addClass" : "removeClass"](
+					this.widgetBaseClass + "-disabled" + " " +
+					this.namespace + "-state-disabled" )
+				.attr( "aria-disabled", value );
+		}
+
+		return this;
+	},
+
+	enable: function() {
+		return this._setOption( "disabled", false );
+	},
+	disable: function() {
+		return this._setOption( "disabled", true );
+	},
+
+	_trigger: function( type, event, data ) {
+		var callback = this.options[ type ];
+
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+		data = data || {};
+
+		// copy original event properties over to the new event
+		// this would happen if we could call $.event.fix instead of $.Event
+		// but we don't have a way to force an event to be fixed multiple times
+		if ( event.originalEvent ) {
+			for ( var i = $.event.props.length, prop; i; ) {
+				prop = $.event.props[ --i ];
+				event[ prop ] = event.originalEvent[ prop ];
+			}
+		}
+
+		this.element.trigger( event, data );
+
+		return !( $.isFunction(callback) &&
+			callback.call( this.element[0], event, data ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+})( jQuery );

+ 75 - 0
web/static-templates/js/jquery.usermode.js

@@ -0,0 +1,75 @@
+/**
+ * @author trixta
+ */
+(function($){
+	$.userMode = (function(){
+		var userBg, 
+			timer, 
+			testDiv,
+			boundEvents = 0;
+		
+		function testBg(){
+			testDiv = testDiv || $('<div></div>').css({position: 'absolute', left: '-999em', top: '-999px', width: '0px', height: '0px'}).appendTo('body');
+			var black = $.curCSS( testDiv.css({backgroundColor: '#000000'})[0], 'backgroundColor', true),
+				white = $.curCSS( testDiv.css({backgroundColor: '#ffffff'})[0], 'backgroundColor', true),
+				newBgStatus = (black === white || white === 'transparent');
+			if(newBgStatus != userBg){
+				userBg = newBgStatus;
+				$.event.trigger('_internalusermode');
+			}
+			return userBg;
+		}
+		
+		function init(){
+			testBg();
+			timer = setInterval(testBg, 3000);
+		}
+		
+		function stop(){
+			clearInterval(timer);
+			testDiv.remove();
+			testDiv = null;
+		}
+		
+		$.event.special.usermode = {
+			setup: function(){
+				(!boundEvents && init());
+				boundEvents++;
+				var jElem = $(this)
+					.bind('_internalusermode', $.event.special.usermode.handler);
+				//always trigger
+				setTimeout(function(){
+					jElem.triggerHandler('_internalusermode');
+				}, 1);
+                return true;
+            },
+			teardown: function(){
+                boundEvents--;
+				(!boundEvents && stop());
+				$(this).unbind('_internalusermode', $.event.special.usermode.handler);
+                return true;
+            },
+            handler: function(e){
+                e.type = 'usermode';
+				e.disabled = !userBg;
+				e.enabled = userBg;
+                return jQuery.event.handle.apply(this, arguments);
+            }
+		};
+		
+		return {
+			get: testBg
+		};
+		
+	})();
+	
+	$.fn.userMode = function(fn){
+		return this[(fn) ? 'bind' : 'trigger']('usermode', fn);
+	};
+	
+	$(function(){
+		$('html').userMode(function(e){
+			$('html')[e.enabled ? 'addClass' : 'removeClass']('hcm');
+		});
+	});
+})(jQuery);

+ 3 - 0
web/static-templates/js/ui.checkbox.init.js

@@ -0,0 +1,3 @@
+$(document).ready(function(){
+	$('.remember-me').checkBox();
+});

+ 276 - 0
web/static-templates/js/ui.checkbox.js

@@ -0,0 +1,276 @@
+/**
+ * @author alexander.farkas
+ * @version 1.4.3
+ */
+(function($){
+	
+	var supportsValidity;
+	(function(){
+		if(!$.prop || supportsValidity){return;}
+		var supportTest = function(){
+			supportsValidity = !!$('<input />').prop('validity');
+		};
+		supportTest();
+		$(supportTest);
+	})();
+	
+    $.widget('ui.checkBox', {
+		options: {
+	        hideInput: true,
+			addVisualElement: true,
+			addLabel: true
+	    },
+        _create: function(){
+            var that = this, 
+				opts = this.options
+			;
+			
+			if(!this.element.is(':radio,:checkbox')){
+				if(this.element[0].elements && $.nodeName(this.element[0], 'form')){
+					$(this.element[0].elements).filter(':radio,:checkbox').checkBox(opts);
+				}
+				return false;
+			}
+			
+			this._proxiedReflectUI = $.proxy(this, 'reflectUI');
+			
+            this.labels = $([]);
+			
+            this.checkedStatus = false;
+			this.disabledStatus = false;
+			this.hoverStatus = false;
+            
+			this.inputType = this.element[0].type;
+            this.radio = this.inputType == 'radio';
+					
+            this.visualElement = $([]);
+            if (opts.hideInput) {
+				this.element.addClass('ui-helper-hidden-accessible');
+				if(opts.addVisualElement){
+					this.visualElement = $('<span />')
+						.addClass('ui-'+this.inputType)
+					;
+					this.element.after(this.visualElement[0]);
+				}
+            }
+			
+			if(opts.addLabel){
+				var id = this.element[0].id;
+				if(id){
+					this.labels = $('label[for="' + id + '"]', this.element[0].form || this.element[0].ownerDocument).add(this.element.parent('label'));
+				}
+				if(!this.labels[0]){
+					this.labels = this.element.closest('label', this.element[0].form);
+				}
+				this.labels.addClass(this.radio ? 'ui-radio' : 'ui-checkbox');
+			}
+			
+			this.visualGroup = this.visualElement.add(this.labels);
+			
+			this._addEvents();
+			
+			this.initialized = true;
+            this.reflectUI({type: 'initialreflect'});
+			return undefined;
+        },
+		_addEvents: function(){
+			var that 		= this, 
+			
+				opts 		= this.options,
+					
+				toggleHover = function(e){
+					if(that.disabledStatus){
+						return false;
+					}
+					that.hover = (e.type == 'focus' || e.type == 'mouseenter');
+					if(e.type == 'focus'){
+						that.visualGroup.addClass(that.inputType +'-focused');
+					} else if(e.type == 'blur'){
+						that.visualGroup.removeClass(that.inputType +'-focused');
+					}
+					that._changeStateClassChain();
+					return undefined;
+				}
+			;
+			
+			this.element
+				.bind('click.checkBox invalid.checkBox', this._proxiedReflectUI)
+				.bind('focus.checkBox blur.checkBox', toggleHover)
+			;
+			if (opts.hideInput){
+				this.element
+					.bind('usermode', function(e){
+	                    (e.enabled &&
+	                        that.destroy.call(that, true));
+	                })
+				;
+            }
+			if(opts.addVisualElement){
+				this.visualElement
+					.bind('click.checkBox', function(e){
+						that.element[0].click();
+						return false;
+					})
+				;
+			}
+			
+			this.visualGroup.bind('mouseenter.checkBox mouseleave.checkBox', toggleHover);
+			
+		},
+		_changeStateClassChain: function(){
+			var allElements = this.labels.add(this.visualElement),
+				stateClass 	= '',
+				baseClass 	= 'ui-'+ this.inputType
+			;
+				
+			if(this.checkedStatus){
+				stateClass += '-checked'; 
+				allElements.addClass(baseClass+'-checked');
+			} else {
+				allElements.removeClass(baseClass+'-checked');
+			}
+			
+			if(this.disabledStatus){
+				stateClass += '-disabled'; 
+				allElements.addClass(baseClass+'-disabled');
+			} else {
+				allElements.removeClass(baseClass+'-disabled');
+			}
+			if(this.hover){
+				stateClass += '-hover'; 
+				allElements.addClass(baseClass+'-hover');
+			} else {
+				allElements.removeClass(baseClass+'-hover');
+			}
+			
+			baseClass += '-state';
+			if(stateClass){
+				stateClass = baseClass + stateClass;
+			}
+			
+			function switchStateClass(){
+				var classes = this.className.split(' '),
+					found = false;
+				$.each(classes, function(i, classN){
+					if(classN.indexOf(baseClass) === 0){
+						found = true;
+						classes[i] = stateClass;
+						return false;
+					}
+					return undefined;
+				});
+				if(!found){
+					classes.push(stateClass);
+				}
+				this.className = classes.join(' ');
+			}
+			
+			this.visualGroup.each(switchStateClass);
+		},
+        destroy: function(onlyCss){
+            this.element.removeClass('ui-helper-hidden-accessible');
+			this.visualElement.addClass('ui-helper-hidden');
+            if (!onlyCss) {
+                var o = this.options;
+                this.element.unbind('.checkBox');
+				this.visualElement.remove();
+                this.labels
+					.unbind('.checkBox')
+					.removeClass('ui-state-hover ui-state-checked ui-state-disabled')
+				;
+            }
+        },
+		
+        disable: function(status){
+			if(status === undefined){
+				status = true;
+			}
+            this.element[0].disabled = status;
+            this.reflectUI({type: 'manuallydisabled'});
+        },
+		
+        enable: function(){
+            this.element[0].disabled = false;
+            this.reflectUI({type: 'manuallyenabled'});
+        },
+		
+        toggle: function(e){
+            this.changeCheckStatus(!(this.element.is(':checked')), e);
+        },
+		
+        changeCheckStatus: function(status, e){
+            if(e && e.type == 'click' && this.element[0].disabled){
+				return false;
+			}
+			this.element[0].checked = !!status;
+            this.reflectUI(e || {
+                type: 'changecheckstatus'
+            });
+			return undefined;
+        },
+        propagate: function(n, e, _noGroupReflect){
+			if(!e || e.type != 'initialreflect'){
+				if (this.radio && !_noGroupReflect) {
+					var elem = this.element[0];
+					//dynamic
+	                $('[name="'+ elem.name +'"]', elem.form || elem.ownerDocument).checkBox('reflectUI', e, true);
+						
+	            }
+	            return this._trigger(n, e, {
+	                options: this.options,
+	                checked: this.checkedStatus,
+	                labels: this.labels,
+					disabled: this.disabledStatus
+	            });
+			}
+			return undefined;
+        },
+		changeValidityState: function(){
+			if(supportsValidity){
+				this.visualGroup[ !this.element.prop('willValidate') || (this.element.prop('validity') || {valid: true}).valid ? 'removeClass' : 'addClass' ](this.inputType +'-invalid');
+			}
+		},
+        reflectUI: function(e){
+			
+            var oldChecked 			= this.checkedStatus, 
+				oldDisabledStatus 	= this.disabledStatus
+			;
+            					
+			this.disabledStatus = this.element.is(':disabled');
+			this.checkedStatus = this.element.is(':checked');
+			if(!e || e.type !== 'initialreflect'){
+				this.changeValidityState();
+			}
+			
+			if (this.disabledStatus != oldDisabledStatus || this.checkedStatus !== oldChecked) {
+				this._changeStateClassChain();
+				
+				(this.disabledStatus != oldDisabledStatus &&
+					this.propagate('disabledchange', e));
+				
+				(this.checkedStatus !== oldChecked &&
+					this.propagate('change', e));
+			}
+            
+        }
+    });
+		
+	if($.propHooks){
+		$.each({checked: 'changeCheckStatus', disabled: 'disable'}, function(name, fn){
+			//be hook friendly
+			if(!$.propHooks[name]){
+				$.propHooks[name] = {};
+			}
+			var oldSetHook = $.propHooks[name].set;
+			
+			$.propHooks[name].set = function(elem, value){
+				var widget = $.data(elem, 'checkBox');
+				if(widget){
+					widget[fn](!!value);
+				}
+				return oldSetHook && oldSetHook(elem, value) ;
+			};
+			
+		});
+	}
+})(jQuery);

+ 58 - 0
web/static-templates/login-form.html

@@ -0,0 +1,58 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | Login Form</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta-login-form.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+</head>
+<body class="page-auth">
+    <div class="page">
+        <div class="b-auth-form">
+            <div class="b-auth-form-wrap">
+                <img class="vesta-logo" src="i/auth/logo.png" width="72" height="24" alt="" />
+                <div class="b-client-title">
+                    <span class="client-title-wrap">Rackspace <i class="planets">&nbsp;</i></span>
+                </div>
+                <form class="auth" action="#" method="post">
+                    <div class="form-row cc">
+                        <label class="field-label" for="email">Email</label>
+                        <input class="field-text" id="email" type="text" tabindex="1"/>
+                    </div>
+                    <div class="form-row cc">
+                        <label class="field-label" for="password">Password</label>
+                        <input class="field-text" id="password" type="password" tabindex="2"/>
+                    </div>
+                    <div class="error-box">Login or password is wrong</div>
+                    <div class="form-row last-row cc">
+                        <div class="b-remember">
+                            <input class="remember-me" id="remember-me" name="remember_me" type="checkbox" value="1" tabindex="3"/>
+                            <label class="remember-label" for="remember-me">remember me</label>
+                        </div>
+                        <input class="sumbit-btn" type="submit" value="enter" tabindex="4"/>
+                    </div>
+                </form>
+                <p class="forgot-pwd"><a class="forgot-pwd-url" href="#">forgot password?</a></p>
+                <div class="footnotes cc">
+                    <p class="additional-info">For questions please contact <a class="questions-url" href="mailto:support@vestacp.com">support@vestacp.com</a></p>
+                    <address class="imprint">&copy; 2011 Vesta Control Panel</address>
+                </div>
+            </div>
+        </div>
+    </div>
+    <!-- Grab Google CDN's jQuery. fall back to local if necessary -->
+    <script src="//ajax.googleapis.com/ajax/libs/jquery/1.4.2/jquery.js"></script>
+    <script>!window.jQuery && document.write(unescape('%3Cscript src="js/jquery-1.4.2.js"%3E%3C/script%3E'))</script>
+    <script src="js/jquery.ui.widget.js"></script>
+    <script src="js/jquery.usermode.js"></script>
+    <script src="js/ui.checkbox.js"></script>
+    <script src="js/common.js"></script>
+</body>
+</html>

+ 1045 - 0
web/static-templates/users-2-form.html

@@ -0,0 +1,1045 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | Users</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/popup.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web Domain</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add user</a>
+			<span class="select-all">select all</span>
+			<span class="clear-selected">Delete selected</span>
+		</div><!-- // actions toolbar -->
+
+		<div class="b-new-entry b-new-entry_user">
+			<div class="entry-header">New user</div>
+			<div class="form-error">
+				<div class="error-box">
+					<span class="error-message">Wrong minute format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+				</div>
+			</div>
+			<div class="form-row cc">
+				<label class="field-label" for="#">username:</label>
+				<input class="text-field" type="text" value="Carlene Delcambre" />
+			</div>
+			<div class="form-row pwd-box cc">
+				<label class="field-label" for="#">password:</label>
+				<input class="text-field" type="text" value="g179x2vpvfamn7v" />
+				<span class="generate-pwd">Generate</span>
+			</div>
+			<div class="form-row cc">
+				<label class="field-label" for="#">package:</label>
+				<select class="styled" name="template">
+					<option value="1" selected="selected">default</option>
+					<option value="2">custom</option>
+					<option value="3">advanced</option>
+				</select>
+			</div>
+			<div class="form-row cc">
+				<label class="field-label" for="#">role:</label>
+				<select class="styled" name="template">
+					<option value="1" selected="selected">user</option>
+					<option value="2">administrator</option>
+				</select>
+			</div>
+			<div class="form-row cc">
+				<label class="field-label" for="#">contact email:</label>
+				<input class="text-field" type="text" value="hansolo.buheit@digital-photography-school.com" />
+			</div>
+
+			<div class="form-row cc">
+				<label class="field-label" for="#">reports:</label>
+				<input class="styled" type="checkbox" value="" />
+			</div>
+			<div class="form-row cc">
+				<label class="field-label" for="#">ns1:</label>
+				<input class="text-field" type="text" value="shared-dedicated-1.digital-photography-school.com" />
+			</div>
+			<div class="form-row cc">
+				<label class="field-label" for="#">ns2:</label>
+				<input class="text-field" type="text" value="custom-edge-cdn2.digital-photography-school.com" />
+			</div>
+			<div class="form-row buttons-row cc">
+				<input class="add-entry-btn" type="submit" value="add" />
+				<span class="cancel-btn">Cancel</span>
+				<span class="delete-btn">Delete</span>
+			</div>
+		</div><!-- // form -->
+		
+		
+		<div id="content">
+			<div class="content-inner">
+				<div class="users-list">
+					<!-- row 1 -->
+					<div class="row first-row user-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta vestavesta vesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">han_solo</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Clayton Musselwhite</span>
+                                        </span>
+
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">han_solo@han_solohan_solo.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>                                        	</span>
+                                        </span>
+                                        <span class="prop-box childs-box">
+                                            <span class="prop-title">childs:</span>
+                                            <span class="prop-value prop-value-collapsed-childs">2 (30)</span>
+                                        </span>
+									</div>
+                                    
+								</div>
+
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:25%;">25% <span class="value-size">(900 Mb)</span></span>
+                                                    <span class="bar" style="width:25%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box overdraft">
+                                                <div class="graph">
+                                                    <span class="value" style="left:135%;">135% <span class="value-size">(2572 Gb)</span></span>
+                                                    <span class="bar" style="width:100%;"></span>
+                                                    <span class="bar_overdraft" style="width:35%;right:-35%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+                                
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row user-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">loraine_pledger</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">loraine_pledger</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Louisa Brockwell</span>
+                                        </span>
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">louisa.brockwell@han_solo_loraine_pledger.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>
+											</span>
+                                        </span>
+									</div>
+								</div>
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:75%;">75% <span class="value-size">(2304 Mb)</span></span>
+                                                    <span class="bar" style="width:75%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:95%;">95% <span class="value-size">(750 Gb)</span></span>
+                                                    <span class="bar" style="width:95%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row user-details-row checked-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
+								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta vestavesta vesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">Clayton.Musselwhite</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Clayton Musselwhite</span>
+                                        </span>
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">Clayton.Musselwhite@clayton-musselwhite.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>
+											</span>
+                                        </span>
+									</div>
+								</div>
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:15%;">15% <span class="value-size">(304 Mb)</span></span>
+                                                    <span class="bar" style="width:15%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box overdraft">
+                                                <div class="graph">
+                                                    <span class="value" style="left:205%;">205% <span class="value-size">(16 Tb)</span></span>
+                                                    <span class="bar" style="width:100%;"></span>
+                                                    <span class="bar_overdraft" style="width:105%;right:-105%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<!-- row 4, suspended status -->
+					<div class="row user-details-row suspended-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-suspended-status"><span class="ip-status-text">suspended</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta vestavesta vesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">Althea-Switalski</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Althea Switalski</span>
+                                        </span>
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">Althea.Switalski@han_solo_musselwhite.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>
+											</span>
+                                        </span>
+									</div>
+								</div>
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:75%;">75% <span class="value-size">(2304 Mb)</span></span>
+                                                    <span class="bar" style="width:75%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:95%;">95% <span class="value-size">(750 Gb)</span></span>
+                                                    <span class="bar" style="width:95%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 4 -->
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_user">
+						<div class="entry-header">New user</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong minute format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">username:</label>
+							<input class="text-field" type="text" value="Carlene Delcambre" />
+						</div>
+						<div class="form-row pwd-box cc">
+							<label class="field-label" for="#">password:</label>
+							<input class="text-field" type="text" value="g179x2vpvfamn7v" />
+							<span class="generate-pwd">Generate</span>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">package:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">default</option>
+								<option value="2">custom</option>
+								<option value="3">advanced</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">role:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">user</option>
+								<option value="2">administrator</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">contact email:</label>
+							<input class="text-field" type="text" value="hansolo.buheit@digital-photography-school.com" />
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">reports:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns1:</label>
+							<input class="text-field" type="text" value="shared-dedicated-1.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns2:</label>
+							<input class="text-field" type="text" value="custom-edge-cdn2.digital-photography-school.com" />
+						</div>
+
+						
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+					
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_user">
+						<div class="entry-header">Edit user</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong minute format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">username:</label>
+							<input class="text-field" type="text" value="Carlene Delcambre" />
+						</div>
+						<div class="form-row pwd-box cc">
+							<label class="field-label" for="#">password:</label>
+							<input class="text-field" type="text" value="g179x2vpvfamn7v" />
+							<span class="generate-pwd">Generate</span>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">first name:</label>
+							<input class="text-field" type="text" value="Carlene" />
+						</div>
+						<div class="form-row lastname-box cc">
+							<label class="field-label" for="#">last name:</label>
+							<input class="text-field" type="text" value="Delcambre" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">package:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">default</option>
+								<option value="2">custom</option>
+								<option value="3">advanced</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">role:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">user</option>
+								<option value="2">administrator</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">contact email:</label>
+							<input class="text-field" type="text" value="hansolo.buheit@digital-photography-school.com" />
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">reports:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns1:</label>
+							<input class="text-field" type="text" value="shared-dedicated-1.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns2:</label>
+							<input class="text-field" type="text" value="custom-edge-cdn2.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns3:</label>
+							<input class="text-field" type="text" value="" />
+							<b class="delete-record"></b>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns4:</label>
+							<input class="text-field" type="text" value="" />
+							<b class="delete-record"></b>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns5:</label>
+							<input class="text-field" type="text" value="" />
+							<b class="delete-record"></b>
+						</div>
+						<div class="form-row cc">
+							<a class="add-ns" href="#">
+								<i class="icon">&nbsp;</i> 
+								<span class="btn-title">Add additional NS</span>
+							</a>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">suspended:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+
+				</div><!-- // .domain-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+<div class="d-popup d-popup-ns-list" style="left:1160px;top:615px;z-index:1000;display:block;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+        	<div class="d-popup-title">NS List</div>
+            <ul class="d-popup-items">
+            	<li class="item">read1@write.com</li>
+            	<li class="item">read2@write.com</li>
+            	<li class="item">read3@write.com</li>
+            	<li class="item">read4@write.com</li>
+            	<li class="item">read5@write.com</li>
+            	<li class="item">read5@write.com</li>
+            </ul>
+        </div>
+    </div>
+</div>
+<div class="d-popup d-popup-webaliases-list" style="left:975px;top:485px;z-index:1001;display:none;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+        	<div class="d-popup-title">Web aliases</div>
+            <ul class="d-popup-items">
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            </ul>
+        </div>
+    </div>
+</div>
+<div class="d-popup d-popup-default-tpl" style="left:780px;top:720px;z-index:1002;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+        	<div class="d-popup-title">Defaul template</div>
+			<div class="group">
+                <span class="prop-box webdomains-box">
+                    <span class="prop-title">web domains:</span>
+                    <span class="prop-value">1 (5)</span>
+                </span>
+                <span class="prop-box websl-box">
+                    <span class="prop-title">web sl:</span>
+                    <span class="prop-value">0 (5)</span>
+                </span>
+                <span class="prop-box webalias-box">
+                    <span class="prop-title">web alias:</span>
+                    <span class="prop-value">? (10)</span>
+                </span>
+                <span class="prop-box shell-box">
+                    <span class="prop-title">shell:</span>
+                    <span class="prop-value">bash</span>
+                </span>
+                <span class="prop-box db-box">
+                    <span class="prop-title">databases:</span>
+                    <span class="prop-value">1 (5)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">mailboxes:</span>
+                    <span class="prop-value">? (30)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">mail forwarders:</span>
+                    <span class="prop-value">? (30)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">mail domains:</span>
+                    <span class="prop-value">0 (?)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">dns domains:</span>
+                    <span class="prop-value">0 (5)</span>
+                </span>
+			</div>
+        </div>
+    </div>
+</div>
+<div class="d-popup d-popup-package-tpl" style="left:780px;top:1240px;z-index:1000;display:block;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+		----------PACKAGE:          defaultWEB_DOMAINS:      10WEB_SSL:          10WEB_ALIASES:      10DATABASES:        10MAIL_DOMAINS:     10MAIL_BOXES:       30MAIL_FORWARDERS:  30DNS_DOMAINS:      10DISK_QUOTA:       10000BANDWIDTH:        10000NS1:NS2:SHELL:            nologinBACKUPS:          3WEB_TPL:          default,phpcgi,unlim,phpfcgidMAX_CHILDS:       300----------PACKAGE:          palegreenWEB_DOMAINS:      30WEB_SSL:          30WEB_ALIASES:      50DATABASES:        30MAIL_DOMAINS:     30MAIL_BOXES:       50MAIL_FORWARDERS:  50DNS_DOMAINS:      30DISK_QUOTA:       50000BANDWIDTH:        50000NS1:NS2:SHELL:            nologinBACKUPS:          5WEB_TPL:          default,phpcgi,unlim,phpfcgidMAX_CHILDS:       300                
+		</div>
+	</div>
+</div>
+</body>
+</html>

+ 1014 - 0
web/static-templates/users-2.html

@@ -0,0 +1,1014 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
+
+<head>
+	<title>Vesta | Users</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="shortcut icon" href="i/fav.ico" type="image/x-icon">
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/popup.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web Domain</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add user</a>
+			
+			<div class="row-filters cc">
+				<div class="b-row-selector">
+					<div class="checkbox-selector cc">
+						<input class="styled" type="checkbox" value="" />
+						<span class="selector-title">385 Selected</span>
+					</div>
+					<div class="context-actions">
+						<div class="b-cust-sel b-cust-sel_inactive">
+							<span class="title">Action</span>
+							<div class="cust-sel-arrow"><i>&nbsp;</i></div>
+							<div class="cust-sel-options">
+								<div class="cust-sel-option ico_gray">Suspend</div>
+								<div class="cust-sel-option ico_green">Unsuspend</div>
+								<div class="cust-sel-option ico_red">Delete</div>
+							</div>
+						</div>
+					</div>
+				</div>
+				<!-- visible only for admin -->
+				<div class="domain-groups-selector">
+					<div class="selector-wrap">
+						<strong class="selector-title">Show:</strong>
+						<span class="selected-groups">mine, vesta, Chronos, vasya (and 35 more)</span>
+					</div>
+				</div><!-- // visible only for admin -->
+				
+			</div>
+			
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="users-list">
+					<!-- row 1 -->
+					<div class="row first-row user-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta vestavesta vesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">han_solo</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Clayton Musselwhite</span>
+                                        </span>
+
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">han_solo@han_solohan_solo.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>                                        	</span>
+                                        </span>
+                                        <span class="prop-box childs-box">
+                                            <span class="prop-title">childs:</span>
+                                            <span class="prop-value prop-value-collapsed-childs">2 (30)</span>
+                                        </span>
+									</div>
+                                    
+								</div>
+
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:25%;">25% <span class="value-size">(900 Mb)</span></span>
+                                                    <span class="bar" style="width:25%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box overdraft">
+                                                <div class="graph">
+                                                    <span class="value" style="left:135%;">135% <span class="value-size">(2572 Gb)</span></span>
+                                                    <span class="bar" style="width:100%;"></span>
+                                                    <span class="bar_overdraft" style="width:35%;right:-35%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+                                
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row user-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">loraine_pledger</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">loraine_pledger</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Louisa Brockwell</span>
+                                        </span>
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">louisa.brockwell@han_solo_loraine_pledger.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>
+											</span>
+                                        </span>
+									</div>
+								</div>
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:75%;">75% <span class="value-size">(2304 Mb)</span></span>
+                                                    <span class="bar" style="width:75%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:95%;">95% <span class="value-size">(750 Gb)</span></span>
+                                                    <span class="bar" style="width:95%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row user-details-row checked-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta vestavesta vesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">Clayton.Musselwhite</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Clayton Musselwhite</span>
+                                        </span>
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">Clayton.Musselwhite@clayton-musselwhite.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>
+											</span>
+                                        </span>
+									</div>
+								</div>
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:15%;">15% <span class="value-size">(304 Mb)</span></span>
+                                                    <span class="bar" style="width:15%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box overdraft">
+                                                <div class="graph">
+                                                    <span class="value" style="left:205%;">205% <span class="value-size">(16 Tb)</span></span>
+                                                    <span class="bar" style="width:100%;"></span>
+                                                    <span class="bar_overdraft" style="width:105%;right:-105%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+
+					<!-- row 4, suspended status -->
+					<div class="row user-details-row suspended-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-suspended-status"><span class="ip-status-text">suspended</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+							<div class="ownership">
+								<span class="prop-box">
+									<span class="prop-title">owner:</span>
+									<span class="prop-value">vestavestavesta vestavesta vesta</span>
+								</span>
+							</div>
+						</div>
+						<div class="row-details cc">
+							<div class="props-main">
+								<div class="user-wrap">
+									<div class="username-box">
+										<span class="user">
+											<span class="nickname">Althea-Switalski</span>
+											<span class="role">(user)</span>
+										</span>
+										<span class="prop-box template-box">
+											<span class="prop-title">package:</span>
+											<span class="prop-value">default</span>
+										</span>
+									</div>
+									<div class="user-details-box">
+                                        <span class="prop-box user-name">
+                                            <span class="prop-title">name:</span>
+                                            <span class="prop-value">Althea Switalski</span>
+                                        </span>
+                                        <span class="prop-box prop-box_group-values cc user-details">
+                                            <span class="prop-title">email:</span>
+                                            <span class="group-values">
+                                                <span class="prop-value user-email">Althea.Switalski@han_solo_musselwhite.com</span>
+                                                <span class="prop-value user-reports">(reports enabled)</span>
+											</span>
+                                        </span>
+									</div>
+								</div>
+								<div class="b-stats-box">
+									<div class="stats-box-title">stats</div>	
+                                    <!-- disk usage block -->
+                                    <div class="b-usage-box2 disk-usage cc">
+                                        <span class="prop-title">disk usage:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:75%;">75% <span class="value-size">(2304 Mb)</span></span>
+                                                    <span class="bar" style="width:75%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">3 <span class="units">Gb</span></div>
+                                        </div>
+                                    </div><!-- // disk usage block -->
+                                    <!-- bandwidth usage block -->
+                                    <div class="b-usage-box2 bandwidth-box cc">
+                                        <span class="prop-title">bandwidth:</span>
+                                        <div class="usage-box">
+                                            <div class="value-box">
+                                                <div class="graph">
+                                                    <span class="value" style="left:95%;">95% <span class="value-size">(750 Gb)</span></span>
+                                                    <span class="bar" style="width:95%;"></span>
+                                                </div>
+                                            </div>
+                                            <div class="max-size">800 <span class="units">Mb</span></div>
+                                        </div>
+                                    </div><!-- // bandwidth usage block -->
+								</div><!-- // .stats-box -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box webdomains-box">
+									<span class="prop-title">web domains:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box websl-box">
+									<span class="prop-title">web ssl:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box webalias-box">
+									<span class="prop-title">web alias:</span>
+									<span class="prop-value prop-value-collapsed-childs">(7) per domain</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc webtpl-box">
+									<span class="prop-title">web templates:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">default</span>
+										<span class="prop-value">phpcgi</span>
+										<span class="prop-value">unlim</span>
+									</span>
+								</span>
+								<span class="prop-box db-box">
+									<span class="prop-title">databases:</span>
+									<span class="prop-value">1 (5)</span>
+								</span>
+								<span class="prop-box shell-box">
+									<span class="prop-title">shell:</span>
+									<span class="prop-value">bash</span>
+								</span>
+								<span class="prop-box backups-box">
+									<span class="prop-title">backups:</span>
+									<span class="prop-value">retention 3</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box mailboxes-box">
+									<span class="prop-title">mailboxes:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box mailfwds-box">
+									<span class="prop-title">mail forwarders:</span>
+									<span class="prop-value">? (30)</span>
+								</span>
+								<span class="prop-box maildomains-box">
+									<span class="prop-title">mail domains:</span>
+									<span class="prop-value">0 (?)</span>
+								</span>
+								<span class="prop-box dnsdomains-box">
+									<span class="prop-title">dns domains:</span>
+									<span class="prop-value">0 (5)</span>
+								</span>
+								<span class="prop-box prop-box_group-values cc ns-list-box">
+									<span class="prop-title">ns list:</span>
+									<span class="group-values group-values__bullet">
+										<span class="prop-value">n1.readwriteweb.com</span>
+										<span class="prop-value">n2.readwriteweb.com</span>
+										<span class="prop-value">n3.readwriteweb.com</span>
+										<span class="group-switcher">
+											<span class="group-values-count">6 more</span>
+										</span>
+									</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 4 -->
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_user">
+						<div class="entry-header">New user</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong minute format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">username:</label>
+							<input class="text-field" type="text" value="Carlene Delcambre" />
+						</div>
+						<div class="form-row pwd-box cc">
+							<label class="field-label" for="#">password:</label>
+							<input class="text-field" type="text" value="g179x2vpvfamn7v" />
+							<span class="generate-pwd">Generate</span>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">package:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">default</option>
+								<option value="2">custom</option>
+								<option value="3">advanced</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">role:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">user</option>
+								<option value="2">administrator</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">contact email:</label>
+							<input class="text-field" type="text" value="hansolo.buheit@digital-photography-school.com" />
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">reports:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns1:</label>
+							<input class="text-field" type="text" value="shared-dedicated-1.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns2:</label>
+							<input class="text-field" type="text" value="custom-edge-cdn2.digital-photography-school.com" />
+						</div>
+
+						
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+					
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_user">
+						<div class="entry-header">Edit user</div>
+						<div class="form-error">
+							<div class="error-box">
+								<span class="error-message">Wrong minute format. Need some <a class="help-tip-url" href="#">Help</a> ?</span>
+							</div>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">username:</label>
+							<input class="text-field" type="text" value="Carlene Delcambre" />
+						</div>
+						<div class="form-row pwd-box cc">
+							<label class="field-label" for="#">password:</label>
+							<input class="text-field" type="text" value="g179x2vpvfamn7v" />
+							<span class="generate-pwd">Generate</span>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">first name:</label>
+							<input class="text-field" type="text" value="Carlene" />
+						</div>
+						<div class="form-row lastname-box cc">
+							<label class="field-label" for="#">last name:</label>
+							<input class="text-field" type="text" value="Delcambre" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">package:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">default</option>
+								<option value="2">custom</option>
+								<option value="3">advanced</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">role:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">user</option>
+								<option value="2">administrator</option>
+							</select>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">contact email:</label>
+							<input class="text-field" type="text" value="hansolo.buheit@digital-photography-school.com" />
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">reports:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns1:</label>
+							<input class="text-field" type="text" value="shared-dedicated-1.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns2:</label>
+							<input class="text-field" type="text" value="custom-edge-cdn2.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns3:</label>
+							<input class="text-field" type="text" value="" />
+							<b class="delete-record"></b>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns4:</label>
+							<input class="text-field" type="text" value="" />
+							<b class="delete-record"></b>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">ns5:</label>
+							<input class="text-field" type="text" value="" />
+							<b class="delete-record"></b>
+						</div>
+						<div class="form-row cc">
+							<a class="add-ns" href="#">
+								<i class="icon">&nbsp;</i> 
+								<span class="btn-title">Add additional NS</span>
+							</a>
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#">suspended:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+
+				</div><!-- // .domain-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+<div class="d-popup d-popup-ns-list" style="left:1160px;top:615px;z-index:1000;display:block;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+        	<div class="d-popup-title">NS List</div>
+            <ul class="d-popup-items">
+            	<li class="item">read1@write.com</li>
+            	<li class="item">read2@write.com</li>
+            	<li class="item">read3@write.com</li>
+            	<li class="item">read4@write.com</li>
+            	<li class="item">read5@write.com</li>
+            	<li class="item">read5@write.com</li>
+            </ul>
+        </div>
+    </div>
+</div>
+<div class="d-popup d-popup-webaliases-list" style="left:975px;top:485px;z-index:1001;display:none;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+        	<div class="d-popup-title">Web aliases</div>
+            <ul class="d-popup-items">
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            	<li class="item"><a href="#">write.com</a> 1</li>
+            </ul>
+        </div>
+    </div>
+</div>
+<div class="d-popup d-popup-default-tpl" style="left:780px;top:720px;z-index:1002;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+        	<div class="d-popup-title">Defaul template</div>
+			<div class="group">
+                <span class="prop-box webdomains-box">
+                    <span class="prop-title">web domains:</span>
+                    <span class="prop-value">1 (5)</span>
+                </span>
+                <span class="prop-box websl-box">
+                    <span class="prop-title">web sl:</span>
+                    <span class="prop-value">0 (5)</span>
+                </span>
+                <span class="prop-box webalias-box">
+                    <span class="prop-title">web alias:</span>
+                    <span class="prop-value">? (10)</span>
+                </span>
+                <span class="prop-box shell-box">
+                    <span class="prop-title">shell:</span>
+                    <span class="prop-value">bash</span>
+                </span>
+                <span class="prop-box db-box">
+                    <span class="prop-title">databases:</span>
+                    <span class="prop-value">1 (5)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">mailboxes:</span>
+                    <span class="prop-value">? (30)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">mail forwarders:</span>
+                    <span class="prop-value">? (30)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">mail domains:</span>
+                    <span class="prop-value">0 (?)</span>
+                </span>
+                <span class="prop-box mailboxes-box">
+                    <span class="prop-title">dns domains:</span>
+                    <span class="prop-value">0 (5)</span>
+                </span>
+			</div>
+        </div>
+    </div>
+</div>
+<div class="d-popup d-popup-package-tpl" style="left:780px;top:1240px;z-index:1000;display:block;">
+	<div class="d-popup-inner">
+		<span class="close">&times;</span>
+        <div class="d-popup-content">
+		----------PACKAGE:          defaultWEB_DOMAINS:      10WEB_SSL:          10WEB_ALIASES:      10DATABASES:        10MAIL_DOMAINS:     10MAIL_BOXES:       30MAIL_FORWARDERS:  30DNS_DOMAINS:      10DISK_QUOTA:       10000BANDWIDTH:        10000NS1:NS2:SHELL:            nologinBACKUPS:          3WEB_TPL:          default,phpcgi,unlim,phpfcgidMAX_CHILDS:       300----------PACKAGE:          palegreenWEB_DOMAINS:      30WEB_SSL:          30WEB_ALIASES:      50DATABASES:        30MAIL_DOMAINS:     30MAIL_BOXES:       50MAIL_FORWARDERS:  50DNS_DOMAINS:      30DISK_QUOTA:       50000BANDWIDTH:        50000NS1:NS2:SHELL:            nologinBACKUPS:          5WEB_TPL:          default,phpcgi,unlim,phpfcgidMAX_CHILDS:       300                
+		</div>
+	</div>
+</div>
+</body>
+</html>

+ 694 - 556
web/static-templates/web-domain.html

@@ -1,556 +1,694 @@
-<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
-<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="ru">
-
-<head>
-	<title>Vesta | Web domain</title>
-	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
-	<meta http-equiv="imagetoolbar" content="false" />
-
-	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
-	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
-
-	<!--[if lt IE 8]>
-		<link rel="stylesheet" type="text/css" href="css/ie.css" />
-    <![endif]-->
-
-	<script type="text/javascript" src="js/custom-form-elements.js"></script>
-</head>
-
-<body>
-<div id="page">
-	<div class="outer">
-		<div id="header">
-			<div class="logo-box">
-				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
-			</div>
-			<ul class="settings">
-				<li><a href="#">settings</a></li>
-				<li><a href="#">exit</a></li>
-			</ul>
-		</div>
-		<div id="primary-nav-box">
-			<ul class="primary-nav cc">
-				<li class="section">
-					<div class="section-inner">
-						<dl class="users-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Users</span> 
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">386 users</span>
-								<span class="def">7 blocked</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section active">
-					<div class="section-inner">
-						<dl class="domains-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Web Domain</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">580 domains</span>
-								<span class="def">22 out of mem</span>
-								<span class="def">3 waiting</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="mail-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Mail</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">320 domains</span>
-								<span class="def">1209 mailboxes</span>
-								<span class="def">25 full</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="db-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">DB</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">7 db</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="dns-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Dns</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">289 records</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section">
-					<div class="section-inner">
-						<dl class="dnstpl-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">IP</span> 
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">7 templates</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-				<li class="section last-section">
-					<div class="section-inner">
-						<dl class="cron-nav-item">
-							<dt class="section-title cc">
-								<span class="to-section">Cron</span>
-								<i class="add-entry">&nbsp;</i>
-							</dt>
-							<dd class="section-contains">
-								<span class="def">15 records</span>
-							</dd>
-						</dl>
-					</div>
-				</li>
-			</ul>
-		</div>
-		<div id="console">
-			<div class="b-console">
-				<div class="b-console-wrap">
-					<form class="b-console-form cc" action="#" method="post">
-						<fieldset>
-							<input class="b-console-field" type="text" value="/"/>
-							<input class="b-console-btn" type="submit" value="Go" />
-						</fieldset>
-					</form>
-					<!-- div class="b-console-statuses">
-						<div class="b-console-status cc">
-							<p class="b-console-status-message">domain <b>google.com</b> have been added <br />
-Cтиль менеджмента, на первый взгляд, методически оправдывает культурный побочный PR-эффект, осознавая социальную ответственность бизнеса. Исходя из структуры пирамиды Маслоу, рекламное сообщество экономит product placement, невзирая на действия конкурентов. Узнавание бренда слабо транслирует имидж, оптимизируя бюджеты.
-							</p>
-							<span class="b-console-status-action">cancel</span>
-							<i class="b-console-status-arrow">&nbsp;</i>							
-						</div>
-					</div -->
-				</div>
-				<div class="b-console-results"></div>
-			</div>
-		</div>
-		<!-- actions toolbar -->
-		<div id="actions-toolbar" class="cc">
-			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add web domain</a>
-			<span class="select-all">select all</span>
-			<span class="clear-selected">Delete selected</span>
-		</div><!-- // actions toolbar -->
-		<div id="content">
-			<!-- additional info block -->
-			<div class="b-ext-info-wrap b-ext-info-wrap_collapsed">
-				<div class="b-ext-info">
-<p>Механическая природа пододвигается под устойчивый силовой трёхосный гироскопический стабилизатор, что увязывается со структурно-тектонической обстановкой, гидродинамическими условиями и литолого-минералогическим составом пород. Фосфоритообразование методически опускает уходящий огненный пояс, исходя из суммы моментов. Инерциальная навигация, в соответствии с основным законом динамики, представляет собой тальк, пользуясь последними системами уравнений. Имея такие данные, можно сделать существенный вывод о том, что маховик неустойчив.</p>
-				</div>
-				<div class="b-ext-info-btn"></div>
-			</div><!-- // additional info block -->
-			<div class="content-inner">
-				<div class="domains-list">
-					<!-- row 1 -->
-					<div class="row first-row domain-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="names">
-								<strong class="domain-name primary">naumov-socolov.co.uk</strong>
-								<span class="alias-title">Alias:</span>
-								<span class="domain-name">naumov-socolov.org.ua,</span>
-								<span class="domain-name">naumov-socolov.org.md,</span>
-								<span class="domain-name">naumov-socolov.to</span>
-							</div>
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-								<!-- disk usage block -->
-								<div class="b-usage-box disk-usage cc">
-									<span class="prop-title">disk usage:</span>
-									<div class="usage-box">
-										<div class="value-box">
-											<span class="value">900</span>
-											<div class="graph low">
-												<span class="bar" style="width:25%;"></span>
-											</div>
-										</div>
-										<div class="max-size">3 000 <span class="units">Mb</span></div>
-									</div>
-								</div><!-- // disk usage block -->
-								<!-- bandwidth usage block -->
-								<div class="b-usage-box bandwidth-box cc">
-									<span class="prop-title">bandwidth:</span>
-									<div class="usage-box">
-										<div class="value-box">
-											<span class="value">2572</span>
-											<div class="graph low">
-												<span class="bar" style="width:30%;"></span>
-											</div>
-										</div>
-										<div class="max-size">5 000 <span class="units">Mb</span></div>
-									</div>
-								</div><!-- // bandwidth usage block -->
-							</div>
-							<div class="props-additional">
-								<span class="prop-box php-box">
-									<span class="prop-title">php:</span>
-									<span class="prop-value">cgi</span>
-								</span>
-								<span class="prop-box cgi-box">
-									<span class="prop-title">cgi:</span>
-									<span class="prop-value">yes</span>
-								</span>
-								<span class="prop-box elog-box">
-									<span class="prop-title">elog:</span>
-									<span class="prop-value">no</span>
-								</span>
-								<span class="prop-box stats-box">
-									<span class="prop-title">stats:</span>
-									<span class="prop-value">yes</span>
-									<span class="stats-auth stats-auth-on">
-										<span class="stats-auth-text">auth</span>
-									</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ssl-box">
-									<span class="prop-title">ssl:</span>
-									<span class="prop-value">yes</span>
-								</span>
-								<span class="prop-box nginx-box">
-									<span class="prop-title">nginx:</span>
-									<span class="prop-value">yes</span>
-									<span class="nginx-ext-list">extension list</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 1 -->
-
-					<!-- row 2 -->
-					<div class="row domain-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">12.11.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="names">
-								<strong class="domain-name primary">www.baden-wuerttemberg.de</strong>
-								<span class="alias-title">Alias:</span>
-								<span class="domain-name">mecklenburg-vorpommern.eu,</span>
-								<span class="domain-name">www.ostprignitz-ruppin.de,</span>
-								<span class="domain-name">potsdam-mittelmark.de,</span>
-								<span class="domain-name">maerkisch-oderland.de</span>
-							</div>
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-								<!-- disk usage block -->
-								<div class="b-usage-box disk-usage cc">
-									<span class="prop-title">disk usage:</span>
-									<div class="usage-box">
-										<div class="value-box">
-											<span class="value">1600</span>
-											<div class="graph middle">
-												<span class="bar" style="width:55%;"></span>
-											</div>
-										</div>
-										<div class="max-size">3 000 <span class="units">Mb</span></div>
-									</div>
-								</div><!-- // disk usage block -->
-								<!-- bandwidth usage block -->
-								<div class="b-usage-box bandwidth-box cc">
-									<span class="prop-title">bandwidth:</span>
-									<div class="usage-box">
-										<div class="value-box">
-											<span class="value">3800</span>
-											<div class="graph middle">
-												<span class="bar" style="width:70%;"></span>
-											</div>
-										</div>
-										<div class="max-size">5 000 <span class="units">Mb</span></div>
-									</div>
-								</div><!-- // bandwidth usage block -->
-							</div>
-							<div class="props-additional">
-								<span class="prop-box php-box">
-									<span class="prop-title">php:</span>
-									<span class="prop-value">cgi</span>
-								</span>
-								<span class="prop-box cgi-box">
-									<span class="prop-title">cgi:</span>
-									<span class="prop-value">yes</span>
-								</span>
-								<span class="prop-box elog-box">
-									<span class="prop-title">elog:</span>
-									<span class="prop-value">no</span>
-								</span>
-								<span class="prop-box stats-box">
-									<span class="prop-title">stats:</span>
-									<span class="prop-value">yes</span>
-									<span class="stats-auth stats-auth-on">
-										<span class="stats-auth-text">auth</span>
-									</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ssl-box">
-									<span class="prop-title">ssl:</span>
-									<span class="prop-value">yes</span>
-								</span>
-								<span class="prop-box nginx-box">
-									<span class="prop-title">nginx:</span>
-									<span class="prop-value">yes</span>
-									<span class="nginx-ext-list">extension list</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 2 -->
-
-					<!-- row 3 -->
-					<div class="row domain-details-row">
-						<div class="row-actions-box cc">
-							<div class="check-this check-control"></div>
-							<div class="row-operations">
-								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">enabled</span></span>
-								<span class="delete-entry"><span class="delete-entry-text">delete</span></span>
-							</div>
-						</div>
-						<div class="row-meta">
-							<div class="entry-created">25.12.2010</div>
-						</div>
-						<div class="row-details cc">
-							<div class="names">
-								<strong class="domain-name primary">www.digital-photography-school.com</strong>
-								<span class="alias-title">Alias:</span>
-								<span class="domain-name">www.designer-daily.com,</span>
-								<span class="domain-name">whatismyipaddress.com,</span>
-								<span class="domain-name">theoryandpractice.ru,</span>
-								<span class="domain-name">www.the-north-pole.com</span>
-							</div>
-							<div class="props-main">
-								<div class="ip-adr-box">
-									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
-									<span class="prop-box template-box">
-										<span class="prop-title">template:</span>
-										<span class="prop-value">default</span>
-									</span>
-								</div>
-								<!-- disk usage block -->
-								<div class="b-usage-box disk-usage cc">
-									<span class="prop-title">disk usage:</span>
-									<div class="usage-box">
-										<div class="value-box">
-											<span class="value">2700</span>
-											<div class="graph critical">
-												<span class="bar" style="width:91%;"></span>
-											</div>
-										</div>
-										<div class="max-size">3 000 <span class="units">Mb</span></div>
-									</div>
-								</div><!-- // disk usage block -->
-								<!-- bandwidth usage block -->
-								<div class="b-usage-box bandwidth-box cc">
-									<span class="prop-title">bandwidth:</span>
-									<div class="usage-box">
-										<div class="value-box">
-											<span class="value">4980</span>
-											<div class="graph critical">
-												<span class="bar" style="width:97%;"></span>
-											</div>
-										</div>
-										<div class="max-size">5 000 <span class="units">Mb</span></div>
-									</div>
-								</div><!-- // bandwidth usage block -->
-							</div>
-							<div class="props-additional">
-								<span class="prop-box php-box">
-									<span class="prop-title">php:</span>
-									<span class="prop-value">cgi</span>
-								</span>
-								<span class="prop-box cgi-box">
-									<span class="prop-title">cgi:</span>
-									<span class="prop-value">yes</span>
-								</span>
-								<span class="prop-box elog-box">
-									<span class="prop-title">elog:</span>
-									<span class="prop-value">no</span>
-								</span>
-								<span class="prop-box stats-box">
-									<span class="prop-title">stats:</span>
-									<span class="prop-value">yes</span>
-									<span class="stats-auth stats-auth-on">
-										<span class="stats-auth-text">auth</span>
-									</span>
-								</span>
-							</div>
-							<div class="props-ext">
-								<span class="prop-box ssl-box">
-									<span class="prop-title">ssl:</span>
-									<span class="prop-value">yes</span>
-								</span>
-								<span class="prop-box nginx-box">
-									<span class="prop-title">nginx:</span>
-									<span class="prop-value">yes</span>
-									<span class="nginx-ext-list">extension list</span>
-								</span>
-							</div>							
-						</div><!-- // .row-details -->
-					</div><!-- // .row 3 -->
-
-					<!-- form -->
-					<div class="b-new-entry b-new-entry_domain">
-						<div class="entry-header">New web domain</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">domain:</label>
-							<input class="text-field" type="text" value="www.digital-photography-school.com" />
-						</div>
-						<div class="form-row cc">
-							<label class="field-label" for="#">ip:</label>
-							<div class="autocomplete-box">
-								<input class="text-field" type="text" value="192.168.64.19" />
-								<i class="arrow">&nbsp;</i>
-							</div>
-						</div>
-						<!-- advanced options -->
-						<div class="form-options-group">
-							<div class="group-header cc expanded">
-								<span class="group-title-outer">
-									<span class="group-title">Advanced options</span>
-								</span>									
-							</div>
-							<div class="form-row cc">
-								<label class="field-label" for="#">template:</label>
-								<select class="styled" name="template">
-									<option value="1" selected="selected">default</option>
-									<option value="2">custom</option>
-									<option value="3">advanced</option>
-								</select>
-							</div>
-							<div class="form-row cc">
-								<label class="field-label" for="#">alias list:</label>
-								<textarea class="textarea"></textarea>
-							</div>
-
-							<div class="form-row cc">
-								<label class="field-label" for="#">statistics:</label>
-								<input class="styled" type="checkbox" value="" />
-							</div>
-							
-							<!-- stats settings -->
-							<div class="stats-settings">
-								<div class="form-row cc">
-									<label class="field-label" for="#">stats auth:</label>
-									<input class="styled" type="checkbox" value="" />
-								</div>
-								<div class="form-row cc">
-									<label class="field-label" for="#">login:</label>
-									<input class="text-field" type="text" value="" />
-								</div>
-								<div class="form-row pwd-box cc">
-									<label class="field-label" for="#">password:</label>
-									<input class="text-field" type="password" value="" />
-									<span class="generate-pwd">Generate</span>
-								</div>
-							</div><!-- // stats settings -->
-
-							<div class="form-row cc">
-								<label class="field-label" for="#">ssl:</label>
-								<input class="styled" type="checkbox" value="" />
-							</div>
-
-							<div class="form-row cc">
-								<label class="field-label" for="#">ssl home:</label>
-								<input class="text-field" type="text" value="" />
-							</div>
-
-							<div class="form-row ssl-crtfct-box cc">
-								<label class="field-label" for="#">ssl certificate: <span class="remark">(upload file or insert text)</label>
-								<input class="file-upload" size="43" type="file" value="" />
-								<textarea class="textarea"></textarea>
-							</div>
-						</div><!-- // advanced options -->
-
-						<!-- DNS options -->
-						<div class="form-options-group">
-							<div class="group-header cc expanded">
-								<span class="group-title-outer">
-									<span class="group-title">DNS options</span>
-								</span>									
-							</div>
-
-							<div class="form-row cc">
-								<label class="field-label" for="#">create dns domain:</label>
-								<input class="styled" type="checkbox" value="" />
-							</div>
-							
-						</div><!-- DNS options -->
-
-						<!-- Mail options -->
-						<div class="form-options-group">
-							<div class="group-header cc collapsed">
-								<span class="group-title-outer">
-									<span class="group-title">Mail options</span>
-								</span>									
-							</div>
-
-							<div class="form-row cc hidden">
-								<label class="field-label" for="#">create mail domain:</label>
-								<input class="styled" type="checkbox" value="" />
-							</div>
-
-						</div><!-- Mail options -->
-
-						<div class="form-row buttons-row cc">
-							<input class="add-entry-btn" type="submit" value="add" />
-							<span class="cancel-btn">Cancel</span>
-							<span class="help-btn">Help</span>
-						</div>
-					</div><!-- // form -->
-				</div><!-- // .domain-list -->
-			</div>
-		</div><!-- // #content -->
-	</div>
-</div>
-</body>
-</html>
+<!doctype html>
+<html>
+
+<head>
+	<title>Vesta | Web domain</title>
+	<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+	<meta http-equiv="imagetoolbar" content="false" />
+
+	<link rel="stylesheet" media="all" type="text/css" href="css/reset2.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/chosen.css" />
+	<link rel="stylesheet" media="all" type="text/css" href="css/vesta.css" />
+
+	<!--[if lt IE 8]>
+		<link rel="stylesheet" type="text/css" href="css/ie.css" />
+    <![endif]-->
+
+	<script type="text/javascript" src="js/custom-form-elements.js"></script>
+	<script type="text/javascript" src="js/jquery-1.4.2.js"></script>
+	<script type="text/javascript" src="js/chosen.jquery.min.js"></script>
+	<script type="text/javascript" src="js/chosen.init.js"></script>
+	
+</head>
+
+<body>
+<div id="page">
+	<div class="outer">
+		<div id="header">
+			<div class="logo-box">
+				<h1 class="logo"><a href="#">Vesta panel <span>&nbsp;</span></a></h1>
+			</div>
+			<ul class="settings">
+				<li class="settings-item">
+					<span class="logged-as">Fabricius Euphranor von Neoptolemos</span>
+					<a class="item-title" href="#">Profile</a>
+				</li>
+				<li class="settings-item"><a class="item-title" href="#">Settings</a></li>
+				<li class="logout"><a class="item-title" href="#"><span class="item-title-inner">Exit</span></a></li>
+			</ul>
+			<ul class="extra-services">
+				<li class="service-item active">
+					<span class="item-title">Backups</span>
+					<i class="item-devider"></i>
+				</li>
+				<li class="service-item">
+					<span class="item-title">Stats</span>
+					<i class="item-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="primary-nav-box">
+			<ul class="primary-nav cc">
+				<li class="section">
+					<div class="section-inner">
+						<dl class="users-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Users</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">386 users</span>
+								<span class="def">7 blocked</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section active">
+					<div class="section-inner">
+						<dl class="domains-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Web</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">580 domains</span>
+								<span class="def">22 out of mem</span>
+								<span class="def">3 waiting</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="mail-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Mail</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">320 domains</span>
+								<span class="def">1209 mailboxes</span>
+								<span class="def">25 full</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="db-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">DB</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 db</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dns-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Dns</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">289 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section">
+					<div class="section-inner">
+						<dl class="dnstpl-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">IP</span> 
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">7 templates</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+				<li class="section last-section">
+					<div class="section-inner">
+						<dl class="cron-nav-item">
+							<dt class="section-title cc">
+								<span class="to-section">Cron</span>
+								<i class="add-entry">&nbsp;</i>
+							</dt>
+							<dd class="section-contains">
+								<span class="def">15 records</span>
+							</dd>
+						</dl>
+					</div>
+					<i class="section-devider"></i>
+				</li>
+			</ul>
+		</div>
+		<div id="console">
+			<div class="b-console">
+				<div class="b-console-wrap">
+					<form class="b-console-form cc" action="#" method="post">
+						<fieldset>
+							<input class="b-console-field" type="text" value="/"/>
+							<input class="b-console-btn" type="submit" value="Go" />
+						</fieldset>
+					</form>
+				</div>
+				<div class="b-console-results"></div>
+			</div>
+		</div>
+		<!-- actions toolbar -->
+		<div id="actions-toolbar" class="cc">
+			<a class="add-btn" href="#"><i class="add-btn-icon">&nbsp;</i>add web domain</a>
+			
+			<div class="row-filters cc">
+				<div class="b-row-selector">
+					<div class="checkbox-selector cc">
+						<input class="styled" type="checkbox" value="" />
+						<span class="selector-title">385 Selected</span>
+					</div>
+					<div class="context-actions">
+						<div class="b-cust-sel b-cust-sel_inactive">
+							<span class="title">Action</span>
+							<div class="cust-sel-arrow"><i>&nbsp;</i></div>
+							<div class="cust-sel-options">
+								<div class="cust-sel-option ico_gray">Suspend</div>
+								<div class="cust-sel-option ico_green">Unsuspend</div>
+								<div class="cust-sel-option ico_red">Delete</div>
+							</div>
+						</div>
+					</div>
+				</div>
+				<!-- visible only for admin -->
+				<div class="domain-groups-selector">
+					<div class="selector-wrap">
+						<strong class="selector-title">Show:</strong>
+						<span class="selected-groups">mine, vesta, Chronos, vasya (and 35 more)</span>
+					</div>
+				</div><!-- // visible only for admin -->
+				
+			</div>
+			
+		</div><!-- // actions toolbar -->
+		<div id="content">
+			<div class="content-inner">
+				<div class="domains-list">
+					<!-- row 1 -->
+					<div class="row first-row domain-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="names">
+								<strong class="domain-name primary">naumov-socolov.co.uk</strong>
+								<span class="alias-title">Alias:</span>
+								<span class="domain-name">naumov-socolov.org.ua,</span>
+								<span class="domain-name">naumov-socolov.org.md,</span>
+								<span class="domain-name">naumov-socolov.to</span>
+							</div>
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<span class="prop-title">disk usage:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">900</span>
+											<div class="graph low">
+												<span class="bar" style="width:25%;"></span>
+											</div>
+										</div>
+										<div class="max-size">3 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+								<!-- bandwidth usage block -->
+								<div class="b-usage-box bandwidth-box cc">
+									<span class="prop-title">bandwidth:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">2572</span>
+											<div class="graph low">
+												<span class="bar" style="width:30%;"></span>
+											</div>
+										</div>
+										<div class="max-size">5 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // bandwidth usage block -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box php-box">
+									<span class="prop-title">php:</span>
+									<span class="prop-value">cgi</span>
+								</span>
+								<span class="prop-box cgi-box">
+									<span class="prop-title">cgi:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box elog-box">
+									<span class="prop-title">elog:</span>
+									<span class="prop-value">no</span>
+								</span>
+								<span class="prop-box stats-box">
+									<span class="prop-title">stats:</span>
+									<span class="prop-value">yes</span>
+									<span class="stats-auth stats-auth-on">
+										<span class="stats-auth-text">auth</span>
+									</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ssl-box">
+									<span class="prop-title">ssl:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box nginx-box">
+									<span class="prop-title">nginx:</span>
+									<span class="prop-value">yes</span>
+									<span class="nginx-ext-list">extension list</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 1 -->
+
+					<!-- row 2 -->
+					<div class="row domain-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">12.11.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="names">
+								<strong class="domain-name primary">www.baden-wuerttemberg.de</strong>
+								<span class="alias-title">Alias:</span>
+								<span class="domain-name">mecklenburg-vorpommern.eu,</span>
+								<span class="domain-name">www.ostprignitz-ruppin.de,</span>
+								<span class="domain-name">potsdam-mittelmark.de,</span>
+								<span class="domain-name">maerkisch-oderland.de</span>
+							</div>
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<span class="prop-title">disk usage:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">1600</span>
+											<div class="graph middle">
+												<span class="bar" style="width:55%;"></span>
+											</div>
+										</div>
+										<div class="max-size">3 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+								<!-- bandwidth usage block -->
+								<div class="b-usage-box bandwidth-box cc">
+									<span class="prop-title">bandwidth:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">3800</span>
+											<div class="graph middle">
+												<span class="bar" style="width:70%;"></span>
+											</div>
+										</div>
+										<div class="max-size">5 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // bandwidth usage block -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box php-box">
+									<span class="prop-title">php:</span>
+									<span class="prop-value">cgi</span>
+								</span>
+								<span class="prop-box cgi-box">
+									<span class="prop-title">cgi:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box elog-box">
+									<span class="prop-title">elog:</span>
+									<span class="prop-value">no</span>
+								</span>
+								<span class="prop-box stats-box">
+									<span class="prop-title">stats:</span>
+									<span class="prop-value">yes</span>
+									<span class="stats-auth stats-auth-on">
+										<span class="stats-auth-text">auth</span>
+									</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ssl-box">
+									<span class="prop-title">ssl:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box nginx-box">
+									<span class="prop-title">nginx:</span>
+									<span class="prop-value">yes</span>
+									<span class="nginx-ext-list">extension list</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 2 -->
+
+					<!-- row 3 -->
+					<div class="row domain-details-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-enabled-status"><span class="ip-status-text">active</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">25.12.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="names">
+								<strong class="domain-name primary">www.digital-photography-school.com</strong>
+								<span class="alias-title">Alias:</span>
+								<span class="domain-name">www.designer-daily.com,</span>
+								<span class="domain-name">whatismyipaddress.com,</span>
+								<span class="domain-name">theoryandpractice.ru,</span>
+								<span class="domain-name">www.the-north-pole.com</span>
+							</div>
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<span class="prop-title">disk usage:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">2700</span>
+											<div class="graph critical">
+												<span class="bar" style="width:91%;"></span>
+											</div>
+										</div>
+										<div class="max-size">3 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+								<!-- bandwidth usage block -->
+								<div class="b-usage-box bandwidth-box cc">
+									<span class="prop-title">bandwidth:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">4980</span>
+											<div class="graph critical">
+												<span class="bar" style="width:97%;"></span>
+											</div>
+										</div>
+										<div class="max-size">5 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // bandwidth usage block -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box php-box">
+									<span class="prop-title">php:</span>
+									<span class="prop-value">cgi</span>
+								</span>
+								<span class="prop-box cgi-box">
+									<span class="prop-title">cgi:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box elog-box">
+									<span class="prop-title">elog:</span>
+									<span class="prop-value">no</span>
+								</span>
+								<span class="prop-box stats-box">
+									<span class="prop-title">stats:</span>
+									<span class="prop-value">yes</span>
+									<span class="stats-auth stats-auth-on">
+										<span class="stats-auth-text">auth</span>
+									</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ssl-box">
+									<span class="prop-title">ssl:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box nginx-box">
+									<span class="prop-title">nginx:</span>
+									<span class="prop-value">yes</span>
+									<span class="nginx-ext-list">extension list</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 3 -->
+					
+					<!-- row 4, suspended status -->
+					<div class="row domain-details-row suspended-row">
+						<div class="row-actions-box cc">
+							<div class="check-this check-control"></div>
+							<div class="row-operations">
+								<span class="ip-status-info ip-suspended-status"><span class="ip-status-text">suspended</span></span>
+							</div>
+						</div>
+						<div class="row-meta">
+							<div class="entry-created">25.12.2010</div>
+						</div>
+						<div class="row-details cc">
+							<div class="names">
+								<strong class="domain-name primary">www.digital-photography-school.com</strong>
+								<span class="alias-title">Alias:</span>
+								<span class="domain-name">www.designer-daily.com,</span>
+								<span class="domain-name">whatismyipaddress.com,</span>
+								<span class="domain-name">theoryandpractice.ru,</span>
+								<span class="domain-name">www.the-north-pole.com</span>
+							</div>
+							<div class="props-main">
+								<div class="ip-adr-box">
+									<span class="ip-adr">192<span class="dot">.</span>52<span class="dot">.</span>107<span class="dot">.</span>26</span>
+									<span class="prop-box template-box">
+										<span class="prop-title">template:</span>
+										<span class="prop-value">default</span>
+									</span>
+								</div>
+								<!-- disk usage block -->
+								<div class="b-usage-box disk-usage cc">
+									<span class="prop-title">disk usage:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">2700</span>
+											<div class="graph critical">
+												<span class="bar" style="width:91%;"></span>
+											</div>
+										</div>
+										<div class="max-size">3 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // disk usage block -->
+								<!-- bandwidth usage block -->
+								<div class="b-usage-box bandwidth-box cc">
+									<span class="prop-title">bandwidth:</span>
+									<div class="usage-box">
+										<div class="value-box">
+											<span class="value">4980</span>
+											<div class="graph critical">
+												<span class="bar" style="width:97%;"></span>
+											</div>
+										</div>
+										<div class="max-size">5 000 <span class="units">Mb</span></div>
+									</div>
+								</div><!-- // bandwidth usage block -->
+							</div>
+							<div class="props-additional">
+								<span class="prop-box php-box">
+									<span class="prop-title">php:</span>
+									<span class="prop-value">cgi</span>
+								</span>
+								<span class="prop-box cgi-box">
+									<span class="prop-title">cgi:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box elog-box">
+									<span class="prop-title">elog:</span>
+									<span class="prop-value">no</span>
+								</span>
+								<span class="prop-box stats-box">
+									<span class="prop-title">stats:</span>
+									<span class="prop-value">yes</span>
+									<span class="stats-auth stats-auth-on">
+										<span class="stats-auth-text">auth</span>
+									</span>
+								</span>
+							</div>
+							<div class="props-ext">
+								<span class="prop-box ssl-box">
+									<span class="prop-title">ssl:</span>
+									<span class="prop-value">yes</span>
+								</span>
+								<span class="prop-box nginx-box">
+									<span class="prop-title">nginx:</span>
+									<span class="prop-value">yes</span>
+									<span class="nginx-ext-list">extension list</span>
+								</span>
+							</div>							
+						</div><!-- // .row-details -->
+					</div><!-- // .row 4 -->
+
+
+					<!-- form -->
+					<div class="b-new-entry b-new-entry_domain">
+						<div class="entry-header">New web domain</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#"><span class="mandatory">domain:</span></label>
+							<input class="text-field rule-required" type="text" value="www.digital-photography-school.com" />
+						</div>
+						<div class="form-row cc">
+							<label class="field-label" for="#"><span class="mandatory">ip:</span></label>
+							<div class="autocomplete-box">
+								<input class="text-field rule-required" type="text" value="192.168.64.19" />
+								<i class="arrow">&nbsp;</i>
+							</div>
+						</div>
+
+						<div class="form-row cc">
+							<label class="field-label" for="#">template:</label>
+							<select class="styled" name="template">
+								<option value="1" selected="selected">default</option>
+								<option value="2">custom</option>
+								<option value="3">advanced</option>
+							</select>
+						</div>
+					
+						<div class="form-row cc">
+							<label class="field-label" for="#">suspended:</label>
+							<input class="styled" type="checkbox" value="" />
+						</div>
+
+						<!-- advanced options -->
+						<div class="form-options-group">
+							<div class="group-header cc expanded">
+								<span class="group-title-outer">
+									<span class="group-title-inner">
+										<span class="group-title">Advanced options</span>
+									</span>
+								</span>									
+							</div>
+							<div class="form-row cc">
+								<label class="field-label" for="#">alias list:</label>
+								<textarea class="textarea"></textarea>
+							</div>
+
+							<div class="form-row cc">
+								<label class="field-label" for="#">statistics:</label>
+								<input class="styled" type="checkbox" value="" />
+							</div>
+							
+							<!-- stats settings -->
+							<div class="stats-settings">
+								<div class="form-row cc">
+									<label class="field-label" for="#">stats auth:</label>
+									<input class="styled" type="checkbox" value="" />
+								</div>
+								<div class="form-row cc">
+									<label class="field-label" for="#">login:</label>
+									<input class="text-field disabled" type="text" value="disabled field example" disabled="disabled" />
+								</div>
+								<div class="form-row pwd-box cc">
+									<label class="field-label" for="#">password:</label>
+									<input class="text-field" type="password" value=""/>
+									<span class="generate-pwd">Generate</span>
+								</div>
+							</div><!-- // stats settings -->
+
+							<div class="form-row cc">
+								<label class="field-label" for="#">ssl:</label>
+								<input class="styled" type="checkbox" value="" />
+							</div>
+
+							<div class="form-row cc">
+								<label class="field-label" for="#">ssl home:</label>
+								<input class="disabled text-field" type="text" value="disabled field example" disabled="disabled"/>
+							</div>
+
+							<div class="form-row ssl-crtfct-box cc">
+								<label class="field-label" for="#">ssl certificate: <span class="remark">(upload file or insert text)</span></label>
+								<input class="file-upload" size="43" type="file" value="" />
+								<textarea class="textarea"></textarea>
+							</div>
+						</div><!-- // advanced options -->
+
+						<!-- DNS options -->
+						<div class="form-options-group">
+							<div class="group-header cc expanded">
+								<span class="group-title-outer">
+									<span class="group-title-inner">								
+										<span class="group-title">DNS options</span>
+									</span>
+								</span>									
+							</div>
+
+							<div class="form-row cc">
+								<label class="field-label" for="#">create dns domain:</label>
+								<input class="styled" type="checkbox" value="" />
+							</div>
+							
+						</div><!-- DNS options -->
+
+						<!-- Mail options -->
+						<div class="form-options-group mail-options-group">
+							<div class="group-header cc collapsed">
+								<span class="group-title-outer">
+									<span class="group-title-inner">								
+										<span class="group-title">Mail options</span>
+									</span>
+								</span>									
+							</div>
+
+							<div class="form-row cc hidden">
+								<label class="field-label" for="#">create mail domain:</label>
+								<input class="styled" type="checkbox" value="" />
+							</div>
+
+						</div><!-- Mail options -->
+
+						<div class="form-row buttons-row cc">
+							<input class="add-entry-btn" type="submit" value="add" />
+							<span class="cancel-btn">Cancel</span>
+							<span class="delete-btn">Delete</span>
+						</div>
+					</div><!-- // form -->
+				</div><!-- // .domain-list -->
+			</div>
+		</div><!-- // #content -->
+	</div>
+</div>
+</body>
+</html>